1 /*- 2 * SPDX-License-Identifier: BSD-2-Clause 3 * 4 * Copyright (c) 1997, Stefan Esser <se@freebsd.org> 5 * Copyright (c) 2000, Michael Smith <msmith@freebsd.org> 6 * Copyright (c) 2000, BSDi 7 * All rights reserved. 8 * 9 * Redistribution and use in source and binary forms, with or without 10 * modification, are permitted provided that the following conditions 11 * are met: 12 * 1. Redistributions of source code must retain the above copyright 13 * notice unmodified, this list of conditions, and the following 14 * disclaimer. 15 * 2. Redistributions in binary form must reproduce the above copyright 16 * notice, this list of conditions and the following disclaimer in the 17 * documentation and/or other materials provided with the distribution. 18 * 19 * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR 20 * IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES 21 * OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. 22 * IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, 23 * INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT 24 * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, 25 * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY 26 * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT 27 * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF 28 * THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. 29 */ 30 31 #include <sys/cdefs.h> 32 #include "opt_acpi.h" 33 #include "opt_iommu.h" 34 #include "opt_bus.h" 35 36 #include <sys/param.h> 37 #include <sys/conf.h> 38 #include <sys/endian.h> 39 #include <sys/eventhandler.h> 40 #include <sys/fcntl.h> 41 #include <sys/kernel.h> 42 #include <sys/limits.h> 43 #include <sys/linker.h> 44 #include <sys/malloc.h> 45 #include <sys/module.h> 46 #include <sys/queue.h> 47 #include <sys/sbuf.h> 48 #include <sys/sysctl.h> 49 #include <sys/systm.h> 50 #include <sys/taskqueue.h> 51 #include <sys/tree.h> 52 53 #include <vm/vm.h> 54 #include <vm/pmap.h> 55 #include <vm/vm_extern.h> 56 57 #include <sys/bus.h> 58 #include <machine/bus.h> 59 #include <sys/rman.h> 60 #include <machine/resource.h> 61 #include <machine/stdarg.h> 62 63 #if defined(__i386__) || defined(__amd64__) || defined(__powerpc__) 64 #include <machine/intr_machdep.h> 65 #endif 66 67 #include <sys/pciio.h> 68 #include <dev/pci/pcireg.h> 69 #include <dev/pci/pcivar.h> 70 #include <dev/pci/pci_private.h> 71 72 #ifdef PCI_IOV 73 #include <sys/nv.h> 74 #include <dev/pci/pci_iov_private.h> 75 #endif 76 77 #include <dev/usb/controller/xhcireg.h> 78 #include <dev/usb/controller/ehcireg.h> 79 #include <dev/usb/controller/ohcireg.h> 80 #include <dev/usb/controller/uhcireg.h> 81 82 #include <dev/iommu/iommu.h> 83 84 #include "pcib_if.h" 85 #include "pci_if.h" 86 87 #define PCIR_IS_BIOS(cfg, reg) \ 88 (((cfg)->hdrtype == PCIM_HDRTYPE_NORMAL && reg == PCIR_BIOS) || \ 89 ((cfg)->hdrtype == PCIM_HDRTYPE_BRIDGE && reg == PCIR_BIOS_1)) 90 91 static int pci_has_quirk(uint32_t devid, int quirk); 92 static pci_addr_t pci_mapbase(uint64_t mapreg); 93 static const char *pci_maptype(uint64_t mapreg); 94 static int pci_maprange(uint64_t mapreg); 95 static pci_addr_t pci_rombase(uint64_t mapreg); 96 static int pci_romsize(uint64_t testval); 97 static void pci_fixancient(pcicfgregs *cfg); 98 static int pci_printf(pcicfgregs *cfg, const char *fmt, ...); 99 100 static int pci_porten(device_t dev); 101 static int pci_memen(device_t dev); 102 static void pci_assign_interrupt(device_t bus, device_t dev, 103 int force_route); 104 static int pci_add_map(device_t bus, device_t dev, int reg, 105 struct resource_list *rl, int force, int prefetch); 106 static int pci_probe(device_t dev); 107 static void pci_load_vendor_data(void); 108 static int pci_describe_parse_line(char **ptr, int *vendor, 109 int *device, char **desc); 110 static char *pci_describe_device(device_t dev); 111 static int pci_modevent(module_t mod, int what, void *arg); 112 static void pci_hdrtypedata(device_t pcib, int b, int s, int f, 113 pcicfgregs *cfg); 114 static void pci_read_cap(device_t pcib, pcicfgregs *cfg); 115 static int pci_read_vpd_reg(device_t pcib, pcicfgregs *cfg, 116 int reg, uint32_t *data); 117 #if 0 118 static int pci_write_vpd_reg(device_t pcib, pcicfgregs *cfg, 119 int reg, uint32_t data); 120 #endif 121 static void pci_read_vpd(device_t pcib, pcicfgregs *cfg); 122 static void pci_mask_msix(device_t dev, u_int index); 123 static void pci_unmask_msix(device_t dev, u_int index); 124 static int pci_msi_blacklisted(void); 125 static int pci_msix_blacklisted(void); 126 static void pci_resume_msi(device_t dev); 127 static void pci_resume_msix(device_t dev); 128 static int pci_remap_intr_method(device_t bus, device_t dev, 129 u_int irq); 130 static void pci_hint_device_unit(device_t acdev, device_t child, 131 const char *name, int *unitp); 132 static int pci_reset_post(device_t dev, device_t child); 133 static int pci_reset_prepare(device_t dev, device_t child); 134 static int pci_reset_child(device_t dev, device_t child, 135 int flags); 136 137 static int pci_get_id_method(device_t dev, device_t child, 138 enum pci_id_type type, uintptr_t *rid); 139 static struct pci_devinfo * pci_fill_devinfo(device_t pcib, device_t bus, int d, 140 int b, int s, int f, uint16_t vid, uint16_t did); 141 142 static device_method_t pci_methods[] = { 143 /* Device interface */ 144 DEVMETHOD(device_probe, pci_probe), 145 DEVMETHOD(device_attach, pci_attach), 146 DEVMETHOD(device_detach, pci_detach), 147 DEVMETHOD(device_shutdown, bus_generic_shutdown), 148 DEVMETHOD(device_suspend, bus_generic_suspend), 149 DEVMETHOD(device_resume, pci_resume), 150 151 /* Bus interface */ 152 DEVMETHOD(bus_print_child, pci_print_child), 153 DEVMETHOD(bus_probe_nomatch, pci_probe_nomatch), 154 DEVMETHOD(bus_read_ivar, pci_read_ivar), 155 DEVMETHOD(bus_write_ivar, pci_write_ivar), 156 DEVMETHOD(bus_driver_added, pci_driver_added), 157 DEVMETHOD(bus_setup_intr, pci_setup_intr), 158 DEVMETHOD(bus_teardown_intr, pci_teardown_intr), 159 DEVMETHOD(bus_reset_prepare, pci_reset_prepare), 160 DEVMETHOD(bus_reset_post, pci_reset_post), 161 DEVMETHOD(bus_reset_child, pci_reset_child), 162 163 DEVMETHOD(bus_get_dma_tag, pci_get_dma_tag), 164 DEVMETHOD(bus_get_resource_list,pci_get_resource_list), 165 DEVMETHOD(bus_set_resource, bus_generic_rl_set_resource), 166 DEVMETHOD(bus_get_resource, bus_generic_rl_get_resource), 167 DEVMETHOD(bus_delete_resource, pci_delete_resource), 168 DEVMETHOD(bus_alloc_resource, pci_alloc_resource), 169 DEVMETHOD(bus_adjust_resource, bus_generic_adjust_resource), 170 DEVMETHOD(bus_release_resource, pci_release_resource), 171 DEVMETHOD(bus_activate_resource, pci_activate_resource), 172 DEVMETHOD(bus_deactivate_resource, pci_deactivate_resource), 173 DEVMETHOD(bus_child_deleted, pci_child_deleted), 174 DEVMETHOD(bus_child_detached, pci_child_detached), 175 DEVMETHOD(bus_child_pnpinfo, pci_child_pnpinfo_method), 176 DEVMETHOD(bus_child_location, pci_child_location_method), 177 DEVMETHOD(bus_get_device_path, pci_get_device_path_method), 178 DEVMETHOD(bus_hint_device_unit, pci_hint_device_unit), 179 DEVMETHOD(bus_remap_intr, pci_remap_intr_method), 180 DEVMETHOD(bus_suspend_child, pci_suspend_child), 181 DEVMETHOD(bus_resume_child, pci_resume_child), 182 DEVMETHOD(bus_rescan, pci_rescan_method), 183 184 /* PCI interface */ 185 DEVMETHOD(pci_read_config, pci_read_config_method), 186 DEVMETHOD(pci_write_config, pci_write_config_method), 187 DEVMETHOD(pci_enable_busmaster, pci_enable_busmaster_method), 188 DEVMETHOD(pci_disable_busmaster, pci_disable_busmaster_method), 189 DEVMETHOD(pci_enable_io, pci_enable_io_method), 190 DEVMETHOD(pci_disable_io, pci_disable_io_method), 191 DEVMETHOD(pci_get_vpd_ident, pci_get_vpd_ident_method), 192 DEVMETHOD(pci_get_vpd_readonly, pci_get_vpd_readonly_method), 193 DEVMETHOD(pci_get_powerstate, pci_get_powerstate_method), 194 DEVMETHOD(pci_set_powerstate, pci_set_powerstate_method), 195 DEVMETHOD(pci_assign_interrupt, pci_assign_interrupt_method), 196 DEVMETHOD(pci_find_cap, pci_find_cap_method), 197 DEVMETHOD(pci_find_next_cap, pci_find_next_cap_method), 198 DEVMETHOD(pci_find_extcap, pci_find_extcap_method), 199 DEVMETHOD(pci_find_next_extcap, pci_find_next_extcap_method), 200 DEVMETHOD(pci_find_htcap, pci_find_htcap_method), 201 DEVMETHOD(pci_find_next_htcap, pci_find_next_htcap_method), 202 DEVMETHOD(pci_alloc_msi, pci_alloc_msi_method), 203 DEVMETHOD(pci_alloc_msix, pci_alloc_msix_method), 204 DEVMETHOD(pci_enable_msi, pci_enable_msi_method), 205 DEVMETHOD(pci_enable_msix, pci_enable_msix_method), 206 DEVMETHOD(pci_disable_msi, pci_disable_msi_method), 207 DEVMETHOD(pci_remap_msix, pci_remap_msix_method), 208 DEVMETHOD(pci_release_msi, pci_release_msi_method), 209 DEVMETHOD(pci_msi_count, pci_msi_count_method), 210 DEVMETHOD(pci_msix_count, pci_msix_count_method), 211 DEVMETHOD(pci_msix_pba_bar, pci_msix_pba_bar_method), 212 DEVMETHOD(pci_msix_table_bar, pci_msix_table_bar_method), 213 DEVMETHOD(pci_get_id, pci_get_id_method), 214 DEVMETHOD(pci_alloc_devinfo, pci_alloc_devinfo_method), 215 DEVMETHOD(pci_child_added, pci_child_added_method), 216 #ifdef PCI_IOV 217 DEVMETHOD(pci_iov_attach, pci_iov_attach_method), 218 DEVMETHOD(pci_iov_detach, pci_iov_detach_method), 219 DEVMETHOD(pci_create_iov_child, pci_create_iov_child_method), 220 #endif 221 222 DEVMETHOD_END 223 }; 224 225 DEFINE_CLASS_0(pci, pci_driver, pci_methods, sizeof(struct pci_softc)); 226 227 EARLY_DRIVER_MODULE(pci, pcib, pci_driver, pci_modevent, NULL, BUS_PASS_BUS); 228 MODULE_VERSION(pci, 1); 229 230 static char *pci_vendordata; 231 static size_t pci_vendordata_size; 232 233 struct pci_quirk { 234 uint32_t devid; /* Vendor/device of the card */ 235 int type; 236 #define PCI_QUIRK_MAP_REG 1 /* PCI map register in weird place */ 237 #define PCI_QUIRK_DISABLE_MSI 2 /* Neither MSI nor MSI-X work */ 238 #define PCI_QUIRK_ENABLE_MSI_VM 3 /* Older chipset in VM where MSI works */ 239 #define PCI_QUIRK_UNMAP_REG 4 /* Ignore PCI map register */ 240 #define PCI_QUIRK_DISABLE_MSIX 5 /* MSI-X doesn't work */ 241 #define PCI_QUIRK_MSI_INTX_BUG 6 /* PCIM_CMD_INTxDIS disables MSI */ 242 #define PCI_QUIRK_REALLOC_BAR 7 /* Can't allocate memory at the default address */ 243 int arg1; 244 int arg2; 245 }; 246 247 static const struct pci_quirk pci_quirks[] = { 248 /* The Intel 82371AB and 82443MX have a map register at offset 0x90. */ 249 { 0x71138086, PCI_QUIRK_MAP_REG, 0x90, 0 }, 250 { 0x719b8086, PCI_QUIRK_MAP_REG, 0x90, 0 }, 251 /* As does the Serverworks OSB4 (the SMBus mapping register) */ 252 { 0x02001166, PCI_QUIRK_MAP_REG, 0x90, 0 }, 253 254 /* 255 * MSI doesn't work with the ServerWorks CNB20-HE Host Bridge 256 * or the CMIC-SL (AKA ServerWorks GC_LE). 257 */ 258 { 0x00141166, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 259 { 0x00171166, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 260 261 /* 262 * MSI doesn't work on earlier Intel chipsets including 263 * E7500, E7501, E7505, 845, 865, 875/E7210, and 855. 264 */ 265 { 0x25408086, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 266 { 0x254c8086, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 267 { 0x25508086, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 268 { 0x25608086, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 269 { 0x25708086, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 270 { 0x25788086, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 271 { 0x35808086, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 272 273 /* 274 * MSI doesn't work with devices behind the AMD 8131 HT-PCIX 275 * bridge. 276 */ 277 { 0x74501022, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 278 279 /* 280 * Some virtualization environments emulate an older chipset 281 * but support MSI just fine. QEMU uses the Intel 82440. 282 */ 283 { 0x12378086, PCI_QUIRK_ENABLE_MSI_VM, 0, 0 }, 284 285 /* 286 * HPET MMIO base address may appear in Bar1 for AMD SB600 SMBus 287 * controller depending on SoftPciRst register (PM_IO 0x55 [7]). 288 * It prevents us from attaching hpet(4) when the bit is unset. 289 * Note this quirk only affects SB600 revision A13 and earlier. 290 * For SB600 A21 and later, firmware must set the bit to hide it. 291 * For SB700 and later, it is unused and hardcoded to zero. 292 */ 293 { 0x43851002, PCI_QUIRK_UNMAP_REG, 0x14, 0 }, 294 295 /* 296 * Atheros AR8161/AR8162/E2200/E2400/E2500 Ethernet controllers have 297 * a bug that MSI interrupt does not assert if PCIM_CMD_INTxDIS bit 298 * of the command register is set. 299 */ 300 { 0x10911969, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, 301 { 0xE0911969, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, 302 { 0xE0A11969, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, 303 { 0xE0B11969, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, 304 { 0x10901969, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, 305 306 /* 307 * Broadcom BCM5714(S)/BCM5715(S)/BCM5780(S) Ethernet MACs don't 308 * issue MSI interrupts with PCIM_CMD_INTxDIS set either. 309 */ 310 { 0x166814e4, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, /* BCM5714 */ 311 { 0x166914e4, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, /* BCM5714S */ 312 { 0x166a14e4, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, /* BCM5780 */ 313 { 0x166b14e4, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, /* BCM5780S */ 314 { 0x167814e4, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, /* BCM5715 */ 315 { 0x167914e4, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, /* BCM5715S */ 316 317 /* 318 * HPE Gen 10 VGA has a memory range that can't be allocated in the 319 * expected place. 320 */ 321 { 0x98741002, PCI_QUIRK_REALLOC_BAR, 0, 0 }, 322 { 0 } 323 }; 324 325 /* map register information */ 326 #define PCI_MAPMEM 0x01 /* memory map */ 327 #define PCI_MAPMEMP 0x02 /* prefetchable memory map */ 328 #define PCI_MAPPORT 0x04 /* port map */ 329 330 struct devlist pci_devq; 331 uint32_t pci_generation; 332 uint32_t pci_numdevs = 0; 333 static int pcie_chipset, pcix_chipset; 334 335 /* sysctl vars */ 336 SYSCTL_NODE(_hw, OID_AUTO, pci, CTLFLAG_RD | CTLFLAG_MPSAFE, 0, 337 "PCI bus tuning parameters"); 338 339 static int pci_enable_io_modes = 1; 340 SYSCTL_INT(_hw_pci, OID_AUTO, enable_io_modes, CTLFLAG_RWTUN, 341 &pci_enable_io_modes, 1, 342 "Enable I/O and memory bits in the config register. Some BIOSes do not" 343 " enable these bits correctly. We'd like to do this all the time, but" 344 " there are some peripherals that this causes problems with."); 345 346 static int pci_do_realloc_bars = 1; 347 SYSCTL_INT(_hw_pci, OID_AUTO, realloc_bars, CTLFLAG_RWTUN, 348 &pci_do_realloc_bars, 0, 349 "Attempt to allocate a new range for any BARs whose original " 350 "firmware-assigned ranges fail to allocate during the initial device scan."); 351 352 static int pci_do_power_nodriver = 0; 353 SYSCTL_INT(_hw_pci, OID_AUTO, do_power_nodriver, CTLFLAG_RWTUN, 354 &pci_do_power_nodriver, 0, 355 "Place a function into D3 state when no driver attaches to it. 0 means" 356 " disable. 1 means conservatively place devices into D3 state. 2 means" 357 " aggressively place devices into D3 state. 3 means put absolutely" 358 " everything in D3 state."); 359 360 int pci_do_power_resume = 1; 361 SYSCTL_INT(_hw_pci, OID_AUTO, do_power_resume, CTLFLAG_RWTUN, 362 &pci_do_power_resume, 1, 363 "Transition from D3 -> D0 on resume."); 364 365 int pci_do_power_suspend = 1; 366 SYSCTL_INT(_hw_pci, OID_AUTO, do_power_suspend, CTLFLAG_RWTUN, 367 &pci_do_power_suspend, 1, 368 "Transition from D0 -> D3 on suspend."); 369 370 static int pci_do_msi = 1; 371 SYSCTL_INT(_hw_pci, OID_AUTO, enable_msi, CTLFLAG_RWTUN, &pci_do_msi, 1, 372 "Enable support for MSI interrupts"); 373 374 static int pci_do_msix = 1; 375 SYSCTL_INT(_hw_pci, OID_AUTO, enable_msix, CTLFLAG_RWTUN, &pci_do_msix, 1, 376 "Enable support for MSI-X interrupts"); 377 378 static int pci_msix_rewrite_table = 0; 379 SYSCTL_INT(_hw_pci, OID_AUTO, msix_rewrite_table, CTLFLAG_RWTUN, 380 &pci_msix_rewrite_table, 0, 381 "Rewrite entire MSI-X table when updating MSI-X entries"); 382 383 static int pci_honor_msi_blacklist = 1; 384 SYSCTL_INT(_hw_pci, OID_AUTO, honor_msi_blacklist, CTLFLAG_RDTUN, 385 &pci_honor_msi_blacklist, 1, "Honor chipset blacklist for MSI/MSI-X"); 386 387 #if defined(__i386__) || defined(__amd64__) 388 static int pci_usb_takeover = 1; 389 #else 390 static int pci_usb_takeover = 0; 391 #endif 392 SYSCTL_INT(_hw_pci, OID_AUTO, usb_early_takeover, CTLFLAG_RDTUN, 393 &pci_usb_takeover, 1, 394 "Enable early takeover of USB controllers. Disable this if you depend on" 395 " BIOS emulation of USB devices, that is you use USB devices (like" 396 " keyboard or mouse) but do not load USB drivers"); 397 398 static int pci_clear_bars; 399 SYSCTL_INT(_hw_pci, OID_AUTO, clear_bars, CTLFLAG_RDTUN, &pci_clear_bars, 0, 400 "Ignore firmware-assigned resources for BARs."); 401 402 #if defined(NEW_PCIB) && defined(PCI_RES_BUS) 403 static int pci_clear_buses; 404 SYSCTL_INT(_hw_pci, OID_AUTO, clear_buses, CTLFLAG_RDTUN, &pci_clear_buses, 0, 405 "Ignore firmware-assigned bus numbers."); 406 #endif 407 408 static int pci_enable_ari = 1; 409 SYSCTL_INT(_hw_pci, OID_AUTO, enable_ari, CTLFLAG_RDTUN, &pci_enable_ari, 410 0, "Enable support for PCIe Alternative RID Interpretation"); 411 412 int pci_enable_aspm = 1; 413 SYSCTL_INT(_hw_pci, OID_AUTO, enable_aspm, CTLFLAG_RDTUN, &pci_enable_aspm, 414 0, "Enable support for PCIe Active State Power Management"); 415 416 static int pci_clear_aer_on_attach = 0; 417 SYSCTL_INT(_hw_pci, OID_AUTO, clear_aer_on_attach, CTLFLAG_RWTUN, 418 &pci_clear_aer_on_attach, 0, 419 "Clear port and device AER state on driver attach"); 420 421 static bool pci_enable_mps_tune = true; 422 SYSCTL_BOOL(_hw_pci, OID_AUTO, enable_mps_tune, CTLFLAG_RWTUN, 423 &pci_enable_mps_tune, 1, 424 "Enable tuning of MPS(maximum payload size)." ); 425 426 static int 427 pci_has_quirk(uint32_t devid, int quirk) 428 { 429 const struct pci_quirk *q; 430 431 for (q = &pci_quirks[0]; q->devid; q++) { 432 if (q->devid == devid && q->type == quirk) 433 return (1); 434 } 435 return (0); 436 } 437 438 /* Find a device_t by bus/slot/function in domain 0 */ 439 440 device_t 441 pci_find_bsf(uint8_t bus, uint8_t slot, uint8_t func) 442 { 443 444 return (pci_find_dbsf(0, bus, slot, func)); 445 } 446 447 /* Find a device_t by domain/bus/slot/function */ 448 449 device_t 450 pci_find_dbsf(uint32_t domain, uint8_t bus, uint8_t slot, uint8_t func) 451 { 452 struct pci_devinfo *dinfo = NULL; 453 454 STAILQ_FOREACH(dinfo, &pci_devq, pci_links) { 455 if ((dinfo->cfg.domain == domain) && 456 (dinfo->cfg.bus == bus) && 457 (dinfo->cfg.slot == slot) && 458 (dinfo->cfg.func == func)) { 459 break; 460 } 461 } 462 463 return (dinfo != NULL ? dinfo->cfg.dev : NULL); 464 } 465 466 /* Find a device_t by vendor/device ID */ 467 468 device_t 469 pci_find_device(uint16_t vendor, uint16_t device) 470 { 471 struct pci_devinfo *dinfo; 472 473 STAILQ_FOREACH(dinfo, &pci_devq, pci_links) { 474 if ((dinfo->cfg.vendor == vendor) && 475 (dinfo->cfg.device == device)) { 476 return (dinfo->cfg.dev); 477 } 478 } 479 480 return (NULL); 481 } 482 483 device_t 484 pci_find_class(uint8_t class, uint8_t subclass) 485 { 486 struct pci_devinfo *dinfo; 487 488 STAILQ_FOREACH(dinfo, &pci_devq, pci_links) { 489 if (dinfo->cfg.baseclass == class && 490 dinfo->cfg.subclass == subclass) { 491 return (dinfo->cfg.dev); 492 } 493 } 494 495 return (NULL); 496 } 497 498 device_t 499 pci_find_class_from(uint8_t class, uint8_t subclass, device_t from) 500 { 501 struct pci_devinfo *dinfo; 502 bool found = false; 503 504 STAILQ_FOREACH(dinfo, &pci_devq, pci_links) { 505 if (from != NULL && found == false) { 506 if (from != dinfo->cfg.dev) 507 continue; 508 found = true; 509 continue; 510 } 511 if (dinfo->cfg.baseclass == class && 512 dinfo->cfg.subclass == subclass) { 513 return (dinfo->cfg.dev); 514 } 515 } 516 517 return (NULL); 518 } 519 520 static int 521 pci_printf(pcicfgregs *cfg, const char *fmt, ...) 522 { 523 va_list ap; 524 int retval; 525 526 retval = printf("pci%d:%d:%d:%d: ", cfg->domain, cfg->bus, cfg->slot, 527 cfg->func); 528 va_start(ap, fmt); 529 retval += vprintf(fmt, ap); 530 va_end(ap); 531 return (retval); 532 } 533 534 /* return base address of memory or port map */ 535 536 static pci_addr_t 537 pci_mapbase(uint64_t mapreg) 538 { 539 540 if (PCI_BAR_MEM(mapreg)) 541 return (mapreg & PCIM_BAR_MEM_BASE); 542 else 543 return (mapreg & PCIM_BAR_IO_BASE); 544 } 545 546 /* return map type of memory or port map */ 547 548 static const char * 549 pci_maptype(uint64_t mapreg) 550 { 551 552 if (PCI_BAR_IO(mapreg)) 553 return ("I/O Port"); 554 if (mapreg & PCIM_BAR_MEM_PREFETCH) 555 return ("Prefetchable Memory"); 556 return ("Memory"); 557 } 558 559 /* return log2 of map size decoded for memory or port map */ 560 561 int 562 pci_mapsize(uint64_t testval) 563 { 564 int ln2size; 565 566 testval = pci_mapbase(testval); 567 ln2size = 0; 568 if (testval != 0) { 569 while ((testval & 1) == 0) 570 { 571 ln2size++; 572 testval >>= 1; 573 } 574 } 575 return (ln2size); 576 } 577 578 /* return base address of device ROM */ 579 580 static pci_addr_t 581 pci_rombase(uint64_t mapreg) 582 { 583 584 return (mapreg & PCIM_BIOS_ADDR_MASK); 585 } 586 587 /* return log2 of map size decided for device ROM */ 588 589 static int 590 pci_romsize(uint64_t testval) 591 { 592 int ln2size; 593 594 testval = pci_rombase(testval); 595 ln2size = 0; 596 if (testval != 0) { 597 while ((testval & 1) == 0) 598 { 599 ln2size++; 600 testval >>= 1; 601 } 602 } 603 return (ln2size); 604 } 605 606 /* return log2 of address range supported by map register */ 607 608 static int 609 pci_maprange(uint64_t mapreg) 610 { 611 int ln2range = 0; 612 613 if (PCI_BAR_IO(mapreg)) 614 ln2range = 32; 615 else 616 switch (mapreg & PCIM_BAR_MEM_TYPE) { 617 case PCIM_BAR_MEM_32: 618 ln2range = 32; 619 break; 620 case PCIM_BAR_MEM_1MB: 621 ln2range = 20; 622 break; 623 case PCIM_BAR_MEM_64: 624 ln2range = 64; 625 break; 626 } 627 return (ln2range); 628 } 629 630 /* adjust some values from PCI 1.0 devices to match 2.0 standards ... */ 631 632 static void 633 pci_fixancient(pcicfgregs *cfg) 634 { 635 if ((cfg->hdrtype & PCIM_HDRTYPE) != PCIM_HDRTYPE_NORMAL) 636 return; 637 638 /* PCI to PCI bridges use header type 1 */ 639 if (cfg->baseclass == PCIC_BRIDGE && cfg->subclass == PCIS_BRIDGE_PCI) 640 cfg->hdrtype = PCIM_HDRTYPE_BRIDGE; 641 } 642 643 /* extract header type specific config data */ 644 645 static void 646 pci_hdrtypedata(device_t pcib, int b, int s, int f, pcicfgregs *cfg) 647 { 648 #define REG(n, w) PCIB_READ_CONFIG(pcib, b, s, f, n, w) 649 switch (cfg->hdrtype & PCIM_HDRTYPE) { 650 case PCIM_HDRTYPE_NORMAL: 651 cfg->subvendor = REG(PCIR_SUBVEND_0, 2); 652 cfg->subdevice = REG(PCIR_SUBDEV_0, 2); 653 cfg->mingnt = REG(PCIR_MINGNT, 1); 654 cfg->maxlat = REG(PCIR_MAXLAT, 1); 655 cfg->nummaps = PCI_MAXMAPS_0; 656 break; 657 case PCIM_HDRTYPE_BRIDGE: 658 cfg->bridge.br_seclat = REG(PCIR_SECLAT_1, 1); 659 cfg->bridge.br_subbus = REG(PCIR_SUBBUS_1, 1); 660 cfg->bridge.br_secbus = REG(PCIR_SECBUS_1, 1); 661 cfg->bridge.br_pribus = REG(PCIR_PRIBUS_1, 1); 662 cfg->bridge.br_control = REG(PCIR_BRIDGECTL_1, 2); 663 cfg->nummaps = PCI_MAXMAPS_1; 664 break; 665 case PCIM_HDRTYPE_CARDBUS: 666 cfg->bridge.br_seclat = REG(PCIR_SECLAT_2, 1); 667 cfg->bridge.br_subbus = REG(PCIR_SUBBUS_2, 1); 668 cfg->bridge.br_secbus = REG(PCIR_SECBUS_2, 1); 669 cfg->bridge.br_pribus = REG(PCIR_PRIBUS_2, 1); 670 cfg->bridge.br_control = REG(PCIR_BRIDGECTL_2, 2); 671 cfg->subvendor = REG(PCIR_SUBVEND_2, 2); 672 cfg->subdevice = REG(PCIR_SUBDEV_2, 2); 673 cfg->nummaps = PCI_MAXMAPS_2; 674 break; 675 } 676 #undef REG 677 } 678 679 /* read configuration header into pcicfgregs structure */ 680 struct pci_devinfo * 681 pci_read_device(device_t pcib, device_t bus, int d, int b, int s, int f) 682 { 683 #define REG(n, w) PCIB_READ_CONFIG(pcib, b, s, f, n, w) 684 uint16_t vid, did; 685 686 vid = REG(PCIR_VENDOR, 2); 687 if (vid == PCIV_INVALID) 688 return (NULL); 689 690 did = REG(PCIR_DEVICE, 2); 691 692 return (pci_fill_devinfo(pcib, bus, d, b, s, f, vid, did)); 693 } 694 695 struct pci_devinfo * 696 pci_alloc_devinfo_method(device_t dev) 697 { 698 699 return (malloc(sizeof(struct pci_devinfo), M_DEVBUF, 700 M_WAITOK | M_ZERO)); 701 } 702 703 static struct pci_devinfo * 704 pci_fill_devinfo(device_t pcib, device_t bus, int d, int b, int s, int f, 705 uint16_t vid, uint16_t did) 706 { 707 struct pci_devinfo *devlist_entry; 708 pcicfgregs *cfg; 709 710 devlist_entry = PCI_ALLOC_DEVINFO(bus); 711 712 cfg = &devlist_entry->cfg; 713 714 cfg->domain = d; 715 cfg->bus = b; 716 cfg->slot = s; 717 cfg->func = f; 718 cfg->vendor = vid; 719 cfg->device = did; 720 cfg->cmdreg = REG(PCIR_COMMAND, 2); 721 cfg->statreg = REG(PCIR_STATUS, 2); 722 cfg->baseclass = REG(PCIR_CLASS, 1); 723 cfg->subclass = REG(PCIR_SUBCLASS, 1); 724 cfg->progif = REG(PCIR_PROGIF, 1); 725 cfg->revid = REG(PCIR_REVID, 1); 726 cfg->hdrtype = REG(PCIR_HDRTYPE, 1); 727 cfg->cachelnsz = REG(PCIR_CACHELNSZ, 1); 728 cfg->lattimer = REG(PCIR_LATTIMER, 1); 729 cfg->intpin = REG(PCIR_INTPIN, 1); 730 cfg->intline = REG(PCIR_INTLINE, 1); 731 732 cfg->mfdev = (cfg->hdrtype & PCIM_MFDEV) != 0; 733 cfg->hdrtype &= ~PCIM_MFDEV; 734 STAILQ_INIT(&cfg->maps); 735 736 cfg->iov = NULL; 737 738 pci_fixancient(cfg); 739 pci_hdrtypedata(pcib, b, s, f, cfg); 740 741 if (REG(PCIR_STATUS, 2) & PCIM_STATUS_CAPPRESENT) 742 pci_read_cap(pcib, cfg); 743 744 STAILQ_INSERT_TAIL(&pci_devq, devlist_entry, pci_links); 745 746 devlist_entry->conf.pc_sel.pc_domain = cfg->domain; 747 devlist_entry->conf.pc_sel.pc_bus = cfg->bus; 748 devlist_entry->conf.pc_sel.pc_dev = cfg->slot; 749 devlist_entry->conf.pc_sel.pc_func = cfg->func; 750 devlist_entry->conf.pc_hdr = cfg->hdrtype; 751 752 devlist_entry->conf.pc_subvendor = cfg->subvendor; 753 devlist_entry->conf.pc_subdevice = cfg->subdevice; 754 devlist_entry->conf.pc_vendor = cfg->vendor; 755 devlist_entry->conf.pc_device = cfg->device; 756 757 devlist_entry->conf.pc_class = cfg->baseclass; 758 devlist_entry->conf.pc_subclass = cfg->subclass; 759 devlist_entry->conf.pc_progif = cfg->progif; 760 devlist_entry->conf.pc_revid = cfg->revid; 761 762 pci_numdevs++; 763 pci_generation++; 764 765 return (devlist_entry); 766 } 767 #undef REG 768 769 static void 770 pci_ea_fill_info(device_t pcib, pcicfgregs *cfg) 771 { 772 #define REG(n, w) PCIB_READ_CONFIG(pcib, cfg->bus, cfg->slot, cfg->func, \ 773 cfg->ea.ea_location + (n), w) 774 int num_ent; 775 int ptr; 776 int a, b; 777 uint32_t val; 778 int ent_size; 779 uint32_t dw[4]; 780 uint64_t base, max_offset; 781 struct pci_ea_entry *eae; 782 783 if (cfg->ea.ea_location == 0) 784 return; 785 786 STAILQ_INIT(&cfg->ea.ea_entries); 787 788 /* Determine the number of entries */ 789 num_ent = REG(PCIR_EA_NUM_ENT, 2); 790 num_ent &= PCIM_EA_NUM_ENT_MASK; 791 792 /* Find the first entry to care of */ 793 ptr = PCIR_EA_FIRST_ENT; 794 795 /* Skip DWORD 2 for type 1 functions */ 796 if ((cfg->hdrtype & PCIM_HDRTYPE) == PCIM_HDRTYPE_BRIDGE) 797 ptr += 4; 798 799 for (a = 0; a < num_ent; a++) { 800 eae = malloc(sizeof(*eae), M_DEVBUF, M_WAITOK | M_ZERO); 801 eae->eae_cfg_offset = cfg->ea.ea_location + ptr; 802 803 /* Read a number of dwords in the entry */ 804 val = REG(ptr, 4); 805 ptr += 4; 806 ent_size = (val & PCIM_EA_ES); 807 808 for (b = 0; b < ent_size; b++) { 809 dw[b] = REG(ptr, 4); 810 ptr += 4; 811 } 812 813 eae->eae_flags = val; 814 eae->eae_bei = (PCIM_EA_BEI & val) >> PCIM_EA_BEI_OFFSET; 815 816 base = dw[0] & PCIM_EA_FIELD_MASK; 817 max_offset = dw[1] | ~PCIM_EA_FIELD_MASK; 818 b = 2; 819 if (((dw[0] & PCIM_EA_IS_64) != 0) && (b < ent_size)) { 820 base |= (uint64_t)dw[b] << 32UL; 821 b++; 822 } 823 if (((dw[1] & PCIM_EA_IS_64) != 0) 824 && (b < ent_size)) { 825 max_offset |= (uint64_t)dw[b] << 32UL; 826 b++; 827 } 828 829 eae->eae_base = base; 830 eae->eae_max_offset = max_offset; 831 832 STAILQ_INSERT_TAIL(&cfg->ea.ea_entries, eae, eae_link); 833 834 if (bootverbose) { 835 printf("PCI(EA) dev %04x:%04x, bei %d, flags #%x, base #%jx, max_offset #%jx\n", 836 cfg->vendor, cfg->device, eae->eae_bei, eae->eae_flags, 837 (uintmax_t)eae->eae_base, (uintmax_t)eae->eae_max_offset); 838 } 839 } 840 } 841 #undef REG 842 843 static void 844 pci_read_cap(device_t pcib, pcicfgregs *cfg) 845 { 846 #define REG(n, w) PCIB_READ_CONFIG(pcib, cfg->bus, cfg->slot, cfg->func, n, w) 847 #define WREG(n, v, w) PCIB_WRITE_CONFIG(pcib, cfg->bus, cfg->slot, cfg->func, n, v, w) 848 #if defined(__i386__) || defined(__amd64__) || defined(__powerpc__) 849 uint64_t addr; 850 #endif 851 uint32_t val; 852 int ptr, nextptr, ptrptr; 853 854 switch (cfg->hdrtype & PCIM_HDRTYPE) { 855 case PCIM_HDRTYPE_NORMAL: 856 case PCIM_HDRTYPE_BRIDGE: 857 ptrptr = PCIR_CAP_PTR; 858 break; 859 case PCIM_HDRTYPE_CARDBUS: 860 ptrptr = PCIR_CAP_PTR_2; /* cardbus capabilities ptr */ 861 break; 862 default: 863 return; /* no extended capabilities support */ 864 } 865 nextptr = REG(ptrptr, 1); /* sanity check? */ 866 867 /* 868 * Read capability entries. 869 */ 870 while (nextptr != 0) { 871 /* Sanity check */ 872 if (nextptr > 255) { 873 printf("illegal PCI extended capability offset %d\n", 874 nextptr); 875 return; 876 } 877 /* Find the next entry */ 878 ptr = nextptr; 879 nextptr = REG(ptr + PCICAP_NEXTPTR, 1); 880 881 /* Process this entry */ 882 switch (REG(ptr + PCICAP_ID, 1)) { 883 case PCIY_PMG: /* PCI power management */ 884 if (cfg->pp.pp_cap == 0) { 885 cfg->pp.pp_cap = REG(ptr + PCIR_POWER_CAP, 2); 886 cfg->pp.pp_status = ptr + PCIR_POWER_STATUS; 887 cfg->pp.pp_bse = ptr + PCIR_POWER_BSE; 888 if ((nextptr - ptr) > PCIR_POWER_DATA) 889 cfg->pp.pp_data = ptr + PCIR_POWER_DATA; 890 } 891 break; 892 case PCIY_HT: /* HyperTransport */ 893 /* Determine HT-specific capability type. */ 894 val = REG(ptr + PCIR_HT_COMMAND, 2); 895 896 if ((val & 0xe000) == PCIM_HTCAP_SLAVE) 897 cfg->ht.ht_slave = ptr; 898 899 #if defined(__i386__) || defined(__amd64__) || defined(__powerpc__) 900 switch (val & PCIM_HTCMD_CAP_MASK) { 901 case PCIM_HTCAP_MSI_MAPPING: 902 if (!(val & PCIM_HTCMD_MSI_FIXED)) { 903 /* Sanity check the mapping window. */ 904 addr = REG(ptr + PCIR_HTMSI_ADDRESS_HI, 905 4); 906 addr <<= 32; 907 addr |= REG(ptr + PCIR_HTMSI_ADDRESS_LO, 908 4); 909 if (addr != MSI_INTEL_ADDR_BASE) 910 device_printf(pcib, 911 "HT device at pci%d:%d:%d:%d has non-default MSI window 0x%llx\n", 912 cfg->domain, cfg->bus, 913 cfg->slot, cfg->func, 914 (long long)addr); 915 } else 916 addr = MSI_INTEL_ADDR_BASE; 917 918 cfg->ht.ht_msimap = ptr; 919 cfg->ht.ht_msictrl = val; 920 cfg->ht.ht_msiaddr = addr; 921 break; 922 } 923 #endif 924 break; 925 case PCIY_MSI: /* PCI MSI */ 926 cfg->msi.msi_location = ptr; 927 cfg->msi.msi_ctrl = REG(ptr + PCIR_MSI_CTRL, 2); 928 cfg->msi.msi_msgnum = 1 << ((cfg->msi.msi_ctrl & 929 PCIM_MSICTRL_MMC_MASK)>>1); 930 break; 931 case PCIY_MSIX: /* PCI MSI-X */ 932 cfg->msix.msix_location = ptr; 933 cfg->msix.msix_ctrl = REG(ptr + PCIR_MSIX_CTRL, 2); 934 cfg->msix.msix_msgnum = (cfg->msix.msix_ctrl & 935 PCIM_MSIXCTRL_TABLE_SIZE) + 1; 936 val = REG(ptr + PCIR_MSIX_TABLE, 4); 937 cfg->msix.msix_table_bar = PCIR_BAR(val & 938 PCIM_MSIX_BIR_MASK); 939 cfg->msix.msix_table_offset = val & ~PCIM_MSIX_BIR_MASK; 940 val = REG(ptr + PCIR_MSIX_PBA, 4); 941 cfg->msix.msix_pba_bar = PCIR_BAR(val & 942 PCIM_MSIX_BIR_MASK); 943 cfg->msix.msix_pba_offset = val & ~PCIM_MSIX_BIR_MASK; 944 break; 945 case PCIY_VPD: /* PCI Vital Product Data */ 946 cfg->vpd.vpd_reg = ptr; 947 break; 948 case PCIY_SUBVENDOR: 949 /* Should always be true. */ 950 if ((cfg->hdrtype & PCIM_HDRTYPE) == 951 PCIM_HDRTYPE_BRIDGE) { 952 val = REG(ptr + PCIR_SUBVENDCAP_ID, 4); 953 cfg->subvendor = val & 0xffff; 954 cfg->subdevice = val >> 16; 955 } 956 break; 957 case PCIY_PCIX: /* PCI-X */ 958 /* 959 * Assume we have a PCI-X chipset if we have 960 * at least one PCI-PCI bridge with a PCI-X 961 * capability. Note that some systems with 962 * PCI-express or HT chipsets might match on 963 * this check as well. 964 */ 965 if ((cfg->hdrtype & PCIM_HDRTYPE) == 966 PCIM_HDRTYPE_BRIDGE) 967 pcix_chipset = 1; 968 cfg->pcix.pcix_location = ptr; 969 break; 970 case PCIY_EXPRESS: /* PCI-express */ 971 /* 972 * Assume we have a PCI-express chipset if we have 973 * at least one PCI-express device. 974 */ 975 pcie_chipset = 1; 976 cfg->pcie.pcie_location = ptr; 977 val = REG(ptr + PCIER_FLAGS, 2); 978 cfg->pcie.pcie_type = val & PCIEM_FLAGS_TYPE; 979 break; 980 case PCIY_EA: /* Enhanced Allocation */ 981 cfg->ea.ea_location = ptr; 982 pci_ea_fill_info(pcib, cfg); 983 break; 984 default: 985 break; 986 } 987 } 988 989 #if defined(__powerpc__) 990 /* 991 * Enable the MSI mapping window for all HyperTransport 992 * slaves. PCI-PCI bridges have their windows enabled via 993 * PCIB_MAP_MSI(). 994 */ 995 if (cfg->ht.ht_slave != 0 && cfg->ht.ht_msimap != 0 && 996 !(cfg->ht.ht_msictrl & PCIM_HTCMD_MSI_ENABLE)) { 997 device_printf(pcib, 998 "Enabling MSI window for HyperTransport slave at pci%d:%d:%d:%d\n", 999 cfg->domain, cfg->bus, cfg->slot, cfg->func); 1000 cfg->ht.ht_msictrl |= PCIM_HTCMD_MSI_ENABLE; 1001 WREG(cfg->ht.ht_msimap + PCIR_HT_COMMAND, cfg->ht.ht_msictrl, 1002 2); 1003 } 1004 #endif 1005 /* REG and WREG use carry through to next functions */ 1006 } 1007 1008 /* 1009 * PCI Vital Product Data 1010 */ 1011 1012 #define PCI_VPD_TIMEOUT 1000000 1013 1014 static int 1015 pci_read_vpd_reg(device_t pcib, pcicfgregs *cfg, int reg, uint32_t *data) 1016 { 1017 int count = PCI_VPD_TIMEOUT; 1018 1019 KASSERT((reg & 3) == 0, ("VPD register must by 4 byte aligned")); 1020 1021 WREG(cfg->vpd.vpd_reg + PCIR_VPD_ADDR, reg, 2); 1022 1023 while ((REG(cfg->vpd.vpd_reg + PCIR_VPD_ADDR, 2) & 0x8000) != 0x8000) { 1024 if (--count < 0) 1025 return (ENXIO); 1026 DELAY(1); /* limit looping */ 1027 } 1028 *data = (REG(cfg->vpd.vpd_reg + PCIR_VPD_DATA, 4)); 1029 1030 return (0); 1031 } 1032 1033 #if 0 1034 static int 1035 pci_write_vpd_reg(device_t pcib, pcicfgregs *cfg, int reg, uint32_t data) 1036 { 1037 int count = PCI_VPD_TIMEOUT; 1038 1039 KASSERT((reg & 3) == 0, ("VPD register must by 4 byte aligned")); 1040 1041 WREG(cfg->vpd.vpd_reg + PCIR_VPD_DATA, data, 4); 1042 WREG(cfg->vpd.vpd_reg + PCIR_VPD_ADDR, reg | 0x8000, 2); 1043 while ((REG(cfg->vpd.vpd_reg + PCIR_VPD_ADDR, 2) & 0x8000) == 0x8000) { 1044 if (--count < 0) 1045 return (ENXIO); 1046 DELAY(1); /* limit looping */ 1047 } 1048 1049 return (0); 1050 } 1051 #endif 1052 1053 #undef PCI_VPD_TIMEOUT 1054 1055 struct vpd_readstate { 1056 device_t pcib; 1057 pcicfgregs *cfg; 1058 uint32_t val; 1059 int bytesinval; 1060 int off; 1061 uint8_t cksum; 1062 }; 1063 1064 /* return 0 and one byte in *data if no read error, -1 else */ 1065 static int 1066 vpd_nextbyte(struct vpd_readstate *vrs, uint8_t *data) 1067 { 1068 uint32_t reg; 1069 uint8_t byte; 1070 1071 if (vrs->bytesinval == 0) { 1072 if (pci_read_vpd_reg(vrs->pcib, vrs->cfg, vrs->off, ®)) 1073 return (-1); 1074 vrs->val = le32toh(reg); 1075 vrs->off += 4; 1076 byte = vrs->val & 0xff; 1077 vrs->bytesinval = 3; 1078 } else { 1079 vrs->val = vrs->val >> 8; 1080 byte = vrs->val & 0xff; 1081 vrs->bytesinval--; 1082 } 1083 1084 vrs->cksum += byte; 1085 *data = byte; 1086 return (0); 1087 } 1088 1089 /* return 0 on match, -1 and "unget" byte on no match */ 1090 static int 1091 vpd_expectbyte(struct vpd_readstate *vrs, uint8_t expected) 1092 { 1093 uint8_t data; 1094 1095 if (vpd_nextbyte(vrs, &data) != 0) 1096 return (-1); 1097 1098 if (data == expected) 1099 return (0); 1100 1101 vrs->cksum -= data; 1102 vrs->val = (vrs->val << 8) + data; 1103 vrs->bytesinval++; 1104 return (-1); 1105 } 1106 1107 /* return size if tag matches, -1 on no match, -2 on read error */ 1108 static int 1109 vpd_read_tag_size(struct vpd_readstate *vrs, uint8_t vpd_tag) 1110 { 1111 uint8_t byte1, byte2; 1112 1113 if (vpd_expectbyte(vrs, vpd_tag) != 0) 1114 return (-1); 1115 1116 if ((vpd_tag & 0x80) == 0) 1117 return (vpd_tag & 0x07); 1118 1119 if (vpd_nextbyte(vrs, &byte1) != 0) 1120 return (-2); 1121 if (vpd_nextbyte(vrs, &byte2) != 0) 1122 return (-2); 1123 1124 return ((byte2 << 8) + byte1); 1125 } 1126 1127 /* (re)allocate buffer in multiples of 8 elements */ 1128 static void* 1129 alloc_buffer(void* buffer, size_t element_size, int needed) 1130 { 1131 int alloc, new_alloc; 1132 1133 alloc = roundup2(needed, 8); 1134 new_alloc = roundup2(needed + 1, 8); 1135 if (alloc != new_alloc) { 1136 buffer = reallocf(buffer, 1137 new_alloc * element_size, M_DEVBUF, M_WAITOK | M_ZERO); 1138 } 1139 1140 return (buffer); 1141 } 1142 1143 /* read VPD keyword and return element size, return -1 on read error */ 1144 static int 1145 vpd_read_elem_head(struct vpd_readstate *vrs, char keyword[2]) 1146 { 1147 uint8_t data; 1148 1149 if (vpd_nextbyte(vrs, &keyword[0]) != 0) 1150 return (-1); 1151 if (vpd_nextbyte(vrs, &keyword[1]) != 0) 1152 return (-1); 1153 if (vpd_nextbyte(vrs, &data) != 0) 1154 return (-1); 1155 1156 return (data); 1157 } 1158 1159 /* read VPD data element of given size into allocated buffer */ 1160 static char * 1161 vpd_read_value(struct vpd_readstate *vrs, int size) 1162 { 1163 int i; 1164 char char1; 1165 char *value; 1166 1167 value = malloc(size + 1, M_DEVBUF, M_WAITOK); 1168 for (i = 0; i < size; i++) { 1169 if (vpd_nextbyte(vrs, &char1) != 0) { 1170 free(value, M_DEVBUF); 1171 return (NULL); 1172 } 1173 value[i] = char1; 1174 } 1175 value[size] = '\0'; 1176 1177 return (value); 1178 } 1179 1180 /* read VPD into *keyword and *value, return length of data element */ 1181 static int 1182 vpd_read_elem_data(struct vpd_readstate *vrs, char keyword[2], char **value, int maxlen) 1183 { 1184 int len; 1185 1186 len = vpd_read_elem_head(vrs, keyword); 1187 if (len > maxlen) 1188 return (-1); 1189 *value = vpd_read_value(vrs, len); 1190 1191 return (len); 1192 } 1193 1194 /* subtract all data following first byte from checksum of RV element */ 1195 static void 1196 vpd_fixup_cksum(struct vpd_readstate *vrs, char *rvstring, int len) 1197 { 1198 int i; 1199 uint8_t fixup; 1200 1201 fixup = 0; 1202 for (i = 1; i < len; i++) 1203 fixup += rvstring[i]; 1204 vrs->cksum -= fixup; 1205 } 1206 1207 /* fetch one read-only element and return size of heading + data */ 1208 static size_t 1209 next_vpd_ro_elem(struct vpd_readstate *vrs, int maxsize) 1210 { 1211 struct pcicfg_vpd *vpd; 1212 pcicfgregs *cfg; 1213 struct vpd_readonly *vpd_ros; 1214 int len; 1215 1216 cfg = vrs->cfg; 1217 vpd = &cfg->vpd; 1218 1219 if (maxsize < 3) 1220 return (-1); 1221 vpd->vpd_ros = alloc_buffer(vpd->vpd_ros, sizeof(*vpd->vpd_ros), vpd->vpd_rocnt); 1222 vpd_ros = &vpd->vpd_ros[vpd->vpd_rocnt]; 1223 maxsize -= 3; 1224 len = vpd_read_elem_data(vrs, vpd_ros->keyword, &vpd_ros->value, maxsize); 1225 if (vpd_ros->value == NULL) 1226 return (-1); 1227 vpd_ros->len = len; 1228 if (vpd_ros->keyword[0] == 'R' && vpd_ros->keyword[1] == 'V') { 1229 vpd_fixup_cksum(vrs, vpd_ros->value, len); 1230 if (vrs->cksum != 0) { 1231 pci_printf(cfg, 1232 "invalid VPD checksum %#hhx\n", vrs->cksum); 1233 return (-1); 1234 } 1235 } 1236 vpd->vpd_rocnt++; 1237 1238 return (len + 3); 1239 } 1240 1241 /* fetch one writable element and return size of heading + data */ 1242 static size_t 1243 next_vpd_rw_elem(struct vpd_readstate *vrs, int maxsize) 1244 { 1245 struct pcicfg_vpd *vpd; 1246 pcicfgregs *cfg; 1247 struct vpd_write *vpd_w; 1248 int len; 1249 1250 cfg = vrs->cfg; 1251 vpd = &cfg->vpd; 1252 1253 if (maxsize < 3) 1254 return (-1); 1255 vpd->vpd_w = alloc_buffer(vpd->vpd_w, sizeof(*vpd->vpd_w), vpd->vpd_wcnt); 1256 if (vpd->vpd_w == NULL) { 1257 pci_printf(cfg, "out of memory"); 1258 return (-1); 1259 } 1260 vpd_w = &vpd->vpd_w[vpd->vpd_wcnt]; 1261 maxsize -= 3; 1262 vpd_w->start = vrs->off + 3 - vrs->bytesinval; 1263 len = vpd_read_elem_data(vrs, vpd_w->keyword, &vpd_w->value, maxsize); 1264 if (vpd_w->value == NULL) 1265 return (-1); 1266 vpd_w->len = len; 1267 vpd->vpd_wcnt++; 1268 1269 return (len + 3); 1270 } 1271 1272 /* free all memory allocated for VPD data */ 1273 static void 1274 vpd_free(struct pcicfg_vpd *vpd) 1275 { 1276 int i; 1277 1278 free(vpd->vpd_ident, M_DEVBUF); 1279 for (i = 0; i < vpd->vpd_rocnt; i++) 1280 free(vpd->vpd_ros[i].value, M_DEVBUF); 1281 free(vpd->vpd_ros, M_DEVBUF); 1282 vpd->vpd_rocnt = 0; 1283 for (i = 0; i < vpd->vpd_wcnt; i++) 1284 free(vpd->vpd_w[i].value, M_DEVBUF); 1285 free(vpd->vpd_w, M_DEVBUF); 1286 vpd->vpd_wcnt = 0; 1287 } 1288 1289 #define VPD_TAG_END ((0x0f << 3) | 0) /* small tag, len == 0 */ 1290 #define VPD_TAG_IDENT (0x02 | 0x80) /* large tag */ 1291 #define VPD_TAG_RO (0x10 | 0x80) /* large tag */ 1292 #define VPD_TAG_RW (0x11 | 0x80) /* large tag */ 1293 1294 static int 1295 pci_parse_vpd(device_t pcib, pcicfgregs *cfg) 1296 { 1297 struct vpd_readstate vrs; 1298 int cksumvalid; 1299 int size, elem_size; 1300 1301 /* init vpd reader */ 1302 vrs.bytesinval = 0; 1303 vrs.off = 0; 1304 vrs.pcib = pcib; 1305 vrs.cfg = cfg; 1306 vrs.cksum = 0; 1307 1308 /* read VPD ident element - mandatory */ 1309 size = vpd_read_tag_size(&vrs, VPD_TAG_IDENT); 1310 if (size <= 0) { 1311 pci_printf(cfg, "no VPD ident found\n"); 1312 return (0); 1313 } 1314 cfg->vpd.vpd_ident = vpd_read_value(&vrs, size); 1315 if (cfg->vpd.vpd_ident == NULL) { 1316 pci_printf(cfg, "error accessing VPD ident data\n"); 1317 return (0); 1318 } 1319 1320 /* read VPD RO elements - mandatory */ 1321 size = vpd_read_tag_size(&vrs, VPD_TAG_RO); 1322 if (size <= 0) { 1323 pci_printf(cfg, "no read-only VPD data found\n"); 1324 return (0); 1325 } 1326 while (size > 0) { 1327 elem_size = next_vpd_ro_elem(&vrs, size); 1328 if (elem_size < 0) { 1329 pci_printf(cfg, "error accessing read-only VPD data\n"); 1330 return (-1); 1331 } 1332 size -= elem_size; 1333 } 1334 cksumvalid = (vrs.cksum == 0); 1335 if (!cksumvalid) 1336 return (-1); 1337 1338 /* read VPD RW elements - optional */ 1339 size = vpd_read_tag_size(&vrs, VPD_TAG_RW); 1340 if (size == -2) 1341 return (-1); 1342 while (size > 0) { 1343 elem_size = next_vpd_rw_elem(&vrs, size); 1344 if (elem_size < 0) { 1345 pci_printf(cfg, "error accessing writeable VPD data\n"); 1346 return (-1); 1347 } 1348 size -= elem_size; 1349 } 1350 1351 /* read empty END tag - mandatory */ 1352 size = vpd_read_tag_size(&vrs, VPD_TAG_END); 1353 if (size != 0) { 1354 pci_printf(cfg, "No valid VPD end tag found\n"); 1355 } 1356 return (0); 1357 } 1358 1359 static void 1360 pci_read_vpd(device_t pcib, pcicfgregs *cfg) 1361 { 1362 int status; 1363 1364 status = pci_parse_vpd(pcib, cfg); 1365 if (status < 0) 1366 vpd_free(&cfg->vpd); 1367 cfg->vpd.vpd_cached = 1; 1368 #undef REG 1369 #undef WREG 1370 } 1371 1372 int 1373 pci_get_vpd_ident_method(device_t dev, device_t child, const char **identptr) 1374 { 1375 struct pci_devinfo *dinfo = device_get_ivars(child); 1376 pcicfgregs *cfg = &dinfo->cfg; 1377 1378 if (!cfg->vpd.vpd_cached && cfg->vpd.vpd_reg != 0) 1379 pci_read_vpd(device_get_parent(dev), cfg); 1380 1381 *identptr = cfg->vpd.vpd_ident; 1382 1383 if (*identptr == NULL) 1384 return (ENXIO); 1385 1386 return (0); 1387 } 1388 1389 int 1390 pci_get_vpd_readonly_method(device_t dev, device_t child, const char *kw, 1391 const char **vptr) 1392 { 1393 struct pci_devinfo *dinfo = device_get_ivars(child); 1394 pcicfgregs *cfg = &dinfo->cfg; 1395 int i; 1396 1397 if (!cfg->vpd.vpd_cached && cfg->vpd.vpd_reg != 0) 1398 pci_read_vpd(device_get_parent(dev), cfg); 1399 1400 for (i = 0; i < cfg->vpd.vpd_rocnt; i++) 1401 if (memcmp(kw, cfg->vpd.vpd_ros[i].keyword, 1402 sizeof(cfg->vpd.vpd_ros[i].keyword)) == 0) { 1403 *vptr = cfg->vpd.vpd_ros[i].value; 1404 return (0); 1405 } 1406 1407 *vptr = NULL; 1408 return (ENXIO); 1409 } 1410 1411 struct pcicfg_vpd * 1412 pci_fetch_vpd_list(device_t dev) 1413 { 1414 struct pci_devinfo *dinfo = device_get_ivars(dev); 1415 pcicfgregs *cfg = &dinfo->cfg; 1416 1417 if (!cfg->vpd.vpd_cached && cfg->vpd.vpd_reg != 0) 1418 pci_read_vpd(device_get_parent(device_get_parent(dev)), cfg); 1419 return (&cfg->vpd); 1420 } 1421 1422 /* 1423 * Find the requested HyperTransport capability and return the offset 1424 * in configuration space via the pointer provided. The function 1425 * returns 0 on success and an error code otherwise. 1426 */ 1427 int 1428 pci_find_htcap_method(device_t dev, device_t child, int capability, int *capreg) 1429 { 1430 int ptr, error; 1431 uint16_t val; 1432 1433 error = pci_find_cap(child, PCIY_HT, &ptr); 1434 if (error) 1435 return (error); 1436 1437 /* 1438 * Traverse the capabilities list checking each HT capability 1439 * to see if it matches the requested HT capability. 1440 */ 1441 for (;;) { 1442 val = pci_read_config(child, ptr + PCIR_HT_COMMAND, 2); 1443 if (capability == PCIM_HTCAP_SLAVE || 1444 capability == PCIM_HTCAP_HOST) 1445 val &= 0xe000; 1446 else 1447 val &= PCIM_HTCMD_CAP_MASK; 1448 if (val == capability) { 1449 if (capreg != NULL) 1450 *capreg = ptr; 1451 return (0); 1452 } 1453 1454 /* Skip to the next HT capability. */ 1455 if (pci_find_next_cap(child, PCIY_HT, ptr, &ptr) != 0) 1456 break; 1457 } 1458 1459 return (ENOENT); 1460 } 1461 1462 /* 1463 * Find the next requested HyperTransport capability after start and return 1464 * the offset in configuration space via the pointer provided. The function 1465 * returns 0 on success and an error code otherwise. 1466 */ 1467 int 1468 pci_find_next_htcap_method(device_t dev, device_t child, int capability, 1469 int start, int *capreg) 1470 { 1471 int ptr; 1472 uint16_t val; 1473 1474 KASSERT(pci_read_config(child, start + PCICAP_ID, 1) == PCIY_HT, 1475 ("start capability is not HyperTransport capability")); 1476 ptr = start; 1477 1478 /* 1479 * Traverse the capabilities list checking each HT capability 1480 * to see if it matches the requested HT capability. 1481 */ 1482 for (;;) { 1483 /* Skip to the next HT capability. */ 1484 if (pci_find_next_cap(child, PCIY_HT, ptr, &ptr) != 0) 1485 break; 1486 1487 val = pci_read_config(child, ptr + PCIR_HT_COMMAND, 2); 1488 if (capability == PCIM_HTCAP_SLAVE || 1489 capability == PCIM_HTCAP_HOST) 1490 val &= 0xe000; 1491 else 1492 val &= PCIM_HTCMD_CAP_MASK; 1493 if (val == capability) { 1494 if (capreg != NULL) 1495 *capreg = ptr; 1496 return (0); 1497 } 1498 } 1499 1500 return (ENOENT); 1501 } 1502 1503 /* 1504 * Find the requested capability and return the offset in 1505 * configuration space via the pointer provided. The function returns 1506 * 0 on success and an error code otherwise. 1507 */ 1508 int 1509 pci_find_cap_method(device_t dev, device_t child, int capability, 1510 int *capreg) 1511 { 1512 struct pci_devinfo *dinfo = device_get_ivars(child); 1513 pcicfgregs *cfg = &dinfo->cfg; 1514 uint32_t status; 1515 uint8_t ptr; 1516 1517 /* 1518 * Check the CAP_LIST bit of the PCI status register first. 1519 */ 1520 status = pci_read_config(child, PCIR_STATUS, 2); 1521 if (!(status & PCIM_STATUS_CAPPRESENT)) 1522 return (ENXIO); 1523 1524 /* 1525 * Determine the start pointer of the capabilities list. 1526 */ 1527 switch (cfg->hdrtype & PCIM_HDRTYPE) { 1528 case PCIM_HDRTYPE_NORMAL: 1529 case PCIM_HDRTYPE_BRIDGE: 1530 ptr = PCIR_CAP_PTR; 1531 break; 1532 case PCIM_HDRTYPE_CARDBUS: 1533 ptr = PCIR_CAP_PTR_2; 1534 break; 1535 default: 1536 /* XXX: panic? */ 1537 return (ENXIO); /* no extended capabilities support */ 1538 } 1539 ptr = pci_read_config(child, ptr, 1); 1540 1541 /* 1542 * Traverse the capabilities list. 1543 */ 1544 while (ptr != 0) { 1545 if (pci_read_config(child, ptr + PCICAP_ID, 1) == capability) { 1546 if (capreg != NULL) 1547 *capreg = ptr; 1548 return (0); 1549 } 1550 ptr = pci_read_config(child, ptr + PCICAP_NEXTPTR, 1); 1551 } 1552 1553 return (ENOENT); 1554 } 1555 1556 /* 1557 * Find the next requested capability after start and return the offset in 1558 * configuration space via the pointer provided. The function returns 1559 * 0 on success and an error code otherwise. 1560 */ 1561 int 1562 pci_find_next_cap_method(device_t dev, device_t child, int capability, 1563 int start, int *capreg) 1564 { 1565 uint8_t ptr; 1566 1567 KASSERT(pci_read_config(child, start + PCICAP_ID, 1) == capability, 1568 ("start capability is not expected capability")); 1569 1570 ptr = pci_read_config(child, start + PCICAP_NEXTPTR, 1); 1571 while (ptr != 0) { 1572 if (pci_read_config(child, ptr + PCICAP_ID, 1) == capability) { 1573 if (capreg != NULL) 1574 *capreg = ptr; 1575 return (0); 1576 } 1577 ptr = pci_read_config(child, ptr + PCICAP_NEXTPTR, 1); 1578 } 1579 1580 return (ENOENT); 1581 } 1582 1583 /* 1584 * Find the requested extended capability and return the offset in 1585 * configuration space via the pointer provided. The function returns 1586 * 0 on success and an error code otherwise. 1587 */ 1588 int 1589 pci_find_extcap_method(device_t dev, device_t child, int capability, 1590 int *capreg) 1591 { 1592 struct pci_devinfo *dinfo = device_get_ivars(child); 1593 pcicfgregs *cfg = &dinfo->cfg; 1594 uint32_t ecap; 1595 uint16_t ptr; 1596 1597 /* Only supported for PCI-express devices. */ 1598 if (cfg->pcie.pcie_location == 0) 1599 return (ENXIO); 1600 1601 ptr = PCIR_EXTCAP; 1602 ecap = pci_read_config(child, ptr, 4); 1603 if (ecap == 0xffffffff || ecap == 0) 1604 return (ENOENT); 1605 for (;;) { 1606 if (PCI_EXTCAP_ID(ecap) == capability) { 1607 if (capreg != NULL) 1608 *capreg = ptr; 1609 return (0); 1610 } 1611 ptr = PCI_EXTCAP_NEXTPTR(ecap); 1612 if (ptr == 0) 1613 break; 1614 ecap = pci_read_config(child, ptr, 4); 1615 } 1616 1617 return (ENOENT); 1618 } 1619 1620 /* 1621 * Find the next requested extended capability after start and return the 1622 * offset in configuration space via the pointer provided. The function 1623 * returns 0 on success and an error code otherwise. 1624 */ 1625 int 1626 pci_find_next_extcap_method(device_t dev, device_t child, int capability, 1627 int start, int *capreg) 1628 { 1629 struct pci_devinfo *dinfo = device_get_ivars(child); 1630 pcicfgregs *cfg = &dinfo->cfg; 1631 uint32_t ecap; 1632 uint16_t ptr; 1633 1634 /* Only supported for PCI-express devices. */ 1635 if (cfg->pcie.pcie_location == 0) 1636 return (ENXIO); 1637 1638 ecap = pci_read_config(child, start, 4); 1639 KASSERT(PCI_EXTCAP_ID(ecap) == capability, 1640 ("start extended capability is not expected capability")); 1641 ptr = PCI_EXTCAP_NEXTPTR(ecap); 1642 while (ptr != 0) { 1643 ecap = pci_read_config(child, ptr, 4); 1644 if (PCI_EXTCAP_ID(ecap) == capability) { 1645 if (capreg != NULL) 1646 *capreg = ptr; 1647 return (0); 1648 } 1649 ptr = PCI_EXTCAP_NEXTPTR(ecap); 1650 } 1651 1652 return (ENOENT); 1653 } 1654 1655 /* 1656 * Support for MSI-X message interrupts. 1657 */ 1658 static void 1659 pci_write_msix_entry(device_t dev, u_int index, uint64_t address, uint32_t data) 1660 { 1661 struct pci_devinfo *dinfo = device_get_ivars(dev); 1662 struct pcicfg_msix *msix = &dinfo->cfg.msix; 1663 uint32_t offset; 1664 1665 KASSERT(msix->msix_table_len > index, ("bogus index")); 1666 offset = msix->msix_table_offset + index * 16; 1667 bus_write_4(msix->msix_table_res, offset, address & 0xffffffff); 1668 bus_write_4(msix->msix_table_res, offset + 4, address >> 32); 1669 bus_write_4(msix->msix_table_res, offset + 8, data); 1670 } 1671 1672 void 1673 pci_enable_msix_method(device_t dev, device_t child, u_int index, 1674 uint64_t address, uint32_t data) 1675 { 1676 1677 if (pci_msix_rewrite_table) { 1678 struct pci_devinfo *dinfo = device_get_ivars(child); 1679 struct pcicfg_msix *msix = &dinfo->cfg.msix; 1680 1681 /* 1682 * Some VM hosts require MSIX to be disabled in the 1683 * control register before updating the MSIX table 1684 * entries are allowed. It is not enough to only 1685 * disable MSIX while updating a single entry. MSIX 1686 * must be disabled while updating all entries in the 1687 * table. 1688 */ 1689 pci_write_config(child, 1690 msix->msix_location + PCIR_MSIX_CTRL, 1691 msix->msix_ctrl & ~PCIM_MSIXCTRL_MSIX_ENABLE, 2); 1692 pci_resume_msix(child); 1693 } else 1694 pci_write_msix_entry(child, index, address, data); 1695 1696 /* Enable MSI -> HT mapping. */ 1697 pci_ht_map_msi(child, address); 1698 } 1699 1700 void 1701 pci_mask_msix(device_t dev, u_int index) 1702 { 1703 struct pci_devinfo *dinfo = device_get_ivars(dev); 1704 struct pcicfg_msix *msix = &dinfo->cfg.msix; 1705 uint32_t offset, val; 1706 1707 KASSERT(msix->msix_msgnum > index, ("bogus index")); 1708 offset = msix->msix_table_offset + index * 16 + 12; 1709 val = bus_read_4(msix->msix_table_res, offset); 1710 val |= PCIM_MSIX_VCTRL_MASK; 1711 1712 /* 1713 * Some devices (e.g. Samsung PM961) do not support reads of this 1714 * register, so always write the new value. 1715 */ 1716 bus_write_4(msix->msix_table_res, offset, val); 1717 } 1718 1719 void 1720 pci_unmask_msix(device_t dev, u_int index) 1721 { 1722 struct pci_devinfo *dinfo = device_get_ivars(dev); 1723 struct pcicfg_msix *msix = &dinfo->cfg.msix; 1724 uint32_t offset, val; 1725 1726 KASSERT(msix->msix_table_len > index, ("bogus index")); 1727 offset = msix->msix_table_offset + index * 16 + 12; 1728 val = bus_read_4(msix->msix_table_res, offset); 1729 val &= ~PCIM_MSIX_VCTRL_MASK; 1730 1731 /* 1732 * Some devices (e.g. Samsung PM961) do not support reads of this 1733 * register, so always write the new value. 1734 */ 1735 bus_write_4(msix->msix_table_res, offset, val); 1736 } 1737 1738 int 1739 pci_pending_msix(device_t dev, u_int index) 1740 { 1741 struct pci_devinfo *dinfo = device_get_ivars(dev); 1742 struct pcicfg_msix *msix = &dinfo->cfg.msix; 1743 uint32_t offset, bit; 1744 1745 KASSERT(msix->msix_table_len > index, ("bogus index")); 1746 offset = msix->msix_pba_offset + (index / 32) * 4; 1747 bit = 1 << index % 32; 1748 return (bus_read_4(msix->msix_pba_res, offset) & bit); 1749 } 1750 1751 /* 1752 * Restore MSI-X registers and table during resume. If MSI-X is 1753 * enabled then walk the virtual table to restore the actual MSI-X 1754 * table. 1755 */ 1756 static void 1757 pci_resume_msix(device_t dev) 1758 { 1759 struct pci_devinfo *dinfo = device_get_ivars(dev); 1760 struct pcicfg_msix *msix = &dinfo->cfg.msix; 1761 struct msix_table_entry *mte; 1762 struct msix_vector *mv; 1763 int i; 1764 1765 if (msix->msix_alloc > 0) { 1766 /* First, mask all vectors. */ 1767 for (i = 0; i < msix->msix_msgnum; i++) 1768 pci_mask_msix(dev, i); 1769 1770 /* Second, program any messages with at least one handler. */ 1771 for (i = 0; i < msix->msix_table_len; i++) { 1772 mte = &msix->msix_table[i]; 1773 if (mte->mte_vector == 0 || mte->mte_handlers == 0) 1774 continue; 1775 mv = &msix->msix_vectors[mte->mte_vector - 1]; 1776 pci_write_msix_entry(dev, i, mv->mv_address, 1777 mv->mv_data); 1778 pci_unmask_msix(dev, i); 1779 } 1780 } 1781 pci_write_config(dev, msix->msix_location + PCIR_MSIX_CTRL, 1782 msix->msix_ctrl, 2); 1783 } 1784 1785 /* 1786 * Attempt to allocate *count MSI-X messages. The actual number allocated is 1787 * returned in *count. After this function returns, each message will be 1788 * available to the driver as SYS_RES_IRQ resources starting at rid 1. 1789 */ 1790 int 1791 pci_alloc_msix_method(device_t dev, device_t child, int *count) 1792 { 1793 struct pci_devinfo *dinfo = device_get_ivars(child); 1794 pcicfgregs *cfg = &dinfo->cfg; 1795 struct resource_list_entry *rle; 1796 int actual, error, i, irq, max; 1797 1798 /* Don't let count == 0 get us into trouble. */ 1799 if (*count == 0) 1800 return (EINVAL); 1801 1802 /* If rid 0 is allocated, then fail. */ 1803 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, 0); 1804 if (rle != NULL && rle->res != NULL) 1805 return (ENXIO); 1806 1807 /* Already have allocated messages? */ 1808 if (cfg->msi.msi_alloc != 0 || cfg->msix.msix_alloc != 0) 1809 return (ENXIO); 1810 1811 /* If MSI-X is blacklisted for this system, fail. */ 1812 if (pci_msix_blacklisted()) 1813 return (ENXIO); 1814 1815 /* MSI-X capability present? */ 1816 if (cfg->msix.msix_location == 0 || !pci_do_msix) 1817 return (ENODEV); 1818 1819 /* Make sure the appropriate BARs are mapped. */ 1820 rle = resource_list_find(&dinfo->resources, SYS_RES_MEMORY, 1821 cfg->msix.msix_table_bar); 1822 if (rle == NULL || rle->res == NULL || 1823 !(rman_get_flags(rle->res) & RF_ACTIVE)) 1824 return (ENXIO); 1825 cfg->msix.msix_table_res = rle->res; 1826 if (cfg->msix.msix_pba_bar != cfg->msix.msix_table_bar) { 1827 rle = resource_list_find(&dinfo->resources, SYS_RES_MEMORY, 1828 cfg->msix.msix_pba_bar); 1829 if (rle == NULL || rle->res == NULL || 1830 !(rman_get_flags(rle->res) & RF_ACTIVE)) 1831 return (ENXIO); 1832 } 1833 cfg->msix.msix_pba_res = rle->res; 1834 1835 if (bootverbose) 1836 device_printf(child, 1837 "attempting to allocate %d MSI-X vectors (%d supported)\n", 1838 *count, cfg->msix.msix_msgnum); 1839 max = min(*count, cfg->msix.msix_msgnum); 1840 for (i = 0; i < max; i++) { 1841 /* Allocate a message. */ 1842 error = PCIB_ALLOC_MSIX(device_get_parent(dev), child, &irq); 1843 if (error) { 1844 if (i == 0) 1845 return (error); 1846 break; 1847 } 1848 resource_list_add(&dinfo->resources, SYS_RES_IRQ, i + 1, irq, 1849 irq, 1); 1850 } 1851 actual = i; 1852 1853 if (bootverbose) { 1854 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, 1); 1855 if (actual == 1) 1856 device_printf(child, "using IRQ %ju for MSI-X\n", 1857 rle->start); 1858 else { 1859 int run; 1860 1861 /* 1862 * Be fancy and try to print contiguous runs of 1863 * IRQ values as ranges. 'irq' is the previous IRQ. 1864 * 'run' is true if we are in a range. 1865 */ 1866 device_printf(child, "using IRQs %ju", rle->start); 1867 irq = rle->start; 1868 run = 0; 1869 for (i = 1; i < actual; i++) { 1870 rle = resource_list_find(&dinfo->resources, 1871 SYS_RES_IRQ, i + 1); 1872 1873 /* Still in a run? */ 1874 if (rle->start == irq + 1) { 1875 run = 1; 1876 irq++; 1877 continue; 1878 } 1879 1880 /* Finish previous range. */ 1881 if (run) { 1882 printf("-%d", irq); 1883 run = 0; 1884 } 1885 1886 /* Start new range. */ 1887 printf(",%ju", rle->start); 1888 irq = rle->start; 1889 } 1890 1891 /* Unfinished range? */ 1892 if (run) 1893 printf("-%d", irq); 1894 printf(" for MSI-X\n"); 1895 } 1896 } 1897 1898 /* Mask all vectors. */ 1899 for (i = 0; i < cfg->msix.msix_msgnum; i++) 1900 pci_mask_msix(child, i); 1901 1902 /* Allocate and initialize vector data and virtual table. */ 1903 cfg->msix.msix_vectors = malloc(sizeof(struct msix_vector) * actual, 1904 M_DEVBUF, M_WAITOK | M_ZERO); 1905 cfg->msix.msix_table = malloc(sizeof(struct msix_table_entry) * actual, 1906 M_DEVBUF, M_WAITOK | M_ZERO); 1907 for (i = 0; i < actual; i++) { 1908 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, i + 1); 1909 cfg->msix.msix_vectors[i].mv_irq = rle->start; 1910 cfg->msix.msix_table[i].mte_vector = i + 1; 1911 } 1912 1913 /* Update control register to enable MSI-X. */ 1914 cfg->msix.msix_ctrl |= PCIM_MSIXCTRL_MSIX_ENABLE; 1915 pci_write_config(child, cfg->msix.msix_location + PCIR_MSIX_CTRL, 1916 cfg->msix.msix_ctrl, 2); 1917 1918 /* Update counts of alloc'd messages. */ 1919 cfg->msix.msix_alloc = actual; 1920 cfg->msix.msix_table_len = actual; 1921 *count = actual; 1922 return (0); 1923 } 1924 1925 /* 1926 * By default, pci_alloc_msix() will assign the allocated IRQ 1927 * resources consecutively to the first N messages in the MSI-X table. 1928 * However, device drivers may want to use different layouts if they 1929 * either receive fewer messages than they asked for, or they wish to 1930 * populate the MSI-X table sparsely. This method allows the driver 1931 * to specify what layout it wants. It must be called after a 1932 * successful pci_alloc_msix() but before any of the associated 1933 * SYS_RES_IRQ resources are allocated via bus_alloc_resource(). 1934 * 1935 * The 'vectors' array contains 'count' message vectors. The array 1936 * maps directly to the MSI-X table in that index 0 in the array 1937 * specifies the vector for the first message in the MSI-X table, etc. 1938 * The vector value in each array index can either be 0 to indicate 1939 * that no vector should be assigned to a message slot, or it can be a 1940 * number from 1 to N (where N is the count returned from a 1941 * succcessful call to pci_alloc_msix()) to indicate which message 1942 * vector (IRQ) to be used for the corresponding message. 1943 * 1944 * On successful return, each message with a non-zero vector will have 1945 * an associated SYS_RES_IRQ whose rid is equal to the array index + 1946 * 1. Additionally, if any of the IRQs allocated via the previous 1947 * call to pci_alloc_msix() are not used in the mapping, those IRQs 1948 * will be freed back to the system automatically. 1949 * 1950 * For example, suppose a driver has a MSI-X table with 6 messages and 1951 * asks for 6 messages, but pci_alloc_msix() only returns a count of 1952 * 3. Call the three vectors allocated by pci_alloc_msix() A, B, and 1953 * C. After the call to pci_alloc_msix(), the device will be setup to 1954 * have an MSI-X table of ABC--- (where - means no vector assigned). 1955 * If the driver then passes a vector array of { 1, 0, 1, 2, 0, 2 }, 1956 * then the MSI-X table will look like A-AB-B, and the 'C' vector will 1957 * be freed back to the system. This device will also have valid 1958 * SYS_RES_IRQ rids of 1, 3, 4, and 6. 1959 * 1960 * In any case, the SYS_RES_IRQ rid X will always map to the message 1961 * at MSI-X table index X - 1 and will only be valid if a vector is 1962 * assigned to that table entry. 1963 */ 1964 int 1965 pci_remap_msix_method(device_t dev, device_t child, int count, 1966 const u_int *vectors) 1967 { 1968 struct pci_devinfo *dinfo = device_get_ivars(child); 1969 struct pcicfg_msix *msix = &dinfo->cfg.msix; 1970 struct resource_list_entry *rle; 1971 int i, irq, j, *used; 1972 1973 /* 1974 * Have to have at least one message in the table but the 1975 * table can't be bigger than the actual MSI-X table in the 1976 * device. 1977 */ 1978 if (count == 0 || count > msix->msix_msgnum) 1979 return (EINVAL); 1980 1981 /* Sanity check the vectors. */ 1982 for (i = 0; i < count; i++) 1983 if (vectors[i] > msix->msix_alloc) 1984 return (EINVAL); 1985 1986 /* 1987 * Make sure there aren't any holes in the vectors to be used. 1988 * It's a big pain to support it, and it doesn't really make 1989 * sense anyway. Also, at least one vector must be used. 1990 */ 1991 used = malloc(sizeof(int) * msix->msix_alloc, M_DEVBUF, M_WAITOK | 1992 M_ZERO); 1993 for (i = 0; i < count; i++) 1994 if (vectors[i] != 0) 1995 used[vectors[i] - 1] = 1; 1996 for (i = 0; i < msix->msix_alloc - 1; i++) 1997 if (used[i] == 0 && used[i + 1] == 1) { 1998 free(used, M_DEVBUF); 1999 return (EINVAL); 2000 } 2001 if (used[0] != 1) { 2002 free(used, M_DEVBUF); 2003 return (EINVAL); 2004 } 2005 2006 /* Make sure none of the resources are allocated. */ 2007 for (i = 0; i < msix->msix_table_len; i++) { 2008 if (msix->msix_table[i].mte_vector == 0) 2009 continue; 2010 if (msix->msix_table[i].mte_handlers > 0) { 2011 free(used, M_DEVBUF); 2012 return (EBUSY); 2013 } 2014 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, i + 1); 2015 KASSERT(rle != NULL, ("missing resource")); 2016 if (rle->res != NULL) { 2017 free(used, M_DEVBUF); 2018 return (EBUSY); 2019 } 2020 } 2021 2022 /* Free the existing resource list entries. */ 2023 for (i = 0; i < msix->msix_table_len; i++) { 2024 if (msix->msix_table[i].mte_vector == 0) 2025 continue; 2026 resource_list_delete(&dinfo->resources, SYS_RES_IRQ, i + 1); 2027 } 2028 2029 /* 2030 * Build the new virtual table keeping track of which vectors are 2031 * used. 2032 */ 2033 free(msix->msix_table, M_DEVBUF); 2034 msix->msix_table = malloc(sizeof(struct msix_table_entry) * count, 2035 M_DEVBUF, M_WAITOK | M_ZERO); 2036 for (i = 0; i < count; i++) 2037 msix->msix_table[i].mte_vector = vectors[i]; 2038 msix->msix_table_len = count; 2039 2040 /* Free any unused IRQs and resize the vectors array if necessary. */ 2041 j = msix->msix_alloc - 1; 2042 if (used[j] == 0) { 2043 struct msix_vector *vec; 2044 2045 while (used[j] == 0) { 2046 PCIB_RELEASE_MSIX(device_get_parent(dev), child, 2047 msix->msix_vectors[j].mv_irq); 2048 j--; 2049 } 2050 vec = malloc(sizeof(struct msix_vector) * (j + 1), M_DEVBUF, 2051 M_WAITOK); 2052 bcopy(msix->msix_vectors, vec, sizeof(struct msix_vector) * 2053 (j + 1)); 2054 free(msix->msix_vectors, M_DEVBUF); 2055 msix->msix_vectors = vec; 2056 msix->msix_alloc = j + 1; 2057 } 2058 free(used, M_DEVBUF); 2059 2060 /* Map the IRQs onto the rids. */ 2061 for (i = 0; i < count; i++) { 2062 if (vectors[i] == 0) 2063 continue; 2064 irq = msix->msix_vectors[vectors[i] - 1].mv_irq; 2065 resource_list_add(&dinfo->resources, SYS_RES_IRQ, i + 1, irq, 2066 irq, 1); 2067 } 2068 2069 if (bootverbose) { 2070 device_printf(child, "Remapped MSI-X IRQs as: "); 2071 for (i = 0; i < count; i++) { 2072 if (i != 0) 2073 printf(", "); 2074 if (vectors[i] == 0) 2075 printf("---"); 2076 else 2077 printf("%d", 2078 msix->msix_vectors[vectors[i] - 1].mv_irq); 2079 } 2080 printf("\n"); 2081 } 2082 2083 return (0); 2084 } 2085 2086 static int 2087 pci_release_msix(device_t dev, device_t child) 2088 { 2089 struct pci_devinfo *dinfo = device_get_ivars(child); 2090 struct pcicfg_msix *msix = &dinfo->cfg.msix; 2091 struct resource_list_entry *rle; 2092 int i; 2093 2094 /* Do we have any messages to release? */ 2095 if (msix->msix_alloc == 0) 2096 return (ENODEV); 2097 2098 /* Make sure none of the resources are allocated. */ 2099 for (i = 0; i < msix->msix_table_len; i++) { 2100 if (msix->msix_table[i].mte_vector == 0) 2101 continue; 2102 if (msix->msix_table[i].mte_handlers > 0) 2103 return (EBUSY); 2104 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, i + 1); 2105 KASSERT(rle != NULL, ("missing resource")); 2106 if (rle->res != NULL) 2107 return (EBUSY); 2108 } 2109 2110 /* Update control register to disable MSI-X. */ 2111 msix->msix_ctrl &= ~PCIM_MSIXCTRL_MSIX_ENABLE; 2112 pci_write_config(child, msix->msix_location + PCIR_MSIX_CTRL, 2113 msix->msix_ctrl, 2); 2114 2115 /* Free the resource list entries. */ 2116 for (i = 0; i < msix->msix_table_len; i++) { 2117 if (msix->msix_table[i].mte_vector == 0) 2118 continue; 2119 resource_list_delete(&dinfo->resources, SYS_RES_IRQ, i + 1); 2120 } 2121 free(msix->msix_table, M_DEVBUF); 2122 msix->msix_table_len = 0; 2123 2124 /* Release the IRQs. */ 2125 for (i = 0; i < msix->msix_alloc; i++) 2126 PCIB_RELEASE_MSIX(device_get_parent(dev), child, 2127 msix->msix_vectors[i].mv_irq); 2128 free(msix->msix_vectors, M_DEVBUF); 2129 msix->msix_alloc = 0; 2130 return (0); 2131 } 2132 2133 /* 2134 * Return the max supported MSI-X messages this device supports. 2135 * Basically, assuming the MD code can alloc messages, this function 2136 * should return the maximum value that pci_alloc_msix() can return. 2137 * Thus, it is subject to the tunables, etc. 2138 */ 2139 int 2140 pci_msix_count_method(device_t dev, device_t child) 2141 { 2142 struct pci_devinfo *dinfo = device_get_ivars(child); 2143 struct pcicfg_msix *msix = &dinfo->cfg.msix; 2144 2145 if (pci_do_msix && msix->msix_location != 0) 2146 return (msix->msix_msgnum); 2147 return (0); 2148 } 2149 2150 int 2151 pci_msix_pba_bar_method(device_t dev, device_t child) 2152 { 2153 struct pci_devinfo *dinfo = device_get_ivars(child); 2154 struct pcicfg_msix *msix = &dinfo->cfg.msix; 2155 2156 if (pci_do_msix && msix->msix_location != 0) 2157 return (msix->msix_pba_bar); 2158 return (-1); 2159 } 2160 2161 int 2162 pci_msix_table_bar_method(device_t dev, device_t child) 2163 { 2164 struct pci_devinfo *dinfo = device_get_ivars(child); 2165 struct pcicfg_msix *msix = &dinfo->cfg.msix; 2166 2167 if (pci_do_msix && msix->msix_location != 0) 2168 return (msix->msix_table_bar); 2169 return (-1); 2170 } 2171 2172 /* 2173 * HyperTransport MSI mapping control 2174 */ 2175 void 2176 pci_ht_map_msi(device_t dev, uint64_t addr) 2177 { 2178 struct pci_devinfo *dinfo = device_get_ivars(dev); 2179 struct pcicfg_ht *ht = &dinfo->cfg.ht; 2180 2181 if (!ht->ht_msimap) 2182 return; 2183 2184 if (addr && !(ht->ht_msictrl & PCIM_HTCMD_MSI_ENABLE) && 2185 ht->ht_msiaddr >> 20 == addr >> 20) { 2186 /* Enable MSI -> HT mapping. */ 2187 ht->ht_msictrl |= PCIM_HTCMD_MSI_ENABLE; 2188 pci_write_config(dev, ht->ht_msimap + PCIR_HT_COMMAND, 2189 ht->ht_msictrl, 2); 2190 } 2191 2192 if (!addr && ht->ht_msictrl & PCIM_HTCMD_MSI_ENABLE) { 2193 /* Disable MSI -> HT mapping. */ 2194 ht->ht_msictrl &= ~PCIM_HTCMD_MSI_ENABLE; 2195 pci_write_config(dev, ht->ht_msimap + PCIR_HT_COMMAND, 2196 ht->ht_msictrl, 2); 2197 } 2198 } 2199 2200 int 2201 pci_get_relaxed_ordering_enabled(device_t dev) 2202 { 2203 struct pci_devinfo *dinfo = device_get_ivars(dev); 2204 int cap; 2205 uint16_t val; 2206 2207 cap = dinfo->cfg.pcie.pcie_location; 2208 if (cap == 0) 2209 return (0); 2210 val = pci_read_config(dev, cap + PCIER_DEVICE_CTL, 2); 2211 val &= PCIEM_CTL_RELAXED_ORD_ENABLE; 2212 return (val != 0); 2213 } 2214 2215 int 2216 pci_get_max_payload(device_t dev) 2217 { 2218 struct pci_devinfo *dinfo = device_get_ivars(dev); 2219 int cap; 2220 uint16_t val; 2221 2222 cap = dinfo->cfg.pcie.pcie_location; 2223 if (cap == 0) 2224 return (0); 2225 val = pci_read_config(dev, cap + PCIER_DEVICE_CTL, 2); 2226 val &= PCIEM_CTL_MAX_PAYLOAD; 2227 val >>= 5; 2228 return (1 << (val + 7)); 2229 } 2230 2231 int 2232 pci_get_max_read_req(device_t dev) 2233 { 2234 struct pci_devinfo *dinfo = device_get_ivars(dev); 2235 int cap; 2236 uint16_t val; 2237 2238 cap = dinfo->cfg.pcie.pcie_location; 2239 if (cap == 0) 2240 return (0); 2241 val = pci_read_config(dev, cap + PCIER_DEVICE_CTL, 2); 2242 val &= PCIEM_CTL_MAX_READ_REQUEST; 2243 val >>= 12; 2244 return (1 << (val + 7)); 2245 } 2246 2247 int 2248 pci_set_max_read_req(device_t dev, int size) 2249 { 2250 struct pci_devinfo *dinfo = device_get_ivars(dev); 2251 int cap; 2252 uint16_t val; 2253 2254 cap = dinfo->cfg.pcie.pcie_location; 2255 if (cap == 0) 2256 return (0); 2257 if (size < 128) 2258 size = 128; 2259 if (size > 4096) 2260 size = 4096; 2261 size = (1 << (fls(size) - 1)); 2262 val = pci_read_config(dev, cap + PCIER_DEVICE_CTL, 2); 2263 val &= ~PCIEM_CTL_MAX_READ_REQUEST; 2264 val |= (fls(size) - 8) << 12; 2265 pci_write_config(dev, cap + PCIER_DEVICE_CTL, val, 2); 2266 return (size); 2267 } 2268 2269 uint32_t 2270 pcie_read_config(device_t dev, int reg, int width) 2271 { 2272 struct pci_devinfo *dinfo = device_get_ivars(dev); 2273 int cap; 2274 2275 cap = dinfo->cfg.pcie.pcie_location; 2276 if (cap == 0) { 2277 if (width == 2) 2278 return (0xffff); 2279 return (0xffffffff); 2280 } 2281 2282 return (pci_read_config(dev, cap + reg, width)); 2283 } 2284 2285 void 2286 pcie_write_config(device_t dev, int reg, uint32_t value, int width) 2287 { 2288 struct pci_devinfo *dinfo = device_get_ivars(dev); 2289 int cap; 2290 2291 cap = dinfo->cfg.pcie.pcie_location; 2292 if (cap == 0) 2293 return; 2294 pci_write_config(dev, cap + reg, value, width); 2295 } 2296 2297 /* 2298 * Adjusts a PCI-e capability register by clearing the bits in mask 2299 * and setting the bits in (value & mask). Bits not set in mask are 2300 * not adjusted. 2301 * 2302 * Returns the old value on success or all ones on failure. 2303 */ 2304 uint32_t 2305 pcie_adjust_config(device_t dev, int reg, uint32_t mask, uint32_t value, 2306 int width) 2307 { 2308 struct pci_devinfo *dinfo = device_get_ivars(dev); 2309 uint32_t old, new; 2310 int cap; 2311 2312 cap = dinfo->cfg.pcie.pcie_location; 2313 if (cap == 0) { 2314 if (width == 2) 2315 return (0xffff); 2316 return (0xffffffff); 2317 } 2318 2319 old = pci_read_config(dev, cap + reg, width); 2320 new = old & ~mask; 2321 new |= (value & mask); 2322 pci_write_config(dev, cap + reg, new, width); 2323 return (old); 2324 } 2325 2326 /* 2327 * Support for MSI message signalled interrupts. 2328 */ 2329 void 2330 pci_enable_msi_method(device_t dev, device_t child, uint64_t address, 2331 uint16_t data) 2332 { 2333 struct pci_devinfo *dinfo = device_get_ivars(child); 2334 struct pcicfg_msi *msi = &dinfo->cfg.msi; 2335 2336 /* Write data and address values. */ 2337 pci_write_config(child, msi->msi_location + PCIR_MSI_ADDR, 2338 address & 0xffffffff, 4); 2339 if (msi->msi_ctrl & PCIM_MSICTRL_64BIT) { 2340 pci_write_config(child, msi->msi_location + PCIR_MSI_ADDR_HIGH, 2341 address >> 32, 4); 2342 pci_write_config(child, msi->msi_location + PCIR_MSI_DATA_64BIT, 2343 data, 2); 2344 } else 2345 pci_write_config(child, msi->msi_location + PCIR_MSI_DATA, data, 2346 2); 2347 2348 /* Enable MSI in the control register. */ 2349 msi->msi_ctrl |= PCIM_MSICTRL_MSI_ENABLE; 2350 pci_write_config(child, msi->msi_location + PCIR_MSI_CTRL, 2351 msi->msi_ctrl, 2); 2352 2353 /* Enable MSI -> HT mapping. */ 2354 pci_ht_map_msi(child, address); 2355 } 2356 2357 void 2358 pci_disable_msi_method(device_t dev, device_t child) 2359 { 2360 struct pci_devinfo *dinfo = device_get_ivars(child); 2361 struct pcicfg_msi *msi = &dinfo->cfg.msi; 2362 2363 /* Disable MSI -> HT mapping. */ 2364 pci_ht_map_msi(child, 0); 2365 2366 /* Disable MSI in the control register. */ 2367 msi->msi_ctrl &= ~PCIM_MSICTRL_MSI_ENABLE; 2368 pci_write_config(child, msi->msi_location + PCIR_MSI_CTRL, 2369 msi->msi_ctrl, 2); 2370 } 2371 2372 /* 2373 * Restore MSI registers during resume. If MSI is enabled then 2374 * restore the data and address registers in addition to the control 2375 * register. 2376 */ 2377 static void 2378 pci_resume_msi(device_t dev) 2379 { 2380 struct pci_devinfo *dinfo = device_get_ivars(dev); 2381 struct pcicfg_msi *msi = &dinfo->cfg.msi; 2382 uint64_t address; 2383 uint16_t data; 2384 2385 if (msi->msi_ctrl & PCIM_MSICTRL_MSI_ENABLE) { 2386 address = msi->msi_addr; 2387 data = msi->msi_data; 2388 pci_write_config(dev, msi->msi_location + PCIR_MSI_ADDR, 2389 address & 0xffffffff, 4); 2390 if (msi->msi_ctrl & PCIM_MSICTRL_64BIT) { 2391 pci_write_config(dev, msi->msi_location + 2392 PCIR_MSI_ADDR_HIGH, address >> 32, 4); 2393 pci_write_config(dev, msi->msi_location + 2394 PCIR_MSI_DATA_64BIT, data, 2); 2395 } else 2396 pci_write_config(dev, msi->msi_location + PCIR_MSI_DATA, 2397 data, 2); 2398 } 2399 pci_write_config(dev, msi->msi_location + PCIR_MSI_CTRL, msi->msi_ctrl, 2400 2); 2401 } 2402 2403 static int 2404 pci_remap_intr_method(device_t bus, device_t dev, u_int irq) 2405 { 2406 struct pci_devinfo *dinfo = device_get_ivars(dev); 2407 pcicfgregs *cfg = &dinfo->cfg; 2408 struct resource_list_entry *rle; 2409 struct msix_table_entry *mte; 2410 struct msix_vector *mv; 2411 uint64_t addr; 2412 uint32_t data; 2413 int error, i, j; 2414 2415 /* 2416 * Handle MSI first. We try to find this IRQ among our list 2417 * of MSI IRQs. If we find it, we request updated address and 2418 * data registers and apply the results. 2419 */ 2420 if (cfg->msi.msi_alloc > 0) { 2421 /* If we don't have any active handlers, nothing to do. */ 2422 if (cfg->msi.msi_handlers == 0) 2423 return (0); 2424 for (i = 0; i < cfg->msi.msi_alloc; i++) { 2425 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, 2426 i + 1); 2427 if (rle->start == irq) { 2428 error = PCIB_MAP_MSI(device_get_parent(bus), 2429 dev, irq, &addr, &data); 2430 if (error) 2431 return (error); 2432 pci_disable_msi(dev); 2433 dinfo->cfg.msi.msi_addr = addr; 2434 dinfo->cfg.msi.msi_data = data; 2435 pci_enable_msi(dev, addr, data); 2436 return (0); 2437 } 2438 } 2439 return (ENOENT); 2440 } 2441 2442 /* 2443 * For MSI-X, we check to see if we have this IRQ. If we do, 2444 * we request the updated mapping info. If that works, we go 2445 * through all the slots that use this IRQ and update them. 2446 */ 2447 if (cfg->msix.msix_alloc > 0) { 2448 bool found = false; 2449 2450 for (i = 0; i < cfg->msix.msix_alloc; i++) { 2451 mv = &cfg->msix.msix_vectors[i]; 2452 if (mv->mv_irq == irq) { 2453 error = PCIB_MAP_MSI(device_get_parent(bus), 2454 dev, irq, &addr, &data); 2455 if (error) 2456 return (error); 2457 mv->mv_address = addr; 2458 mv->mv_data = data; 2459 for (j = 0; j < cfg->msix.msix_table_len; j++) { 2460 mte = &cfg->msix.msix_table[j]; 2461 if (mte->mte_vector != i + 1) 2462 continue; 2463 if (mte->mte_handlers == 0) 2464 continue; 2465 pci_mask_msix(dev, j); 2466 pci_enable_msix(dev, j, addr, data); 2467 pci_unmask_msix(dev, j); 2468 } 2469 found = true; 2470 } 2471 } 2472 return (found ? 0 : ENOENT); 2473 } 2474 2475 return (ENOENT); 2476 } 2477 2478 /* 2479 * Returns true if the specified device is blacklisted because MSI 2480 * doesn't work. 2481 */ 2482 int 2483 pci_msi_device_blacklisted(device_t dev) 2484 { 2485 2486 if (!pci_honor_msi_blacklist) 2487 return (0); 2488 2489 return (pci_has_quirk(pci_get_devid(dev), PCI_QUIRK_DISABLE_MSI)); 2490 } 2491 2492 /* 2493 * Determine if MSI is blacklisted globally on this system. Currently, 2494 * we just check for blacklisted chipsets as represented by the 2495 * host-PCI bridge at device 0:0:0. In the future, it may become 2496 * necessary to check other system attributes, such as the kenv values 2497 * that give the motherboard manufacturer and model number. 2498 */ 2499 static int 2500 pci_msi_blacklisted(void) 2501 { 2502 device_t dev; 2503 2504 if (!pci_honor_msi_blacklist) 2505 return (0); 2506 2507 /* Blacklist all non-PCI-express and non-PCI-X chipsets. */ 2508 if (!(pcie_chipset || pcix_chipset)) { 2509 if (vm_guest != VM_GUEST_NO) { 2510 /* 2511 * Whitelist older chipsets in virtual 2512 * machines known to support MSI. 2513 */ 2514 dev = pci_find_bsf(0, 0, 0); 2515 if (dev != NULL) 2516 return (!pci_has_quirk(pci_get_devid(dev), 2517 PCI_QUIRK_ENABLE_MSI_VM)); 2518 } 2519 return (1); 2520 } 2521 2522 dev = pci_find_bsf(0, 0, 0); 2523 if (dev != NULL) 2524 return (pci_msi_device_blacklisted(dev)); 2525 return (0); 2526 } 2527 2528 /* 2529 * Returns true if the specified device is blacklisted because MSI-X 2530 * doesn't work. Note that this assumes that if MSI doesn't work, 2531 * MSI-X doesn't either. 2532 */ 2533 int 2534 pci_msix_device_blacklisted(device_t dev) 2535 { 2536 2537 if (!pci_honor_msi_blacklist) 2538 return (0); 2539 2540 if (pci_has_quirk(pci_get_devid(dev), PCI_QUIRK_DISABLE_MSIX)) 2541 return (1); 2542 2543 return (pci_msi_device_blacklisted(dev)); 2544 } 2545 2546 /* 2547 * Determine if MSI-X is blacklisted globally on this system. If MSI 2548 * is blacklisted, assume that MSI-X is as well. Check for additional 2549 * chipsets where MSI works but MSI-X does not. 2550 */ 2551 static int 2552 pci_msix_blacklisted(void) 2553 { 2554 device_t dev; 2555 2556 if (!pci_honor_msi_blacklist) 2557 return (0); 2558 2559 dev = pci_find_bsf(0, 0, 0); 2560 if (dev != NULL && pci_has_quirk(pci_get_devid(dev), 2561 PCI_QUIRK_DISABLE_MSIX)) 2562 return (1); 2563 2564 return (pci_msi_blacklisted()); 2565 } 2566 2567 /* 2568 * Attempt to allocate *count MSI messages. The actual number allocated is 2569 * returned in *count. After this function returns, each message will be 2570 * available to the driver as SYS_RES_IRQ resources starting at a rid 1. 2571 */ 2572 int 2573 pci_alloc_msi_method(device_t dev, device_t child, int *count) 2574 { 2575 struct pci_devinfo *dinfo = device_get_ivars(child); 2576 pcicfgregs *cfg = &dinfo->cfg; 2577 struct resource_list_entry *rle; 2578 int actual, error, i, irqs[32]; 2579 uint16_t ctrl; 2580 2581 /* Don't let count == 0 get us into trouble. */ 2582 if (*count == 0) 2583 return (EINVAL); 2584 2585 /* If rid 0 is allocated, then fail. */ 2586 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, 0); 2587 if (rle != NULL && rle->res != NULL) 2588 return (ENXIO); 2589 2590 /* Already have allocated messages? */ 2591 if (cfg->msi.msi_alloc != 0 || cfg->msix.msix_alloc != 0) 2592 return (ENXIO); 2593 2594 /* If MSI is blacklisted for this system, fail. */ 2595 if (pci_msi_blacklisted()) 2596 return (ENXIO); 2597 2598 /* MSI capability present? */ 2599 if (cfg->msi.msi_location == 0 || !pci_do_msi) 2600 return (ENODEV); 2601 2602 if (bootverbose) 2603 device_printf(child, 2604 "attempting to allocate %d MSI vectors (%d supported)\n", 2605 *count, cfg->msi.msi_msgnum); 2606 2607 /* Don't ask for more than the device supports. */ 2608 actual = min(*count, cfg->msi.msi_msgnum); 2609 2610 /* Don't ask for more than 32 messages. */ 2611 actual = min(actual, 32); 2612 2613 /* MSI requires power of 2 number of messages. */ 2614 if (!powerof2(actual)) 2615 return (EINVAL); 2616 2617 for (;;) { 2618 /* Try to allocate N messages. */ 2619 error = PCIB_ALLOC_MSI(device_get_parent(dev), child, actual, 2620 actual, irqs); 2621 if (error == 0) 2622 break; 2623 if (actual == 1) 2624 return (error); 2625 2626 /* Try N / 2. */ 2627 actual >>= 1; 2628 } 2629 2630 /* 2631 * We now have N actual messages mapped onto SYS_RES_IRQ 2632 * resources in the irqs[] array, so add new resources 2633 * starting at rid 1. 2634 */ 2635 for (i = 0; i < actual; i++) 2636 resource_list_add(&dinfo->resources, SYS_RES_IRQ, i + 1, 2637 irqs[i], irqs[i], 1); 2638 2639 if (bootverbose) { 2640 if (actual == 1) 2641 device_printf(child, "using IRQ %d for MSI\n", irqs[0]); 2642 else { 2643 int run; 2644 2645 /* 2646 * Be fancy and try to print contiguous runs 2647 * of IRQ values as ranges. 'run' is true if 2648 * we are in a range. 2649 */ 2650 device_printf(child, "using IRQs %d", irqs[0]); 2651 run = 0; 2652 for (i = 1; i < actual; i++) { 2653 /* Still in a run? */ 2654 if (irqs[i] == irqs[i - 1] + 1) { 2655 run = 1; 2656 continue; 2657 } 2658 2659 /* Finish previous range. */ 2660 if (run) { 2661 printf("-%d", irqs[i - 1]); 2662 run = 0; 2663 } 2664 2665 /* Start new range. */ 2666 printf(",%d", irqs[i]); 2667 } 2668 2669 /* Unfinished range? */ 2670 if (run) 2671 printf("-%d", irqs[actual - 1]); 2672 printf(" for MSI\n"); 2673 } 2674 } 2675 2676 /* Update control register with actual count. */ 2677 ctrl = cfg->msi.msi_ctrl; 2678 ctrl &= ~PCIM_MSICTRL_MME_MASK; 2679 ctrl |= (ffs(actual) - 1) << 4; 2680 cfg->msi.msi_ctrl = ctrl; 2681 pci_write_config(child, cfg->msi.msi_location + PCIR_MSI_CTRL, ctrl, 2); 2682 2683 /* Update counts of alloc'd messages. */ 2684 cfg->msi.msi_alloc = actual; 2685 cfg->msi.msi_handlers = 0; 2686 *count = actual; 2687 return (0); 2688 } 2689 2690 /* Release the MSI messages associated with this device. */ 2691 int 2692 pci_release_msi_method(device_t dev, device_t child) 2693 { 2694 struct pci_devinfo *dinfo = device_get_ivars(child); 2695 struct pcicfg_msi *msi = &dinfo->cfg.msi; 2696 struct resource_list_entry *rle; 2697 int error, i, irqs[32]; 2698 2699 /* Try MSI-X first. */ 2700 error = pci_release_msix(dev, child); 2701 if (error != ENODEV) 2702 return (error); 2703 2704 /* Do we have any messages to release? */ 2705 if (msi->msi_alloc == 0) 2706 return (ENODEV); 2707 KASSERT(msi->msi_alloc <= 32, ("more than 32 alloc'd messages")); 2708 2709 /* Make sure none of the resources are allocated. */ 2710 if (msi->msi_handlers > 0) 2711 return (EBUSY); 2712 for (i = 0; i < msi->msi_alloc; i++) { 2713 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, i + 1); 2714 KASSERT(rle != NULL, ("missing MSI resource")); 2715 if (rle->res != NULL) 2716 return (EBUSY); 2717 irqs[i] = rle->start; 2718 } 2719 2720 /* Update control register with 0 count. */ 2721 KASSERT(!(msi->msi_ctrl & PCIM_MSICTRL_MSI_ENABLE), 2722 ("%s: MSI still enabled", __func__)); 2723 msi->msi_ctrl &= ~PCIM_MSICTRL_MME_MASK; 2724 pci_write_config(child, msi->msi_location + PCIR_MSI_CTRL, 2725 msi->msi_ctrl, 2); 2726 2727 /* Release the messages. */ 2728 PCIB_RELEASE_MSI(device_get_parent(dev), child, msi->msi_alloc, irqs); 2729 for (i = 0; i < msi->msi_alloc; i++) 2730 resource_list_delete(&dinfo->resources, SYS_RES_IRQ, i + 1); 2731 2732 /* Update alloc count. */ 2733 msi->msi_alloc = 0; 2734 msi->msi_addr = 0; 2735 msi->msi_data = 0; 2736 return (0); 2737 } 2738 2739 /* 2740 * Return the max supported MSI messages this device supports. 2741 * Basically, assuming the MD code can alloc messages, this function 2742 * should return the maximum value that pci_alloc_msi() can return. 2743 * Thus, it is subject to the tunables, etc. 2744 */ 2745 int 2746 pci_msi_count_method(device_t dev, device_t child) 2747 { 2748 struct pci_devinfo *dinfo = device_get_ivars(child); 2749 struct pcicfg_msi *msi = &dinfo->cfg.msi; 2750 2751 if (pci_do_msi && msi->msi_location != 0) 2752 return (msi->msi_msgnum); 2753 return (0); 2754 } 2755 2756 /* free pcicfgregs structure and all depending data structures */ 2757 2758 int 2759 pci_freecfg(struct pci_devinfo *dinfo) 2760 { 2761 struct devlist *devlist_head; 2762 struct pci_map *pm, *next; 2763 2764 devlist_head = &pci_devq; 2765 2766 if (dinfo->cfg.vpd.vpd_reg) 2767 vpd_free(&dinfo->cfg.vpd); 2768 2769 STAILQ_FOREACH_SAFE(pm, &dinfo->cfg.maps, pm_link, next) { 2770 free(pm, M_DEVBUF); 2771 } 2772 STAILQ_REMOVE(devlist_head, dinfo, pci_devinfo, pci_links); 2773 free(dinfo, M_DEVBUF); 2774 2775 /* increment the generation count */ 2776 pci_generation++; 2777 2778 /* we're losing one device */ 2779 pci_numdevs--; 2780 return (0); 2781 } 2782 2783 /* 2784 * PCI power manangement 2785 */ 2786 int 2787 pci_set_powerstate_method(device_t dev, device_t child, int state) 2788 { 2789 struct pci_devinfo *dinfo = device_get_ivars(child); 2790 pcicfgregs *cfg = &dinfo->cfg; 2791 uint16_t status; 2792 int oldstate, highest, delay; 2793 2794 if (cfg->pp.pp_cap == 0) 2795 return (EOPNOTSUPP); 2796 2797 /* 2798 * Optimize a no state change request away. While it would be OK to 2799 * write to the hardware in theory, some devices have shown odd 2800 * behavior when going from D3 -> D3. 2801 */ 2802 oldstate = pci_get_powerstate(child); 2803 if (oldstate == state) 2804 return (0); 2805 2806 /* 2807 * The PCI power management specification states that after a state 2808 * transition between PCI power states, system software must 2809 * guarantee a minimal delay before the function accesses the device. 2810 * Compute the worst case delay that we need to guarantee before we 2811 * access the device. Many devices will be responsive much more 2812 * quickly than this delay, but there are some that don't respond 2813 * instantly to state changes. Transitions to/from D3 state require 2814 * 10ms, while D2 requires 200us, and D0/1 require none. The delay 2815 * is done below with DELAY rather than a sleeper function because 2816 * this function can be called from contexts where we cannot sleep. 2817 */ 2818 highest = (oldstate > state) ? oldstate : state; 2819 if (highest == PCI_POWERSTATE_D3) 2820 delay = 10000; 2821 else if (highest == PCI_POWERSTATE_D2) 2822 delay = 200; 2823 else 2824 delay = 0; 2825 status = PCI_READ_CONFIG(dev, child, cfg->pp.pp_status, 2) 2826 & ~PCIM_PSTAT_DMASK; 2827 switch (state) { 2828 case PCI_POWERSTATE_D0: 2829 status |= PCIM_PSTAT_D0; 2830 break; 2831 case PCI_POWERSTATE_D1: 2832 if ((cfg->pp.pp_cap & PCIM_PCAP_D1SUPP) == 0) 2833 return (EOPNOTSUPP); 2834 status |= PCIM_PSTAT_D1; 2835 break; 2836 case PCI_POWERSTATE_D2: 2837 if ((cfg->pp.pp_cap & PCIM_PCAP_D2SUPP) == 0) 2838 return (EOPNOTSUPP); 2839 status |= PCIM_PSTAT_D2; 2840 break; 2841 case PCI_POWERSTATE_D3: 2842 status |= PCIM_PSTAT_D3; 2843 break; 2844 default: 2845 return (EINVAL); 2846 } 2847 2848 if (bootverbose) 2849 pci_printf(cfg, "Transition from D%d to D%d\n", oldstate, 2850 state); 2851 2852 PCI_WRITE_CONFIG(dev, child, cfg->pp.pp_status, status, 2); 2853 if (delay) 2854 DELAY(delay); 2855 return (0); 2856 } 2857 2858 int 2859 pci_get_powerstate_method(device_t dev, device_t child) 2860 { 2861 struct pci_devinfo *dinfo = device_get_ivars(child); 2862 pcicfgregs *cfg = &dinfo->cfg; 2863 uint16_t status; 2864 int result; 2865 2866 if (cfg->pp.pp_cap != 0) { 2867 status = PCI_READ_CONFIG(dev, child, cfg->pp.pp_status, 2); 2868 switch (status & PCIM_PSTAT_DMASK) { 2869 case PCIM_PSTAT_D0: 2870 result = PCI_POWERSTATE_D0; 2871 break; 2872 case PCIM_PSTAT_D1: 2873 result = PCI_POWERSTATE_D1; 2874 break; 2875 case PCIM_PSTAT_D2: 2876 result = PCI_POWERSTATE_D2; 2877 break; 2878 case PCIM_PSTAT_D3: 2879 result = PCI_POWERSTATE_D3; 2880 break; 2881 default: 2882 result = PCI_POWERSTATE_UNKNOWN; 2883 break; 2884 } 2885 } else { 2886 /* No support, device is always at D0 */ 2887 result = PCI_POWERSTATE_D0; 2888 } 2889 return (result); 2890 } 2891 2892 /* 2893 * Some convenience functions for PCI device drivers. 2894 */ 2895 2896 static __inline void 2897 pci_set_command_bit(device_t dev, device_t child, uint16_t bit) 2898 { 2899 uint16_t command; 2900 2901 command = PCI_READ_CONFIG(dev, child, PCIR_COMMAND, 2); 2902 command |= bit; 2903 PCI_WRITE_CONFIG(dev, child, PCIR_COMMAND, command, 2); 2904 } 2905 2906 static __inline void 2907 pci_clear_command_bit(device_t dev, device_t child, uint16_t bit) 2908 { 2909 uint16_t command; 2910 2911 command = PCI_READ_CONFIG(dev, child, PCIR_COMMAND, 2); 2912 command &= ~bit; 2913 PCI_WRITE_CONFIG(dev, child, PCIR_COMMAND, command, 2); 2914 } 2915 2916 int 2917 pci_enable_busmaster_method(device_t dev, device_t child) 2918 { 2919 pci_set_command_bit(dev, child, PCIM_CMD_BUSMASTEREN); 2920 return (0); 2921 } 2922 2923 int 2924 pci_disable_busmaster_method(device_t dev, device_t child) 2925 { 2926 pci_clear_command_bit(dev, child, PCIM_CMD_BUSMASTEREN); 2927 return (0); 2928 } 2929 2930 int 2931 pci_enable_io_method(device_t dev, device_t child, int space) 2932 { 2933 uint16_t bit; 2934 2935 switch(space) { 2936 case SYS_RES_IOPORT: 2937 bit = PCIM_CMD_PORTEN; 2938 break; 2939 case SYS_RES_MEMORY: 2940 bit = PCIM_CMD_MEMEN; 2941 break; 2942 default: 2943 return (EINVAL); 2944 } 2945 pci_set_command_bit(dev, child, bit); 2946 return (0); 2947 } 2948 2949 int 2950 pci_disable_io_method(device_t dev, device_t child, int space) 2951 { 2952 uint16_t bit; 2953 2954 switch(space) { 2955 case SYS_RES_IOPORT: 2956 bit = PCIM_CMD_PORTEN; 2957 break; 2958 case SYS_RES_MEMORY: 2959 bit = PCIM_CMD_MEMEN; 2960 break; 2961 default: 2962 return (EINVAL); 2963 } 2964 pci_clear_command_bit(dev, child, bit); 2965 return (0); 2966 } 2967 2968 /* 2969 * New style pci driver. Parent device is either a pci-host-bridge or a 2970 * pci-pci-bridge. Both kinds are represented by instances of pcib. 2971 */ 2972 2973 void 2974 pci_print_verbose(struct pci_devinfo *dinfo) 2975 { 2976 2977 if (bootverbose) { 2978 pcicfgregs *cfg = &dinfo->cfg; 2979 2980 printf("found->\tvendor=0x%04x, dev=0x%04x, revid=0x%02x\n", 2981 cfg->vendor, cfg->device, cfg->revid); 2982 printf("\tdomain=%d, bus=%d, slot=%d, func=%d\n", 2983 cfg->domain, cfg->bus, cfg->slot, cfg->func); 2984 printf("\tclass=%02x-%02x-%02x, hdrtype=0x%02x, mfdev=%d\n", 2985 cfg->baseclass, cfg->subclass, cfg->progif, cfg->hdrtype, 2986 cfg->mfdev); 2987 printf("\tcmdreg=0x%04x, statreg=0x%04x, cachelnsz=%d (dwords)\n", 2988 cfg->cmdreg, cfg->statreg, cfg->cachelnsz); 2989 printf("\tlattimer=0x%02x (%d ns), mingnt=0x%02x (%d ns), maxlat=0x%02x (%d ns)\n", 2990 cfg->lattimer, cfg->lattimer * 30, cfg->mingnt, 2991 cfg->mingnt * 250, cfg->maxlat, cfg->maxlat * 250); 2992 if (cfg->intpin > 0) 2993 printf("\tintpin=%c, irq=%d\n", 2994 cfg->intpin +'a' -1, cfg->intline); 2995 if (cfg->pp.pp_cap) { 2996 uint16_t status; 2997 2998 status = pci_read_config(cfg->dev, cfg->pp.pp_status, 2); 2999 printf("\tpowerspec %d supports D0%s%s D3 current D%d\n", 3000 cfg->pp.pp_cap & PCIM_PCAP_SPEC, 3001 cfg->pp.pp_cap & PCIM_PCAP_D1SUPP ? " D1" : "", 3002 cfg->pp.pp_cap & PCIM_PCAP_D2SUPP ? " D2" : "", 3003 status & PCIM_PSTAT_DMASK); 3004 } 3005 if (cfg->msi.msi_location) { 3006 int ctrl; 3007 3008 ctrl = cfg->msi.msi_ctrl; 3009 printf("\tMSI supports %d message%s%s%s\n", 3010 cfg->msi.msi_msgnum, 3011 (cfg->msi.msi_msgnum == 1) ? "" : "s", 3012 (ctrl & PCIM_MSICTRL_64BIT) ? ", 64 bit" : "", 3013 (ctrl & PCIM_MSICTRL_VECTOR) ? ", vector masks":""); 3014 } 3015 if (cfg->msix.msix_location) { 3016 printf("\tMSI-X supports %d message%s ", 3017 cfg->msix.msix_msgnum, 3018 (cfg->msix.msix_msgnum == 1) ? "" : "s"); 3019 if (cfg->msix.msix_table_bar == cfg->msix.msix_pba_bar) 3020 printf("in map 0x%x\n", 3021 cfg->msix.msix_table_bar); 3022 else 3023 printf("in maps 0x%x and 0x%x\n", 3024 cfg->msix.msix_table_bar, 3025 cfg->msix.msix_pba_bar); 3026 } 3027 } 3028 } 3029 3030 static int 3031 pci_porten(device_t dev) 3032 { 3033 return (pci_read_config(dev, PCIR_COMMAND, 2) & PCIM_CMD_PORTEN) != 0; 3034 } 3035 3036 static int 3037 pci_memen(device_t dev) 3038 { 3039 return (pci_read_config(dev, PCIR_COMMAND, 2) & PCIM_CMD_MEMEN) != 0; 3040 } 3041 3042 void 3043 pci_read_bar(device_t dev, int reg, pci_addr_t *mapp, pci_addr_t *testvalp, 3044 int *bar64) 3045 { 3046 struct pci_devinfo *dinfo; 3047 pci_addr_t map, testval; 3048 int ln2range; 3049 uint16_t cmd; 3050 3051 /* 3052 * The device ROM BAR is special. It is always a 32-bit 3053 * memory BAR. Bit 0 is special and should not be set when 3054 * sizing the BAR. 3055 */ 3056 dinfo = device_get_ivars(dev); 3057 if (PCIR_IS_BIOS(&dinfo->cfg, reg)) { 3058 map = pci_read_config(dev, reg, 4); 3059 pci_write_config(dev, reg, 0xfffffffe, 4); 3060 testval = pci_read_config(dev, reg, 4); 3061 pci_write_config(dev, reg, map, 4); 3062 *mapp = map; 3063 *testvalp = testval; 3064 if (bar64 != NULL) 3065 *bar64 = 0; 3066 return; 3067 } 3068 3069 map = pci_read_config(dev, reg, 4); 3070 ln2range = pci_maprange(map); 3071 if (ln2range == 64) 3072 map |= (pci_addr_t)pci_read_config(dev, reg + 4, 4) << 32; 3073 3074 /* 3075 * Disable decoding via the command register before 3076 * determining the BAR's length since we will be placing it in 3077 * a weird state. 3078 */ 3079 cmd = pci_read_config(dev, PCIR_COMMAND, 2); 3080 pci_write_config(dev, PCIR_COMMAND, 3081 cmd & ~(PCI_BAR_MEM(map) ? PCIM_CMD_MEMEN : PCIM_CMD_PORTEN), 2); 3082 3083 /* 3084 * Determine the BAR's length by writing all 1's. The bottom 3085 * log_2(size) bits of the BAR will stick as 0 when we read 3086 * the value back. 3087 * 3088 * NB: according to the PCI Local Bus Specification, rev. 3.0: 3089 * "Software writes 0FFFFFFFFh to both registers, reads them back, 3090 * and combines the result into a 64-bit value." (section 6.2.5.1) 3091 * 3092 * Writes to both registers must be performed before attempting to 3093 * read back the size value. 3094 */ 3095 testval = 0; 3096 pci_write_config(dev, reg, 0xffffffff, 4); 3097 if (ln2range == 64) { 3098 pci_write_config(dev, reg + 4, 0xffffffff, 4); 3099 testval |= (pci_addr_t)pci_read_config(dev, reg + 4, 4) << 32; 3100 } 3101 testval |= pci_read_config(dev, reg, 4); 3102 3103 /* 3104 * Restore the original value of the BAR. We may have reprogrammed 3105 * the BAR of the low-level console device and when booting verbose, 3106 * we need the console device addressable. 3107 */ 3108 pci_write_config(dev, reg, map, 4); 3109 if (ln2range == 64) 3110 pci_write_config(dev, reg + 4, map >> 32, 4); 3111 pci_write_config(dev, PCIR_COMMAND, cmd, 2); 3112 3113 *mapp = map; 3114 *testvalp = testval; 3115 if (bar64 != NULL) 3116 *bar64 = (ln2range == 64); 3117 } 3118 3119 static void 3120 pci_write_bar(device_t dev, struct pci_map *pm, pci_addr_t base) 3121 { 3122 struct pci_devinfo *dinfo; 3123 int ln2range; 3124 3125 /* The device ROM BAR is always a 32-bit memory BAR. */ 3126 dinfo = device_get_ivars(dev); 3127 if (PCIR_IS_BIOS(&dinfo->cfg, pm->pm_reg)) 3128 ln2range = 32; 3129 else 3130 ln2range = pci_maprange(pm->pm_value); 3131 pci_write_config(dev, pm->pm_reg, base, 4); 3132 if (ln2range == 64) 3133 pci_write_config(dev, pm->pm_reg + 4, base >> 32, 4); 3134 pm->pm_value = pci_read_config(dev, pm->pm_reg, 4); 3135 if (ln2range == 64) 3136 pm->pm_value |= (pci_addr_t)pci_read_config(dev, 3137 pm->pm_reg + 4, 4) << 32; 3138 } 3139 3140 struct pci_map * 3141 pci_find_bar(device_t dev, int reg) 3142 { 3143 struct pci_devinfo *dinfo; 3144 struct pci_map *pm; 3145 3146 dinfo = device_get_ivars(dev); 3147 STAILQ_FOREACH(pm, &dinfo->cfg.maps, pm_link) { 3148 if (pm->pm_reg == reg) 3149 return (pm); 3150 } 3151 return (NULL); 3152 } 3153 3154 struct pci_map * 3155 pci_first_bar(device_t dev) 3156 { 3157 struct pci_devinfo *dinfo; 3158 3159 dinfo = device_get_ivars(dev); 3160 return (STAILQ_FIRST(&dinfo->cfg.maps)); 3161 } 3162 3163 struct pci_map * 3164 pci_next_bar(struct pci_map *pm) 3165 { 3166 return (STAILQ_NEXT(pm, pm_link)); 3167 } 3168 3169 int 3170 pci_bar_enabled(device_t dev, struct pci_map *pm) 3171 { 3172 struct pci_devinfo *dinfo; 3173 uint16_t cmd; 3174 3175 dinfo = device_get_ivars(dev); 3176 if (PCIR_IS_BIOS(&dinfo->cfg, pm->pm_reg) && 3177 !(pm->pm_value & PCIM_BIOS_ENABLE)) 3178 return (0); 3179 #ifdef PCI_IOV 3180 if ((dinfo->cfg.flags & PCICFG_VF) != 0) { 3181 struct pcicfg_iov *iov; 3182 3183 iov = dinfo->cfg.iov; 3184 cmd = pci_read_config(iov->iov_pf, 3185 iov->iov_pos + PCIR_SRIOV_CTL, 2); 3186 return ((cmd & PCIM_SRIOV_VF_MSE) != 0); 3187 } 3188 #endif 3189 cmd = pci_read_config(dev, PCIR_COMMAND, 2); 3190 if (PCIR_IS_BIOS(&dinfo->cfg, pm->pm_reg) || PCI_BAR_MEM(pm->pm_value)) 3191 return ((cmd & PCIM_CMD_MEMEN) != 0); 3192 else 3193 return ((cmd & PCIM_CMD_PORTEN) != 0); 3194 } 3195 3196 struct pci_map * 3197 pci_add_bar(device_t dev, int reg, pci_addr_t value, pci_addr_t size) 3198 { 3199 struct pci_devinfo *dinfo; 3200 struct pci_map *pm, *prev; 3201 3202 dinfo = device_get_ivars(dev); 3203 pm = malloc(sizeof(*pm), M_DEVBUF, M_WAITOK | M_ZERO); 3204 pm->pm_reg = reg; 3205 pm->pm_value = value; 3206 pm->pm_size = size; 3207 STAILQ_FOREACH(prev, &dinfo->cfg.maps, pm_link) { 3208 KASSERT(prev->pm_reg != pm->pm_reg, ("duplicate map %02x", 3209 reg)); 3210 if (STAILQ_NEXT(prev, pm_link) == NULL || 3211 STAILQ_NEXT(prev, pm_link)->pm_reg > pm->pm_reg) 3212 break; 3213 } 3214 if (prev != NULL) 3215 STAILQ_INSERT_AFTER(&dinfo->cfg.maps, prev, pm, pm_link); 3216 else 3217 STAILQ_INSERT_TAIL(&dinfo->cfg.maps, pm, pm_link); 3218 return (pm); 3219 } 3220 3221 static void 3222 pci_restore_bars(device_t dev) 3223 { 3224 struct pci_devinfo *dinfo; 3225 struct pci_map *pm; 3226 int ln2range; 3227 3228 dinfo = device_get_ivars(dev); 3229 STAILQ_FOREACH(pm, &dinfo->cfg.maps, pm_link) { 3230 if (PCIR_IS_BIOS(&dinfo->cfg, pm->pm_reg)) 3231 ln2range = 32; 3232 else 3233 ln2range = pci_maprange(pm->pm_value); 3234 pci_write_config(dev, pm->pm_reg, pm->pm_value, 4); 3235 if (ln2range == 64) 3236 pci_write_config(dev, pm->pm_reg + 4, 3237 pm->pm_value >> 32, 4); 3238 } 3239 } 3240 3241 /* 3242 * Add a resource based on a pci map register. Return 1 if the map 3243 * register is a 32bit map register or 2 if it is a 64bit register. 3244 */ 3245 static int 3246 pci_add_map(device_t bus, device_t dev, int reg, struct resource_list *rl, 3247 int force, int prefetch) 3248 { 3249 struct pci_map *pm; 3250 pci_addr_t base, map, testval; 3251 pci_addr_t start, end, count; 3252 int barlen, basezero, flags, maprange, mapsize, type; 3253 uint16_t cmd; 3254 struct resource *res; 3255 3256 /* 3257 * The BAR may already exist if the device is a CardBus card 3258 * whose CIS is stored in this BAR. 3259 */ 3260 pm = pci_find_bar(dev, reg); 3261 if (pm != NULL) { 3262 maprange = pci_maprange(pm->pm_value); 3263 barlen = maprange == 64 ? 2 : 1; 3264 return (barlen); 3265 } 3266 3267 pci_read_bar(dev, reg, &map, &testval, NULL); 3268 if (PCI_BAR_MEM(map)) { 3269 type = SYS_RES_MEMORY; 3270 if (map & PCIM_BAR_MEM_PREFETCH) 3271 prefetch = 1; 3272 } else 3273 type = SYS_RES_IOPORT; 3274 mapsize = pci_mapsize(testval); 3275 base = pci_mapbase(map); 3276 #ifdef __PCI_BAR_ZERO_VALID 3277 basezero = 0; 3278 #else 3279 basezero = base == 0; 3280 #endif 3281 maprange = pci_maprange(map); 3282 barlen = maprange == 64 ? 2 : 1; 3283 3284 /* 3285 * For I/O registers, if bottom bit is set, and the next bit up 3286 * isn't clear, we know we have a BAR that doesn't conform to the 3287 * spec, so ignore it. Also, sanity check the size of the data 3288 * areas to the type of memory involved. Memory must be at least 3289 * 16 bytes in size, while I/O ranges must be at least 4. 3290 */ 3291 if (PCI_BAR_IO(testval) && (testval & PCIM_BAR_IO_RESERVED) != 0) 3292 return (barlen); 3293 if ((type == SYS_RES_MEMORY && mapsize < 4) || 3294 (type == SYS_RES_IOPORT && mapsize < 2)) 3295 return (barlen); 3296 3297 /* Save a record of this BAR. */ 3298 pm = pci_add_bar(dev, reg, map, mapsize); 3299 if (bootverbose) { 3300 printf("\tmap[%02x]: type %s, range %2d, base %#jx, size %2d", 3301 reg, pci_maptype(map), maprange, (uintmax_t)base, mapsize); 3302 if (type == SYS_RES_IOPORT && !pci_porten(dev)) 3303 printf(", port disabled\n"); 3304 else if (type == SYS_RES_MEMORY && !pci_memen(dev)) 3305 printf(", memory disabled\n"); 3306 else 3307 printf(", enabled\n"); 3308 } 3309 3310 /* 3311 * If base is 0, then we have problems if this architecture does 3312 * not allow that. It is best to ignore such entries for the 3313 * moment. These will be allocated later if the driver specifically 3314 * requests them. However, some removable buses look better when 3315 * all resources are allocated, so allow '0' to be overridden. 3316 * 3317 * Similarly treat maps whose values is the same as the test value 3318 * read back. These maps have had all f's written to them by the 3319 * BIOS in an attempt to disable the resources. 3320 */ 3321 if (!force && (basezero || map == testval)) 3322 return (barlen); 3323 if ((u_long)base != base) { 3324 device_printf(bus, 3325 "pci%d:%d:%d:%d bar %#x too many address bits", 3326 pci_get_domain(dev), pci_get_bus(dev), pci_get_slot(dev), 3327 pci_get_function(dev), reg); 3328 return (barlen); 3329 } 3330 3331 /* 3332 * This code theoretically does the right thing, but has 3333 * undesirable side effects in some cases where peripherals 3334 * respond oddly to having these bits enabled. Let the user 3335 * be able to turn them off (since pci_enable_io_modes is 1 by 3336 * default). 3337 */ 3338 if (pci_enable_io_modes) { 3339 /* Turn on resources that have been left off by a lazy BIOS */ 3340 if (type == SYS_RES_IOPORT && !pci_porten(dev)) { 3341 cmd = pci_read_config(dev, PCIR_COMMAND, 2); 3342 cmd |= PCIM_CMD_PORTEN; 3343 pci_write_config(dev, PCIR_COMMAND, cmd, 2); 3344 } 3345 if (type == SYS_RES_MEMORY && !pci_memen(dev)) { 3346 cmd = pci_read_config(dev, PCIR_COMMAND, 2); 3347 cmd |= PCIM_CMD_MEMEN; 3348 pci_write_config(dev, PCIR_COMMAND, cmd, 2); 3349 } 3350 } else { 3351 if (type == SYS_RES_IOPORT && !pci_porten(dev)) 3352 return (barlen); 3353 if (type == SYS_RES_MEMORY && !pci_memen(dev)) 3354 return (barlen); 3355 } 3356 3357 count = (pci_addr_t)1 << mapsize; 3358 flags = RF_ALIGNMENT_LOG2(mapsize); 3359 if (prefetch) 3360 flags |= RF_PREFETCHABLE; 3361 if (basezero || base == pci_mapbase(testval) || pci_clear_bars) { 3362 start = 0; /* Let the parent decide. */ 3363 end = ~0; 3364 } else { 3365 start = base; 3366 end = base + count - 1; 3367 } 3368 resource_list_add(rl, type, reg, start, end, count); 3369 3370 /* 3371 * Try to allocate the resource for this BAR from our parent 3372 * so that this resource range is already reserved. The 3373 * driver for this device will later inherit this resource in 3374 * pci_alloc_resource(). 3375 */ 3376 res = resource_list_reserve(rl, bus, dev, type, ®, start, end, count, 3377 flags); 3378 if ((pci_do_realloc_bars 3379 || pci_has_quirk(pci_get_devid(dev), PCI_QUIRK_REALLOC_BAR)) 3380 && res == NULL && (start != 0 || end != ~0)) { 3381 /* 3382 * If the allocation fails, try to allocate a resource for 3383 * this BAR using any available range. The firmware felt 3384 * it was important enough to assign a resource, so don't 3385 * disable decoding if we can help it. 3386 */ 3387 resource_list_delete(rl, type, reg); 3388 resource_list_add(rl, type, reg, 0, ~0, count); 3389 res = resource_list_reserve(rl, bus, dev, type, ®, 0, ~0, 3390 count, flags); 3391 } 3392 if (res == NULL) { 3393 /* 3394 * If the allocation fails, delete the resource list entry 3395 * and disable decoding for this device. 3396 * 3397 * If the driver requests this resource in the future, 3398 * pci_reserve_map() will try to allocate a fresh 3399 * resource range. 3400 */ 3401 resource_list_delete(rl, type, reg); 3402 pci_disable_io(dev, type); 3403 if (bootverbose) 3404 device_printf(bus, 3405 "pci%d:%d:%d:%d bar %#x failed to allocate\n", 3406 pci_get_domain(dev), pci_get_bus(dev), 3407 pci_get_slot(dev), pci_get_function(dev), reg); 3408 } else { 3409 start = rman_get_start(res); 3410 pci_write_bar(dev, pm, start); 3411 } 3412 return (barlen); 3413 } 3414 3415 /* 3416 * For ATA devices we need to decide early what addressing mode to use. 3417 * Legacy demands that the primary and secondary ATA ports sits on the 3418 * same addresses that old ISA hardware did. This dictates that we use 3419 * those addresses and ignore the BAR's if we cannot set PCI native 3420 * addressing mode. 3421 */ 3422 static void 3423 pci_ata_maps(device_t bus, device_t dev, struct resource_list *rl, int force, 3424 uint32_t prefetchmask) 3425 { 3426 int rid, type, progif; 3427 #if 0 3428 /* if this device supports PCI native addressing use it */ 3429 progif = pci_read_config(dev, PCIR_PROGIF, 1); 3430 if ((progif & 0x8a) == 0x8a) { 3431 if (pci_mapbase(pci_read_config(dev, PCIR_BAR(0), 4)) && 3432 pci_mapbase(pci_read_config(dev, PCIR_BAR(2), 4))) { 3433 printf("Trying ATA native PCI addressing mode\n"); 3434 pci_write_config(dev, PCIR_PROGIF, progif | 0x05, 1); 3435 } 3436 } 3437 #endif 3438 progif = pci_read_config(dev, PCIR_PROGIF, 1); 3439 type = SYS_RES_IOPORT; 3440 if (progif & PCIP_STORAGE_IDE_MODEPRIM) { 3441 pci_add_map(bus, dev, PCIR_BAR(0), rl, force, 3442 prefetchmask & (1 << 0)); 3443 pci_add_map(bus, dev, PCIR_BAR(1), rl, force, 3444 prefetchmask & (1 << 1)); 3445 } else { 3446 rid = PCIR_BAR(0); 3447 resource_list_add(rl, type, rid, 0x1f0, 0x1f7, 8); 3448 (void)resource_list_reserve(rl, bus, dev, type, &rid, 0x1f0, 3449 0x1f7, 8, 0); 3450 rid = PCIR_BAR(1); 3451 resource_list_add(rl, type, rid, 0x3f6, 0x3f6, 1); 3452 (void)resource_list_reserve(rl, bus, dev, type, &rid, 0x3f6, 3453 0x3f6, 1, 0); 3454 } 3455 if (progif & PCIP_STORAGE_IDE_MODESEC) { 3456 pci_add_map(bus, dev, PCIR_BAR(2), rl, force, 3457 prefetchmask & (1 << 2)); 3458 pci_add_map(bus, dev, PCIR_BAR(3), rl, force, 3459 prefetchmask & (1 << 3)); 3460 } else { 3461 rid = PCIR_BAR(2); 3462 resource_list_add(rl, type, rid, 0x170, 0x177, 8); 3463 (void)resource_list_reserve(rl, bus, dev, type, &rid, 0x170, 3464 0x177, 8, 0); 3465 rid = PCIR_BAR(3); 3466 resource_list_add(rl, type, rid, 0x376, 0x376, 1); 3467 (void)resource_list_reserve(rl, bus, dev, type, &rid, 0x376, 3468 0x376, 1, 0); 3469 } 3470 pci_add_map(bus, dev, PCIR_BAR(4), rl, force, 3471 prefetchmask & (1 << 4)); 3472 pci_add_map(bus, dev, PCIR_BAR(5), rl, force, 3473 prefetchmask & (1 << 5)); 3474 } 3475 3476 static void 3477 pci_assign_interrupt(device_t bus, device_t dev, int force_route) 3478 { 3479 struct pci_devinfo *dinfo = device_get_ivars(dev); 3480 pcicfgregs *cfg = &dinfo->cfg; 3481 char tunable_name[64]; 3482 int irq; 3483 3484 /* Has to have an intpin to have an interrupt. */ 3485 if (cfg->intpin == 0) 3486 return; 3487 3488 /* Let the user override the IRQ with a tunable. */ 3489 irq = PCI_INVALID_IRQ; 3490 snprintf(tunable_name, sizeof(tunable_name), 3491 "hw.pci%d.%d.%d.INT%c.irq", 3492 cfg->domain, cfg->bus, cfg->slot, cfg->intpin + 'A' - 1); 3493 if (TUNABLE_INT_FETCH(tunable_name, &irq) && (irq >= 255 || irq <= 0)) 3494 irq = PCI_INVALID_IRQ; 3495 3496 /* 3497 * If we didn't get an IRQ via the tunable, then we either use the 3498 * IRQ value in the intline register or we ask the bus to route an 3499 * interrupt for us. If force_route is true, then we only use the 3500 * value in the intline register if the bus was unable to assign an 3501 * IRQ. 3502 */ 3503 if (!PCI_INTERRUPT_VALID(irq)) { 3504 if (!PCI_INTERRUPT_VALID(cfg->intline) || force_route) 3505 irq = PCI_ASSIGN_INTERRUPT(bus, dev); 3506 if (!PCI_INTERRUPT_VALID(irq)) 3507 irq = cfg->intline; 3508 } 3509 3510 /* If after all that we don't have an IRQ, just bail. */ 3511 if (!PCI_INTERRUPT_VALID(irq)) 3512 return; 3513 3514 /* Update the config register if it changed. */ 3515 if (irq != cfg->intline) { 3516 cfg->intline = irq; 3517 pci_write_config(dev, PCIR_INTLINE, irq, 1); 3518 } 3519 3520 /* Add this IRQ as rid 0 interrupt resource. */ 3521 resource_list_add(&dinfo->resources, SYS_RES_IRQ, 0, irq, irq, 1); 3522 } 3523 3524 /* Perform early OHCI takeover from SMM. */ 3525 static void 3526 ohci_early_takeover(device_t self) 3527 { 3528 struct resource *res; 3529 uint32_t ctl; 3530 int rid; 3531 int i; 3532 3533 rid = PCIR_BAR(0); 3534 res = bus_alloc_resource_any(self, SYS_RES_MEMORY, &rid, RF_ACTIVE); 3535 if (res == NULL) 3536 return; 3537 3538 ctl = bus_read_4(res, OHCI_CONTROL); 3539 if (ctl & OHCI_IR) { 3540 if (bootverbose) 3541 printf("ohci early: " 3542 "SMM active, request owner change\n"); 3543 bus_write_4(res, OHCI_COMMAND_STATUS, OHCI_OCR); 3544 for (i = 0; (i < 100) && (ctl & OHCI_IR); i++) { 3545 DELAY(1000); 3546 ctl = bus_read_4(res, OHCI_CONTROL); 3547 } 3548 if (ctl & OHCI_IR) { 3549 if (bootverbose) 3550 printf("ohci early: " 3551 "SMM does not respond, resetting\n"); 3552 bus_write_4(res, OHCI_CONTROL, OHCI_HCFS_RESET); 3553 } 3554 /* Disable interrupts */ 3555 bus_write_4(res, OHCI_INTERRUPT_DISABLE, OHCI_ALL_INTRS); 3556 } 3557 3558 bus_release_resource(self, SYS_RES_MEMORY, rid, res); 3559 } 3560 3561 /* Perform early UHCI takeover from SMM. */ 3562 static void 3563 uhci_early_takeover(device_t self) 3564 { 3565 struct resource *res; 3566 int rid; 3567 3568 /* 3569 * Set the PIRQD enable bit and switch off all the others. We don't 3570 * want legacy support to interfere with us XXX Does this also mean 3571 * that the BIOS won't touch the keyboard anymore if it is connected 3572 * to the ports of the root hub? 3573 */ 3574 pci_write_config(self, PCI_LEGSUP, PCI_LEGSUP_USBPIRQDEN, 2); 3575 3576 /* Disable interrupts */ 3577 rid = PCI_UHCI_BASE_REG; 3578 res = bus_alloc_resource_any(self, SYS_RES_IOPORT, &rid, RF_ACTIVE); 3579 if (res != NULL) { 3580 bus_write_2(res, UHCI_INTR, 0); 3581 bus_release_resource(self, SYS_RES_IOPORT, rid, res); 3582 } 3583 } 3584 3585 /* Perform early EHCI takeover from SMM. */ 3586 static void 3587 ehci_early_takeover(device_t self) 3588 { 3589 struct resource *res; 3590 uint32_t cparams; 3591 uint32_t eec; 3592 uint8_t eecp; 3593 uint8_t bios_sem; 3594 uint8_t offs; 3595 int rid; 3596 int i; 3597 3598 rid = PCIR_BAR(0); 3599 res = bus_alloc_resource_any(self, SYS_RES_MEMORY, &rid, RF_ACTIVE); 3600 if (res == NULL) 3601 return; 3602 3603 cparams = bus_read_4(res, EHCI_HCCPARAMS); 3604 3605 /* Synchronise with the BIOS if it owns the controller. */ 3606 for (eecp = EHCI_HCC_EECP(cparams); eecp != 0; 3607 eecp = EHCI_EECP_NEXT(eec)) { 3608 eec = pci_read_config(self, eecp, 4); 3609 if (EHCI_EECP_ID(eec) != EHCI_EC_LEGSUP) { 3610 continue; 3611 } 3612 bios_sem = pci_read_config(self, eecp + 3613 EHCI_LEGSUP_BIOS_SEM, 1); 3614 if (bios_sem == 0) { 3615 continue; 3616 } 3617 if (bootverbose) 3618 printf("ehci early: " 3619 "SMM active, request owner change\n"); 3620 3621 pci_write_config(self, eecp + EHCI_LEGSUP_OS_SEM, 1, 1); 3622 3623 for (i = 0; (i < 100) && (bios_sem != 0); i++) { 3624 DELAY(1000); 3625 bios_sem = pci_read_config(self, eecp + 3626 EHCI_LEGSUP_BIOS_SEM, 1); 3627 } 3628 3629 if (bios_sem != 0) { 3630 if (bootverbose) 3631 printf("ehci early: " 3632 "SMM does not respond\n"); 3633 } 3634 /* Disable interrupts */ 3635 offs = EHCI_CAPLENGTH(bus_read_4(res, EHCI_CAPLEN_HCIVERSION)); 3636 bus_write_4(res, offs + EHCI_USBINTR, 0); 3637 } 3638 bus_release_resource(self, SYS_RES_MEMORY, rid, res); 3639 } 3640 3641 /* Perform early XHCI takeover from SMM. */ 3642 static void 3643 xhci_early_takeover(device_t self) 3644 { 3645 struct resource *res; 3646 uint32_t cparams; 3647 uint32_t eec; 3648 uint8_t eecp; 3649 uint8_t bios_sem; 3650 uint8_t offs; 3651 int rid; 3652 int i; 3653 3654 rid = PCIR_BAR(0); 3655 res = bus_alloc_resource_any(self, SYS_RES_MEMORY, &rid, RF_ACTIVE); 3656 if (res == NULL) 3657 return; 3658 3659 cparams = bus_read_4(res, XHCI_HCSPARAMS0); 3660 3661 eec = -1; 3662 3663 /* Synchronise with the BIOS if it owns the controller. */ 3664 for (eecp = XHCI_HCS0_XECP(cparams) << 2; eecp != 0 && XHCI_XECP_NEXT(eec); 3665 eecp += XHCI_XECP_NEXT(eec) << 2) { 3666 eec = bus_read_4(res, eecp); 3667 3668 if (XHCI_XECP_ID(eec) != XHCI_ID_USB_LEGACY) 3669 continue; 3670 3671 bios_sem = bus_read_1(res, eecp + XHCI_XECP_BIOS_SEM); 3672 if (bios_sem == 0) 3673 continue; 3674 3675 if (bootverbose) 3676 printf("xhci early: " 3677 "SMM active, request owner change\n"); 3678 3679 bus_write_1(res, eecp + XHCI_XECP_OS_SEM, 1); 3680 3681 /* wait a maximum of 5 second */ 3682 3683 for (i = 0; (i < 5000) && (bios_sem != 0); i++) { 3684 DELAY(1000); 3685 bios_sem = bus_read_1(res, eecp + 3686 XHCI_XECP_BIOS_SEM); 3687 } 3688 3689 if (bios_sem != 0) { 3690 if (bootverbose) 3691 printf("xhci early: " 3692 "SMM does not respond\n"); 3693 } 3694 3695 /* Disable interrupts */ 3696 offs = bus_read_1(res, XHCI_CAPLENGTH); 3697 bus_write_4(res, offs + XHCI_USBCMD, 0); 3698 bus_read_4(res, offs + XHCI_USBSTS); 3699 } 3700 bus_release_resource(self, SYS_RES_MEMORY, rid, res); 3701 } 3702 3703 #if defined(NEW_PCIB) && defined(PCI_RES_BUS) 3704 static void 3705 pci_reserve_secbus(device_t bus, device_t dev, pcicfgregs *cfg, 3706 struct resource_list *rl) 3707 { 3708 struct resource *res; 3709 char *cp; 3710 rman_res_t start, end, count; 3711 int rid, sec_bus, sec_reg, sub_bus, sub_reg, sup_bus; 3712 3713 switch (cfg->hdrtype & PCIM_HDRTYPE) { 3714 case PCIM_HDRTYPE_BRIDGE: 3715 sec_reg = PCIR_SECBUS_1; 3716 sub_reg = PCIR_SUBBUS_1; 3717 break; 3718 case PCIM_HDRTYPE_CARDBUS: 3719 sec_reg = PCIR_SECBUS_2; 3720 sub_reg = PCIR_SUBBUS_2; 3721 break; 3722 default: 3723 return; 3724 } 3725 3726 /* 3727 * If the existing bus range is valid, attempt to reserve it 3728 * from our parent. If this fails for any reason, clear the 3729 * secbus and subbus registers. 3730 * 3731 * XXX: Should we reset sub_bus to sec_bus if it is < sec_bus? 3732 * This would at least preserve the existing sec_bus if it is 3733 * valid. 3734 */ 3735 sec_bus = PCI_READ_CONFIG(bus, dev, sec_reg, 1); 3736 sub_bus = PCI_READ_CONFIG(bus, dev, sub_reg, 1); 3737 3738 /* Quirk handling. */ 3739 switch (pci_get_devid(dev)) { 3740 case 0x12258086: /* Intel 82454KX/GX (Orion) */ 3741 sup_bus = pci_read_config(dev, 0x41, 1); 3742 if (sup_bus != 0xff) { 3743 sec_bus = sup_bus + 1; 3744 sub_bus = sup_bus + 1; 3745 PCI_WRITE_CONFIG(bus, dev, sec_reg, sec_bus, 1); 3746 PCI_WRITE_CONFIG(bus, dev, sub_reg, sub_bus, 1); 3747 } 3748 break; 3749 3750 case 0x00dd10de: 3751 /* Compaq R3000 BIOS sets wrong subordinate bus number. */ 3752 if ((cp = kern_getenv("smbios.planar.maker")) == NULL) 3753 break; 3754 if (strncmp(cp, "Compal", 6) != 0) { 3755 freeenv(cp); 3756 break; 3757 } 3758 freeenv(cp); 3759 if ((cp = kern_getenv("smbios.planar.product")) == NULL) 3760 break; 3761 if (strncmp(cp, "08A0", 4) != 0) { 3762 freeenv(cp); 3763 break; 3764 } 3765 freeenv(cp); 3766 if (sub_bus < 0xa) { 3767 sub_bus = 0xa; 3768 PCI_WRITE_CONFIG(bus, dev, sub_reg, sub_bus, 1); 3769 } 3770 break; 3771 } 3772 3773 if (bootverbose) 3774 printf("\tsecbus=%d, subbus=%d\n", sec_bus, sub_bus); 3775 if (sec_bus > 0 && sub_bus >= sec_bus) { 3776 start = sec_bus; 3777 end = sub_bus; 3778 count = end - start + 1; 3779 3780 resource_list_add(rl, PCI_RES_BUS, 0, 0, ~0, count); 3781 3782 /* 3783 * If requested, clear secondary bus registers in 3784 * bridge devices to force a complete renumbering 3785 * rather than reserving the existing range. However, 3786 * preserve the existing size. 3787 */ 3788 if (pci_clear_buses) 3789 goto clear; 3790 3791 rid = 0; 3792 res = resource_list_reserve(rl, bus, dev, PCI_RES_BUS, &rid, 3793 start, end, count, 0); 3794 if (res != NULL) 3795 return; 3796 3797 if (bootverbose) 3798 device_printf(bus, 3799 "pci%d:%d:%d:%d secbus failed to allocate\n", 3800 pci_get_domain(dev), pci_get_bus(dev), 3801 pci_get_slot(dev), pci_get_function(dev)); 3802 } 3803 3804 clear: 3805 PCI_WRITE_CONFIG(bus, dev, sec_reg, 0, 1); 3806 PCI_WRITE_CONFIG(bus, dev, sub_reg, 0, 1); 3807 } 3808 3809 static struct resource * 3810 pci_alloc_secbus(device_t dev, device_t child, int *rid, rman_res_t start, 3811 rman_res_t end, rman_res_t count, u_int flags) 3812 { 3813 struct pci_devinfo *dinfo; 3814 pcicfgregs *cfg; 3815 struct resource_list *rl; 3816 struct resource *res; 3817 int sec_reg, sub_reg; 3818 3819 dinfo = device_get_ivars(child); 3820 cfg = &dinfo->cfg; 3821 rl = &dinfo->resources; 3822 switch (cfg->hdrtype & PCIM_HDRTYPE) { 3823 case PCIM_HDRTYPE_BRIDGE: 3824 sec_reg = PCIR_SECBUS_1; 3825 sub_reg = PCIR_SUBBUS_1; 3826 break; 3827 case PCIM_HDRTYPE_CARDBUS: 3828 sec_reg = PCIR_SECBUS_2; 3829 sub_reg = PCIR_SUBBUS_2; 3830 break; 3831 default: 3832 return (NULL); 3833 } 3834 3835 if (*rid != 0) 3836 return (NULL); 3837 3838 if (resource_list_find(rl, PCI_RES_BUS, *rid) == NULL) 3839 resource_list_add(rl, PCI_RES_BUS, *rid, start, end, count); 3840 if (!resource_list_reserved(rl, PCI_RES_BUS, *rid)) { 3841 res = resource_list_reserve(rl, dev, child, PCI_RES_BUS, rid, 3842 start, end, count, flags & ~RF_ACTIVE); 3843 if (res == NULL) { 3844 resource_list_delete(rl, PCI_RES_BUS, *rid); 3845 device_printf(child, "allocating %ju bus%s failed\n", 3846 count, count == 1 ? "" : "es"); 3847 return (NULL); 3848 } 3849 if (bootverbose) 3850 device_printf(child, 3851 "Lazy allocation of %ju bus%s at %ju\n", count, 3852 count == 1 ? "" : "es", rman_get_start(res)); 3853 PCI_WRITE_CONFIG(dev, child, sec_reg, rman_get_start(res), 1); 3854 PCI_WRITE_CONFIG(dev, child, sub_reg, rman_get_end(res), 1); 3855 } 3856 return (resource_list_alloc(rl, dev, child, PCI_RES_BUS, rid, start, 3857 end, count, flags)); 3858 } 3859 #endif 3860 3861 static int 3862 pci_ea_bei_to_rid(device_t dev, int bei) 3863 { 3864 #ifdef PCI_IOV 3865 struct pci_devinfo *dinfo; 3866 int iov_pos; 3867 struct pcicfg_iov *iov; 3868 3869 dinfo = device_get_ivars(dev); 3870 iov = dinfo->cfg.iov; 3871 if (iov != NULL) 3872 iov_pos = iov->iov_pos; 3873 else 3874 iov_pos = 0; 3875 #endif 3876 3877 /* Check if matches BAR */ 3878 if ((bei >= PCIM_EA_BEI_BAR_0) && 3879 (bei <= PCIM_EA_BEI_BAR_5)) 3880 return (PCIR_BAR(bei)); 3881 3882 /* Check ROM */ 3883 if (bei == PCIM_EA_BEI_ROM) 3884 return (PCIR_BIOS); 3885 3886 #ifdef PCI_IOV 3887 /* Check if matches VF_BAR */ 3888 if ((iov != NULL) && (bei >= PCIM_EA_BEI_VF_BAR_0) && 3889 (bei <= PCIM_EA_BEI_VF_BAR_5)) 3890 return (PCIR_SRIOV_BAR(bei - PCIM_EA_BEI_VF_BAR_0) + 3891 iov_pos); 3892 #endif 3893 3894 return (-1); 3895 } 3896 3897 int 3898 pci_ea_is_enabled(device_t dev, int rid) 3899 { 3900 struct pci_ea_entry *ea; 3901 struct pci_devinfo *dinfo; 3902 3903 dinfo = device_get_ivars(dev); 3904 3905 STAILQ_FOREACH(ea, &dinfo->cfg.ea.ea_entries, eae_link) { 3906 if (pci_ea_bei_to_rid(dev, ea->eae_bei) == rid) 3907 return ((ea->eae_flags & PCIM_EA_ENABLE) > 0); 3908 } 3909 3910 return (0); 3911 } 3912 3913 void 3914 pci_add_resources_ea(device_t bus, device_t dev, int alloc_iov) 3915 { 3916 struct pci_ea_entry *ea; 3917 struct pci_devinfo *dinfo; 3918 pci_addr_t start, end, count; 3919 struct resource_list *rl; 3920 int type, flags, rid; 3921 struct resource *res; 3922 uint32_t tmp; 3923 #ifdef PCI_IOV 3924 struct pcicfg_iov *iov; 3925 #endif 3926 3927 dinfo = device_get_ivars(dev); 3928 rl = &dinfo->resources; 3929 flags = 0; 3930 3931 #ifdef PCI_IOV 3932 iov = dinfo->cfg.iov; 3933 #endif 3934 3935 if (dinfo->cfg.ea.ea_location == 0) 3936 return; 3937 3938 STAILQ_FOREACH(ea, &dinfo->cfg.ea.ea_entries, eae_link) { 3939 /* 3940 * TODO: Ignore EA-BAR if is not enabled. 3941 * Currently the EA implementation supports 3942 * only situation, where EA structure contains 3943 * predefined entries. In case they are not enabled 3944 * leave them unallocated and proceed with 3945 * a legacy-BAR mechanism. 3946 */ 3947 if ((ea->eae_flags & PCIM_EA_ENABLE) == 0) 3948 continue; 3949 3950 switch ((ea->eae_flags & PCIM_EA_PP) >> PCIM_EA_PP_OFFSET) { 3951 case PCIM_EA_P_MEM_PREFETCH: 3952 case PCIM_EA_P_VF_MEM_PREFETCH: 3953 flags = RF_PREFETCHABLE; 3954 /* FALLTHROUGH */ 3955 case PCIM_EA_P_VF_MEM: 3956 case PCIM_EA_P_MEM: 3957 type = SYS_RES_MEMORY; 3958 break; 3959 case PCIM_EA_P_IO: 3960 type = SYS_RES_IOPORT; 3961 break; 3962 default: 3963 continue; 3964 } 3965 3966 if (alloc_iov != 0) { 3967 #ifdef PCI_IOV 3968 /* Allocating IOV, confirm BEI matches */ 3969 if ((ea->eae_bei < PCIM_EA_BEI_VF_BAR_0) || 3970 (ea->eae_bei > PCIM_EA_BEI_VF_BAR_5)) 3971 continue; 3972 #else 3973 continue; 3974 #endif 3975 } else { 3976 /* Allocating BAR, confirm BEI matches */ 3977 if (((ea->eae_bei < PCIM_EA_BEI_BAR_0) || 3978 (ea->eae_bei > PCIM_EA_BEI_BAR_5)) && 3979 (ea->eae_bei != PCIM_EA_BEI_ROM)) 3980 continue; 3981 } 3982 3983 rid = pci_ea_bei_to_rid(dev, ea->eae_bei); 3984 if (rid < 0) 3985 continue; 3986 3987 /* Skip resources already allocated by EA */ 3988 if ((resource_list_find(rl, SYS_RES_MEMORY, rid) != NULL) || 3989 (resource_list_find(rl, SYS_RES_IOPORT, rid) != NULL)) 3990 continue; 3991 3992 start = ea->eae_base; 3993 count = ea->eae_max_offset + 1; 3994 #ifdef PCI_IOV 3995 if (iov != NULL) 3996 count = count * iov->iov_num_vfs; 3997 #endif 3998 end = start + count - 1; 3999 if (count == 0) 4000 continue; 4001 4002 resource_list_add(rl, type, rid, start, end, count); 4003 res = resource_list_reserve(rl, bus, dev, type, &rid, start, end, count, 4004 flags); 4005 if (res == NULL) { 4006 resource_list_delete(rl, type, rid); 4007 4008 /* 4009 * Failed to allocate using EA, disable entry. 4010 * Another attempt to allocation will be performed 4011 * further, but this time using legacy BAR registers 4012 */ 4013 tmp = pci_read_config(dev, ea->eae_cfg_offset, 4); 4014 tmp &= ~PCIM_EA_ENABLE; 4015 pci_write_config(dev, ea->eae_cfg_offset, tmp, 4); 4016 4017 /* 4018 * Disabling entry might fail in case it is hardwired. 4019 * Read flags again to match current status. 4020 */ 4021 ea->eae_flags = pci_read_config(dev, ea->eae_cfg_offset, 4); 4022 4023 continue; 4024 } 4025 4026 /* As per specification, fill BAR with zeros */ 4027 pci_write_config(dev, rid, 0, 4); 4028 } 4029 } 4030 4031 void 4032 pci_add_resources(device_t bus, device_t dev, int force, uint32_t prefetchmask) 4033 { 4034 struct pci_devinfo *dinfo; 4035 pcicfgregs *cfg; 4036 struct resource_list *rl; 4037 const struct pci_quirk *q; 4038 uint32_t devid; 4039 int i; 4040 4041 dinfo = device_get_ivars(dev); 4042 cfg = &dinfo->cfg; 4043 rl = &dinfo->resources; 4044 devid = (cfg->device << 16) | cfg->vendor; 4045 4046 /* Allocate resources using Enhanced Allocation */ 4047 pci_add_resources_ea(bus, dev, 0); 4048 4049 /* ATA devices needs special map treatment */ 4050 if ((pci_get_class(dev) == PCIC_STORAGE) && 4051 (pci_get_subclass(dev) == PCIS_STORAGE_IDE) && 4052 ((pci_get_progif(dev) & PCIP_STORAGE_IDE_MASTERDEV) || 4053 (!pci_read_config(dev, PCIR_BAR(0), 4) && 4054 !pci_read_config(dev, PCIR_BAR(2), 4))) ) 4055 pci_ata_maps(bus, dev, rl, force, prefetchmask); 4056 else 4057 for (i = 0; i < cfg->nummaps;) { 4058 /* Skip resources already managed by EA */ 4059 if ((resource_list_find(rl, SYS_RES_MEMORY, PCIR_BAR(i)) != NULL) || 4060 (resource_list_find(rl, SYS_RES_IOPORT, PCIR_BAR(i)) != NULL) || 4061 pci_ea_is_enabled(dev, PCIR_BAR(i))) { 4062 i++; 4063 continue; 4064 } 4065 4066 /* 4067 * Skip quirked resources. 4068 */ 4069 for (q = &pci_quirks[0]; q->devid != 0; q++) 4070 if (q->devid == devid && 4071 q->type == PCI_QUIRK_UNMAP_REG && 4072 q->arg1 == PCIR_BAR(i)) 4073 break; 4074 if (q->devid != 0) { 4075 i++; 4076 continue; 4077 } 4078 i += pci_add_map(bus, dev, PCIR_BAR(i), rl, force, 4079 prefetchmask & (1 << i)); 4080 } 4081 4082 /* 4083 * Add additional, quirked resources. 4084 */ 4085 for (q = &pci_quirks[0]; q->devid != 0; q++) 4086 if (q->devid == devid && q->type == PCI_QUIRK_MAP_REG) 4087 pci_add_map(bus, dev, q->arg1, rl, force, 0); 4088 4089 if (cfg->intpin > 0 && PCI_INTERRUPT_VALID(cfg->intline)) { 4090 #ifdef __PCI_REROUTE_INTERRUPT 4091 /* 4092 * Try to re-route interrupts. Sometimes the BIOS or 4093 * firmware may leave bogus values in these registers. 4094 * If the re-route fails, then just stick with what we 4095 * have. 4096 */ 4097 pci_assign_interrupt(bus, dev, 1); 4098 #else 4099 pci_assign_interrupt(bus, dev, 0); 4100 #endif 4101 } 4102 4103 if (pci_usb_takeover && pci_get_class(dev) == PCIC_SERIALBUS && 4104 pci_get_subclass(dev) == PCIS_SERIALBUS_USB) { 4105 if (pci_get_progif(dev) == PCIP_SERIALBUS_USB_XHCI) 4106 xhci_early_takeover(dev); 4107 else if (pci_get_progif(dev) == PCIP_SERIALBUS_USB_EHCI) 4108 ehci_early_takeover(dev); 4109 else if (pci_get_progif(dev) == PCIP_SERIALBUS_USB_OHCI) 4110 ohci_early_takeover(dev); 4111 else if (pci_get_progif(dev) == PCIP_SERIALBUS_USB_UHCI) 4112 uhci_early_takeover(dev); 4113 } 4114 4115 #if defined(NEW_PCIB) && defined(PCI_RES_BUS) 4116 /* 4117 * Reserve resources for secondary bus ranges behind bridge 4118 * devices. 4119 */ 4120 pci_reserve_secbus(bus, dev, cfg, rl); 4121 #endif 4122 } 4123 4124 static struct pci_devinfo * 4125 pci_identify_function(device_t pcib, device_t dev, int domain, int busno, 4126 int slot, int func) 4127 { 4128 struct pci_devinfo *dinfo; 4129 4130 dinfo = pci_read_device(pcib, dev, domain, busno, slot, func); 4131 if (dinfo != NULL) 4132 pci_add_child(dev, dinfo); 4133 4134 return (dinfo); 4135 } 4136 4137 void 4138 pci_add_children(device_t dev, int domain, int busno) 4139 { 4140 #define REG(n, w) PCIB_READ_CONFIG(pcib, busno, s, f, n, w) 4141 device_t pcib = device_get_parent(dev); 4142 struct pci_devinfo *dinfo; 4143 int maxslots; 4144 int s, f, pcifunchigh; 4145 uint8_t hdrtype; 4146 int first_func; 4147 4148 /* 4149 * Try to detect a device at slot 0, function 0. If it exists, try to 4150 * enable ARI. We must enable ARI before detecting the rest of the 4151 * functions on this bus as ARI changes the set of slots and functions 4152 * that are legal on this bus. 4153 */ 4154 dinfo = pci_identify_function(pcib, dev, domain, busno, 0, 0); 4155 if (dinfo != NULL && pci_enable_ari) 4156 PCIB_TRY_ENABLE_ARI(pcib, dinfo->cfg.dev); 4157 4158 /* 4159 * Start looking for new devices on slot 0 at function 1 because we 4160 * just identified the device at slot 0, function 0. 4161 */ 4162 first_func = 1; 4163 4164 maxslots = PCIB_MAXSLOTS(pcib); 4165 for (s = 0; s <= maxslots; s++, first_func = 0) { 4166 pcifunchigh = 0; 4167 f = 0; 4168 DELAY(1); 4169 4170 /* If function 0 is not present, skip to the next slot. */ 4171 if (REG(PCIR_VENDOR, 2) == PCIV_INVALID) 4172 continue; 4173 hdrtype = REG(PCIR_HDRTYPE, 1); 4174 if ((hdrtype & PCIM_HDRTYPE) > PCI_MAXHDRTYPE) 4175 continue; 4176 if (hdrtype & PCIM_MFDEV) 4177 pcifunchigh = PCIB_MAXFUNCS(pcib); 4178 for (f = first_func; f <= pcifunchigh; f++) 4179 pci_identify_function(pcib, dev, domain, busno, s, f); 4180 } 4181 #undef REG 4182 } 4183 4184 int 4185 pci_rescan_method(device_t dev) 4186 { 4187 #define REG(n, w) PCIB_READ_CONFIG(pcib, busno, s, f, n, w) 4188 device_t pcib = device_get_parent(dev); 4189 device_t child, *devlist, *unchanged; 4190 int devcount, error, i, j, maxslots, oldcount; 4191 int busno, domain, s, f, pcifunchigh; 4192 uint8_t hdrtype; 4193 4194 /* No need to check for ARI on a rescan. */ 4195 error = device_get_children(dev, &devlist, &devcount); 4196 if (error) 4197 return (error); 4198 if (devcount != 0) { 4199 unchanged = malloc(devcount * sizeof(device_t), M_TEMP, 4200 M_NOWAIT | M_ZERO); 4201 if (unchanged == NULL) { 4202 free(devlist, M_TEMP); 4203 return (ENOMEM); 4204 } 4205 } else 4206 unchanged = NULL; 4207 4208 domain = pcib_get_domain(dev); 4209 busno = pcib_get_bus(dev); 4210 maxslots = PCIB_MAXSLOTS(pcib); 4211 for (s = 0; s <= maxslots; s++) { 4212 /* If function 0 is not present, skip to the next slot. */ 4213 f = 0; 4214 if (REG(PCIR_VENDOR, 2) == PCIV_INVALID) 4215 continue; 4216 pcifunchigh = 0; 4217 hdrtype = REG(PCIR_HDRTYPE, 1); 4218 if ((hdrtype & PCIM_HDRTYPE) > PCI_MAXHDRTYPE) 4219 continue; 4220 if (hdrtype & PCIM_MFDEV) 4221 pcifunchigh = PCIB_MAXFUNCS(pcib); 4222 for (f = 0; f <= pcifunchigh; f++) { 4223 if (REG(PCIR_VENDOR, 2) == PCIV_INVALID) 4224 continue; 4225 4226 /* 4227 * Found a valid function. Check if a 4228 * device_t for this device already exists. 4229 */ 4230 for (i = 0; i < devcount; i++) { 4231 child = devlist[i]; 4232 if (child == NULL) 4233 continue; 4234 if (pci_get_slot(child) == s && 4235 pci_get_function(child) == f) { 4236 unchanged[i] = child; 4237 goto next_func; 4238 } 4239 } 4240 4241 pci_identify_function(pcib, dev, domain, busno, s, f); 4242 next_func:; 4243 } 4244 } 4245 4246 /* Remove devices that are no longer present. */ 4247 for (i = 0; i < devcount; i++) { 4248 if (unchanged[i] != NULL) 4249 continue; 4250 device_delete_child(dev, devlist[i]); 4251 } 4252 4253 free(devlist, M_TEMP); 4254 oldcount = devcount; 4255 4256 /* Try to attach the devices just added. */ 4257 error = device_get_children(dev, &devlist, &devcount); 4258 if (error) { 4259 free(unchanged, M_TEMP); 4260 return (error); 4261 } 4262 4263 for (i = 0; i < devcount; i++) { 4264 for (j = 0; j < oldcount; j++) { 4265 if (devlist[i] == unchanged[j]) 4266 goto next_device; 4267 } 4268 4269 device_probe_and_attach(devlist[i]); 4270 next_device:; 4271 } 4272 4273 free(unchanged, M_TEMP); 4274 free(devlist, M_TEMP); 4275 return (0); 4276 #undef REG 4277 } 4278 4279 #ifdef PCI_IOV 4280 device_t 4281 pci_add_iov_child(device_t bus, device_t pf, uint16_t rid, uint16_t vid, 4282 uint16_t did) 4283 { 4284 struct pci_devinfo *vf_dinfo; 4285 device_t pcib; 4286 int busno, slot, func; 4287 4288 pcib = device_get_parent(bus); 4289 4290 PCIB_DECODE_RID(pcib, rid, &busno, &slot, &func); 4291 4292 vf_dinfo = pci_fill_devinfo(pcib, bus, pci_get_domain(pcib), busno, 4293 slot, func, vid, did); 4294 4295 vf_dinfo->cfg.flags |= PCICFG_VF; 4296 pci_add_child(bus, vf_dinfo); 4297 4298 return (vf_dinfo->cfg.dev); 4299 } 4300 4301 device_t 4302 pci_create_iov_child_method(device_t bus, device_t pf, uint16_t rid, 4303 uint16_t vid, uint16_t did) 4304 { 4305 4306 return (pci_add_iov_child(bus, pf, rid, vid, did)); 4307 } 4308 #endif 4309 4310 /* 4311 * For PCIe device set Max_Payload_Size to match PCIe root's. 4312 */ 4313 static void 4314 pcie_setup_mps(device_t dev) 4315 { 4316 struct pci_devinfo *dinfo = device_get_ivars(dev); 4317 device_t root; 4318 uint16_t rmps, mmps, mps; 4319 4320 if (dinfo->cfg.pcie.pcie_location == 0) 4321 return; 4322 root = pci_find_pcie_root_port(dev); 4323 if (root == NULL) 4324 return; 4325 /* Check whether the MPS is already configured. */ 4326 rmps = pcie_read_config(root, PCIER_DEVICE_CTL, 2) & 4327 PCIEM_CTL_MAX_PAYLOAD; 4328 mps = pcie_read_config(dev, PCIER_DEVICE_CTL, 2) & 4329 PCIEM_CTL_MAX_PAYLOAD; 4330 if (mps == rmps) 4331 return; 4332 /* Check whether the device is capable of the root's MPS. */ 4333 mmps = (pcie_read_config(dev, PCIER_DEVICE_CAP, 2) & 4334 PCIEM_CAP_MAX_PAYLOAD) << 5; 4335 if (rmps > mmps) { 4336 /* 4337 * The device is unable to handle root's MPS. Limit root. 4338 * XXX: We should traverse through all the tree, applying 4339 * it to all the devices. 4340 */ 4341 pcie_adjust_config(root, PCIER_DEVICE_CTL, 4342 PCIEM_CTL_MAX_PAYLOAD, mmps, 2); 4343 } else { 4344 pcie_adjust_config(dev, PCIER_DEVICE_CTL, 4345 PCIEM_CTL_MAX_PAYLOAD, rmps, 2); 4346 } 4347 } 4348 4349 static void 4350 pci_add_child_clear_aer(device_t dev, struct pci_devinfo *dinfo) 4351 { 4352 int aer; 4353 uint32_t r; 4354 uint16_t r2; 4355 4356 if (dinfo->cfg.pcie.pcie_location != 0 && 4357 dinfo->cfg.pcie.pcie_type == PCIEM_TYPE_ROOT_PORT) { 4358 r2 = pci_read_config(dev, dinfo->cfg.pcie.pcie_location + 4359 PCIER_ROOT_CTL, 2); 4360 r2 &= ~(PCIEM_ROOT_CTL_SERR_CORR | 4361 PCIEM_ROOT_CTL_SERR_NONFATAL | PCIEM_ROOT_CTL_SERR_FATAL); 4362 pci_write_config(dev, dinfo->cfg.pcie.pcie_location + 4363 PCIER_ROOT_CTL, r2, 2); 4364 } 4365 if (pci_find_extcap(dev, PCIZ_AER, &aer) == 0) { 4366 r = pci_read_config(dev, aer + PCIR_AER_UC_STATUS, 4); 4367 pci_write_config(dev, aer + PCIR_AER_UC_STATUS, r, 4); 4368 if (r != 0 && bootverbose) { 4369 pci_printf(&dinfo->cfg, 4370 "clearing AER UC 0x%08x -> 0x%08x\n", 4371 r, pci_read_config(dev, aer + PCIR_AER_UC_STATUS, 4372 4)); 4373 } 4374 4375 r = pci_read_config(dev, aer + PCIR_AER_UC_MASK, 4); 4376 r &= ~(PCIM_AER_UC_TRAINING_ERROR | 4377 PCIM_AER_UC_DL_PROTOCOL_ERROR | 4378 PCIM_AER_UC_SURPRISE_LINK_DOWN | 4379 PCIM_AER_UC_POISONED_TLP | 4380 PCIM_AER_UC_FC_PROTOCOL_ERROR | 4381 PCIM_AER_UC_COMPLETION_TIMEOUT | 4382 PCIM_AER_UC_COMPLETER_ABORT | 4383 PCIM_AER_UC_UNEXPECTED_COMPLETION | 4384 PCIM_AER_UC_RECEIVER_OVERFLOW | 4385 PCIM_AER_UC_MALFORMED_TLP | 4386 PCIM_AER_UC_ECRC_ERROR | 4387 PCIM_AER_UC_UNSUPPORTED_REQUEST | 4388 PCIM_AER_UC_ACS_VIOLATION | 4389 PCIM_AER_UC_INTERNAL_ERROR | 4390 PCIM_AER_UC_MC_BLOCKED_TLP | 4391 PCIM_AER_UC_ATOMIC_EGRESS_BLK | 4392 PCIM_AER_UC_TLP_PREFIX_BLOCKED); 4393 pci_write_config(dev, aer + PCIR_AER_UC_MASK, r, 4); 4394 4395 r = pci_read_config(dev, aer + PCIR_AER_COR_STATUS, 4); 4396 pci_write_config(dev, aer + PCIR_AER_COR_STATUS, r, 4); 4397 if (r != 0 && bootverbose) { 4398 pci_printf(&dinfo->cfg, 4399 "clearing AER COR 0x%08x -> 0x%08x\n", 4400 r, pci_read_config(dev, aer + PCIR_AER_COR_STATUS, 4401 4)); 4402 } 4403 4404 r = pci_read_config(dev, aer + PCIR_AER_COR_MASK, 4); 4405 r &= ~(PCIM_AER_COR_RECEIVER_ERROR | 4406 PCIM_AER_COR_BAD_TLP | 4407 PCIM_AER_COR_BAD_DLLP | 4408 PCIM_AER_COR_REPLAY_ROLLOVER | 4409 PCIM_AER_COR_REPLAY_TIMEOUT | 4410 PCIM_AER_COR_ADVISORY_NF_ERROR | 4411 PCIM_AER_COR_INTERNAL_ERROR | 4412 PCIM_AER_COR_HEADER_LOG_OVFLOW); 4413 pci_write_config(dev, aer + PCIR_AER_COR_MASK, r, 4); 4414 4415 r = pci_read_config(dev, dinfo->cfg.pcie.pcie_location + 4416 PCIER_DEVICE_CTL, 2); 4417 r |= PCIEM_CTL_COR_ENABLE | PCIEM_CTL_NFER_ENABLE | 4418 PCIEM_CTL_FER_ENABLE | PCIEM_CTL_URR_ENABLE; 4419 pci_write_config(dev, dinfo->cfg.pcie.pcie_location + 4420 PCIER_DEVICE_CTL, r, 2); 4421 } 4422 } 4423 4424 void 4425 pci_add_child(device_t bus, struct pci_devinfo *dinfo) 4426 { 4427 device_t dev; 4428 4429 dinfo->cfg.dev = dev = device_add_child(bus, NULL, -1); 4430 device_set_ivars(dev, dinfo); 4431 resource_list_init(&dinfo->resources); 4432 pci_cfg_save(dev, dinfo, 0); 4433 pci_cfg_restore(dev, dinfo); 4434 pci_print_verbose(dinfo); 4435 pci_add_resources(bus, dev, 0, 0); 4436 if (pci_enable_mps_tune) 4437 pcie_setup_mps(dev); 4438 pci_child_added(dinfo->cfg.dev); 4439 4440 if (pci_clear_aer_on_attach) 4441 pci_add_child_clear_aer(dev, dinfo); 4442 4443 EVENTHANDLER_INVOKE(pci_add_device, dinfo->cfg.dev); 4444 } 4445 4446 void 4447 pci_child_added_method(device_t dev, device_t child) 4448 { 4449 4450 } 4451 4452 static int 4453 pci_probe(device_t dev) 4454 { 4455 4456 device_set_desc(dev, "PCI bus"); 4457 4458 /* Allow other subclasses to override this driver. */ 4459 return (BUS_PROBE_GENERIC); 4460 } 4461 4462 int 4463 pci_attach_common(device_t dev) 4464 { 4465 struct pci_softc *sc; 4466 int busno, domain; 4467 #ifdef PCI_RES_BUS 4468 int rid; 4469 #endif 4470 4471 sc = device_get_softc(dev); 4472 domain = pcib_get_domain(dev); 4473 busno = pcib_get_bus(dev); 4474 #ifdef PCI_RES_BUS 4475 rid = 0; 4476 sc->sc_bus = bus_alloc_resource(dev, PCI_RES_BUS, &rid, busno, busno, 4477 1, 0); 4478 if (sc->sc_bus == NULL) { 4479 device_printf(dev, "failed to allocate bus number\n"); 4480 return (ENXIO); 4481 } 4482 #endif 4483 if (bootverbose) 4484 device_printf(dev, "domain=%d, physical bus=%d\n", 4485 domain, busno); 4486 sc->sc_dma_tag = bus_get_dma_tag(dev); 4487 return (0); 4488 } 4489 4490 int 4491 pci_attach(device_t dev) 4492 { 4493 int busno, domain, error; 4494 4495 error = pci_attach_common(dev); 4496 if (error) 4497 return (error); 4498 4499 /* 4500 * Since there can be multiple independently numbered PCI 4501 * buses on systems with multiple PCI domains, we can't use 4502 * the unit number to decide which bus we are probing. We ask 4503 * the parent pcib what our domain and bus numbers are. 4504 */ 4505 domain = pcib_get_domain(dev); 4506 busno = pcib_get_bus(dev); 4507 pci_add_children(dev, domain, busno); 4508 return (bus_generic_attach(dev)); 4509 } 4510 4511 int 4512 pci_detach(device_t dev) 4513 { 4514 #ifdef PCI_RES_BUS 4515 struct pci_softc *sc; 4516 #endif 4517 int error; 4518 4519 error = bus_generic_detach(dev); 4520 if (error) 4521 return (error); 4522 #ifdef PCI_RES_BUS 4523 sc = device_get_softc(dev); 4524 error = bus_release_resource(dev, PCI_RES_BUS, 0, sc->sc_bus); 4525 if (error) 4526 return (error); 4527 #endif 4528 return (device_delete_children(dev)); 4529 } 4530 4531 static void 4532 pci_hint_device_unit(device_t dev, device_t child, const char *name, int *unitp) 4533 { 4534 int line, unit; 4535 const char *at; 4536 char me1[24], me2[32]; 4537 uint8_t b, s, f; 4538 uint32_t d; 4539 device_location_cache_t *cache; 4540 4541 d = pci_get_domain(child); 4542 b = pci_get_bus(child); 4543 s = pci_get_slot(child); 4544 f = pci_get_function(child); 4545 snprintf(me1, sizeof(me1), "pci%u:%u:%u", b, s, f); 4546 snprintf(me2, sizeof(me2), "pci%u:%u:%u:%u", d, b, s, f); 4547 line = 0; 4548 cache = dev_wired_cache_init(); 4549 while (resource_find_dev(&line, name, &unit, "at", NULL) == 0) { 4550 resource_string_value(name, unit, "at", &at); 4551 if (strcmp(at, me1) == 0 || strcmp(at, me2) == 0) { 4552 *unitp = unit; 4553 break; 4554 } 4555 if (dev_wired_cache_match(cache, child, at)) { 4556 *unitp = unit; 4557 break; 4558 } 4559 } 4560 dev_wired_cache_fini(cache); 4561 } 4562 4563 static void 4564 pci_set_power_child(device_t dev, device_t child, int state) 4565 { 4566 device_t pcib; 4567 int dstate; 4568 4569 /* 4570 * Set the device to the given state. If the firmware suggests 4571 * a different power state, use it instead. If power management 4572 * is not present, the firmware is responsible for managing 4573 * device power. Skip children who aren't attached since they 4574 * are handled separately. 4575 */ 4576 pcib = device_get_parent(dev); 4577 dstate = state; 4578 if (device_is_attached(child) && 4579 PCIB_POWER_FOR_SLEEP(pcib, child, &dstate) == 0) 4580 pci_set_powerstate(child, dstate); 4581 } 4582 4583 int 4584 pci_suspend_child(device_t dev, device_t child) 4585 { 4586 struct pci_devinfo *dinfo; 4587 struct resource_list_entry *rle; 4588 int error; 4589 4590 dinfo = device_get_ivars(child); 4591 4592 /* 4593 * Save the PCI configuration space for the child and set the 4594 * device in the appropriate power state for this sleep state. 4595 */ 4596 pci_cfg_save(child, dinfo, 0); 4597 4598 /* Suspend devices before potentially powering them down. */ 4599 error = bus_generic_suspend_child(dev, child); 4600 4601 if (error) 4602 return (error); 4603 4604 if (pci_do_power_suspend) { 4605 /* 4606 * Make sure this device's interrupt handler is not invoked 4607 * in the case the device uses a shared interrupt that can 4608 * be raised by some other device. 4609 * This is applicable only to regular (legacy) PCI interrupts 4610 * as MSI/MSI-X interrupts are never shared. 4611 */ 4612 rle = resource_list_find(&dinfo->resources, 4613 SYS_RES_IRQ, 0); 4614 if (rle != NULL && rle->res != NULL) 4615 (void)bus_suspend_intr(child, rle->res); 4616 pci_set_power_child(dev, child, PCI_POWERSTATE_D3); 4617 } 4618 4619 return (0); 4620 } 4621 4622 int 4623 pci_resume_child(device_t dev, device_t child) 4624 { 4625 struct pci_devinfo *dinfo; 4626 struct resource_list_entry *rle; 4627 4628 if (pci_do_power_resume) 4629 pci_set_power_child(dev, child, PCI_POWERSTATE_D0); 4630 4631 dinfo = device_get_ivars(child); 4632 pci_cfg_restore(child, dinfo); 4633 if (!device_is_attached(child)) 4634 pci_cfg_save(child, dinfo, 1); 4635 4636 bus_generic_resume_child(dev, child); 4637 4638 /* 4639 * Allow interrupts only after fully resuming the driver and hardware. 4640 */ 4641 if (pci_do_power_suspend) { 4642 /* See pci_suspend_child for details. */ 4643 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, 0); 4644 if (rle != NULL && rle->res != NULL) 4645 (void)bus_resume_intr(child, rle->res); 4646 } 4647 4648 return (0); 4649 } 4650 4651 int 4652 pci_resume(device_t dev) 4653 { 4654 device_t child, *devlist; 4655 int error, i, numdevs; 4656 4657 if ((error = device_get_children(dev, &devlist, &numdevs)) != 0) 4658 return (error); 4659 4660 /* 4661 * Resume critical devices first, then everything else later. 4662 */ 4663 for (i = 0; i < numdevs; i++) { 4664 child = devlist[i]; 4665 switch (pci_get_class(child)) { 4666 case PCIC_DISPLAY: 4667 case PCIC_MEMORY: 4668 case PCIC_BRIDGE: 4669 case PCIC_BASEPERIPH: 4670 BUS_RESUME_CHILD(dev, child); 4671 break; 4672 } 4673 } 4674 for (i = 0; i < numdevs; i++) { 4675 child = devlist[i]; 4676 switch (pci_get_class(child)) { 4677 case PCIC_DISPLAY: 4678 case PCIC_MEMORY: 4679 case PCIC_BRIDGE: 4680 case PCIC_BASEPERIPH: 4681 break; 4682 default: 4683 BUS_RESUME_CHILD(dev, child); 4684 } 4685 } 4686 free(devlist, M_TEMP); 4687 return (0); 4688 } 4689 4690 static void 4691 pci_load_vendor_data(void) 4692 { 4693 caddr_t data; 4694 void *ptr; 4695 size_t sz; 4696 4697 data = preload_search_by_type("pci_vendor_data"); 4698 if (data != NULL) { 4699 ptr = preload_fetch_addr(data); 4700 sz = preload_fetch_size(data); 4701 if (ptr != NULL && sz != 0) { 4702 pci_vendordata = ptr; 4703 pci_vendordata_size = sz; 4704 /* terminate the database */ 4705 pci_vendordata[pci_vendordata_size] = '\n'; 4706 } 4707 } 4708 } 4709 4710 void 4711 pci_driver_added(device_t dev, driver_t *driver) 4712 { 4713 int numdevs; 4714 device_t *devlist; 4715 device_t child; 4716 struct pci_devinfo *dinfo; 4717 int i; 4718 4719 if (bootverbose) 4720 device_printf(dev, "driver added\n"); 4721 DEVICE_IDENTIFY(driver, dev); 4722 if (device_get_children(dev, &devlist, &numdevs) != 0) 4723 return; 4724 for (i = 0; i < numdevs; i++) { 4725 child = devlist[i]; 4726 if (device_get_state(child) != DS_NOTPRESENT) 4727 continue; 4728 dinfo = device_get_ivars(child); 4729 pci_print_verbose(dinfo); 4730 if (bootverbose) 4731 pci_printf(&dinfo->cfg, "reprobing on driver added\n"); 4732 pci_cfg_restore(child, dinfo); 4733 if (device_probe_and_attach(child) != 0) 4734 pci_child_detached(dev, child); 4735 } 4736 free(devlist, M_TEMP); 4737 } 4738 4739 int 4740 pci_setup_intr(device_t dev, device_t child, struct resource *irq, int flags, 4741 driver_filter_t *filter, driver_intr_t *intr, void *arg, void **cookiep) 4742 { 4743 struct pci_devinfo *dinfo; 4744 struct msix_table_entry *mte; 4745 struct msix_vector *mv; 4746 uint64_t addr; 4747 uint32_t data; 4748 void *cookie; 4749 int error, rid; 4750 4751 error = bus_generic_setup_intr(dev, child, irq, flags, filter, intr, 4752 arg, &cookie); 4753 if (error) 4754 return (error); 4755 4756 /* If this is not a direct child, just bail out. */ 4757 if (device_get_parent(child) != dev) { 4758 *cookiep = cookie; 4759 return(0); 4760 } 4761 4762 rid = rman_get_rid(irq); 4763 if (rid == 0) { 4764 /* Make sure that INTx is enabled */ 4765 pci_clear_command_bit(dev, child, PCIM_CMD_INTxDIS); 4766 } else { 4767 /* 4768 * Check to see if the interrupt is MSI or MSI-X. 4769 * Ask our parent to map the MSI and give 4770 * us the address and data register values. 4771 * If we fail for some reason, teardown the 4772 * interrupt handler. 4773 */ 4774 dinfo = device_get_ivars(child); 4775 if (dinfo->cfg.msi.msi_alloc > 0) { 4776 if (dinfo->cfg.msi.msi_addr == 0) { 4777 KASSERT(dinfo->cfg.msi.msi_handlers == 0, 4778 ("MSI has handlers, but vectors not mapped")); 4779 error = PCIB_MAP_MSI(device_get_parent(dev), 4780 child, rman_get_start(irq), &addr, &data); 4781 if (error) 4782 goto bad; 4783 dinfo->cfg.msi.msi_addr = addr; 4784 dinfo->cfg.msi.msi_data = data; 4785 } 4786 if (dinfo->cfg.msi.msi_handlers == 0) 4787 pci_enable_msi(child, dinfo->cfg.msi.msi_addr, 4788 dinfo->cfg.msi.msi_data); 4789 dinfo->cfg.msi.msi_handlers++; 4790 } else { 4791 KASSERT(dinfo->cfg.msix.msix_alloc > 0, 4792 ("No MSI or MSI-X interrupts allocated")); 4793 KASSERT(rid <= dinfo->cfg.msix.msix_table_len, 4794 ("MSI-X index too high")); 4795 mte = &dinfo->cfg.msix.msix_table[rid - 1]; 4796 KASSERT(mte->mte_vector != 0, ("no message vector")); 4797 mv = &dinfo->cfg.msix.msix_vectors[mte->mte_vector - 1]; 4798 KASSERT(mv->mv_irq == rman_get_start(irq), 4799 ("IRQ mismatch")); 4800 if (mv->mv_address == 0) { 4801 KASSERT(mte->mte_handlers == 0, 4802 ("MSI-X table entry has handlers, but vector not mapped")); 4803 error = PCIB_MAP_MSI(device_get_parent(dev), 4804 child, rman_get_start(irq), &addr, &data); 4805 if (error) 4806 goto bad; 4807 mv->mv_address = addr; 4808 mv->mv_data = data; 4809 } 4810 4811 /* 4812 * The MSIX table entry must be made valid by 4813 * incrementing the mte_handlers before 4814 * calling pci_enable_msix() and 4815 * pci_resume_msix(). Else the MSIX rewrite 4816 * table quirk will not work as expected. 4817 */ 4818 mte->mte_handlers++; 4819 if (mte->mte_handlers == 1) { 4820 pci_enable_msix(child, rid - 1, mv->mv_address, 4821 mv->mv_data); 4822 pci_unmask_msix(child, rid - 1); 4823 } 4824 } 4825 4826 /* 4827 * Make sure that INTx is disabled if we are using MSI/MSI-X, 4828 * unless the device is affected by PCI_QUIRK_MSI_INTX_BUG, 4829 * in which case we "enable" INTx so MSI/MSI-X actually works. 4830 */ 4831 if (!pci_has_quirk(pci_get_devid(child), 4832 PCI_QUIRK_MSI_INTX_BUG)) 4833 pci_set_command_bit(dev, child, PCIM_CMD_INTxDIS); 4834 else 4835 pci_clear_command_bit(dev, child, PCIM_CMD_INTxDIS); 4836 bad: 4837 if (error) { 4838 (void)bus_generic_teardown_intr(dev, child, irq, 4839 cookie); 4840 return (error); 4841 } 4842 } 4843 *cookiep = cookie; 4844 return (0); 4845 } 4846 4847 int 4848 pci_teardown_intr(device_t dev, device_t child, struct resource *irq, 4849 void *cookie) 4850 { 4851 struct msix_table_entry *mte; 4852 struct resource_list_entry *rle; 4853 struct pci_devinfo *dinfo; 4854 int error, rid; 4855 4856 if (irq == NULL || !(rman_get_flags(irq) & RF_ACTIVE)) 4857 return (EINVAL); 4858 4859 /* If this isn't a direct child, just bail out */ 4860 if (device_get_parent(child) != dev) 4861 return(bus_generic_teardown_intr(dev, child, irq, cookie)); 4862 4863 rid = rman_get_rid(irq); 4864 if (rid == 0) { 4865 /* Mask INTx */ 4866 pci_set_command_bit(dev, child, PCIM_CMD_INTxDIS); 4867 } else { 4868 /* 4869 * Check to see if the interrupt is MSI or MSI-X. If so, 4870 * decrement the appropriate handlers count and mask the 4871 * MSI-X message, or disable MSI messages if the count 4872 * drops to 0. 4873 */ 4874 dinfo = device_get_ivars(child); 4875 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, rid); 4876 if (rle->res != irq) 4877 return (EINVAL); 4878 if (dinfo->cfg.msi.msi_alloc > 0) { 4879 KASSERT(rid <= dinfo->cfg.msi.msi_alloc, 4880 ("MSI-X index too high")); 4881 if (dinfo->cfg.msi.msi_handlers == 0) 4882 return (EINVAL); 4883 dinfo->cfg.msi.msi_handlers--; 4884 if (dinfo->cfg.msi.msi_handlers == 0) 4885 pci_disable_msi(child); 4886 } else { 4887 KASSERT(dinfo->cfg.msix.msix_alloc > 0, 4888 ("No MSI or MSI-X interrupts allocated")); 4889 KASSERT(rid <= dinfo->cfg.msix.msix_table_len, 4890 ("MSI-X index too high")); 4891 mte = &dinfo->cfg.msix.msix_table[rid - 1]; 4892 if (mte->mte_handlers == 0) 4893 return (EINVAL); 4894 mte->mte_handlers--; 4895 if (mte->mte_handlers == 0) 4896 pci_mask_msix(child, rid - 1); 4897 } 4898 } 4899 error = bus_generic_teardown_intr(dev, child, irq, cookie); 4900 if (rid > 0) 4901 KASSERT(error == 0, 4902 ("%s: generic teardown failed for MSI/MSI-X", __func__)); 4903 return (error); 4904 } 4905 4906 int 4907 pci_print_child(device_t dev, device_t child) 4908 { 4909 struct pci_devinfo *dinfo; 4910 struct resource_list *rl; 4911 int retval = 0; 4912 4913 dinfo = device_get_ivars(child); 4914 rl = &dinfo->resources; 4915 4916 retval += bus_print_child_header(dev, child); 4917 4918 retval += resource_list_print_type(rl, "port", SYS_RES_IOPORT, "%#jx"); 4919 retval += resource_list_print_type(rl, "mem", SYS_RES_MEMORY, "%#jx"); 4920 retval += resource_list_print_type(rl, "irq", SYS_RES_IRQ, "%jd"); 4921 if (device_get_flags(dev)) 4922 retval += printf(" flags %#x", device_get_flags(dev)); 4923 4924 retval += printf(" at device %d.%d", pci_get_slot(child), 4925 pci_get_function(child)); 4926 4927 retval += bus_print_child_domain(dev, child); 4928 retval += bus_print_child_footer(dev, child); 4929 4930 return (retval); 4931 } 4932 4933 static const struct 4934 { 4935 int class; 4936 int subclass; 4937 int report; /* 0 = bootverbose, 1 = always */ 4938 const char *desc; 4939 } pci_nomatch_tab[] = { 4940 {PCIC_OLD, -1, 1, "old"}, 4941 {PCIC_OLD, PCIS_OLD_NONVGA, 1, "non-VGA display device"}, 4942 {PCIC_OLD, PCIS_OLD_VGA, 1, "VGA-compatible display device"}, 4943 {PCIC_STORAGE, -1, 1, "mass storage"}, 4944 {PCIC_STORAGE, PCIS_STORAGE_SCSI, 1, "SCSI"}, 4945 {PCIC_STORAGE, PCIS_STORAGE_IDE, 1, "ATA"}, 4946 {PCIC_STORAGE, PCIS_STORAGE_FLOPPY, 1, "floppy disk"}, 4947 {PCIC_STORAGE, PCIS_STORAGE_IPI, 1, "IPI"}, 4948 {PCIC_STORAGE, PCIS_STORAGE_RAID, 1, "RAID"}, 4949 {PCIC_STORAGE, PCIS_STORAGE_ATA_ADMA, 1, "ATA (ADMA)"}, 4950 {PCIC_STORAGE, PCIS_STORAGE_SATA, 1, "SATA"}, 4951 {PCIC_STORAGE, PCIS_STORAGE_SAS, 1, "SAS"}, 4952 {PCIC_STORAGE, PCIS_STORAGE_NVM, 1, "NVM"}, 4953 {PCIC_NETWORK, -1, 1, "network"}, 4954 {PCIC_NETWORK, PCIS_NETWORK_ETHERNET, 1, "ethernet"}, 4955 {PCIC_NETWORK, PCIS_NETWORK_TOKENRING, 1, "token ring"}, 4956 {PCIC_NETWORK, PCIS_NETWORK_FDDI, 1, "fddi"}, 4957 {PCIC_NETWORK, PCIS_NETWORK_ATM, 1, "ATM"}, 4958 {PCIC_NETWORK, PCIS_NETWORK_ISDN, 1, "ISDN"}, 4959 {PCIC_DISPLAY, -1, 1, "display"}, 4960 {PCIC_DISPLAY, PCIS_DISPLAY_VGA, 1, "VGA"}, 4961 {PCIC_DISPLAY, PCIS_DISPLAY_XGA, 1, "XGA"}, 4962 {PCIC_DISPLAY, PCIS_DISPLAY_3D, 1, "3D"}, 4963 {PCIC_MULTIMEDIA, -1, 1, "multimedia"}, 4964 {PCIC_MULTIMEDIA, PCIS_MULTIMEDIA_VIDEO, 1, "video"}, 4965 {PCIC_MULTIMEDIA, PCIS_MULTIMEDIA_AUDIO, 1, "audio"}, 4966 {PCIC_MULTIMEDIA, PCIS_MULTIMEDIA_TELE, 1, "telephony"}, 4967 {PCIC_MULTIMEDIA, PCIS_MULTIMEDIA_HDA, 1, "HDA"}, 4968 {PCIC_MEMORY, -1, 1, "memory"}, 4969 {PCIC_MEMORY, PCIS_MEMORY_RAM, 1, "RAM"}, 4970 {PCIC_MEMORY, PCIS_MEMORY_FLASH, 1, "flash"}, 4971 {PCIC_BRIDGE, -1, 1, "bridge"}, 4972 {PCIC_BRIDGE, PCIS_BRIDGE_HOST, 1, "HOST-PCI"}, 4973 {PCIC_BRIDGE, PCIS_BRIDGE_ISA, 1, "PCI-ISA"}, 4974 {PCIC_BRIDGE, PCIS_BRIDGE_EISA, 1, "PCI-EISA"}, 4975 {PCIC_BRIDGE, PCIS_BRIDGE_MCA, 1, "PCI-MCA"}, 4976 {PCIC_BRIDGE, PCIS_BRIDGE_PCI, 1, "PCI-PCI"}, 4977 {PCIC_BRIDGE, PCIS_BRIDGE_PCMCIA, 1, "PCI-PCMCIA"}, 4978 {PCIC_BRIDGE, PCIS_BRIDGE_NUBUS, 1, "PCI-NuBus"}, 4979 {PCIC_BRIDGE, PCIS_BRIDGE_CARDBUS, 1, "PCI-CardBus"}, 4980 {PCIC_BRIDGE, PCIS_BRIDGE_RACEWAY, 1, "PCI-RACEway"}, 4981 {PCIC_SIMPLECOMM, -1, 1, "simple comms"}, 4982 {PCIC_SIMPLECOMM, PCIS_SIMPLECOMM_UART, 1, "UART"}, /* could detect 16550 */ 4983 {PCIC_SIMPLECOMM, PCIS_SIMPLECOMM_PAR, 1, "parallel port"}, 4984 {PCIC_SIMPLECOMM, PCIS_SIMPLECOMM_MULSER, 1, "multiport serial"}, 4985 {PCIC_SIMPLECOMM, PCIS_SIMPLECOMM_MODEM, 1, "generic modem"}, 4986 {PCIC_BASEPERIPH, -1, 0, "base peripheral"}, 4987 {PCIC_BASEPERIPH, PCIS_BASEPERIPH_PIC, 1, "interrupt controller"}, 4988 {PCIC_BASEPERIPH, PCIS_BASEPERIPH_DMA, 1, "DMA controller"}, 4989 {PCIC_BASEPERIPH, PCIS_BASEPERIPH_TIMER, 1, "timer"}, 4990 {PCIC_BASEPERIPH, PCIS_BASEPERIPH_RTC, 1, "realtime clock"}, 4991 {PCIC_BASEPERIPH, PCIS_BASEPERIPH_PCIHOT, 1, "PCI hot-plug controller"}, 4992 {PCIC_BASEPERIPH, PCIS_BASEPERIPH_SDHC, 1, "SD host controller"}, 4993 {PCIC_BASEPERIPH, PCIS_BASEPERIPH_IOMMU, 1, "IOMMU"}, 4994 {PCIC_INPUTDEV, -1, 1, "input device"}, 4995 {PCIC_INPUTDEV, PCIS_INPUTDEV_KEYBOARD, 1, "keyboard"}, 4996 {PCIC_INPUTDEV, PCIS_INPUTDEV_DIGITIZER,1, "digitizer"}, 4997 {PCIC_INPUTDEV, PCIS_INPUTDEV_MOUSE, 1, "mouse"}, 4998 {PCIC_INPUTDEV, PCIS_INPUTDEV_SCANNER, 1, "scanner"}, 4999 {PCIC_INPUTDEV, PCIS_INPUTDEV_GAMEPORT, 1, "gameport"}, 5000 {PCIC_DOCKING, -1, 1, "docking station"}, 5001 {PCIC_PROCESSOR, -1, 1, "processor"}, 5002 {PCIC_SERIALBUS, -1, 1, "serial bus"}, 5003 {PCIC_SERIALBUS, PCIS_SERIALBUS_FW, 1, "FireWire"}, 5004 {PCIC_SERIALBUS, PCIS_SERIALBUS_ACCESS, 1, "AccessBus"}, 5005 {PCIC_SERIALBUS, PCIS_SERIALBUS_SSA, 1, "SSA"}, 5006 {PCIC_SERIALBUS, PCIS_SERIALBUS_USB, 1, "USB"}, 5007 {PCIC_SERIALBUS, PCIS_SERIALBUS_FC, 1, "Fibre Channel"}, 5008 {PCIC_SERIALBUS, PCIS_SERIALBUS_SMBUS, 0, "SMBus"}, 5009 {PCIC_WIRELESS, -1, 1, "wireless controller"}, 5010 {PCIC_WIRELESS, PCIS_WIRELESS_IRDA, 1, "iRDA"}, 5011 {PCIC_WIRELESS, PCIS_WIRELESS_IR, 1, "IR"}, 5012 {PCIC_WIRELESS, PCIS_WIRELESS_RF, 1, "RF"}, 5013 {PCIC_INTELLIIO, -1, 1, "intelligent I/O controller"}, 5014 {PCIC_INTELLIIO, PCIS_INTELLIIO_I2O, 1, "I2O"}, 5015 {PCIC_SATCOM, -1, 1, "satellite communication"}, 5016 {PCIC_SATCOM, PCIS_SATCOM_TV, 1, "sat TV"}, 5017 {PCIC_SATCOM, PCIS_SATCOM_AUDIO, 1, "sat audio"}, 5018 {PCIC_SATCOM, PCIS_SATCOM_VOICE, 1, "sat voice"}, 5019 {PCIC_SATCOM, PCIS_SATCOM_DATA, 1, "sat data"}, 5020 {PCIC_CRYPTO, -1, 1, "encrypt/decrypt"}, 5021 {PCIC_CRYPTO, PCIS_CRYPTO_NETCOMP, 1, "network/computer crypto"}, 5022 {PCIC_CRYPTO, PCIS_CRYPTO_ENTERTAIN, 1, "entertainment crypto"}, 5023 {PCIC_DASP, -1, 0, "dasp"}, 5024 {PCIC_DASP, PCIS_DASP_DPIO, 1, "DPIO module"}, 5025 {PCIC_DASP, PCIS_DASP_PERFCNTRS, 1, "performance counters"}, 5026 {PCIC_DASP, PCIS_DASP_COMM_SYNC, 1, "communication synchronizer"}, 5027 {PCIC_DASP, PCIS_DASP_MGMT_CARD, 1, "signal processing management"}, 5028 {PCIC_INSTRUMENT, -1, 0, "non-essential instrumentation"}, 5029 {0, 0, 0, NULL} 5030 }; 5031 5032 void 5033 pci_probe_nomatch(device_t dev, device_t child) 5034 { 5035 int i, report; 5036 const char *cp, *scp; 5037 char *device; 5038 5039 /* 5040 * Look for a listing for this device in a loaded device database. 5041 */ 5042 report = 1; 5043 if ((device = pci_describe_device(child)) != NULL) { 5044 device_printf(dev, "<%s>", device); 5045 free(device, M_DEVBUF); 5046 } else { 5047 /* 5048 * Scan the class/subclass descriptions for a general 5049 * description. 5050 */ 5051 cp = "unknown"; 5052 scp = NULL; 5053 for (i = 0; pci_nomatch_tab[i].desc != NULL; i++) { 5054 if (pci_nomatch_tab[i].class == pci_get_class(child)) { 5055 if (pci_nomatch_tab[i].subclass == -1) { 5056 cp = pci_nomatch_tab[i].desc; 5057 report = pci_nomatch_tab[i].report; 5058 } else if (pci_nomatch_tab[i].subclass == 5059 pci_get_subclass(child)) { 5060 scp = pci_nomatch_tab[i].desc; 5061 report = pci_nomatch_tab[i].report; 5062 } 5063 } 5064 } 5065 if (report || bootverbose) { 5066 device_printf(dev, "<%s%s%s>", 5067 cp ? cp : "", 5068 ((cp != NULL) && (scp != NULL)) ? ", " : "", 5069 scp ? scp : ""); 5070 } 5071 } 5072 if (report || bootverbose) { 5073 printf(" at device %d.%d (no driver attached)\n", 5074 pci_get_slot(child), pci_get_function(child)); 5075 } 5076 pci_cfg_save(child, device_get_ivars(child), 1); 5077 } 5078 5079 void 5080 pci_child_detached(device_t dev, device_t child) 5081 { 5082 struct pci_devinfo *dinfo; 5083 struct resource_list *rl; 5084 5085 dinfo = device_get_ivars(child); 5086 rl = &dinfo->resources; 5087 5088 /* 5089 * Have to deallocate IRQs before releasing any MSI messages and 5090 * have to release MSI messages before deallocating any memory 5091 * BARs. 5092 */ 5093 if (resource_list_release_active(rl, dev, child, SYS_RES_IRQ) != 0) 5094 pci_printf(&dinfo->cfg, "Device leaked IRQ resources\n"); 5095 if (dinfo->cfg.msi.msi_alloc != 0 || dinfo->cfg.msix.msix_alloc != 0) { 5096 if (dinfo->cfg.msi.msi_alloc != 0) 5097 pci_printf(&dinfo->cfg, "Device leaked %d MSI " 5098 "vectors\n", dinfo->cfg.msi.msi_alloc); 5099 else 5100 pci_printf(&dinfo->cfg, "Device leaked %d MSI-X " 5101 "vectors\n", dinfo->cfg.msix.msix_alloc); 5102 (void)pci_release_msi(child); 5103 } 5104 if (resource_list_release_active(rl, dev, child, SYS_RES_MEMORY) != 0) 5105 pci_printf(&dinfo->cfg, "Device leaked memory resources\n"); 5106 if (resource_list_release_active(rl, dev, child, SYS_RES_IOPORT) != 0) 5107 pci_printf(&dinfo->cfg, "Device leaked I/O resources\n"); 5108 #ifdef PCI_RES_BUS 5109 if (resource_list_release_active(rl, dev, child, PCI_RES_BUS) != 0) 5110 pci_printf(&dinfo->cfg, "Device leaked PCI bus numbers\n"); 5111 #endif 5112 5113 pci_cfg_save(child, dinfo, 1); 5114 } 5115 5116 /* 5117 * Parse the PCI device database, if loaded, and return a pointer to a 5118 * description of the device. 5119 * 5120 * The database is flat text formatted as follows: 5121 * 5122 * Any line not in a valid format is ignored. 5123 * Lines are terminated with newline '\n' characters. 5124 * 5125 * A VENDOR line consists of the 4 digit (hex) vendor code, a TAB, then 5126 * the vendor name. 5127 * 5128 * A DEVICE line is entered immediately below the corresponding VENDOR ID. 5129 * - devices cannot be listed without a corresponding VENDOR line. 5130 * A DEVICE line consists of a TAB, the 4 digit (hex) device code, 5131 * another TAB, then the device name. 5132 */ 5133 5134 /* 5135 * Assuming (ptr) points to the beginning of a line in the database, 5136 * return the vendor or device and description of the next entry. 5137 * The value of (vendor) or (device) inappropriate for the entry type 5138 * is set to -1. Returns nonzero at the end of the database. 5139 * 5140 * Note that this is slightly unrobust in the face of corrupt data; 5141 * we attempt to safeguard against this by spamming the end of the 5142 * database with a newline when we initialise. 5143 */ 5144 static int 5145 pci_describe_parse_line(char **ptr, int *vendor, int *device, char **desc) 5146 { 5147 char *cp = *ptr; 5148 int left; 5149 5150 *device = -1; 5151 *vendor = -1; 5152 **desc = '\0'; 5153 for (;;) { 5154 left = pci_vendordata_size - (cp - pci_vendordata); 5155 if (left <= 0) { 5156 *ptr = cp; 5157 return(1); 5158 } 5159 5160 /* vendor entry? */ 5161 if (*cp != '\t' && 5162 sscanf(cp, "%x\t%80[^\n]", vendor, *desc) == 2) 5163 break; 5164 /* device entry? */ 5165 if (*cp == '\t' && 5166 sscanf(cp, "%x\t%80[^\n]", device, *desc) == 2) 5167 break; 5168 5169 /* skip to next line */ 5170 while (*cp != '\n' && left > 0) { 5171 cp++; 5172 left--; 5173 } 5174 if (*cp == '\n') { 5175 cp++; 5176 left--; 5177 } 5178 } 5179 /* skip to next line */ 5180 while (*cp != '\n' && left > 0) { 5181 cp++; 5182 left--; 5183 } 5184 if (*cp == '\n' && left > 0) 5185 cp++; 5186 *ptr = cp; 5187 return(0); 5188 } 5189 5190 static char * 5191 pci_describe_device(device_t dev) 5192 { 5193 int vendor, device; 5194 char *desc, *vp, *dp, *line; 5195 5196 desc = vp = dp = NULL; 5197 5198 /* 5199 * If we have no vendor data, we can't do anything. 5200 */ 5201 if (pci_vendordata == NULL) 5202 goto out; 5203 5204 /* 5205 * Scan the vendor data looking for this device 5206 */ 5207 line = pci_vendordata; 5208 if ((vp = malloc(80, M_DEVBUF, M_NOWAIT)) == NULL) 5209 goto out; 5210 for (;;) { 5211 if (pci_describe_parse_line(&line, &vendor, &device, &vp)) 5212 goto out; 5213 if (vendor == pci_get_vendor(dev)) 5214 break; 5215 } 5216 if ((dp = malloc(80, M_DEVBUF, M_NOWAIT)) == NULL) 5217 goto out; 5218 for (;;) { 5219 if (pci_describe_parse_line(&line, &vendor, &device, &dp)) { 5220 *dp = 0; 5221 break; 5222 } 5223 if (vendor != -1) { 5224 *dp = 0; 5225 break; 5226 } 5227 if (device == pci_get_device(dev)) 5228 break; 5229 } 5230 if (dp[0] == '\0') 5231 snprintf(dp, 80, "0x%x", pci_get_device(dev)); 5232 if ((desc = malloc(strlen(vp) + strlen(dp) + 3, M_DEVBUF, M_NOWAIT)) != 5233 NULL) 5234 sprintf(desc, "%s, %s", vp, dp); 5235 out: 5236 if (vp != NULL) 5237 free(vp, M_DEVBUF); 5238 if (dp != NULL) 5239 free(dp, M_DEVBUF); 5240 return(desc); 5241 } 5242 5243 int 5244 pci_read_ivar(device_t dev, device_t child, int which, uintptr_t *result) 5245 { 5246 struct pci_devinfo *dinfo; 5247 pcicfgregs *cfg; 5248 5249 dinfo = device_get_ivars(child); 5250 cfg = &dinfo->cfg; 5251 5252 switch (which) { 5253 case PCI_IVAR_ETHADDR: 5254 /* 5255 * The generic accessor doesn't deal with failure, so 5256 * we set the return value, then return an error. 5257 */ 5258 *((uint8_t **) result) = NULL; 5259 return (EINVAL); 5260 case PCI_IVAR_SUBVENDOR: 5261 *result = cfg->subvendor; 5262 break; 5263 case PCI_IVAR_SUBDEVICE: 5264 *result = cfg->subdevice; 5265 break; 5266 case PCI_IVAR_VENDOR: 5267 *result = cfg->vendor; 5268 break; 5269 case PCI_IVAR_DEVICE: 5270 *result = cfg->device; 5271 break; 5272 case PCI_IVAR_DEVID: 5273 *result = (cfg->device << 16) | cfg->vendor; 5274 break; 5275 case PCI_IVAR_CLASS: 5276 *result = cfg->baseclass; 5277 break; 5278 case PCI_IVAR_SUBCLASS: 5279 *result = cfg->subclass; 5280 break; 5281 case PCI_IVAR_PROGIF: 5282 *result = cfg->progif; 5283 break; 5284 case PCI_IVAR_REVID: 5285 *result = cfg->revid; 5286 break; 5287 case PCI_IVAR_INTPIN: 5288 *result = cfg->intpin; 5289 break; 5290 case PCI_IVAR_IRQ: 5291 *result = cfg->intline; 5292 break; 5293 case PCI_IVAR_DOMAIN: 5294 *result = cfg->domain; 5295 break; 5296 case PCI_IVAR_BUS: 5297 *result = cfg->bus; 5298 break; 5299 case PCI_IVAR_SLOT: 5300 *result = cfg->slot; 5301 break; 5302 case PCI_IVAR_FUNCTION: 5303 *result = cfg->func; 5304 break; 5305 case PCI_IVAR_CMDREG: 5306 *result = cfg->cmdreg; 5307 break; 5308 case PCI_IVAR_CACHELNSZ: 5309 *result = cfg->cachelnsz; 5310 break; 5311 case PCI_IVAR_MINGNT: 5312 if (cfg->hdrtype != PCIM_HDRTYPE_NORMAL) { 5313 *result = -1; 5314 return (EINVAL); 5315 } 5316 *result = cfg->mingnt; 5317 break; 5318 case PCI_IVAR_MAXLAT: 5319 if (cfg->hdrtype != PCIM_HDRTYPE_NORMAL) { 5320 *result = -1; 5321 return (EINVAL); 5322 } 5323 *result = cfg->maxlat; 5324 break; 5325 case PCI_IVAR_LATTIMER: 5326 *result = cfg->lattimer; 5327 break; 5328 default: 5329 return (ENOENT); 5330 } 5331 return (0); 5332 } 5333 5334 int 5335 pci_write_ivar(device_t dev, device_t child, int which, uintptr_t value) 5336 { 5337 struct pci_devinfo *dinfo; 5338 5339 dinfo = device_get_ivars(child); 5340 5341 switch (which) { 5342 case PCI_IVAR_INTPIN: 5343 dinfo->cfg.intpin = value; 5344 return (0); 5345 case PCI_IVAR_ETHADDR: 5346 case PCI_IVAR_SUBVENDOR: 5347 case PCI_IVAR_SUBDEVICE: 5348 case PCI_IVAR_VENDOR: 5349 case PCI_IVAR_DEVICE: 5350 case PCI_IVAR_DEVID: 5351 case PCI_IVAR_CLASS: 5352 case PCI_IVAR_SUBCLASS: 5353 case PCI_IVAR_PROGIF: 5354 case PCI_IVAR_REVID: 5355 case PCI_IVAR_IRQ: 5356 case PCI_IVAR_DOMAIN: 5357 case PCI_IVAR_BUS: 5358 case PCI_IVAR_SLOT: 5359 case PCI_IVAR_FUNCTION: 5360 return (EINVAL); /* disallow for now */ 5361 5362 default: 5363 return (ENOENT); 5364 } 5365 } 5366 5367 #include "opt_ddb.h" 5368 #ifdef DDB 5369 #include <ddb/ddb.h> 5370 #include <sys/cons.h> 5371 5372 /* 5373 * List resources based on pci map registers, used for within ddb 5374 */ 5375 5376 DB_SHOW_COMMAND_FLAGS(pciregs, db_pci_dump, DB_CMD_MEMSAFE) 5377 { 5378 struct pci_devinfo *dinfo; 5379 struct devlist *devlist_head; 5380 struct pci_conf *p; 5381 const char *name; 5382 int i, error, none_count; 5383 5384 none_count = 0; 5385 /* get the head of the device queue */ 5386 devlist_head = &pci_devq; 5387 5388 /* 5389 * Go through the list of devices and print out devices 5390 */ 5391 for (error = 0, i = 0, 5392 dinfo = STAILQ_FIRST(devlist_head); 5393 (dinfo != NULL) && (error == 0) && (i < pci_numdevs) && !db_pager_quit; 5394 dinfo = STAILQ_NEXT(dinfo, pci_links), i++) { 5395 /* Populate pd_name and pd_unit */ 5396 name = NULL; 5397 if (dinfo->cfg.dev) 5398 name = device_get_name(dinfo->cfg.dev); 5399 5400 p = &dinfo->conf; 5401 db_printf("%s%d@pci%d:%d:%d:%d:\tclass=0x%06x card=0x%08x " 5402 "chip=0x%08x rev=0x%02x hdr=0x%02x\n", 5403 (name && *name) ? name : "none", 5404 (name && *name) ? (int)device_get_unit(dinfo->cfg.dev) : 5405 none_count++, 5406 p->pc_sel.pc_domain, p->pc_sel.pc_bus, p->pc_sel.pc_dev, 5407 p->pc_sel.pc_func, (p->pc_class << 16) | 5408 (p->pc_subclass << 8) | p->pc_progif, 5409 (p->pc_subdevice << 16) | p->pc_subvendor, 5410 (p->pc_device << 16) | p->pc_vendor, 5411 p->pc_revid, p->pc_hdr); 5412 } 5413 } 5414 #endif /* DDB */ 5415 5416 struct resource * 5417 pci_reserve_map(device_t dev, device_t child, int type, int *rid, 5418 rman_res_t start, rman_res_t end, rman_res_t count, u_int num, 5419 u_int flags) 5420 { 5421 struct pci_devinfo *dinfo = device_get_ivars(child); 5422 struct resource_list *rl = &dinfo->resources; 5423 struct resource *res; 5424 struct pci_map *pm; 5425 uint16_t cmd; 5426 pci_addr_t map, testval; 5427 int mapsize; 5428 5429 res = NULL; 5430 5431 /* If rid is managed by EA, ignore it */ 5432 if (pci_ea_is_enabled(child, *rid)) 5433 goto out; 5434 5435 pm = pci_find_bar(child, *rid); 5436 if (pm != NULL) { 5437 /* This is a BAR that we failed to allocate earlier. */ 5438 mapsize = pm->pm_size; 5439 map = pm->pm_value; 5440 } else { 5441 /* 5442 * Weed out the bogons, and figure out how large the 5443 * BAR/map is. BARs that read back 0 here are bogus 5444 * and unimplemented. Note: atapci in legacy mode are 5445 * special and handled elsewhere in the code. If you 5446 * have a atapci device in legacy mode and it fails 5447 * here, that other code is broken. 5448 */ 5449 pci_read_bar(child, *rid, &map, &testval, NULL); 5450 5451 /* 5452 * Determine the size of the BAR and ignore BARs with a size 5453 * of 0. Device ROM BARs use a different mask value. 5454 */ 5455 if (PCIR_IS_BIOS(&dinfo->cfg, *rid)) 5456 mapsize = pci_romsize(testval); 5457 else 5458 mapsize = pci_mapsize(testval); 5459 if (mapsize == 0) 5460 goto out; 5461 pm = pci_add_bar(child, *rid, map, mapsize); 5462 } 5463 5464 if (PCI_BAR_MEM(map) || PCIR_IS_BIOS(&dinfo->cfg, *rid)) { 5465 if (type != SYS_RES_MEMORY) { 5466 if (bootverbose) 5467 device_printf(dev, 5468 "child %s requested type %d for rid %#x," 5469 " but the BAR says it is an memio\n", 5470 device_get_nameunit(child), type, *rid); 5471 goto out; 5472 } 5473 } else { 5474 if (type != SYS_RES_IOPORT) { 5475 if (bootverbose) 5476 device_printf(dev, 5477 "child %s requested type %d for rid %#x," 5478 " but the BAR says it is an ioport\n", 5479 device_get_nameunit(child), type, *rid); 5480 goto out; 5481 } 5482 } 5483 5484 /* 5485 * For real BARs, we need to override the size that 5486 * the driver requests, because that's what the BAR 5487 * actually uses and we would otherwise have a 5488 * situation where we might allocate the excess to 5489 * another driver, which won't work. 5490 */ 5491 count = ((pci_addr_t)1 << mapsize) * num; 5492 if (RF_ALIGNMENT(flags) < mapsize) 5493 flags = (flags & ~RF_ALIGNMENT_MASK) | RF_ALIGNMENT_LOG2(mapsize); 5494 if (PCI_BAR_MEM(map) && (map & PCIM_BAR_MEM_PREFETCH)) 5495 flags |= RF_PREFETCHABLE; 5496 5497 /* 5498 * Allocate enough resource, and then write back the 5499 * appropriate BAR for that resource. 5500 */ 5501 resource_list_add(rl, type, *rid, start, end, count); 5502 res = resource_list_reserve(rl, dev, child, type, rid, start, end, 5503 count, flags & ~RF_ACTIVE); 5504 if (res == NULL) { 5505 resource_list_delete(rl, type, *rid); 5506 device_printf(child, 5507 "%#jx bytes of rid %#x res %d failed (%#jx, %#jx).\n", 5508 count, *rid, type, start, end); 5509 goto out; 5510 } 5511 if (bootverbose) 5512 device_printf(child, 5513 "Lazy allocation of %#jx bytes rid %#x type %d at %#jx\n", 5514 count, *rid, type, rman_get_start(res)); 5515 5516 /* Disable decoding via the CMD register before updating the BAR */ 5517 cmd = pci_read_config(child, PCIR_COMMAND, 2); 5518 pci_write_config(child, PCIR_COMMAND, 5519 cmd & ~(PCI_BAR_MEM(map) ? PCIM_CMD_MEMEN : PCIM_CMD_PORTEN), 2); 5520 5521 map = rman_get_start(res); 5522 pci_write_bar(child, pm, map); 5523 5524 /* Restore the original value of the CMD register */ 5525 pci_write_config(child, PCIR_COMMAND, cmd, 2); 5526 out: 5527 return (res); 5528 } 5529 5530 struct resource * 5531 pci_alloc_multi_resource(device_t dev, device_t child, int type, int *rid, 5532 rman_res_t start, rman_res_t end, rman_res_t count, u_long num, 5533 u_int flags) 5534 { 5535 struct pci_devinfo *dinfo; 5536 struct resource_list *rl; 5537 struct resource_list_entry *rle; 5538 struct resource *res; 5539 pcicfgregs *cfg; 5540 5541 /* 5542 * Perform lazy resource allocation 5543 */ 5544 dinfo = device_get_ivars(child); 5545 rl = &dinfo->resources; 5546 cfg = &dinfo->cfg; 5547 switch (type) { 5548 #if defined(NEW_PCIB) && defined(PCI_RES_BUS) 5549 case PCI_RES_BUS: 5550 return (pci_alloc_secbus(dev, child, rid, start, end, count, 5551 flags)); 5552 #endif 5553 case SYS_RES_IRQ: 5554 /* 5555 * Can't alloc legacy interrupt once MSI messages have 5556 * been allocated. 5557 */ 5558 if (*rid == 0 && (cfg->msi.msi_alloc > 0 || 5559 cfg->msix.msix_alloc > 0)) 5560 return (NULL); 5561 5562 /* 5563 * If the child device doesn't have an interrupt 5564 * routed and is deserving of an interrupt, try to 5565 * assign it one. 5566 */ 5567 if (*rid == 0 && !PCI_INTERRUPT_VALID(cfg->intline) && 5568 (cfg->intpin != 0)) 5569 pci_assign_interrupt(dev, child, 0); 5570 break; 5571 case SYS_RES_IOPORT: 5572 case SYS_RES_MEMORY: 5573 #ifdef NEW_PCIB 5574 /* 5575 * PCI-PCI bridge I/O window resources are not BARs. 5576 * For those allocations just pass the request up the 5577 * tree. 5578 */ 5579 if (cfg->hdrtype == PCIM_HDRTYPE_BRIDGE) { 5580 switch (*rid) { 5581 case PCIR_IOBASEL_1: 5582 case PCIR_MEMBASE_1: 5583 case PCIR_PMBASEL_1: 5584 /* 5585 * XXX: Should we bother creating a resource 5586 * list entry? 5587 */ 5588 return (bus_generic_alloc_resource(dev, child, 5589 type, rid, start, end, count, flags)); 5590 } 5591 } 5592 #endif 5593 /* Reserve resources for this BAR if needed. */ 5594 rle = resource_list_find(rl, type, *rid); 5595 if (rle == NULL) { 5596 res = pci_reserve_map(dev, child, type, rid, start, end, 5597 count, num, flags); 5598 if (res == NULL) 5599 return (NULL); 5600 } 5601 } 5602 return (resource_list_alloc(rl, dev, child, type, rid, 5603 start, end, count, flags)); 5604 } 5605 5606 struct resource * 5607 pci_alloc_resource(device_t dev, device_t child, int type, int *rid, 5608 rman_res_t start, rman_res_t end, rman_res_t count, u_int flags) 5609 { 5610 #ifdef PCI_IOV 5611 struct pci_devinfo *dinfo; 5612 #endif 5613 5614 if (device_get_parent(child) != dev) 5615 return (BUS_ALLOC_RESOURCE(device_get_parent(dev), child, 5616 type, rid, start, end, count, flags)); 5617 5618 #ifdef PCI_IOV 5619 dinfo = device_get_ivars(child); 5620 if (dinfo->cfg.flags & PCICFG_VF) { 5621 switch (type) { 5622 /* VFs can't have I/O BARs. */ 5623 case SYS_RES_IOPORT: 5624 return (NULL); 5625 case SYS_RES_MEMORY: 5626 return (pci_vf_alloc_mem_resource(dev, child, rid, 5627 start, end, count, flags)); 5628 } 5629 5630 /* Fall through for other types of resource allocations. */ 5631 } 5632 #endif 5633 5634 return (pci_alloc_multi_resource(dev, child, type, rid, start, end, 5635 count, 1, flags)); 5636 } 5637 5638 int 5639 pci_release_resource(device_t dev, device_t child, int type, int rid, 5640 struct resource *r) 5641 { 5642 struct pci_devinfo *dinfo; 5643 struct resource_list *rl; 5644 pcicfgregs *cfg __unused; 5645 5646 if (device_get_parent(child) != dev) 5647 return (BUS_RELEASE_RESOURCE(device_get_parent(dev), child, 5648 type, rid, r)); 5649 5650 dinfo = device_get_ivars(child); 5651 cfg = &dinfo->cfg; 5652 5653 #ifdef PCI_IOV 5654 if (cfg->flags & PCICFG_VF) { 5655 switch (type) { 5656 /* VFs can't have I/O BARs. */ 5657 case SYS_RES_IOPORT: 5658 return (EDOOFUS); 5659 case SYS_RES_MEMORY: 5660 return (pci_vf_release_mem_resource(dev, child, rid, 5661 r)); 5662 } 5663 5664 /* Fall through for other types of resource allocations. */ 5665 } 5666 #endif 5667 5668 #ifdef NEW_PCIB 5669 /* 5670 * PCI-PCI bridge I/O window resources are not BARs. For 5671 * those allocations just pass the request up the tree. 5672 */ 5673 if (cfg->hdrtype == PCIM_HDRTYPE_BRIDGE && 5674 (type == SYS_RES_IOPORT || type == SYS_RES_MEMORY)) { 5675 switch (rid) { 5676 case PCIR_IOBASEL_1: 5677 case PCIR_MEMBASE_1: 5678 case PCIR_PMBASEL_1: 5679 return (bus_generic_release_resource(dev, child, type, 5680 rid, r)); 5681 } 5682 } 5683 #endif 5684 5685 rl = &dinfo->resources; 5686 return (resource_list_release(rl, dev, child, type, rid, r)); 5687 } 5688 5689 int 5690 pci_activate_resource(device_t dev, device_t child, int type, int rid, 5691 struct resource *r) 5692 { 5693 struct pci_devinfo *dinfo; 5694 int error; 5695 5696 error = bus_generic_activate_resource(dev, child, type, rid, r); 5697 if (error) 5698 return (error); 5699 5700 /* Enable decoding in the command register when activating BARs. */ 5701 if (device_get_parent(child) == dev) { 5702 /* Device ROMs need their decoding explicitly enabled. */ 5703 dinfo = device_get_ivars(child); 5704 if (type == SYS_RES_MEMORY && PCIR_IS_BIOS(&dinfo->cfg, rid)) 5705 pci_write_bar(child, pci_find_bar(child, rid), 5706 rman_get_start(r) | PCIM_BIOS_ENABLE); 5707 switch (type) { 5708 case SYS_RES_IOPORT: 5709 case SYS_RES_MEMORY: 5710 error = PCI_ENABLE_IO(dev, child, type); 5711 break; 5712 } 5713 } 5714 return (error); 5715 } 5716 5717 int 5718 pci_deactivate_resource(device_t dev, device_t child, int type, 5719 int rid, struct resource *r) 5720 { 5721 struct pci_devinfo *dinfo; 5722 int error; 5723 5724 error = bus_generic_deactivate_resource(dev, child, type, rid, r); 5725 if (error) 5726 return (error); 5727 5728 /* Disable decoding for device ROMs. */ 5729 if (device_get_parent(child) == dev) { 5730 dinfo = device_get_ivars(child); 5731 if (type == SYS_RES_MEMORY && PCIR_IS_BIOS(&dinfo->cfg, rid)) 5732 pci_write_bar(child, pci_find_bar(child, rid), 5733 rman_get_start(r)); 5734 } 5735 return (0); 5736 } 5737 5738 void 5739 pci_child_deleted(device_t dev, device_t child) 5740 { 5741 struct resource_list_entry *rle; 5742 struct resource_list *rl; 5743 struct pci_devinfo *dinfo; 5744 5745 dinfo = device_get_ivars(child); 5746 rl = &dinfo->resources; 5747 5748 EVENTHANDLER_INVOKE(pci_delete_device, child); 5749 5750 /* Turn off access to resources we're about to free */ 5751 if (bus_child_present(child) != 0) { 5752 pci_write_config(child, PCIR_COMMAND, pci_read_config(child, 5753 PCIR_COMMAND, 2) & ~(PCIM_CMD_MEMEN | PCIM_CMD_PORTEN), 2); 5754 5755 pci_disable_busmaster(child); 5756 } 5757 5758 /* Free all allocated resources */ 5759 STAILQ_FOREACH(rle, rl, link) { 5760 if (rle->res) { 5761 if (rman_get_flags(rle->res) & RF_ACTIVE || 5762 resource_list_busy(rl, rle->type, rle->rid)) { 5763 pci_printf(&dinfo->cfg, 5764 "Resource still owned, oops. " 5765 "(type=%d, rid=%d, addr=%lx)\n", 5766 rle->type, rle->rid, 5767 rman_get_start(rle->res)); 5768 bus_release_resource(child, rle->type, rle->rid, 5769 rle->res); 5770 } 5771 resource_list_unreserve(rl, dev, child, rle->type, 5772 rle->rid); 5773 } 5774 } 5775 resource_list_free(rl); 5776 5777 pci_freecfg(dinfo); 5778 } 5779 5780 void 5781 pci_delete_resource(device_t dev, device_t child, int type, int rid) 5782 { 5783 struct pci_devinfo *dinfo; 5784 struct resource_list *rl; 5785 struct resource_list_entry *rle; 5786 5787 if (device_get_parent(child) != dev) 5788 return; 5789 5790 dinfo = device_get_ivars(child); 5791 rl = &dinfo->resources; 5792 rle = resource_list_find(rl, type, rid); 5793 if (rle == NULL) 5794 return; 5795 5796 if (rle->res) { 5797 if (rman_get_flags(rle->res) & RF_ACTIVE || 5798 resource_list_busy(rl, type, rid)) { 5799 device_printf(dev, "delete_resource: " 5800 "Resource still owned by child, oops. " 5801 "(type=%d, rid=%d, addr=%jx)\n", 5802 type, rid, rman_get_start(rle->res)); 5803 return; 5804 } 5805 resource_list_unreserve(rl, dev, child, type, rid); 5806 } 5807 resource_list_delete(rl, type, rid); 5808 } 5809 5810 struct resource_list * 5811 pci_get_resource_list (device_t dev, device_t child) 5812 { 5813 struct pci_devinfo *dinfo = device_get_ivars(child); 5814 5815 return (&dinfo->resources); 5816 } 5817 5818 #ifdef IOMMU 5819 bus_dma_tag_t 5820 pci_get_dma_tag(device_t bus, device_t dev) 5821 { 5822 bus_dma_tag_t tag; 5823 struct pci_softc *sc; 5824 5825 if (device_get_parent(dev) == bus) { 5826 /* try iommu and return if it works */ 5827 tag = iommu_get_dma_tag(bus, dev); 5828 } else 5829 tag = NULL; 5830 if (tag == NULL) { 5831 sc = device_get_softc(bus); 5832 tag = sc->sc_dma_tag; 5833 } 5834 return (tag); 5835 } 5836 #else 5837 bus_dma_tag_t 5838 pci_get_dma_tag(device_t bus, device_t dev) 5839 { 5840 struct pci_softc *sc = device_get_softc(bus); 5841 5842 return (sc->sc_dma_tag); 5843 } 5844 #endif 5845 5846 uint32_t 5847 pci_read_config_method(device_t dev, device_t child, int reg, int width) 5848 { 5849 struct pci_devinfo *dinfo = device_get_ivars(child); 5850 pcicfgregs *cfg = &dinfo->cfg; 5851 5852 #ifdef PCI_IOV 5853 /* 5854 * SR-IOV VFs don't implement the VID or DID registers, so we have to 5855 * emulate them here. 5856 */ 5857 if (cfg->flags & PCICFG_VF) { 5858 if (reg == PCIR_VENDOR) { 5859 switch (width) { 5860 case 4: 5861 return (cfg->device << 16 | cfg->vendor); 5862 case 2: 5863 return (cfg->vendor); 5864 case 1: 5865 return (cfg->vendor & 0xff); 5866 default: 5867 return (0xffffffff); 5868 } 5869 } else if (reg == PCIR_DEVICE) { 5870 switch (width) { 5871 /* Note that an unaligned 4-byte read is an error. */ 5872 case 2: 5873 return (cfg->device); 5874 case 1: 5875 return (cfg->device & 0xff); 5876 default: 5877 return (0xffffffff); 5878 } 5879 } 5880 } 5881 #endif 5882 5883 return (PCIB_READ_CONFIG(device_get_parent(dev), 5884 cfg->bus, cfg->slot, cfg->func, reg, width)); 5885 } 5886 5887 void 5888 pci_write_config_method(device_t dev, device_t child, int reg, 5889 uint32_t val, int width) 5890 { 5891 struct pci_devinfo *dinfo = device_get_ivars(child); 5892 pcicfgregs *cfg = &dinfo->cfg; 5893 5894 PCIB_WRITE_CONFIG(device_get_parent(dev), 5895 cfg->bus, cfg->slot, cfg->func, reg, val, width); 5896 } 5897 5898 int 5899 pci_child_location_method(device_t dev, device_t child, struct sbuf *sb) 5900 { 5901 5902 sbuf_printf(sb, "slot=%d function=%d dbsf=pci%d:%d:%d:%d", 5903 pci_get_slot(child), pci_get_function(child), pci_get_domain(child), 5904 pci_get_bus(child), pci_get_slot(child), pci_get_function(child)); 5905 return (0); 5906 } 5907 5908 int 5909 pci_child_pnpinfo_method(device_t dev, device_t child, struct sbuf *sb) 5910 { 5911 struct pci_devinfo *dinfo; 5912 pcicfgregs *cfg; 5913 5914 dinfo = device_get_ivars(child); 5915 cfg = &dinfo->cfg; 5916 sbuf_printf(sb, "vendor=0x%04x device=0x%04x subvendor=0x%04x " 5917 "subdevice=0x%04x class=0x%02x%02x%02x", cfg->vendor, cfg->device, 5918 cfg->subvendor, cfg->subdevice, cfg->baseclass, cfg->subclass, 5919 cfg->progif); 5920 return (0); 5921 } 5922 5923 int 5924 pci_get_device_path_method(device_t bus, device_t child, const char *locator, 5925 struct sbuf *sb) 5926 { 5927 device_t parent = device_get_parent(bus); 5928 int rv; 5929 5930 if (strcmp(locator, BUS_LOCATOR_UEFI) == 0) { 5931 rv = bus_generic_get_device_path(parent, bus, locator, sb); 5932 if (rv == 0) { 5933 sbuf_printf(sb, "/Pci(0x%x,0x%x)", pci_get_slot(child), 5934 pci_get_function(child)); 5935 } 5936 return (0); 5937 } 5938 return (bus_generic_get_device_path(bus, child, locator, sb)); 5939 } 5940 5941 int 5942 pci_assign_interrupt_method(device_t dev, device_t child) 5943 { 5944 struct pci_devinfo *dinfo = device_get_ivars(child); 5945 pcicfgregs *cfg = &dinfo->cfg; 5946 5947 return (PCIB_ROUTE_INTERRUPT(device_get_parent(dev), child, 5948 cfg->intpin)); 5949 } 5950 5951 static void 5952 pci_lookup(void *arg, const char *name, device_t *dev) 5953 { 5954 long val; 5955 char *end; 5956 int domain, bus, slot, func; 5957 5958 if (*dev != NULL) 5959 return; 5960 5961 /* 5962 * Accept pciconf-style selectors of either pciD:B:S:F or 5963 * pciB:S:F. In the latter case, the domain is assumed to 5964 * be zero. 5965 */ 5966 if (strncmp(name, "pci", 3) != 0) 5967 return; 5968 val = strtol(name + 3, &end, 10); 5969 if (val < 0 || val > INT_MAX || *end != ':') 5970 return; 5971 domain = val; 5972 val = strtol(end + 1, &end, 10); 5973 if (val < 0 || val > INT_MAX || *end != ':') 5974 return; 5975 bus = val; 5976 val = strtol(end + 1, &end, 10); 5977 if (val < 0 || val > INT_MAX) 5978 return; 5979 slot = val; 5980 if (*end == ':') { 5981 val = strtol(end + 1, &end, 10); 5982 if (val < 0 || val > INT_MAX || *end != '\0') 5983 return; 5984 func = val; 5985 } else if (*end == '\0') { 5986 func = slot; 5987 slot = bus; 5988 bus = domain; 5989 domain = 0; 5990 } else 5991 return; 5992 5993 if (domain > PCI_DOMAINMAX || bus > PCI_BUSMAX || slot > PCI_SLOTMAX || 5994 func > PCIE_ARI_FUNCMAX || (slot != 0 && func > PCI_FUNCMAX)) 5995 return; 5996 5997 *dev = pci_find_dbsf(domain, bus, slot, func); 5998 } 5999 6000 static int 6001 pci_modevent(module_t mod, int what, void *arg) 6002 { 6003 static struct cdev *pci_cdev; 6004 static eventhandler_tag tag; 6005 6006 switch (what) { 6007 case MOD_LOAD: 6008 STAILQ_INIT(&pci_devq); 6009 pci_generation = 0; 6010 pci_cdev = make_dev(&pcicdev, 0, UID_ROOT, GID_WHEEL, 0644, 6011 "pci"); 6012 pci_load_vendor_data(); 6013 tag = EVENTHANDLER_REGISTER(dev_lookup, pci_lookup, NULL, 6014 1000); 6015 break; 6016 6017 case MOD_UNLOAD: 6018 if (tag != NULL) 6019 EVENTHANDLER_DEREGISTER(dev_lookup, tag); 6020 destroy_dev(pci_cdev); 6021 break; 6022 } 6023 6024 return (0); 6025 } 6026 6027 static void 6028 pci_cfg_restore_pcie(device_t dev, struct pci_devinfo *dinfo) 6029 { 6030 #define WREG(n, v) pci_write_config(dev, pos + (n), (v), 2) 6031 struct pcicfg_pcie *cfg; 6032 int version, pos; 6033 6034 cfg = &dinfo->cfg.pcie; 6035 pos = cfg->pcie_location; 6036 6037 version = cfg->pcie_flags & PCIEM_FLAGS_VERSION; 6038 6039 WREG(PCIER_DEVICE_CTL, cfg->pcie_device_ctl); 6040 6041 if (version > 1 || cfg->pcie_type == PCIEM_TYPE_ROOT_PORT || 6042 cfg->pcie_type == PCIEM_TYPE_ENDPOINT || 6043 cfg->pcie_type == PCIEM_TYPE_LEGACY_ENDPOINT) 6044 WREG(PCIER_LINK_CTL, cfg->pcie_link_ctl); 6045 6046 if (version > 1 || (cfg->pcie_type == PCIEM_TYPE_ROOT_PORT || 6047 (cfg->pcie_type == PCIEM_TYPE_DOWNSTREAM_PORT && 6048 (cfg->pcie_flags & PCIEM_FLAGS_SLOT)))) 6049 WREG(PCIER_SLOT_CTL, cfg->pcie_slot_ctl); 6050 6051 if (version > 1 || cfg->pcie_type == PCIEM_TYPE_ROOT_PORT || 6052 cfg->pcie_type == PCIEM_TYPE_ROOT_EC) 6053 WREG(PCIER_ROOT_CTL, cfg->pcie_root_ctl); 6054 6055 if (version > 1) { 6056 WREG(PCIER_DEVICE_CTL2, cfg->pcie_device_ctl2); 6057 WREG(PCIER_LINK_CTL2, cfg->pcie_link_ctl2); 6058 WREG(PCIER_SLOT_CTL2, cfg->pcie_slot_ctl2); 6059 } 6060 #undef WREG 6061 } 6062 6063 static void 6064 pci_cfg_restore_pcix(device_t dev, struct pci_devinfo *dinfo) 6065 { 6066 pci_write_config(dev, dinfo->cfg.pcix.pcix_location + PCIXR_COMMAND, 6067 dinfo->cfg.pcix.pcix_command, 2); 6068 } 6069 6070 void 6071 pci_cfg_restore(device_t dev, struct pci_devinfo *dinfo) 6072 { 6073 6074 /* 6075 * Restore the device to full power mode. We must do this 6076 * before we restore the registers because moving from D3 to 6077 * D0 will cause the chip's BARs and some other registers to 6078 * be reset to some unknown power on reset values. Cut down 6079 * the noise on boot by doing nothing if we are already in 6080 * state D0. 6081 */ 6082 if (pci_get_powerstate(dev) != PCI_POWERSTATE_D0) 6083 pci_set_powerstate(dev, PCI_POWERSTATE_D0); 6084 pci_write_config(dev, PCIR_INTLINE, dinfo->cfg.intline, 1); 6085 pci_write_config(dev, PCIR_INTPIN, dinfo->cfg.intpin, 1); 6086 pci_write_config(dev, PCIR_CACHELNSZ, dinfo->cfg.cachelnsz, 1); 6087 pci_write_config(dev, PCIR_LATTIMER, dinfo->cfg.lattimer, 1); 6088 pci_write_config(dev, PCIR_PROGIF, dinfo->cfg.progif, 1); 6089 pci_write_config(dev, PCIR_REVID, dinfo->cfg.revid, 1); 6090 switch (dinfo->cfg.hdrtype & PCIM_HDRTYPE) { 6091 case PCIM_HDRTYPE_NORMAL: 6092 pci_write_config(dev, PCIR_MINGNT, dinfo->cfg.mingnt, 1); 6093 pci_write_config(dev, PCIR_MAXLAT, dinfo->cfg.maxlat, 1); 6094 break; 6095 case PCIM_HDRTYPE_BRIDGE: 6096 pci_write_config(dev, PCIR_SECLAT_1, 6097 dinfo->cfg.bridge.br_seclat, 1); 6098 pci_write_config(dev, PCIR_SUBBUS_1, 6099 dinfo->cfg.bridge.br_subbus, 1); 6100 pci_write_config(dev, PCIR_SECBUS_1, 6101 dinfo->cfg.bridge.br_secbus, 1); 6102 pci_write_config(dev, PCIR_PRIBUS_1, 6103 dinfo->cfg.bridge.br_pribus, 1); 6104 pci_write_config(dev, PCIR_BRIDGECTL_1, 6105 dinfo->cfg.bridge.br_control, 2); 6106 break; 6107 case PCIM_HDRTYPE_CARDBUS: 6108 pci_write_config(dev, PCIR_SECLAT_2, 6109 dinfo->cfg.bridge.br_seclat, 1); 6110 pci_write_config(dev, PCIR_SUBBUS_2, 6111 dinfo->cfg.bridge.br_subbus, 1); 6112 pci_write_config(dev, PCIR_SECBUS_2, 6113 dinfo->cfg.bridge.br_secbus, 1); 6114 pci_write_config(dev, PCIR_PRIBUS_2, 6115 dinfo->cfg.bridge.br_pribus, 1); 6116 pci_write_config(dev, PCIR_BRIDGECTL_2, 6117 dinfo->cfg.bridge.br_control, 2); 6118 break; 6119 } 6120 pci_restore_bars(dev); 6121 6122 if ((dinfo->cfg.hdrtype & PCIM_HDRTYPE) != PCIM_HDRTYPE_BRIDGE) 6123 pci_write_config(dev, PCIR_COMMAND, dinfo->cfg.cmdreg, 2); 6124 6125 /* 6126 * Restore extended capabilities for PCI-Express and PCI-X 6127 */ 6128 if (dinfo->cfg.pcie.pcie_location != 0) 6129 pci_cfg_restore_pcie(dev, dinfo); 6130 if (dinfo->cfg.pcix.pcix_location != 0) 6131 pci_cfg_restore_pcix(dev, dinfo); 6132 6133 /* Restore MSI and MSI-X configurations if they are present. */ 6134 if (dinfo->cfg.msi.msi_location != 0) 6135 pci_resume_msi(dev); 6136 if (dinfo->cfg.msix.msix_location != 0) 6137 pci_resume_msix(dev); 6138 6139 #ifdef PCI_IOV 6140 if (dinfo->cfg.iov != NULL) 6141 pci_iov_cfg_restore(dev, dinfo); 6142 #endif 6143 } 6144 6145 static void 6146 pci_cfg_save_pcie(device_t dev, struct pci_devinfo *dinfo) 6147 { 6148 #define RREG(n) pci_read_config(dev, pos + (n), 2) 6149 struct pcicfg_pcie *cfg; 6150 int version, pos; 6151 6152 cfg = &dinfo->cfg.pcie; 6153 pos = cfg->pcie_location; 6154 6155 cfg->pcie_flags = RREG(PCIER_FLAGS); 6156 6157 version = cfg->pcie_flags & PCIEM_FLAGS_VERSION; 6158 6159 cfg->pcie_device_ctl = RREG(PCIER_DEVICE_CTL); 6160 6161 if (version > 1 || cfg->pcie_type == PCIEM_TYPE_ROOT_PORT || 6162 cfg->pcie_type == PCIEM_TYPE_ENDPOINT || 6163 cfg->pcie_type == PCIEM_TYPE_LEGACY_ENDPOINT) 6164 cfg->pcie_link_ctl = RREG(PCIER_LINK_CTL); 6165 6166 if (version > 1 || (cfg->pcie_type == PCIEM_TYPE_ROOT_PORT || 6167 (cfg->pcie_type == PCIEM_TYPE_DOWNSTREAM_PORT && 6168 (cfg->pcie_flags & PCIEM_FLAGS_SLOT)))) 6169 cfg->pcie_slot_ctl = RREG(PCIER_SLOT_CTL); 6170 6171 if (version > 1 || cfg->pcie_type == PCIEM_TYPE_ROOT_PORT || 6172 cfg->pcie_type == PCIEM_TYPE_ROOT_EC) 6173 cfg->pcie_root_ctl = RREG(PCIER_ROOT_CTL); 6174 6175 if (version > 1) { 6176 cfg->pcie_device_ctl2 = RREG(PCIER_DEVICE_CTL2); 6177 cfg->pcie_link_ctl2 = RREG(PCIER_LINK_CTL2); 6178 cfg->pcie_slot_ctl2 = RREG(PCIER_SLOT_CTL2); 6179 } 6180 #undef RREG 6181 } 6182 6183 static void 6184 pci_cfg_save_pcix(device_t dev, struct pci_devinfo *dinfo) 6185 { 6186 dinfo->cfg.pcix.pcix_command = pci_read_config(dev, 6187 dinfo->cfg.pcix.pcix_location + PCIXR_COMMAND, 2); 6188 } 6189 6190 void 6191 pci_cfg_save(device_t dev, struct pci_devinfo *dinfo, int setstate) 6192 { 6193 uint32_t cls; 6194 int ps; 6195 6196 /* 6197 * Some drivers apparently write to these registers w/o updating our 6198 * cached copy. No harm happens if we update the copy, so do so here 6199 * so we can restore them. The COMMAND register is modified by the 6200 * bus w/o updating the cache. This should represent the normally 6201 * writable portion of the 'defined' part of type 0/1/2 headers. 6202 */ 6203 dinfo->cfg.vendor = pci_read_config(dev, PCIR_VENDOR, 2); 6204 dinfo->cfg.device = pci_read_config(dev, PCIR_DEVICE, 2); 6205 dinfo->cfg.cmdreg = pci_read_config(dev, PCIR_COMMAND, 2); 6206 dinfo->cfg.intline = pci_read_config(dev, PCIR_INTLINE, 1); 6207 dinfo->cfg.intpin = pci_read_config(dev, PCIR_INTPIN, 1); 6208 dinfo->cfg.cachelnsz = pci_read_config(dev, PCIR_CACHELNSZ, 1); 6209 dinfo->cfg.lattimer = pci_read_config(dev, PCIR_LATTIMER, 1); 6210 dinfo->cfg.baseclass = pci_read_config(dev, PCIR_CLASS, 1); 6211 dinfo->cfg.subclass = pci_read_config(dev, PCIR_SUBCLASS, 1); 6212 dinfo->cfg.progif = pci_read_config(dev, PCIR_PROGIF, 1); 6213 dinfo->cfg.revid = pci_read_config(dev, PCIR_REVID, 1); 6214 switch (dinfo->cfg.hdrtype & PCIM_HDRTYPE) { 6215 case PCIM_HDRTYPE_NORMAL: 6216 dinfo->cfg.subvendor = pci_read_config(dev, PCIR_SUBVEND_0, 2); 6217 dinfo->cfg.subdevice = pci_read_config(dev, PCIR_SUBDEV_0, 2); 6218 dinfo->cfg.mingnt = pci_read_config(dev, PCIR_MINGNT, 1); 6219 dinfo->cfg.maxlat = pci_read_config(dev, PCIR_MAXLAT, 1); 6220 break; 6221 case PCIM_HDRTYPE_BRIDGE: 6222 dinfo->cfg.bridge.br_seclat = pci_read_config(dev, 6223 PCIR_SECLAT_1, 1); 6224 dinfo->cfg.bridge.br_subbus = pci_read_config(dev, 6225 PCIR_SUBBUS_1, 1); 6226 dinfo->cfg.bridge.br_secbus = pci_read_config(dev, 6227 PCIR_SECBUS_1, 1); 6228 dinfo->cfg.bridge.br_pribus = pci_read_config(dev, 6229 PCIR_PRIBUS_1, 1); 6230 dinfo->cfg.bridge.br_control = pci_read_config(dev, 6231 PCIR_BRIDGECTL_1, 2); 6232 break; 6233 case PCIM_HDRTYPE_CARDBUS: 6234 dinfo->cfg.bridge.br_seclat = pci_read_config(dev, 6235 PCIR_SECLAT_2, 1); 6236 dinfo->cfg.bridge.br_subbus = pci_read_config(dev, 6237 PCIR_SUBBUS_2, 1); 6238 dinfo->cfg.bridge.br_secbus = pci_read_config(dev, 6239 PCIR_SECBUS_2, 1); 6240 dinfo->cfg.bridge.br_pribus = pci_read_config(dev, 6241 PCIR_PRIBUS_2, 1); 6242 dinfo->cfg.bridge.br_control = pci_read_config(dev, 6243 PCIR_BRIDGECTL_2, 2); 6244 dinfo->cfg.subvendor = pci_read_config(dev, PCIR_SUBVEND_2, 2); 6245 dinfo->cfg.subdevice = pci_read_config(dev, PCIR_SUBDEV_2, 2); 6246 break; 6247 } 6248 6249 if (dinfo->cfg.pcie.pcie_location != 0) 6250 pci_cfg_save_pcie(dev, dinfo); 6251 6252 if (dinfo->cfg.pcix.pcix_location != 0) 6253 pci_cfg_save_pcix(dev, dinfo); 6254 6255 #ifdef PCI_IOV 6256 if (dinfo->cfg.iov != NULL) 6257 pci_iov_cfg_save(dev, dinfo); 6258 #endif 6259 6260 /* 6261 * don't set the state for display devices, base peripherals and 6262 * memory devices since bad things happen when they are powered down. 6263 * We should (a) have drivers that can easily detach and (b) use 6264 * generic drivers for these devices so that some device actually 6265 * attaches. We need to make sure that when we implement (a) we don't 6266 * power the device down on a reattach. 6267 */ 6268 cls = pci_get_class(dev); 6269 if (!setstate) 6270 return; 6271 switch (pci_do_power_nodriver) 6272 { 6273 case 0: /* NO powerdown at all */ 6274 return; 6275 case 1: /* Conservative about what to power down */ 6276 if (cls == PCIC_STORAGE) 6277 return; 6278 /*FALLTHROUGH*/ 6279 case 2: /* Aggressive about what to power down */ 6280 if (cls == PCIC_DISPLAY || cls == PCIC_MEMORY || 6281 cls == PCIC_BASEPERIPH) 6282 return; 6283 /*FALLTHROUGH*/ 6284 case 3: /* Power down everything */ 6285 break; 6286 } 6287 /* 6288 * PCI spec says we can only go into D3 state from D0 state. 6289 * Transition from D[12] into D0 before going to D3 state. 6290 */ 6291 ps = pci_get_powerstate(dev); 6292 if (ps != PCI_POWERSTATE_D0 && ps != PCI_POWERSTATE_D3) 6293 pci_set_powerstate(dev, PCI_POWERSTATE_D0); 6294 if (pci_get_powerstate(dev) != PCI_POWERSTATE_D3) 6295 pci_set_powerstate(dev, PCI_POWERSTATE_D3); 6296 } 6297 6298 /* Wrapper APIs suitable for device driver use. */ 6299 void 6300 pci_save_state(device_t dev) 6301 { 6302 struct pci_devinfo *dinfo; 6303 6304 dinfo = device_get_ivars(dev); 6305 pci_cfg_save(dev, dinfo, 0); 6306 } 6307 6308 void 6309 pci_restore_state(device_t dev) 6310 { 6311 struct pci_devinfo *dinfo; 6312 6313 dinfo = device_get_ivars(dev); 6314 pci_cfg_restore(dev, dinfo); 6315 } 6316 6317 static int 6318 pci_get_id_method(device_t dev, device_t child, enum pci_id_type type, 6319 uintptr_t *id) 6320 { 6321 6322 return (PCIB_GET_ID(device_get_parent(dev), child, type, id)); 6323 } 6324 6325 /* Find the upstream port of a given PCI device in a root complex. */ 6326 device_t 6327 pci_find_pcie_root_port(device_t dev) 6328 { 6329 struct pci_devinfo *dinfo; 6330 devclass_t pci_class; 6331 device_t pcib, bus; 6332 6333 pci_class = devclass_find("pci"); 6334 KASSERT(device_get_devclass(device_get_parent(dev)) == pci_class, 6335 ("%s: non-pci device %s", __func__, device_get_nameunit(dev))); 6336 6337 /* 6338 * Walk the bridge hierarchy until we find a PCI-e root 6339 * port or a non-PCI device. 6340 */ 6341 for (;;) { 6342 bus = device_get_parent(dev); 6343 KASSERT(bus != NULL, ("%s: null parent of %s", __func__, 6344 device_get_nameunit(dev))); 6345 6346 pcib = device_get_parent(bus); 6347 KASSERT(pcib != NULL, ("%s: null bridge of %s", __func__, 6348 device_get_nameunit(bus))); 6349 6350 /* 6351 * pcib's parent must be a PCI bus for this to be a 6352 * PCI-PCI bridge. 6353 */ 6354 if (device_get_devclass(device_get_parent(pcib)) != pci_class) 6355 return (NULL); 6356 6357 dinfo = device_get_ivars(pcib); 6358 if (dinfo->cfg.pcie.pcie_location != 0 && 6359 dinfo->cfg.pcie.pcie_type == PCIEM_TYPE_ROOT_PORT) 6360 return (pcib); 6361 6362 dev = pcib; 6363 } 6364 } 6365 6366 /* 6367 * Wait for pending transactions to complete on a PCI-express function. 6368 * 6369 * The maximum delay is specified in milliseconds in max_delay. Note 6370 * that this function may sleep. 6371 * 6372 * Returns true if the function is idle and false if the timeout is 6373 * exceeded. If dev is not a PCI-express function, this returns true. 6374 */ 6375 bool 6376 pcie_wait_for_pending_transactions(device_t dev, u_int max_delay) 6377 { 6378 struct pci_devinfo *dinfo = device_get_ivars(dev); 6379 uint16_t sta; 6380 int cap; 6381 6382 cap = dinfo->cfg.pcie.pcie_location; 6383 if (cap == 0) 6384 return (true); 6385 6386 sta = pci_read_config(dev, cap + PCIER_DEVICE_STA, 2); 6387 while (sta & PCIEM_STA_TRANSACTION_PND) { 6388 if (max_delay == 0) 6389 return (false); 6390 6391 /* Poll once every 100 milliseconds up to the timeout. */ 6392 if (max_delay > 100) { 6393 pause_sbt("pcietp", 100 * SBT_1MS, 0, C_HARDCLOCK); 6394 max_delay -= 100; 6395 } else { 6396 pause_sbt("pcietp", max_delay * SBT_1MS, 0, 6397 C_HARDCLOCK); 6398 max_delay = 0; 6399 } 6400 sta = pci_read_config(dev, cap + PCIER_DEVICE_STA, 2); 6401 } 6402 6403 return (true); 6404 } 6405 6406 /* 6407 * Determine the maximum Completion Timeout in microseconds. 6408 * 6409 * For non-PCI-express functions this returns 0. 6410 */ 6411 int 6412 pcie_get_max_completion_timeout(device_t dev) 6413 { 6414 struct pci_devinfo *dinfo = device_get_ivars(dev); 6415 int cap; 6416 6417 cap = dinfo->cfg.pcie.pcie_location; 6418 if (cap == 0) 6419 return (0); 6420 6421 /* 6422 * Functions using the 1.x spec use the default timeout range of 6423 * 50 microseconds to 50 milliseconds. Functions that do not 6424 * support programmable timeouts also use this range. 6425 */ 6426 if ((dinfo->cfg.pcie.pcie_flags & PCIEM_FLAGS_VERSION) < 2 || 6427 (pci_read_config(dev, cap + PCIER_DEVICE_CAP2, 4) & 6428 PCIEM_CAP2_COMP_TIMO_RANGES) == 0) 6429 return (50 * 1000); 6430 6431 switch (pci_read_config(dev, cap + PCIER_DEVICE_CTL2, 2) & 6432 PCIEM_CTL2_COMP_TIMO_VAL) { 6433 case PCIEM_CTL2_COMP_TIMO_100US: 6434 return (100); 6435 case PCIEM_CTL2_COMP_TIMO_10MS: 6436 return (10 * 1000); 6437 case PCIEM_CTL2_COMP_TIMO_55MS: 6438 return (55 * 1000); 6439 case PCIEM_CTL2_COMP_TIMO_210MS: 6440 return (210 * 1000); 6441 case PCIEM_CTL2_COMP_TIMO_900MS: 6442 return (900 * 1000); 6443 case PCIEM_CTL2_COMP_TIMO_3500MS: 6444 return (3500 * 1000); 6445 case PCIEM_CTL2_COMP_TIMO_13S: 6446 return (13 * 1000 * 1000); 6447 case PCIEM_CTL2_COMP_TIMO_64S: 6448 return (64 * 1000 * 1000); 6449 default: 6450 return (50 * 1000); 6451 } 6452 } 6453 6454 void 6455 pcie_apei_error(device_t dev, int sev, uint8_t *aerp) 6456 { 6457 struct pci_devinfo *dinfo = device_get_ivars(dev); 6458 const char *s; 6459 int aer; 6460 uint32_t r, r1; 6461 uint16_t rs; 6462 6463 if (sev == PCIEM_STA_CORRECTABLE_ERROR) 6464 s = "Correctable"; 6465 else if (sev == PCIEM_STA_NON_FATAL_ERROR) 6466 s = "Uncorrectable (Non-Fatal)"; 6467 else 6468 s = "Uncorrectable (Fatal)"; 6469 device_printf(dev, "%s PCIe error reported by APEI\n", s); 6470 if (aerp) { 6471 if (sev == PCIEM_STA_CORRECTABLE_ERROR) { 6472 r = le32dec(aerp + PCIR_AER_COR_STATUS); 6473 r1 = le32dec(aerp + PCIR_AER_COR_MASK); 6474 } else { 6475 r = le32dec(aerp + PCIR_AER_UC_STATUS); 6476 r1 = le32dec(aerp + PCIR_AER_UC_MASK); 6477 } 6478 device_printf(dev, "status 0x%08x mask 0x%08x", r, r1); 6479 if (sev != PCIEM_STA_CORRECTABLE_ERROR) { 6480 r = le32dec(aerp + PCIR_AER_UC_SEVERITY); 6481 rs = le16dec(aerp + PCIR_AER_CAP_CONTROL); 6482 printf(" severity 0x%08x first %d\n", 6483 r, rs & 0x1f); 6484 } else 6485 printf("\n"); 6486 } 6487 6488 /* As kind of recovery just report and clear the error statuses. */ 6489 if (pci_find_extcap(dev, PCIZ_AER, &aer) == 0) { 6490 r = pci_read_config(dev, aer + PCIR_AER_UC_STATUS, 4); 6491 if (r != 0) { 6492 pci_write_config(dev, aer + PCIR_AER_UC_STATUS, r, 4); 6493 device_printf(dev, "Clearing UC AER errors 0x%08x\n", r); 6494 } 6495 6496 r = pci_read_config(dev, aer + PCIR_AER_COR_STATUS, 4); 6497 if (r != 0) { 6498 pci_write_config(dev, aer + PCIR_AER_COR_STATUS, r, 4); 6499 device_printf(dev, "Clearing COR AER errors 0x%08x\n", r); 6500 } 6501 } 6502 if (dinfo->cfg.pcie.pcie_location != 0) { 6503 rs = pci_read_config(dev, dinfo->cfg.pcie.pcie_location + 6504 PCIER_DEVICE_STA, 2); 6505 if ((rs & (PCIEM_STA_CORRECTABLE_ERROR | 6506 PCIEM_STA_NON_FATAL_ERROR | PCIEM_STA_FATAL_ERROR | 6507 PCIEM_STA_UNSUPPORTED_REQ)) != 0) { 6508 pci_write_config(dev, dinfo->cfg.pcie.pcie_location + 6509 PCIER_DEVICE_STA, rs, 2); 6510 device_printf(dev, "Clearing PCIe errors 0x%04x\n", rs); 6511 } 6512 } 6513 } 6514 6515 /* 6516 * Perform a Function Level Reset (FLR) on a device. 6517 * 6518 * This function first waits for any pending transactions to complete 6519 * within the timeout specified by max_delay. If transactions are 6520 * still pending, the function will return false without attempting a 6521 * reset. 6522 * 6523 * If dev is not a PCI-express function or does not support FLR, this 6524 * function returns false. 6525 * 6526 * Note that no registers are saved or restored. The caller is 6527 * responsible for saving and restoring any registers including 6528 * PCI-standard registers via pci_save_state() and 6529 * pci_restore_state(). 6530 */ 6531 bool 6532 pcie_flr(device_t dev, u_int max_delay, bool force) 6533 { 6534 struct pci_devinfo *dinfo = device_get_ivars(dev); 6535 uint16_t cmd, ctl; 6536 int compl_delay; 6537 int cap; 6538 6539 cap = dinfo->cfg.pcie.pcie_location; 6540 if (cap == 0) 6541 return (false); 6542 6543 if (!(pci_read_config(dev, cap + PCIER_DEVICE_CAP, 4) & PCIEM_CAP_FLR)) 6544 return (false); 6545 6546 /* 6547 * Disable busmastering to prevent generation of new 6548 * transactions while waiting for the device to go idle. If 6549 * the idle timeout fails, the command register is restored 6550 * which will re-enable busmastering. 6551 */ 6552 cmd = pci_read_config(dev, PCIR_COMMAND, 2); 6553 pci_write_config(dev, PCIR_COMMAND, cmd & ~(PCIM_CMD_BUSMASTEREN), 2); 6554 if (!pcie_wait_for_pending_transactions(dev, max_delay)) { 6555 if (!force) { 6556 pci_write_config(dev, PCIR_COMMAND, cmd, 2); 6557 return (false); 6558 } 6559 pci_printf(&dinfo->cfg, 6560 "Resetting with transactions pending after %d ms\n", 6561 max_delay); 6562 6563 /* 6564 * Extend the post-FLR delay to cover the maximum 6565 * Completion Timeout delay of anything in flight 6566 * during the FLR delay. Enforce a minimum delay of 6567 * at least 10ms. 6568 */ 6569 compl_delay = pcie_get_max_completion_timeout(dev) / 1000; 6570 if (compl_delay < 10) 6571 compl_delay = 10; 6572 } else 6573 compl_delay = 0; 6574 6575 /* Initiate the reset. */ 6576 ctl = pci_read_config(dev, cap + PCIER_DEVICE_CTL, 2); 6577 pci_write_config(dev, cap + PCIER_DEVICE_CTL, ctl | 6578 PCIEM_CTL_INITIATE_FLR, 2); 6579 6580 /* Wait for 100ms. */ 6581 pause_sbt("pcieflr", (100 + compl_delay) * SBT_1MS, 0, C_HARDCLOCK); 6582 6583 if (pci_read_config(dev, cap + PCIER_DEVICE_STA, 2) & 6584 PCIEM_STA_TRANSACTION_PND) 6585 pci_printf(&dinfo->cfg, "Transactions pending after FLR!\n"); 6586 return (true); 6587 } 6588 6589 /* 6590 * Attempt a power-management reset by cycling the device in/out of D3 6591 * state. PCI spec says we can only go into D3 state from D0 state. 6592 * Transition from D[12] into D0 before going to D3 state. 6593 */ 6594 int 6595 pci_power_reset(device_t dev) 6596 { 6597 int ps; 6598 6599 ps = pci_get_powerstate(dev); 6600 if (ps != PCI_POWERSTATE_D0 && ps != PCI_POWERSTATE_D3) 6601 pci_set_powerstate(dev, PCI_POWERSTATE_D0); 6602 pci_set_powerstate(dev, PCI_POWERSTATE_D3); 6603 pci_set_powerstate(dev, ps); 6604 return (0); 6605 } 6606 6607 /* 6608 * Try link drop and retrain of the downstream port of upstream 6609 * switch, for PCIe. According to the PCIe 3.0 spec 6.6.1, this must 6610 * cause Conventional Hot reset of the device in the slot. 6611 * Alternative, for PCIe, could be the secondary bus reset initiatied 6612 * on the upstream switch PCIR_BRIDGECTL_1, bit 6. 6613 */ 6614 int 6615 pcie_link_reset(device_t port, int pcie_location) 6616 { 6617 uint16_t v; 6618 6619 v = pci_read_config(port, pcie_location + PCIER_LINK_CTL, 2); 6620 v |= PCIEM_LINK_CTL_LINK_DIS; 6621 pci_write_config(port, pcie_location + PCIER_LINK_CTL, v, 2); 6622 pause_sbt("pcier1", mstosbt(20), 0, 0); 6623 v &= ~PCIEM_LINK_CTL_LINK_DIS; 6624 v |= PCIEM_LINK_CTL_RETRAIN_LINK; 6625 pci_write_config(port, pcie_location + PCIER_LINK_CTL, v, 2); 6626 pause_sbt("pcier2", mstosbt(100), 0, 0); /* 100 ms */ 6627 v = pci_read_config(port, pcie_location + PCIER_LINK_STA, 2); 6628 return ((v & PCIEM_LINK_STA_TRAINING) != 0 ? ETIMEDOUT : 0); 6629 } 6630 6631 static int 6632 pci_reset_post(device_t dev, device_t child) 6633 { 6634 6635 if (dev == device_get_parent(child)) 6636 pci_restore_state(child); 6637 return (0); 6638 } 6639 6640 static int 6641 pci_reset_prepare(device_t dev, device_t child) 6642 { 6643 6644 if (dev == device_get_parent(child)) 6645 pci_save_state(child); 6646 return (0); 6647 } 6648 6649 static int 6650 pci_reset_child(device_t dev, device_t child, int flags) 6651 { 6652 int error; 6653 6654 if (dev == NULL || device_get_parent(child) != dev) 6655 return (0); 6656 if ((flags & DEVF_RESET_DETACH) != 0) { 6657 error = device_get_state(child) == DS_ATTACHED ? 6658 device_detach(child) : 0; 6659 } else { 6660 error = BUS_SUSPEND_CHILD(dev, child); 6661 } 6662 if (error == 0) { 6663 if (!pcie_flr(child, 1000, false)) { 6664 error = BUS_RESET_PREPARE(dev, child); 6665 if (error == 0) 6666 pci_power_reset(child); 6667 BUS_RESET_POST(dev, child); 6668 } 6669 if ((flags & DEVF_RESET_DETACH) != 0) 6670 device_probe_and_attach(child); 6671 else 6672 BUS_RESUME_CHILD(dev, child); 6673 } 6674 return (error); 6675 } 6676 6677 const struct pci_device_table * 6678 pci_match_device(device_t child, const struct pci_device_table *id, size_t nelt) 6679 { 6680 bool match; 6681 uint16_t vendor, device, subvendor, subdevice, class, subclass, revid; 6682 6683 vendor = pci_get_vendor(child); 6684 device = pci_get_device(child); 6685 subvendor = pci_get_subvendor(child); 6686 subdevice = pci_get_subdevice(child); 6687 class = pci_get_class(child); 6688 subclass = pci_get_subclass(child); 6689 revid = pci_get_revid(child); 6690 while (nelt-- > 0) { 6691 match = true; 6692 if (id->match_flag_vendor) 6693 match &= vendor == id->vendor; 6694 if (id->match_flag_device) 6695 match &= device == id->device; 6696 if (id->match_flag_subvendor) 6697 match &= subvendor == id->subvendor; 6698 if (id->match_flag_subdevice) 6699 match &= subdevice == id->subdevice; 6700 if (id->match_flag_class) 6701 match &= class == id->class_id; 6702 if (id->match_flag_subclass) 6703 match &= subclass == id->subclass; 6704 if (id->match_flag_revid) 6705 match &= revid == id->revid; 6706 if (match) 6707 return (id); 6708 id++; 6709 } 6710 return (NULL); 6711 } 6712 6713 static void 6714 pci_print_faulted_dev_name(const struct pci_devinfo *dinfo) 6715 { 6716 const char *dev_name; 6717 device_t dev; 6718 6719 dev = dinfo->cfg.dev; 6720 printf("pci%d:%d:%d:%d", dinfo->cfg.domain, dinfo->cfg.bus, 6721 dinfo->cfg.slot, dinfo->cfg.func); 6722 dev_name = device_get_name(dev); 6723 if (dev_name != NULL) 6724 printf(" (%s%d)", dev_name, device_get_unit(dev)); 6725 } 6726 6727 void 6728 pci_print_faulted_dev(void) 6729 { 6730 struct pci_devinfo *dinfo; 6731 device_t dev; 6732 int aer, i; 6733 uint32_t r1, r2; 6734 uint16_t status; 6735 6736 STAILQ_FOREACH(dinfo, &pci_devq, pci_links) { 6737 dev = dinfo->cfg.dev; 6738 status = pci_read_config(dev, PCIR_STATUS, 2); 6739 status &= PCIM_STATUS_MDPERR | PCIM_STATUS_STABORT | 6740 PCIM_STATUS_RTABORT | PCIM_STATUS_RMABORT | 6741 PCIM_STATUS_SERR | PCIM_STATUS_PERR; 6742 if (status != 0) { 6743 pci_print_faulted_dev_name(dinfo); 6744 printf(" error 0x%04x\n", status); 6745 } 6746 if (dinfo->cfg.pcie.pcie_location != 0) { 6747 status = pci_read_config(dev, 6748 dinfo->cfg.pcie.pcie_location + 6749 PCIER_DEVICE_STA, 2); 6750 if ((status & (PCIEM_STA_CORRECTABLE_ERROR | 6751 PCIEM_STA_NON_FATAL_ERROR | PCIEM_STA_FATAL_ERROR | 6752 PCIEM_STA_UNSUPPORTED_REQ)) != 0) { 6753 pci_print_faulted_dev_name(dinfo); 6754 printf(" PCIe DEVCTL 0x%04x DEVSTA 0x%04x\n", 6755 pci_read_config(dev, 6756 dinfo->cfg.pcie.pcie_location + 6757 PCIER_DEVICE_CTL, 2), 6758 status); 6759 } 6760 } 6761 if (pci_find_extcap(dev, PCIZ_AER, &aer) == 0) { 6762 r1 = pci_read_config(dev, aer + PCIR_AER_UC_STATUS, 4); 6763 r2 = pci_read_config(dev, aer + PCIR_AER_COR_STATUS, 4); 6764 if (r1 != 0 || r2 != 0) { 6765 pci_print_faulted_dev_name(dinfo); 6766 printf(" AER UC 0x%08x Mask 0x%08x Svr 0x%08x\n" 6767 " COR 0x%08x Mask 0x%08x Ctl 0x%08x\n", 6768 r1, pci_read_config(dev, aer + 6769 PCIR_AER_UC_MASK, 4), 6770 pci_read_config(dev, aer + 6771 PCIR_AER_UC_SEVERITY, 4), 6772 r2, pci_read_config(dev, aer + 6773 PCIR_AER_COR_MASK, 4), 6774 pci_read_config(dev, aer + 6775 PCIR_AER_CAP_CONTROL, 4)); 6776 for (i = 0; i < 4; i++) { 6777 r1 = pci_read_config(dev, aer + 6778 PCIR_AER_HEADER_LOG + i * 4, 4); 6779 printf(" HL%d: 0x%08x\n", i, r1); 6780 } 6781 } 6782 } 6783 } 6784 } 6785 6786 #ifdef DDB 6787 DB_SHOW_COMMAND_FLAGS(pcierr, pci_print_faulted_dev_db, DB_CMD_MEMSAFE) 6788 { 6789 6790 pci_print_faulted_dev(); 6791 } 6792 6793 static void 6794 db_clear_pcie_errors(const struct pci_devinfo *dinfo) 6795 { 6796 device_t dev; 6797 int aer; 6798 uint32_t r; 6799 6800 dev = dinfo->cfg.dev; 6801 r = pci_read_config(dev, dinfo->cfg.pcie.pcie_location + 6802 PCIER_DEVICE_STA, 2); 6803 pci_write_config(dev, dinfo->cfg.pcie.pcie_location + 6804 PCIER_DEVICE_STA, r, 2); 6805 6806 if (pci_find_extcap(dev, PCIZ_AER, &aer) != 0) 6807 return; 6808 r = pci_read_config(dev, aer + PCIR_AER_UC_STATUS, 4); 6809 if (r != 0) 6810 pci_write_config(dev, aer + PCIR_AER_UC_STATUS, r, 4); 6811 r = pci_read_config(dev, aer + PCIR_AER_COR_STATUS, 4); 6812 if (r != 0) 6813 pci_write_config(dev, aer + PCIR_AER_COR_STATUS, r, 4); 6814 } 6815 6816 DB_COMMAND_FLAGS(pci_clearerr, db_pci_clearerr, DB_CMD_MEMSAFE) 6817 { 6818 struct pci_devinfo *dinfo; 6819 device_t dev; 6820 uint16_t status, status1; 6821 6822 STAILQ_FOREACH(dinfo, &pci_devq, pci_links) { 6823 dev = dinfo->cfg.dev; 6824 status1 = status = pci_read_config(dev, PCIR_STATUS, 2); 6825 status1 &= PCIM_STATUS_MDPERR | PCIM_STATUS_STABORT | 6826 PCIM_STATUS_RTABORT | PCIM_STATUS_RMABORT | 6827 PCIM_STATUS_SERR | PCIM_STATUS_PERR; 6828 if (status1 != 0) { 6829 status &= ~status1; 6830 pci_write_config(dev, PCIR_STATUS, status, 2); 6831 } 6832 if (dinfo->cfg.pcie.pcie_location != 0) 6833 db_clear_pcie_errors(dinfo); 6834 } 6835 } 6836 #endif 6837