1 /*- 2 * SPDX-License-Identifier: BSD-2-Clause-FreeBSD 3 * 4 * Copyright (c) 1997, Stefan Esser <se@freebsd.org> 5 * Copyright (c) 2000, Michael Smith <msmith@freebsd.org> 6 * Copyright (c) 2000, BSDi 7 * All rights reserved. 8 * 9 * Redistribution and use in source and binary forms, with or without 10 * modification, are permitted provided that the following conditions 11 * are met: 12 * 1. Redistributions of source code must retain the above copyright 13 * notice unmodified, this list of conditions, and the following 14 * disclaimer. 15 * 2. Redistributions in binary form must reproduce the above copyright 16 * notice, this list of conditions and the following disclaimer in the 17 * documentation and/or other materials provided with the distribution. 18 * 19 * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR 20 * IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES 21 * OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. 22 * IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, 23 * INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT 24 * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, 25 * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY 26 * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT 27 * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF 28 * THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. 29 */ 30 31 #include <sys/cdefs.h> 32 __FBSDID("$FreeBSD$"); 33 34 #include "opt_acpi.h" 35 #include "opt_iommu.h" 36 #include "opt_bus.h" 37 38 #include <sys/param.h> 39 #include <sys/conf.h> 40 #include <sys/endian.h> 41 #include <sys/eventhandler.h> 42 #include <sys/fcntl.h> 43 #include <sys/kernel.h> 44 #include <sys/limits.h> 45 #include <sys/linker.h> 46 #include <sys/malloc.h> 47 #include <sys/module.h> 48 #include <sys/queue.h> 49 #include <sys/sbuf.h> 50 #include <sys/sysctl.h> 51 #include <sys/systm.h> 52 #include <sys/taskqueue.h> 53 #include <sys/tree.h> 54 55 #include <vm/vm.h> 56 #include <vm/pmap.h> 57 #include <vm/vm_extern.h> 58 59 #include <sys/bus.h> 60 #include <machine/bus.h> 61 #include <sys/rman.h> 62 #include <machine/resource.h> 63 #include <machine/stdarg.h> 64 65 #if defined(__i386__) || defined(__amd64__) || defined(__powerpc__) 66 #include <machine/intr_machdep.h> 67 #endif 68 69 #include <sys/pciio.h> 70 #include <dev/pci/pcireg.h> 71 #include <dev/pci/pcivar.h> 72 #include <dev/pci/pci_private.h> 73 74 #ifdef PCI_IOV 75 #include <sys/nv.h> 76 #include <dev/pci/pci_iov_private.h> 77 #endif 78 79 #include <dev/usb/controller/xhcireg.h> 80 #include <dev/usb/controller/ehcireg.h> 81 #include <dev/usb/controller/ohcireg.h> 82 #include <dev/usb/controller/uhcireg.h> 83 84 #include <dev/iommu/iommu.h> 85 86 #include "pcib_if.h" 87 #include "pci_if.h" 88 89 #define PCIR_IS_BIOS(cfg, reg) \ 90 (((cfg)->hdrtype == PCIM_HDRTYPE_NORMAL && reg == PCIR_BIOS) || \ 91 ((cfg)->hdrtype == PCIM_HDRTYPE_BRIDGE && reg == PCIR_BIOS_1)) 92 93 static int pci_has_quirk(uint32_t devid, int quirk); 94 static pci_addr_t pci_mapbase(uint64_t mapreg); 95 static const char *pci_maptype(uint64_t mapreg); 96 static int pci_maprange(uint64_t mapreg); 97 static pci_addr_t pci_rombase(uint64_t mapreg); 98 static int pci_romsize(uint64_t testval); 99 static void pci_fixancient(pcicfgregs *cfg); 100 static int pci_printf(pcicfgregs *cfg, const char *fmt, ...); 101 102 static int pci_porten(device_t dev); 103 static int pci_memen(device_t dev); 104 static void pci_assign_interrupt(device_t bus, device_t dev, 105 int force_route); 106 static int pci_add_map(device_t bus, device_t dev, int reg, 107 struct resource_list *rl, int force, int prefetch); 108 static int pci_probe(device_t dev); 109 static void pci_load_vendor_data(void); 110 static int pci_describe_parse_line(char **ptr, int *vendor, 111 int *device, char **desc); 112 static char *pci_describe_device(device_t dev); 113 static int pci_modevent(module_t mod, int what, void *arg); 114 static void pci_hdrtypedata(device_t pcib, int b, int s, int f, 115 pcicfgregs *cfg); 116 static void pci_read_cap(device_t pcib, pcicfgregs *cfg); 117 static int pci_read_vpd_reg(device_t pcib, pcicfgregs *cfg, 118 int reg, uint32_t *data); 119 #if 0 120 static int pci_write_vpd_reg(device_t pcib, pcicfgregs *cfg, 121 int reg, uint32_t data); 122 #endif 123 static void pci_read_vpd(device_t pcib, pcicfgregs *cfg); 124 static void pci_mask_msix(device_t dev, u_int index); 125 static void pci_unmask_msix(device_t dev, u_int index); 126 static int pci_msi_blacklisted(void); 127 static int pci_msix_blacklisted(void); 128 static void pci_resume_msi(device_t dev); 129 static void pci_resume_msix(device_t dev); 130 static int pci_remap_intr_method(device_t bus, device_t dev, 131 u_int irq); 132 static void pci_hint_device_unit(device_t acdev, device_t child, 133 const char *name, int *unitp); 134 static int pci_reset_post(device_t dev, device_t child); 135 static int pci_reset_prepare(device_t dev, device_t child); 136 static int pci_reset_child(device_t dev, device_t child, 137 int flags); 138 139 static int pci_get_id_method(device_t dev, device_t child, 140 enum pci_id_type type, uintptr_t *rid); 141 static struct pci_devinfo * pci_fill_devinfo(device_t pcib, device_t bus, int d, 142 int b, int s, int f, uint16_t vid, uint16_t did); 143 144 static device_method_t pci_methods[] = { 145 /* Device interface */ 146 DEVMETHOD(device_probe, pci_probe), 147 DEVMETHOD(device_attach, pci_attach), 148 DEVMETHOD(device_detach, pci_detach), 149 DEVMETHOD(device_shutdown, bus_generic_shutdown), 150 DEVMETHOD(device_suspend, bus_generic_suspend), 151 DEVMETHOD(device_resume, pci_resume), 152 153 /* Bus interface */ 154 DEVMETHOD(bus_print_child, pci_print_child), 155 DEVMETHOD(bus_probe_nomatch, pci_probe_nomatch), 156 DEVMETHOD(bus_read_ivar, pci_read_ivar), 157 DEVMETHOD(bus_write_ivar, pci_write_ivar), 158 DEVMETHOD(bus_driver_added, pci_driver_added), 159 DEVMETHOD(bus_setup_intr, pci_setup_intr), 160 DEVMETHOD(bus_teardown_intr, pci_teardown_intr), 161 DEVMETHOD(bus_reset_prepare, pci_reset_prepare), 162 DEVMETHOD(bus_reset_post, pci_reset_post), 163 DEVMETHOD(bus_reset_child, pci_reset_child), 164 165 DEVMETHOD(bus_get_dma_tag, pci_get_dma_tag), 166 DEVMETHOD(bus_get_resource_list,pci_get_resource_list), 167 DEVMETHOD(bus_set_resource, bus_generic_rl_set_resource), 168 DEVMETHOD(bus_get_resource, bus_generic_rl_get_resource), 169 DEVMETHOD(bus_delete_resource, pci_delete_resource), 170 DEVMETHOD(bus_alloc_resource, pci_alloc_resource), 171 DEVMETHOD(bus_adjust_resource, bus_generic_adjust_resource), 172 DEVMETHOD(bus_release_resource, pci_release_resource), 173 DEVMETHOD(bus_activate_resource, pci_activate_resource), 174 DEVMETHOD(bus_deactivate_resource, pci_deactivate_resource), 175 DEVMETHOD(bus_child_deleted, pci_child_deleted), 176 DEVMETHOD(bus_child_detached, pci_child_detached), 177 DEVMETHOD(bus_child_pnpinfo, pci_child_pnpinfo_method), 178 DEVMETHOD(bus_child_location, pci_child_location_method), 179 DEVMETHOD(bus_get_device_path, pci_get_device_path_method), 180 DEVMETHOD(bus_hint_device_unit, pci_hint_device_unit), 181 DEVMETHOD(bus_remap_intr, pci_remap_intr_method), 182 DEVMETHOD(bus_suspend_child, pci_suspend_child), 183 DEVMETHOD(bus_resume_child, pci_resume_child), 184 DEVMETHOD(bus_rescan, pci_rescan_method), 185 186 /* PCI interface */ 187 DEVMETHOD(pci_read_config, pci_read_config_method), 188 DEVMETHOD(pci_write_config, pci_write_config_method), 189 DEVMETHOD(pci_enable_busmaster, pci_enable_busmaster_method), 190 DEVMETHOD(pci_disable_busmaster, pci_disable_busmaster_method), 191 DEVMETHOD(pci_enable_io, pci_enable_io_method), 192 DEVMETHOD(pci_disable_io, pci_disable_io_method), 193 DEVMETHOD(pci_get_vpd_ident, pci_get_vpd_ident_method), 194 DEVMETHOD(pci_get_vpd_readonly, pci_get_vpd_readonly_method), 195 DEVMETHOD(pci_get_powerstate, pci_get_powerstate_method), 196 DEVMETHOD(pci_set_powerstate, pci_set_powerstate_method), 197 DEVMETHOD(pci_assign_interrupt, pci_assign_interrupt_method), 198 DEVMETHOD(pci_find_cap, pci_find_cap_method), 199 DEVMETHOD(pci_find_next_cap, pci_find_next_cap_method), 200 DEVMETHOD(pci_find_extcap, pci_find_extcap_method), 201 DEVMETHOD(pci_find_next_extcap, pci_find_next_extcap_method), 202 DEVMETHOD(pci_find_htcap, pci_find_htcap_method), 203 DEVMETHOD(pci_find_next_htcap, pci_find_next_htcap_method), 204 DEVMETHOD(pci_alloc_msi, pci_alloc_msi_method), 205 DEVMETHOD(pci_alloc_msix, pci_alloc_msix_method), 206 DEVMETHOD(pci_enable_msi, pci_enable_msi_method), 207 DEVMETHOD(pci_enable_msix, pci_enable_msix_method), 208 DEVMETHOD(pci_disable_msi, pci_disable_msi_method), 209 DEVMETHOD(pci_remap_msix, pci_remap_msix_method), 210 DEVMETHOD(pci_release_msi, pci_release_msi_method), 211 DEVMETHOD(pci_msi_count, pci_msi_count_method), 212 DEVMETHOD(pci_msix_count, pci_msix_count_method), 213 DEVMETHOD(pci_msix_pba_bar, pci_msix_pba_bar_method), 214 DEVMETHOD(pci_msix_table_bar, pci_msix_table_bar_method), 215 DEVMETHOD(pci_get_id, pci_get_id_method), 216 DEVMETHOD(pci_alloc_devinfo, pci_alloc_devinfo_method), 217 DEVMETHOD(pci_child_added, pci_child_added_method), 218 #ifdef PCI_IOV 219 DEVMETHOD(pci_iov_attach, pci_iov_attach_method), 220 DEVMETHOD(pci_iov_detach, pci_iov_detach_method), 221 DEVMETHOD(pci_create_iov_child, pci_create_iov_child_method), 222 #endif 223 224 DEVMETHOD_END 225 }; 226 227 DEFINE_CLASS_0(pci, pci_driver, pci_methods, sizeof(struct pci_softc)); 228 229 static devclass_t pci_devclass; 230 EARLY_DRIVER_MODULE(pci, pcib, pci_driver, pci_devclass, pci_modevent, NULL, 231 BUS_PASS_BUS); 232 MODULE_VERSION(pci, 1); 233 234 static char *pci_vendordata; 235 static size_t pci_vendordata_size; 236 237 struct pci_quirk { 238 uint32_t devid; /* Vendor/device of the card */ 239 int type; 240 #define PCI_QUIRK_MAP_REG 1 /* PCI map register in weird place */ 241 #define PCI_QUIRK_DISABLE_MSI 2 /* Neither MSI nor MSI-X work */ 242 #define PCI_QUIRK_ENABLE_MSI_VM 3 /* Older chipset in VM where MSI works */ 243 #define PCI_QUIRK_UNMAP_REG 4 /* Ignore PCI map register */ 244 #define PCI_QUIRK_DISABLE_MSIX 5 /* MSI-X doesn't work */ 245 #define PCI_QUIRK_MSI_INTX_BUG 6 /* PCIM_CMD_INTxDIS disables MSI */ 246 #define PCI_QUIRK_REALLOC_BAR 7 /* Can't allocate memory at the default address */ 247 int arg1; 248 int arg2; 249 }; 250 251 static const struct pci_quirk pci_quirks[] = { 252 /* The Intel 82371AB and 82443MX have a map register at offset 0x90. */ 253 { 0x71138086, PCI_QUIRK_MAP_REG, 0x90, 0 }, 254 { 0x719b8086, PCI_QUIRK_MAP_REG, 0x90, 0 }, 255 /* As does the Serverworks OSB4 (the SMBus mapping register) */ 256 { 0x02001166, PCI_QUIRK_MAP_REG, 0x90, 0 }, 257 258 /* 259 * MSI doesn't work with the ServerWorks CNB20-HE Host Bridge 260 * or the CMIC-SL (AKA ServerWorks GC_LE). 261 */ 262 { 0x00141166, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 263 { 0x00171166, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 264 265 /* 266 * MSI doesn't work on earlier Intel chipsets including 267 * E7500, E7501, E7505, 845, 865, 875/E7210, and 855. 268 */ 269 { 0x25408086, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 270 { 0x254c8086, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 271 { 0x25508086, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 272 { 0x25608086, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 273 { 0x25708086, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 274 { 0x25788086, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 275 { 0x35808086, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 276 277 /* 278 * MSI doesn't work with devices behind the AMD 8131 HT-PCIX 279 * bridge. 280 */ 281 { 0x74501022, PCI_QUIRK_DISABLE_MSI, 0, 0 }, 282 283 /* 284 * Some virtualization environments emulate an older chipset 285 * but support MSI just fine. QEMU uses the Intel 82440. 286 */ 287 { 0x12378086, PCI_QUIRK_ENABLE_MSI_VM, 0, 0 }, 288 289 /* 290 * HPET MMIO base address may appear in Bar1 for AMD SB600 SMBus 291 * controller depending on SoftPciRst register (PM_IO 0x55 [7]). 292 * It prevents us from attaching hpet(4) when the bit is unset. 293 * Note this quirk only affects SB600 revision A13 and earlier. 294 * For SB600 A21 and later, firmware must set the bit to hide it. 295 * For SB700 and later, it is unused and hardcoded to zero. 296 */ 297 { 0x43851002, PCI_QUIRK_UNMAP_REG, 0x14, 0 }, 298 299 /* 300 * Atheros AR8161/AR8162/E2200/E2400/E2500 Ethernet controllers have 301 * a bug that MSI interrupt does not assert if PCIM_CMD_INTxDIS bit 302 * of the command register is set. 303 */ 304 { 0x10911969, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, 305 { 0xE0911969, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, 306 { 0xE0A11969, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, 307 { 0xE0B11969, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, 308 { 0x10901969, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, 309 310 /* 311 * Broadcom BCM5714(S)/BCM5715(S)/BCM5780(S) Ethernet MACs don't 312 * issue MSI interrupts with PCIM_CMD_INTxDIS set either. 313 */ 314 { 0x166814e4, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, /* BCM5714 */ 315 { 0x166914e4, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, /* BCM5714S */ 316 { 0x166a14e4, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, /* BCM5780 */ 317 { 0x166b14e4, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, /* BCM5780S */ 318 { 0x167814e4, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, /* BCM5715 */ 319 { 0x167914e4, PCI_QUIRK_MSI_INTX_BUG, 0, 0 }, /* BCM5715S */ 320 321 /* 322 * HPE Gen 10 VGA has a memory range that can't be allocated in the 323 * expected place. 324 */ 325 { 0x98741002, PCI_QUIRK_REALLOC_BAR, 0, 0 }, 326 { 0 } 327 }; 328 329 /* map register information */ 330 #define PCI_MAPMEM 0x01 /* memory map */ 331 #define PCI_MAPMEMP 0x02 /* prefetchable memory map */ 332 #define PCI_MAPPORT 0x04 /* port map */ 333 334 struct devlist pci_devq; 335 uint32_t pci_generation; 336 uint32_t pci_numdevs = 0; 337 static int pcie_chipset, pcix_chipset; 338 339 /* sysctl vars */ 340 SYSCTL_NODE(_hw, OID_AUTO, pci, CTLFLAG_RD | CTLFLAG_MPSAFE, 0, 341 "PCI bus tuning parameters"); 342 343 static int pci_enable_io_modes = 1; 344 SYSCTL_INT(_hw_pci, OID_AUTO, enable_io_modes, CTLFLAG_RWTUN, 345 &pci_enable_io_modes, 1, 346 "Enable I/O and memory bits in the config register. Some BIOSes do not" 347 " enable these bits correctly. We'd like to do this all the time, but" 348 " there are some peripherals that this causes problems with."); 349 350 static int pci_do_realloc_bars = 1; 351 SYSCTL_INT(_hw_pci, OID_AUTO, realloc_bars, CTLFLAG_RWTUN, 352 &pci_do_realloc_bars, 0, 353 "Attempt to allocate a new range for any BARs whose original " 354 "firmware-assigned ranges fail to allocate during the initial device scan."); 355 356 static int pci_do_power_nodriver = 0; 357 SYSCTL_INT(_hw_pci, OID_AUTO, do_power_nodriver, CTLFLAG_RWTUN, 358 &pci_do_power_nodriver, 0, 359 "Place a function into D3 state when no driver attaches to it. 0 means" 360 " disable. 1 means conservatively place devices into D3 state. 2 means" 361 " aggressively place devices into D3 state. 3 means put absolutely" 362 " everything in D3 state."); 363 364 int pci_do_power_resume = 1; 365 SYSCTL_INT(_hw_pci, OID_AUTO, do_power_resume, CTLFLAG_RWTUN, 366 &pci_do_power_resume, 1, 367 "Transition from D3 -> D0 on resume."); 368 369 int pci_do_power_suspend = 1; 370 SYSCTL_INT(_hw_pci, OID_AUTO, do_power_suspend, CTLFLAG_RWTUN, 371 &pci_do_power_suspend, 1, 372 "Transition from D0 -> D3 on suspend."); 373 374 static int pci_do_msi = 1; 375 SYSCTL_INT(_hw_pci, OID_AUTO, enable_msi, CTLFLAG_RWTUN, &pci_do_msi, 1, 376 "Enable support for MSI interrupts"); 377 378 static int pci_do_msix = 1; 379 SYSCTL_INT(_hw_pci, OID_AUTO, enable_msix, CTLFLAG_RWTUN, &pci_do_msix, 1, 380 "Enable support for MSI-X interrupts"); 381 382 static int pci_msix_rewrite_table = 0; 383 SYSCTL_INT(_hw_pci, OID_AUTO, msix_rewrite_table, CTLFLAG_RWTUN, 384 &pci_msix_rewrite_table, 0, 385 "Rewrite entire MSI-X table when updating MSI-X entries"); 386 387 static int pci_honor_msi_blacklist = 1; 388 SYSCTL_INT(_hw_pci, OID_AUTO, honor_msi_blacklist, CTLFLAG_RDTUN, 389 &pci_honor_msi_blacklist, 1, "Honor chipset blacklist for MSI/MSI-X"); 390 391 #if defined(__i386__) || defined(__amd64__) 392 static int pci_usb_takeover = 1; 393 #else 394 static int pci_usb_takeover = 0; 395 #endif 396 SYSCTL_INT(_hw_pci, OID_AUTO, usb_early_takeover, CTLFLAG_RDTUN, 397 &pci_usb_takeover, 1, 398 "Enable early takeover of USB controllers. Disable this if you depend on" 399 " BIOS emulation of USB devices, that is you use USB devices (like" 400 " keyboard or mouse) but do not load USB drivers"); 401 402 static int pci_clear_bars; 403 SYSCTL_INT(_hw_pci, OID_AUTO, clear_bars, CTLFLAG_RDTUN, &pci_clear_bars, 0, 404 "Ignore firmware-assigned resources for BARs."); 405 406 #if defined(NEW_PCIB) && defined(PCI_RES_BUS) 407 static int pci_clear_buses; 408 SYSCTL_INT(_hw_pci, OID_AUTO, clear_buses, CTLFLAG_RDTUN, &pci_clear_buses, 0, 409 "Ignore firmware-assigned bus numbers."); 410 #endif 411 412 static int pci_enable_ari = 1; 413 SYSCTL_INT(_hw_pci, OID_AUTO, enable_ari, CTLFLAG_RDTUN, &pci_enable_ari, 414 0, "Enable support for PCIe Alternative RID Interpretation"); 415 416 int pci_enable_aspm = 1; 417 SYSCTL_INT(_hw_pci, OID_AUTO, enable_aspm, CTLFLAG_RDTUN, &pci_enable_aspm, 418 0, "Enable support for PCIe Active State Power Management"); 419 420 static int pci_clear_aer_on_attach = 0; 421 SYSCTL_INT(_hw_pci, OID_AUTO, clear_aer_on_attach, CTLFLAG_RWTUN, 422 &pci_clear_aer_on_attach, 0, 423 "Clear port and device AER state on driver attach"); 424 425 static int 426 pci_has_quirk(uint32_t devid, int quirk) 427 { 428 const struct pci_quirk *q; 429 430 for (q = &pci_quirks[0]; q->devid; q++) { 431 if (q->devid == devid && q->type == quirk) 432 return (1); 433 } 434 return (0); 435 } 436 437 /* Find a device_t by bus/slot/function in domain 0 */ 438 439 device_t 440 pci_find_bsf(uint8_t bus, uint8_t slot, uint8_t func) 441 { 442 443 return (pci_find_dbsf(0, bus, slot, func)); 444 } 445 446 /* Find a device_t by domain/bus/slot/function */ 447 448 device_t 449 pci_find_dbsf(uint32_t domain, uint8_t bus, uint8_t slot, uint8_t func) 450 { 451 struct pci_devinfo *dinfo = NULL; 452 453 STAILQ_FOREACH(dinfo, &pci_devq, pci_links) { 454 if ((dinfo->cfg.domain == domain) && 455 (dinfo->cfg.bus == bus) && 456 (dinfo->cfg.slot == slot) && 457 (dinfo->cfg.func == func)) { 458 break; 459 } 460 } 461 462 return (dinfo != NULL ? dinfo->cfg.dev : NULL); 463 } 464 465 /* Find a device_t by vendor/device ID */ 466 467 device_t 468 pci_find_device(uint16_t vendor, uint16_t device) 469 { 470 struct pci_devinfo *dinfo; 471 472 STAILQ_FOREACH(dinfo, &pci_devq, pci_links) { 473 if ((dinfo->cfg.vendor == vendor) && 474 (dinfo->cfg.device == device)) { 475 return (dinfo->cfg.dev); 476 } 477 } 478 479 return (NULL); 480 } 481 482 device_t 483 pci_find_class(uint8_t class, uint8_t subclass) 484 { 485 struct pci_devinfo *dinfo; 486 487 STAILQ_FOREACH(dinfo, &pci_devq, pci_links) { 488 if (dinfo->cfg.baseclass == class && 489 dinfo->cfg.subclass == subclass) { 490 return (dinfo->cfg.dev); 491 } 492 } 493 494 return (NULL); 495 } 496 497 device_t 498 pci_find_class_from(uint8_t class, uint8_t subclass, device_t from) 499 { 500 struct pci_devinfo *dinfo; 501 bool found = false; 502 503 STAILQ_FOREACH(dinfo, &pci_devq, pci_links) { 504 if (from != NULL && found == false) { 505 if (from != dinfo->cfg.dev) 506 continue; 507 found = true; 508 continue; 509 } 510 if (dinfo->cfg.baseclass == class && 511 dinfo->cfg.subclass == subclass) { 512 return (dinfo->cfg.dev); 513 } 514 } 515 516 return (NULL); 517 } 518 519 static int 520 pci_printf(pcicfgregs *cfg, const char *fmt, ...) 521 { 522 va_list ap; 523 int retval; 524 525 retval = printf("pci%d:%d:%d:%d: ", cfg->domain, cfg->bus, cfg->slot, 526 cfg->func); 527 va_start(ap, fmt); 528 retval += vprintf(fmt, ap); 529 va_end(ap); 530 return (retval); 531 } 532 533 /* return base address of memory or port map */ 534 535 static pci_addr_t 536 pci_mapbase(uint64_t mapreg) 537 { 538 539 if (PCI_BAR_MEM(mapreg)) 540 return (mapreg & PCIM_BAR_MEM_BASE); 541 else 542 return (mapreg & PCIM_BAR_IO_BASE); 543 } 544 545 /* return map type of memory or port map */ 546 547 static const char * 548 pci_maptype(uint64_t mapreg) 549 { 550 551 if (PCI_BAR_IO(mapreg)) 552 return ("I/O Port"); 553 if (mapreg & PCIM_BAR_MEM_PREFETCH) 554 return ("Prefetchable Memory"); 555 return ("Memory"); 556 } 557 558 /* return log2 of map size decoded for memory or port map */ 559 560 int 561 pci_mapsize(uint64_t testval) 562 { 563 int ln2size; 564 565 testval = pci_mapbase(testval); 566 ln2size = 0; 567 if (testval != 0) { 568 while ((testval & 1) == 0) 569 { 570 ln2size++; 571 testval >>= 1; 572 } 573 } 574 return (ln2size); 575 } 576 577 /* return base address of device ROM */ 578 579 static pci_addr_t 580 pci_rombase(uint64_t mapreg) 581 { 582 583 return (mapreg & PCIM_BIOS_ADDR_MASK); 584 } 585 586 /* return log2 of map size decided for device ROM */ 587 588 static int 589 pci_romsize(uint64_t testval) 590 { 591 int ln2size; 592 593 testval = pci_rombase(testval); 594 ln2size = 0; 595 if (testval != 0) { 596 while ((testval & 1) == 0) 597 { 598 ln2size++; 599 testval >>= 1; 600 } 601 } 602 return (ln2size); 603 } 604 605 /* return log2 of address range supported by map register */ 606 607 static int 608 pci_maprange(uint64_t mapreg) 609 { 610 int ln2range = 0; 611 612 if (PCI_BAR_IO(mapreg)) 613 ln2range = 32; 614 else 615 switch (mapreg & PCIM_BAR_MEM_TYPE) { 616 case PCIM_BAR_MEM_32: 617 ln2range = 32; 618 break; 619 case PCIM_BAR_MEM_1MB: 620 ln2range = 20; 621 break; 622 case PCIM_BAR_MEM_64: 623 ln2range = 64; 624 break; 625 } 626 return (ln2range); 627 } 628 629 /* adjust some values from PCI 1.0 devices to match 2.0 standards ... */ 630 631 static void 632 pci_fixancient(pcicfgregs *cfg) 633 { 634 if ((cfg->hdrtype & PCIM_HDRTYPE) != PCIM_HDRTYPE_NORMAL) 635 return; 636 637 /* PCI to PCI bridges use header type 1 */ 638 if (cfg->baseclass == PCIC_BRIDGE && cfg->subclass == PCIS_BRIDGE_PCI) 639 cfg->hdrtype = PCIM_HDRTYPE_BRIDGE; 640 } 641 642 /* extract header type specific config data */ 643 644 static void 645 pci_hdrtypedata(device_t pcib, int b, int s, int f, pcicfgregs *cfg) 646 { 647 #define REG(n, w) PCIB_READ_CONFIG(pcib, b, s, f, n, w) 648 switch (cfg->hdrtype & PCIM_HDRTYPE) { 649 case PCIM_HDRTYPE_NORMAL: 650 cfg->subvendor = REG(PCIR_SUBVEND_0, 2); 651 cfg->subdevice = REG(PCIR_SUBDEV_0, 2); 652 cfg->mingnt = REG(PCIR_MINGNT, 1); 653 cfg->maxlat = REG(PCIR_MAXLAT, 1); 654 cfg->nummaps = PCI_MAXMAPS_0; 655 break; 656 case PCIM_HDRTYPE_BRIDGE: 657 cfg->bridge.br_seclat = REG(PCIR_SECLAT_1, 1); 658 cfg->bridge.br_subbus = REG(PCIR_SUBBUS_1, 1); 659 cfg->bridge.br_secbus = REG(PCIR_SECBUS_1, 1); 660 cfg->bridge.br_pribus = REG(PCIR_PRIBUS_1, 1); 661 cfg->bridge.br_control = REG(PCIR_BRIDGECTL_1, 2); 662 cfg->nummaps = PCI_MAXMAPS_1; 663 break; 664 case PCIM_HDRTYPE_CARDBUS: 665 cfg->bridge.br_seclat = REG(PCIR_SECLAT_2, 1); 666 cfg->bridge.br_subbus = REG(PCIR_SUBBUS_2, 1); 667 cfg->bridge.br_secbus = REG(PCIR_SECBUS_2, 1); 668 cfg->bridge.br_pribus = REG(PCIR_PRIBUS_2, 1); 669 cfg->bridge.br_control = REG(PCIR_BRIDGECTL_2, 2); 670 cfg->subvendor = REG(PCIR_SUBVEND_2, 2); 671 cfg->subdevice = REG(PCIR_SUBDEV_2, 2); 672 cfg->nummaps = PCI_MAXMAPS_2; 673 break; 674 } 675 #undef REG 676 } 677 678 /* read configuration header into pcicfgregs structure */ 679 struct pci_devinfo * 680 pci_read_device(device_t pcib, device_t bus, int d, int b, int s, int f) 681 { 682 #define REG(n, w) PCIB_READ_CONFIG(pcib, b, s, f, n, w) 683 uint16_t vid, did; 684 685 vid = REG(PCIR_VENDOR, 2); 686 if (vid == PCIV_INVALID) 687 return (NULL); 688 689 did = REG(PCIR_DEVICE, 2); 690 691 return (pci_fill_devinfo(pcib, bus, d, b, s, f, vid, did)); 692 } 693 694 struct pci_devinfo * 695 pci_alloc_devinfo_method(device_t dev) 696 { 697 698 return (malloc(sizeof(struct pci_devinfo), M_DEVBUF, 699 M_WAITOK | M_ZERO)); 700 } 701 702 static struct pci_devinfo * 703 pci_fill_devinfo(device_t pcib, device_t bus, int d, int b, int s, int f, 704 uint16_t vid, uint16_t did) 705 { 706 struct pci_devinfo *devlist_entry; 707 pcicfgregs *cfg; 708 709 devlist_entry = PCI_ALLOC_DEVINFO(bus); 710 711 cfg = &devlist_entry->cfg; 712 713 cfg->domain = d; 714 cfg->bus = b; 715 cfg->slot = s; 716 cfg->func = f; 717 cfg->vendor = vid; 718 cfg->device = did; 719 cfg->cmdreg = REG(PCIR_COMMAND, 2); 720 cfg->statreg = REG(PCIR_STATUS, 2); 721 cfg->baseclass = REG(PCIR_CLASS, 1); 722 cfg->subclass = REG(PCIR_SUBCLASS, 1); 723 cfg->progif = REG(PCIR_PROGIF, 1); 724 cfg->revid = REG(PCIR_REVID, 1); 725 cfg->hdrtype = REG(PCIR_HDRTYPE, 1); 726 cfg->cachelnsz = REG(PCIR_CACHELNSZ, 1); 727 cfg->lattimer = REG(PCIR_LATTIMER, 1); 728 cfg->intpin = REG(PCIR_INTPIN, 1); 729 cfg->intline = REG(PCIR_INTLINE, 1); 730 731 cfg->mfdev = (cfg->hdrtype & PCIM_MFDEV) != 0; 732 cfg->hdrtype &= ~PCIM_MFDEV; 733 STAILQ_INIT(&cfg->maps); 734 735 cfg->iov = NULL; 736 737 pci_fixancient(cfg); 738 pci_hdrtypedata(pcib, b, s, f, cfg); 739 740 if (REG(PCIR_STATUS, 2) & PCIM_STATUS_CAPPRESENT) 741 pci_read_cap(pcib, cfg); 742 743 STAILQ_INSERT_TAIL(&pci_devq, devlist_entry, pci_links); 744 745 devlist_entry->conf.pc_sel.pc_domain = cfg->domain; 746 devlist_entry->conf.pc_sel.pc_bus = cfg->bus; 747 devlist_entry->conf.pc_sel.pc_dev = cfg->slot; 748 devlist_entry->conf.pc_sel.pc_func = cfg->func; 749 devlist_entry->conf.pc_hdr = cfg->hdrtype; 750 751 devlist_entry->conf.pc_subvendor = cfg->subvendor; 752 devlist_entry->conf.pc_subdevice = cfg->subdevice; 753 devlist_entry->conf.pc_vendor = cfg->vendor; 754 devlist_entry->conf.pc_device = cfg->device; 755 756 devlist_entry->conf.pc_class = cfg->baseclass; 757 devlist_entry->conf.pc_subclass = cfg->subclass; 758 devlist_entry->conf.pc_progif = cfg->progif; 759 devlist_entry->conf.pc_revid = cfg->revid; 760 761 pci_numdevs++; 762 pci_generation++; 763 764 return (devlist_entry); 765 } 766 #undef REG 767 768 static void 769 pci_ea_fill_info(device_t pcib, pcicfgregs *cfg) 770 { 771 #define REG(n, w) PCIB_READ_CONFIG(pcib, cfg->bus, cfg->slot, cfg->func, \ 772 cfg->ea.ea_location + (n), w) 773 int num_ent; 774 int ptr; 775 int a, b; 776 uint32_t val; 777 int ent_size; 778 uint32_t dw[4]; 779 uint64_t base, max_offset; 780 struct pci_ea_entry *eae; 781 782 if (cfg->ea.ea_location == 0) 783 return; 784 785 STAILQ_INIT(&cfg->ea.ea_entries); 786 787 /* Determine the number of entries */ 788 num_ent = REG(PCIR_EA_NUM_ENT, 2); 789 num_ent &= PCIM_EA_NUM_ENT_MASK; 790 791 /* Find the first entry to care of */ 792 ptr = PCIR_EA_FIRST_ENT; 793 794 /* Skip DWORD 2 for type 1 functions */ 795 if ((cfg->hdrtype & PCIM_HDRTYPE) == PCIM_HDRTYPE_BRIDGE) 796 ptr += 4; 797 798 for (a = 0; a < num_ent; a++) { 799 eae = malloc(sizeof(*eae), M_DEVBUF, M_WAITOK | M_ZERO); 800 eae->eae_cfg_offset = cfg->ea.ea_location + ptr; 801 802 /* Read a number of dwords in the entry */ 803 val = REG(ptr, 4); 804 ptr += 4; 805 ent_size = (val & PCIM_EA_ES); 806 807 for (b = 0; b < ent_size; b++) { 808 dw[b] = REG(ptr, 4); 809 ptr += 4; 810 } 811 812 eae->eae_flags = val; 813 eae->eae_bei = (PCIM_EA_BEI & val) >> PCIM_EA_BEI_OFFSET; 814 815 base = dw[0] & PCIM_EA_FIELD_MASK; 816 max_offset = dw[1] | ~PCIM_EA_FIELD_MASK; 817 b = 2; 818 if (((dw[0] & PCIM_EA_IS_64) != 0) && (b < ent_size)) { 819 base |= (uint64_t)dw[b] << 32UL; 820 b++; 821 } 822 if (((dw[1] & PCIM_EA_IS_64) != 0) 823 && (b < ent_size)) { 824 max_offset |= (uint64_t)dw[b] << 32UL; 825 b++; 826 } 827 828 eae->eae_base = base; 829 eae->eae_max_offset = max_offset; 830 831 STAILQ_INSERT_TAIL(&cfg->ea.ea_entries, eae, eae_link); 832 833 if (bootverbose) { 834 printf("PCI(EA) dev %04x:%04x, bei %d, flags #%x, base #%jx, max_offset #%jx\n", 835 cfg->vendor, cfg->device, eae->eae_bei, eae->eae_flags, 836 (uintmax_t)eae->eae_base, (uintmax_t)eae->eae_max_offset); 837 } 838 } 839 } 840 #undef REG 841 842 static void 843 pci_read_cap(device_t pcib, pcicfgregs *cfg) 844 { 845 #define REG(n, w) PCIB_READ_CONFIG(pcib, cfg->bus, cfg->slot, cfg->func, n, w) 846 #define WREG(n, v, w) PCIB_WRITE_CONFIG(pcib, cfg->bus, cfg->slot, cfg->func, n, v, w) 847 #if defined(__i386__) || defined(__amd64__) || defined(__powerpc__) 848 uint64_t addr; 849 #endif 850 uint32_t val; 851 int ptr, nextptr, ptrptr; 852 853 switch (cfg->hdrtype & PCIM_HDRTYPE) { 854 case PCIM_HDRTYPE_NORMAL: 855 case PCIM_HDRTYPE_BRIDGE: 856 ptrptr = PCIR_CAP_PTR; 857 break; 858 case PCIM_HDRTYPE_CARDBUS: 859 ptrptr = PCIR_CAP_PTR_2; /* cardbus capabilities ptr */ 860 break; 861 default: 862 return; /* no extended capabilities support */ 863 } 864 nextptr = REG(ptrptr, 1); /* sanity check? */ 865 866 /* 867 * Read capability entries. 868 */ 869 while (nextptr != 0) { 870 /* Sanity check */ 871 if (nextptr > 255) { 872 printf("illegal PCI extended capability offset %d\n", 873 nextptr); 874 return; 875 } 876 /* Find the next entry */ 877 ptr = nextptr; 878 nextptr = REG(ptr + PCICAP_NEXTPTR, 1); 879 880 /* Process this entry */ 881 switch (REG(ptr + PCICAP_ID, 1)) { 882 case PCIY_PMG: /* PCI power management */ 883 if (cfg->pp.pp_cap == 0) { 884 cfg->pp.pp_cap = REG(ptr + PCIR_POWER_CAP, 2); 885 cfg->pp.pp_status = ptr + PCIR_POWER_STATUS; 886 cfg->pp.pp_bse = ptr + PCIR_POWER_BSE; 887 if ((nextptr - ptr) > PCIR_POWER_DATA) 888 cfg->pp.pp_data = ptr + PCIR_POWER_DATA; 889 } 890 break; 891 case PCIY_HT: /* HyperTransport */ 892 /* Determine HT-specific capability type. */ 893 val = REG(ptr + PCIR_HT_COMMAND, 2); 894 895 if ((val & 0xe000) == PCIM_HTCAP_SLAVE) 896 cfg->ht.ht_slave = ptr; 897 898 #if defined(__i386__) || defined(__amd64__) || defined(__powerpc__) 899 switch (val & PCIM_HTCMD_CAP_MASK) { 900 case PCIM_HTCAP_MSI_MAPPING: 901 if (!(val & PCIM_HTCMD_MSI_FIXED)) { 902 /* Sanity check the mapping window. */ 903 addr = REG(ptr + PCIR_HTMSI_ADDRESS_HI, 904 4); 905 addr <<= 32; 906 addr |= REG(ptr + PCIR_HTMSI_ADDRESS_LO, 907 4); 908 if (addr != MSI_INTEL_ADDR_BASE) 909 device_printf(pcib, 910 "HT device at pci%d:%d:%d:%d has non-default MSI window 0x%llx\n", 911 cfg->domain, cfg->bus, 912 cfg->slot, cfg->func, 913 (long long)addr); 914 } else 915 addr = MSI_INTEL_ADDR_BASE; 916 917 cfg->ht.ht_msimap = ptr; 918 cfg->ht.ht_msictrl = val; 919 cfg->ht.ht_msiaddr = addr; 920 break; 921 } 922 #endif 923 break; 924 case PCIY_MSI: /* PCI MSI */ 925 cfg->msi.msi_location = ptr; 926 cfg->msi.msi_ctrl = REG(ptr + PCIR_MSI_CTRL, 2); 927 cfg->msi.msi_msgnum = 1 << ((cfg->msi.msi_ctrl & 928 PCIM_MSICTRL_MMC_MASK)>>1); 929 break; 930 case PCIY_MSIX: /* PCI MSI-X */ 931 cfg->msix.msix_location = ptr; 932 cfg->msix.msix_ctrl = REG(ptr + PCIR_MSIX_CTRL, 2); 933 cfg->msix.msix_msgnum = (cfg->msix.msix_ctrl & 934 PCIM_MSIXCTRL_TABLE_SIZE) + 1; 935 val = REG(ptr + PCIR_MSIX_TABLE, 4); 936 cfg->msix.msix_table_bar = PCIR_BAR(val & 937 PCIM_MSIX_BIR_MASK); 938 cfg->msix.msix_table_offset = val & ~PCIM_MSIX_BIR_MASK; 939 val = REG(ptr + PCIR_MSIX_PBA, 4); 940 cfg->msix.msix_pba_bar = PCIR_BAR(val & 941 PCIM_MSIX_BIR_MASK); 942 cfg->msix.msix_pba_offset = val & ~PCIM_MSIX_BIR_MASK; 943 break; 944 case PCIY_VPD: /* PCI Vital Product Data */ 945 cfg->vpd.vpd_reg = ptr; 946 break; 947 case PCIY_SUBVENDOR: 948 /* Should always be true. */ 949 if ((cfg->hdrtype & PCIM_HDRTYPE) == 950 PCIM_HDRTYPE_BRIDGE) { 951 val = REG(ptr + PCIR_SUBVENDCAP_ID, 4); 952 cfg->subvendor = val & 0xffff; 953 cfg->subdevice = val >> 16; 954 } 955 break; 956 case PCIY_PCIX: /* PCI-X */ 957 /* 958 * Assume we have a PCI-X chipset if we have 959 * at least one PCI-PCI bridge with a PCI-X 960 * capability. Note that some systems with 961 * PCI-express or HT chipsets might match on 962 * this check as well. 963 */ 964 if ((cfg->hdrtype & PCIM_HDRTYPE) == 965 PCIM_HDRTYPE_BRIDGE) 966 pcix_chipset = 1; 967 cfg->pcix.pcix_location = ptr; 968 break; 969 case PCIY_EXPRESS: /* PCI-express */ 970 /* 971 * Assume we have a PCI-express chipset if we have 972 * at least one PCI-express device. 973 */ 974 pcie_chipset = 1; 975 cfg->pcie.pcie_location = ptr; 976 val = REG(ptr + PCIER_FLAGS, 2); 977 cfg->pcie.pcie_type = val & PCIEM_FLAGS_TYPE; 978 break; 979 case PCIY_EA: /* Enhanced Allocation */ 980 cfg->ea.ea_location = ptr; 981 pci_ea_fill_info(pcib, cfg); 982 break; 983 default: 984 break; 985 } 986 } 987 988 #if defined(__powerpc__) 989 /* 990 * Enable the MSI mapping window for all HyperTransport 991 * slaves. PCI-PCI bridges have their windows enabled via 992 * PCIB_MAP_MSI(). 993 */ 994 if (cfg->ht.ht_slave != 0 && cfg->ht.ht_msimap != 0 && 995 !(cfg->ht.ht_msictrl & PCIM_HTCMD_MSI_ENABLE)) { 996 device_printf(pcib, 997 "Enabling MSI window for HyperTransport slave at pci%d:%d:%d:%d\n", 998 cfg->domain, cfg->bus, cfg->slot, cfg->func); 999 cfg->ht.ht_msictrl |= PCIM_HTCMD_MSI_ENABLE; 1000 WREG(cfg->ht.ht_msimap + PCIR_HT_COMMAND, cfg->ht.ht_msictrl, 1001 2); 1002 } 1003 #endif 1004 /* REG and WREG use carry through to next functions */ 1005 } 1006 1007 /* 1008 * PCI Vital Product Data 1009 */ 1010 1011 #define PCI_VPD_TIMEOUT 1000000 1012 1013 static int 1014 pci_read_vpd_reg(device_t pcib, pcicfgregs *cfg, int reg, uint32_t *data) 1015 { 1016 int count = PCI_VPD_TIMEOUT; 1017 1018 KASSERT((reg & 3) == 0, ("VPD register must by 4 byte aligned")); 1019 1020 WREG(cfg->vpd.vpd_reg + PCIR_VPD_ADDR, reg, 2); 1021 1022 while ((REG(cfg->vpd.vpd_reg + PCIR_VPD_ADDR, 2) & 0x8000) != 0x8000) { 1023 if (--count < 0) 1024 return (ENXIO); 1025 DELAY(1); /* limit looping */ 1026 } 1027 *data = (REG(cfg->vpd.vpd_reg + PCIR_VPD_DATA, 4)); 1028 1029 return (0); 1030 } 1031 1032 #if 0 1033 static int 1034 pci_write_vpd_reg(device_t pcib, pcicfgregs *cfg, int reg, uint32_t data) 1035 { 1036 int count = PCI_VPD_TIMEOUT; 1037 1038 KASSERT((reg & 3) == 0, ("VPD register must by 4 byte aligned")); 1039 1040 WREG(cfg->vpd.vpd_reg + PCIR_VPD_DATA, data, 4); 1041 WREG(cfg->vpd.vpd_reg + PCIR_VPD_ADDR, reg | 0x8000, 2); 1042 while ((REG(cfg->vpd.vpd_reg + PCIR_VPD_ADDR, 2) & 0x8000) == 0x8000) { 1043 if (--count < 0) 1044 return (ENXIO); 1045 DELAY(1); /* limit looping */ 1046 } 1047 1048 return (0); 1049 } 1050 #endif 1051 1052 #undef PCI_VPD_TIMEOUT 1053 1054 struct vpd_readstate { 1055 device_t pcib; 1056 pcicfgregs *cfg; 1057 uint32_t val; 1058 int bytesinval; 1059 int off; 1060 uint8_t cksum; 1061 }; 1062 1063 static int 1064 vpd_nextbyte(struct vpd_readstate *vrs, uint8_t *data) 1065 { 1066 uint32_t reg; 1067 uint8_t byte; 1068 1069 if (vrs->bytesinval == 0) { 1070 if (pci_read_vpd_reg(vrs->pcib, vrs->cfg, vrs->off, ®)) 1071 return (ENXIO); 1072 vrs->val = le32toh(reg); 1073 vrs->off += 4; 1074 byte = vrs->val & 0xff; 1075 vrs->bytesinval = 3; 1076 } else { 1077 vrs->val = vrs->val >> 8; 1078 byte = vrs->val & 0xff; 1079 vrs->bytesinval--; 1080 } 1081 1082 vrs->cksum += byte; 1083 *data = byte; 1084 return (0); 1085 } 1086 1087 static void 1088 pci_read_vpd(device_t pcib, pcicfgregs *cfg) 1089 { 1090 struct vpd_readstate vrs; 1091 int state; 1092 int name; 1093 int remain; 1094 int i; 1095 int alloc, off; /* alloc/off for RO/W arrays */ 1096 int cksumvalid; 1097 int dflen; 1098 int firstrecord; 1099 uint8_t byte; 1100 uint8_t byte2; 1101 1102 /* init vpd reader */ 1103 vrs.bytesinval = 0; 1104 vrs.off = 0; 1105 vrs.pcib = pcib; 1106 vrs.cfg = cfg; 1107 vrs.cksum = 0; 1108 1109 state = 0; 1110 name = remain = i = 0; /* shut up stupid gcc */ 1111 alloc = off = 0; /* shut up stupid gcc */ 1112 dflen = 0; /* shut up stupid gcc */ 1113 cksumvalid = -1; 1114 firstrecord = 1; 1115 while (state >= 0) { 1116 if (vpd_nextbyte(&vrs, &byte)) { 1117 pci_printf(cfg, "VPD read timed out\n"); 1118 state = -2; 1119 break; 1120 } 1121 #if 0 1122 pci_printf(cfg, "vpd: val: %#x, off: %d, bytesinval: %d, byte: " 1123 "%#hhx, state: %d, remain: %d, name: %#x, i: %d\n", vrs.val, 1124 vrs.off, vrs.bytesinval, byte, state, remain, name, i); 1125 #endif 1126 switch (state) { 1127 case 0: /* item name */ 1128 if (byte & 0x80) { 1129 if (vpd_nextbyte(&vrs, &byte2)) { 1130 state = -2; 1131 break; 1132 } 1133 remain = byte2; 1134 if (vpd_nextbyte(&vrs, &byte2)) { 1135 state = -2; 1136 break; 1137 } 1138 remain |= byte2 << 8; 1139 name = byte & 0x7f; 1140 } else { 1141 remain = byte & 0x7; 1142 name = (byte >> 3) & 0xf; 1143 } 1144 if (firstrecord) { 1145 if (name != 0x2) { 1146 pci_printf(cfg, "VPD data does not " \ 1147 "start with ident (%#x)\n", name); 1148 state = -2; 1149 break; 1150 } 1151 firstrecord = 0; 1152 } 1153 if (vrs.off + remain - vrs.bytesinval > 0x8000) { 1154 pci_printf(cfg, 1155 "VPD data overflow, remain %#x\n", remain); 1156 state = -1; 1157 break; 1158 } 1159 switch (name) { 1160 case 0x2: /* String */ 1161 if (cfg->vpd.vpd_ident != NULL) { 1162 pci_printf(cfg, 1163 "duplicate VPD ident record\n"); 1164 state = -2; 1165 break; 1166 } 1167 if (remain > 255) { 1168 pci_printf(cfg, 1169 "VPD ident length %d exceeds 255\n", 1170 remain); 1171 state = -2; 1172 break; 1173 } 1174 cfg->vpd.vpd_ident = malloc(remain + 1, 1175 M_DEVBUF, M_WAITOK); 1176 i = 0; 1177 state = 1; 1178 break; 1179 case 0xf: /* End */ 1180 state = -1; 1181 break; 1182 case 0x10: /* VPD-R */ 1183 alloc = 8; 1184 off = 0; 1185 cfg->vpd.vpd_ros = malloc(alloc * 1186 sizeof(*cfg->vpd.vpd_ros), M_DEVBUF, 1187 M_WAITOK | M_ZERO); 1188 state = 2; 1189 break; 1190 case 0x11: /* VPD-W */ 1191 alloc = 8; 1192 off = 0; 1193 cfg->vpd.vpd_w = malloc(alloc * 1194 sizeof(*cfg->vpd.vpd_w), M_DEVBUF, 1195 M_WAITOK | M_ZERO); 1196 state = 5; 1197 break; 1198 default: /* Invalid data, abort */ 1199 pci_printf(cfg, "invalid VPD name: %#x\n", name); 1200 state = -2; 1201 break; 1202 } 1203 break; 1204 1205 case 1: /* Identifier String */ 1206 cfg->vpd.vpd_ident[i++] = byte; 1207 remain--; 1208 if (remain == 0) { 1209 cfg->vpd.vpd_ident[i] = '\0'; 1210 state = 0; 1211 } 1212 break; 1213 1214 case 2: /* VPD-R Keyword Header */ 1215 if (off == alloc) { 1216 cfg->vpd.vpd_ros = reallocf(cfg->vpd.vpd_ros, 1217 (alloc *= 2) * sizeof(*cfg->vpd.vpd_ros), 1218 M_DEVBUF, M_WAITOK | M_ZERO); 1219 } 1220 cfg->vpd.vpd_ros[off].keyword[0] = byte; 1221 if (vpd_nextbyte(&vrs, &byte2)) { 1222 state = -2; 1223 break; 1224 } 1225 cfg->vpd.vpd_ros[off].keyword[1] = byte2; 1226 if (vpd_nextbyte(&vrs, &byte2)) { 1227 state = -2; 1228 break; 1229 } 1230 cfg->vpd.vpd_ros[off].len = dflen = byte2; 1231 if (dflen == 0 && 1232 strncmp(cfg->vpd.vpd_ros[off].keyword, "RV", 1233 2) == 0) { 1234 /* 1235 * if this happens, we can't trust the rest 1236 * of the VPD. 1237 */ 1238 pci_printf(cfg, "invalid VPD RV record"); 1239 cksumvalid = 0; 1240 state = -1; 1241 break; 1242 } else if (dflen == 0) { 1243 cfg->vpd.vpd_ros[off].value = malloc(1 * 1244 sizeof(*cfg->vpd.vpd_ros[off].value), 1245 M_DEVBUF, M_WAITOK); 1246 cfg->vpd.vpd_ros[off].value[0] = '\x00'; 1247 } else 1248 cfg->vpd.vpd_ros[off].value = malloc( 1249 (dflen + 1) * 1250 sizeof(*cfg->vpd.vpd_ros[off].value), 1251 M_DEVBUF, M_WAITOK); 1252 remain -= 3; 1253 i = 0; 1254 /* keep in sync w/ state 3's transistions */ 1255 if (dflen == 0 && remain == 0) 1256 state = 0; 1257 else if (dflen == 0) 1258 state = 2; 1259 else 1260 state = 3; 1261 break; 1262 1263 case 3: /* VPD-R Keyword Value */ 1264 cfg->vpd.vpd_ros[off].value[i++] = byte; 1265 if (strncmp(cfg->vpd.vpd_ros[off].keyword, 1266 "RV", 2) == 0 && cksumvalid == -1) { 1267 if (vrs.cksum == 0) 1268 cksumvalid = 1; 1269 else { 1270 if (bootverbose) 1271 pci_printf(cfg, 1272 "bad VPD cksum, remain %hhu\n", 1273 vrs.cksum); 1274 cksumvalid = 0; 1275 state = -1; 1276 break; 1277 } 1278 } 1279 dflen--; 1280 remain--; 1281 /* keep in sync w/ state 2's transistions */ 1282 if (dflen == 0) 1283 cfg->vpd.vpd_ros[off++].value[i++] = '\0'; 1284 if (dflen == 0 && remain == 0) { 1285 cfg->vpd.vpd_rocnt = off; 1286 cfg->vpd.vpd_ros = reallocf(cfg->vpd.vpd_ros, 1287 off * sizeof(*cfg->vpd.vpd_ros), 1288 M_DEVBUF, M_WAITOK | M_ZERO); 1289 state = 0; 1290 } else if (dflen == 0) 1291 state = 2; 1292 break; 1293 1294 case 4: 1295 remain--; 1296 if (remain == 0) 1297 state = 0; 1298 break; 1299 1300 case 5: /* VPD-W Keyword Header */ 1301 if (off == alloc) { 1302 cfg->vpd.vpd_w = reallocf(cfg->vpd.vpd_w, 1303 (alloc *= 2) * sizeof(*cfg->vpd.vpd_w), 1304 M_DEVBUF, M_WAITOK | M_ZERO); 1305 } 1306 cfg->vpd.vpd_w[off].keyword[0] = byte; 1307 if (vpd_nextbyte(&vrs, &byte2)) { 1308 state = -2; 1309 break; 1310 } 1311 cfg->vpd.vpd_w[off].keyword[1] = byte2; 1312 if (vpd_nextbyte(&vrs, &byte2)) { 1313 state = -2; 1314 break; 1315 } 1316 cfg->vpd.vpd_w[off].len = dflen = byte2; 1317 cfg->vpd.vpd_w[off].start = vrs.off - vrs.bytesinval; 1318 cfg->vpd.vpd_w[off].value = malloc((dflen + 1) * 1319 sizeof(*cfg->vpd.vpd_w[off].value), 1320 M_DEVBUF, M_WAITOK); 1321 remain -= 3; 1322 i = 0; 1323 /* keep in sync w/ state 6's transistions */ 1324 if (dflen == 0 && remain == 0) 1325 state = 0; 1326 else if (dflen == 0) 1327 state = 5; 1328 else 1329 state = 6; 1330 break; 1331 1332 case 6: /* VPD-W Keyword Value */ 1333 cfg->vpd.vpd_w[off].value[i++] = byte; 1334 dflen--; 1335 remain--; 1336 /* keep in sync w/ state 5's transistions */ 1337 if (dflen == 0) 1338 cfg->vpd.vpd_w[off++].value[i++] = '\0'; 1339 if (dflen == 0 && remain == 0) { 1340 cfg->vpd.vpd_wcnt = off; 1341 cfg->vpd.vpd_w = reallocf(cfg->vpd.vpd_w, 1342 off * sizeof(*cfg->vpd.vpd_w), 1343 M_DEVBUF, M_WAITOK | M_ZERO); 1344 state = 0; 1345 } else if (dflen == 0) 1346 state = 5; 1347 break; 1348 1349 default: 1350 pci_printf(cfg, "invalid state: %d\n", state); 1351 state = -1; 1352 break; 1353 } 1354 1355 if (cfg->vpd.vpd_ident == NULL || cfg->vpd.vpd_ident[0] == '\0') { 1356 pci_printf(cfg, "no valid vpd ident found\n"); 1357 state = -2; 1358 } 1359 } 1360 1361 if (cksumvalid <= 0 || state < -1) { 1362 /* read-only data bad, clean up */ 1363 if (cfg->vpd.vpd_ros != NULL) { 1364 for (off = 0; cfg->vpd.vpd_ros[off].value; off++) 1365 free(cfg->vpd.vpd_ros[off].value, M_DEVBUF); 1366 free(cfg->vpd.vpd_ros, M_DEVBUF); 1367 cfg->vpd.vpd_ros = NULL; 1368 } 1369 } 1370 if (state < -1) { 1371 /* I/O error, clean up */ 1372 pci_printf(cfg, "failed to read VPD data.\n"); 1373 if (cfg->vpd.vpd_ident != NULL) { 1374 free(cfg->vpd.vpd_ident, M_DEVBUF); 1375 cfg->vpd.vpd_ident = NULL; 1376 } 1377 if (cfg->vpd.vpd_w != NULL) { 1378 for (off = 0; cfg->vpd.vpd_w[off].value; off++) 1379 free(cfg->vpd.vpd_w[off].value, M_DEVBUF); 1380 free(cfg->vpd.vpd_w, M_DEVBUF); 1381 cfg->vpd.vpd_w = NULL; 1382 } 1383 } 1384 cfg->vpd.vpd_cached = 1; 1385 #undef REG 1386 #undef WREG 1387 } 1388 1389 int 1390 pci_get_vpd_ident_method(device_t dev, device_t child, const char **identptr) 1391 { 1392 struct pci_devinfo *dinfo = device_get_ivars(child); 1393 pcicfgregs *cfg = &dinfo->cfg; 1394 1395 if (!cfg->vpd.vpd_cached && cfg->vpd.vpd_reg != 0) 1396 pci_read_vpd(device_get_parent(dev), cfg); 1397 1398 *identptr = cfg->vpd.vpd_ident; 1399 1400 if (*identptr == NULL) 1401 return (ENXIO); 1402 1403 return (0); 1404 } 1405 1406 int 1407 pci_get_vpd_readonly_method(device_t dev, device_t child, const char *kw, 1408 const char **vptr) 1409 { 1410 struct pci_devinfo *dinfo = device_get_ivars(child); 1411 pcicfgregs *cfg = &dinfo->cfg; 1412 int i; 1413 1414 if (!cfg->vpd.vpd_cached && cfg->vpd.vpd_reg != 0) 1415 pci_read_vpd(device_get_parent(dev), cfg); 1416 1417 for (i = 0; i < cfg->vpd.vpd_rocnt; i++) 1418 if (memcmp(kw, cfg->vpd.vpd_ros[i].keyword, 1419 sizeof(cfg->vpd.vpd_ros[i].keyword)) == 0) { 1420 *vptr = cfg->vpd.vpd_ros[i].value; 1421 return (0); 1422 } 1423 1424 *vptr = NULL; 1425 return (ENXIO); 1426 } 1427 1428 struct pcicfg_vpd * 1429 pci_fetch_vpd_list(device_t dev) 1430 { 1431 struct pci_devinfo *dinfo = device_get_ivars(dev); 1432 pcicfgregs *cfg = &dinfo->cfg; 1433 1434 if (!cfg->vpd.vpd_cached && cfg->vpd.vpd_reg != 0) 1435 pci_read_vpd(device_get_parent(device_get_parent(dev)), cfg); 1436 return (&cfg->vpd); 1437 } 1438 1439 /* 1440 * Find the requested HyperTransport capability and return the offset 1441 * in configuration space via the pointer provided. The function 1442 * returns 0 on success and an error code otherwise. 1443 */ 1444 int 1445 pci_find_htcap_method(device_t dev, device_t child, int capability, int *capreg) 1446 { 1447 int ptr, error; 1448 uint16_t val; 1449 1450 error = pci_find_cap(child, PCIY_HT, &ptr); 1451 if (error) 1452 return (error); 1453 1454 /* 1455 * Traverse the capabilities list checking each HT capability 1456 * to see if it matches the requested HT capability. 1457 */ 1458 for (;;) { 1459 val = pci_read_config(child, ptr + PCIR_HT_COMMAND, 2); 1460 if (capability == PCIM_HTCAP_SLAVE || 1461 capability == PCIM_HTCAP_HOST) 1462 val &= 0xe000; 1463 else 1464 val &= PCIM_HTCMD_CAP_MASK; 1465 if (val == capability) { 1466 if (capreg != NULL) 1467 *capreg = ptr; 1468 return (0); 1469 } 1470 1471 /* Skip to the next HT capability. */ 1472 if (pci_find_next_cap(child, PCIY_HT, ptr, &ptr) != 0) 1473 break; 1474 } 1475 1476 return (ENOENT); 1477 } 1478 1479 /* 1480 * Find the next requested HyperTransport capability after start and return 1481 * the offset in configuration space via the pointer provided. The function 1482 * returns 0 on success and an error code otherwise. 1483 */ 1484 int 1485 pci_find_next_htcap_method(device_t dev, device_t child, int capability, 1486 int start, int *capreg) 1487 { 1488 int ptr; 1489 uint16_t val; 1490 1491 KASSERT(pci_read_config(child, start + PCICAP_ID, 1) == PCIY_HT, 1492 ("start capability is not HyperTransport capability")); 1493 ptr = start; 1494 1495 /* 1496 * Traverse the capabilities list checking each HT capability 1497 * to see if it matches the requested HT capability. 1498 */ 1499 for (;;) { 1500 /* Skip to the next HT capability. */ 1501 if (pci_find_next_cap(child, PCIY_HT, ptr, &ptr) != 0) 1502 break; 1503 1504 val = pci_read_config(child, ptr + PCIR_HT_COMMAND, 2); 1505 if (capability == PCIM_HTCAP_SLAVE || 1506 capability == PCIM_HTCAP_HOST) 1507 val &= 0xe000; 1508 else 1509 val &= PCIM_HTCMD_CAP_MASK; 1510 if (val == capability) { 1511 if (capreg != NULL) 1512 *capreg = ptr; 1513 return (0); 1514 } 1515 } 1516 1517 return (ENOENT); 1518 } 1519 1520 /* 1521 * Find the requested capability and return the offset in 1522 * configuration space via the pointer provided. The function returns 1523 * 0 on success and an error code otherwise. 1524 */ 1525 int 1526 pci_find_cap_method(device_t dev, device_t child, int capability, 1527 int *capreg) 1528 { 1529 struct pci_devinfo *dinfo = device_get_ivars(child); 1530 pcicfgregs *cfg = &dinfo->cfg; 1531 uint32_t status; 1532 uint8_t ptr; 1533 1534 /* 1535 * Check the CAP_LIST bit of the PCI status register first. 1536 */ 1537 status = pci_read_config(child, PCIR_STATUS, 2); 1538 if (!(status & PCIM_STATUS_CAPPRESENT)) 1539 return (ENXIO); 1540 1541 /* 1542 * Determine the start pointer of the capabilities list. 1543 */ 1544 switch (cfg->hdrtype & PCIM_HDRTYPE) { 1545 case PCIM_HDRTYPE_NORMAL: 1546 case PCIM_HDRTYPE_BRIDGE: 1547 ptr = PCIR_CAP_PTR; 1548 break; 1549 case PCIM_HDRTYPE_CARDBUS: 1550 ptr = PCIR_CAP_PTR_2; 1551 break; 1552 default: 1553 /* XXX: panic? */ 1554 return (ENXIO); /* no extended capabilities support */ 1555 } 1556 ptr = pci_read_config(child, ptr, 1); 1557 1558 /* 1559 * Traverse the capabilities list. 1560 */ 1561 while (ptr != 0) { 1562 if (pci_read_config(child, ptr + PCICAP_ID, 1) == capability) { 1563 if (capreg != NULL) 1564 *capreg = ptr; 1565 return (0); 1566 } 1567 ptr = pci_read_config(child, ptr + PCICAP_NEXTPTR, 1); 1568 } 1569 1570 return (ENOENT); 1571 } 1572 1573 /* 1574 * Find the next requested capability after start and return the offset in 1575 * configuration space via the pointer provided. The function returns 1576 * 0 on success and an error code otherwise. 1577 */ 1578 int 1579 pci_find_next_cap_method(device_t dev, device_t child, int capability, 1580 int start, int *capreg) 1581 { 1582 uint8_t ptr; 1583 1584 KASSERT(pci_read_config(child, start + PCICAP_ID, 1) == capability, 1585 ("start capability is not expected capability")); 1586 1587 ptr = pci_read_config(child, start + PCICAP_NEXTPTR, 1); 1588 while (ptr != 0) { 1589 if (pci_read_config(child, ptr + PCICAP_ID, 1) == capability) { 1590 if (capreg != NULL) 1591 *capreg = ptr; 1592 return (0); 1593 } 1594 ptr = pci_read_config(child, ptr + PCICAP_NEXTPTR, 1); 1595 } 1596 1597 return (ENOENT); 1598 } 1599 1600 /* 1601 * Find the requested extended capability and return the offset in 1602 * configuration space via the pointer provided. The function returns 1603 * 0 on success and an error code otherwise. 1604 */ 1605 int 1606 pci_find_extcap_method(device_t dev, device_t child, int capability, 1607 int *capreg) 1608 { 1609 struct pci_devinfo *dinfo = device_get_ivars(child); 1610 pcicfgregs *cfg = &dinfo->cfg; 1611 uint32_t ecap; 1612 uint16_t ptr; 1613 1614 /* Only supported for PCI-express devices. */ 1615 if (cfg->pcie.pcie_location == 0) 1616 return (ENXIO); 1617 1618 ptr = PCIR_EXTCAP; 1619 ecap = pci_read_config(child, ptr, 4); 1620 if (ecap == 0xffffffff || ecap == 0) 1621 return (ENOENT); 1622 for (;;) { 1623 if (PCI_EXTCAP_ID(ecap) == capability) { 1624 if (capreg != NULL) 1625 *capreg = ptr; 1626 return (0); 1627 } 1628 ptr = PCI_EXTCAP_NEXTPTR(ecap); 1629 if (ptr == 0) 1630 break; 1631 ecap = pci_read_config(child, ptr, 4); 1632 } 1633 1634 return (ENOENT); 1635 } 1636 1637 /* 1638 * Find the next requested extended capability after start and return the 1639 * offset in configuration space via the pointer provided. The function 1640 * returns 0 on success and an error code otherwise. 1641 */ 1642 int 1643 pci_find_next_extcap_method(device_t dev, device_t child, int capability, 1644 int start, int *capreg) 1645 { 1646 struct pci_devinfo *dinfo = device_get_ivars(child); 1647 pcicfgregs *cfg = &dinfo->cfg; 1648 uint32_t ecap; 1649 uint16_t ptr; 1650 1651 /* Only supported for PCI-express devices. */ 1652 if (cfg->pcie.pcie_location == 0) 1653 return (ENXIO); 1654 1655 ecap = pci_read_config(child, start, 4); 1656 KASSERT(PCI_EXTCAP_ID(ecap) == capability, 1657 ("start extended capability is not expected capability")); 1658 ptr = PCI_EXTCAP_NEXTPTR(ecap); 1659 while (ptr != 0) { 1660 ecap = pci_read_config(child, ptr, 4); 1661 if (PCI_EXTCAP_ID(ecap) == capability) { 1662 if (capreg != NULL) 1663 *capreg = ptr; 1664 return (0); 1665 } 1666 ptr = PCI_EXTCAP_NEXTPTR(ecap); 1667 } 1668 1669 return (ENOENT); 1670 } 1671 1672 /* 1673 * Support for MSI-X message interrupts. 1674 */ 1675 static void 1676 pci_write_msix_entry(device_t dev, u_int index, uint64_t address, uint32_t data) 1677 { 1678 struct pci_devinfo *dinfo = device_get_ivars(dev); 1679 struct pcicfg_msix *msix = &dinfo->cfg.msix; 1680 uint32_t offset; 1681 1682 KASSERT(msix->msix_table_len > index, ("bogus index")); 1683 offset = msix->msix_table_offset + index * 16; 1684 bus_write_4(msix->msix_table_res, offset, address & 0xffffffff); 1685 bus_write_4(msix->msix_table_res, offset + 4, address >> 32); 1686 bus_write_4(msix->msix_table_res, offset + 8, data); 1687 } 1688 1689 void 1690 pci_enable_msix_method(device_t dev, device_t child, u_int index, 1691 uint64_t address, uint32_t data) 1692 { 1693 1694 if (pci_msix_rewrite_table) { 1695 struct pci_devinfo *dinfo = device_get_ivars(child); 1696 struct pcicfg_msix *msix = &dinfo->cfg.msix; 1697 1698 /* 1699 * Some VM hosts require MSIX to be disabled in the 1700 * control register before updating the MSIX table 1701 * entries are allowed. It is not enough to only 1702 * disable MSIX while updating a single entry. MSIX 1703 * must be disabled while updating all entries in the 1704 * table. 1705 */ 1706 pci_write_config(child, 1707 msix->msix_location + PCIR_MSIX_CTRL, 1708 msix->msix_ctrl & ~PCIM_MSIXCTRL_MSIX_ENABLE, 2); 1709 pci_resume_msix(child); 1710 } else 1711 pci_write_msix_entry(child, index, address, data); 1712 1713 /* Enable MSI -> HT mapping. */ 1714 pci_ht_map_msi(child, address); 1715 } 1716 1717 void 1718 pci_mask_msix(device_t dev, u_int index) 1719 { 1720 struct pci_devinfo *dinfo = device_get_ivars(dev); 1721 struct pcicfg_msix *msix = &dinfo->cfg.msix; 1722 uint32_t offset, val; 1723 1724 KASSERT(msix->msix_msgnum > index, ("bogus index")); 1725 offset = msix->msix_table_offset + index * 16 + 12; 1726 val = bus_read_4(msix->msix_table_res, offset); 1727 val |= PCIM_MSIX_VCTRL_MASK; 1728 1729 /* 1730 * Some devices (e.g. Samsung PM961) do not support reads of this 1731 * register, so always write the new value. 1732 */ 1733 bus_write_4(msix->msix_table_res, offset, val); 1734 } 1735 1736 void 1737 pci_unmask_msix(device_t dev, u_int index) 1738 { 1739 struct pci_devinfo *dinfo = device_get_ivars(dev); 1740 struct pcicfg_msix *msix = &dinfo->cfg.msix; 1741 uint32_t offset, val; 1742 1743 KASSERT(msix->msix_table_len > index, ("bogus index")); 1744 offset = msix->msix_table_offset + index * 16 + 12; 1745 val = bus_read_4(msix->msix_table_res, offset); 1746 val &= ~PCIM_MSIX_VCTRL_MASK; 1747 1748 /* 1749 * Some devices (e.g. Samsung PM961) do not support reads of this 1750 * register, so always write the new value. 1751 */ 1752 bus_write_4(msix->msix_table_res, offset, val); 1753 } 1754 1755 int 1756 pci_pending_msix(device_t dev, u_int index) 1757 { 1758 struct pci_devinfo *dinfo = device_get_ivars(dev); 1759 struct pcicfg_msix *msix = &dinfo->cfg.msix; 1760 uint32_t offset, bit; 1761 1762 KASSERT(msix->msix_table_len > index, ("bogus index")); 1763 offset = msix->msix_pba_offset + (index / 32) * 4; 1764 bit = 1 << index % 32; 1765 return (bus_read_4(msix->msix_pba_res, offset) & bit); 1766 } 1767 1768 /* 1769 * Restore MSI-X registers and table during resume. If MSI-X is 1770 * enabled then walk the virtual table to restore the actual MSI-X 1771 * table. 1772 */ 1773 static void 1774 pci_resume_msix(device_t dev) 1775 { 1776 struct pci_devinfo *dinfo = device_get_ivars(dev); 1777 struct pcicfg_msix *msix = &dinfo->cfg.msix; 1778 struct msix_table_entry *mte; 1779 struct msix_vector *mv; 1780 int i; 1781 1782 if (msix->msix_alloc > 0) { 1783 /* First, mask all vectors. */ 1784 for (i = 0; i < msix->msix_msgnum; i++) 1785 pci_mask_msix(dev, i); 1786 1787 /* Second, program any messages with at least one handler. */ 1788 for (i = 0; i < msix->msix_table_len; i++) { 1789 mte = &msix->msix_table[i]; 1790 if (mte->mte_vector == 0 || mte->mte_handlers == 0) 1791 continue; 1792 mv = &msix->msix_vectors[mte->mte_vector - 1]; 1793 pci_write_msix_entry(dev, i, mv->mv_address, 1794 mv->mv_data); 1795 pci_unmask_msix(dev, i); 1796 } 1797 } 1798 pci_write_config(dev, msix->msix_location + PCIR_MSIX_CTRL, 1799 msix->msix_ctrl, 2); 1800 } 1801 1802 /* 1803 * Attempt to allocate *count MSI-X messages. The actual number allocated is 1804 * returned in *count. After this function returns, each message will be 1805 * available to the driver as SYS_RES_IRQ resources starting at rid 1. 1806 */ 1807 int 1808 pci_alloc_msix_method(device_t dev, device_t child, int *count) 1809 { 1810 struct pci_devinfo *dinfo = device_get_ivars(child); 1811 pcicfgregs *cfg = &dinfo->cfg; 1812 struct resource_list_entry *rle; 1813 int actual, error, i, irq, max; 1814 1815 /* Don't let count == 0 get us into trouble. */ 1816 if (*count == 0) 1817 return (EINVAL); 1818 1819 /* If rid 0 is allocated, then fail. */ 1820 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, 0); 1821 if (rle != NULL && rle->res != NULL) 1822 return (ENXIO); 1823 1824 /* Already have allocated messages? */ 1825 if (cfg->msi.msi_alloc != 0 || cfg->msix.msix_alloc != 0) 1826 return (ENXIO); 1827 1828 /* If MSI-X is blacklisted for this system, fail. */ 1829 if (pci_msix_blacklisted()) 1830 return (ENXIO); 1831 1832 /* MSI-X capability present? */ 1833 if (cfg->msix.msix_location == 0 || !pci_do_msix) 1834 return (ENODEV); 1835 1836 /* Make sure the appropriate BARs are mapped. */ 1837 rle = resource_list_find(&dinfo->resources, SYS_RES_MEMORY, 1838 cfg->msix.msix_table_bar); 1839 if (rle == NULL || rle->res == NULL || 1840 !(rman_get_flags(rle->res) & RF_ACTIVE)) 1841 return (ENXIO); 1842 cfg->msix.msix_table_res = rle->res; 1843 if (cfg->msix.msix_pba_bar != cfg->msix.msix_table_bar) { 1844 rle = resource_list_find(&dinfo->resources, SYS_RES_MEMORY, 1845 cfg->msix.msix_pba_bar); 1846 if (rle == NULL || rle->res == NULL || 1847 !(rman_get_flags(rle->res) & RF_ACTIVE)) 1848 return (ENXIO); 1849 } 1850 cfg->msix.msix_pba_res = rle->res; 1851 1852 if (bootverbose) 1853 device_printf(child, 1854 "attempting to allocate %d MSI-X vectors (%d supported)\n", 1855 *count, cfg->msix.msix_msgnum); 1856 max = min(*count, cfg->msix.msix_msgnum); 1857 for (i = 0; i < max; i++) { 1858 /* Allocate a message. */ 1859 error = PCIB_ALLOC_MSIX(device_get_parent(dev), child, &irq); 1860 if (error) { 1861 if (i == 0) 1862 return (error); 1863 break; 1864 } 1865 resource_list_add(&dinfo->resources, SYS_RES_IRQ, i + 1, irq, 1866 irq, 1); 1867 } 1868 actual = i; 1869 1870 if (bootverbose) { 1871 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, 1); 1872 if (actual == 1) 1873 device_printf(child, "using IRQ %ju for MSI-X\n", 1874 rle->start); 1875 else { 1876 int run; 1877 1878 /* 1879 * Be fancy and try to print contiguous runs of 1880 * IRQ values as ranges. 'irq' is the previous IRQ. 1881 * 'run' is true if we are in a range. 1882 */ 1883 device_printf(child, "using IRQs %ju", rle->start); 1884 irq = rle->start; 1885 run = 0; 1886 for (i = 1; i < actual; i++) { 1887 rle = resource_list_find(&dinfo->resources, 1888 SYS_RES_IRQ, i + 1); 1889 1890 /* Still in a run? */ 1891 if (rle->start == irq + 1) { 1892 run = 1; 1893 irq++; 1894 continue; 1895 } 1896 1897 /* Finish previous range. */ 1898 if (run) { 1899 printf("-%d", irq); 1900 run = 0; 1901 } 1902 1903 /* Start new range. */ 1904 printf(",%ju", rle->start); 1905 irq = rle->start; 1906 } 1907 1908 /* Unfinished range? */ 1909 if (run) 1910 printf("-%d", irq); 1911 printf(" for MSI-X\n"); 1912 } 1913 } 1914 1915 /* Mask all vectors. */ 1916 for (i = 0; i < cfg->msix.msix_msgnum; i++) 1917 pci_mask_msix(child, i); 1918 1919 /* Allocate and initialize vector data and virtual table. */ 1920 cfg->msix.msix_vectors = malloc(sizeof(struct msix_vector) * actual, 1921 M_DEVBUF, M_WAITOK | M_ZERO); 1922 cfg->msix.msix_table = malloc(sizeof(struct msix_table_entry) * actual, 1923 M_DEVBUF, M_WAITOK | M_ZERO); 1924 for (i = 0; i < actual; i++) { 1925 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, i + 1); 1926 cfg->msix.msix_vectors[i].mv_irq = rle->start; 1927 cfg->msix.msix_table[i].mte_vector = i + 1; 1928 } 1929 1930 /* Update control register to enable MSI-X. */ 1931 cfg->msix.msix_ctrl |= PCIM_MSIXCTRL_MSIX_ENABLE; 1932 pci_write_config(child, cfg->msix.msix_location + PCIR_MSIX_CTRL, 1933 cfg->msix.msix_ctrl, 2); 1934 1935 /* Update counts of alloc'd messages. */ 1936 cfg->msix.msix_alloc = actual; 1937 cfg->msix.msix_table_len = actual; 1938 *count = actual; 1939 return (0); 1940 } 1941 1942 /* 1943 * By default, pci_alloc_msix() will assign the allocated IRQ 1944 * resources consecutively to the first N messages in the MSI-X table. 1945 * However, device drivers may want to use different layouts if they 1946 * either receive fewer messages than they asked for, or they wish to 1947 * populate the MSI-X table sparsely. This method allows the driver 1948 * to specify what layout it wants. It must be called after a 1949 * successful pci_alloc_msix() but before any of the associated 1950 * SYS_RES_IRQ resources are allocated via bus_alloc_resource(). 1951 * 1952 * The 'vectors' array contains 'count' message vectors. The array 1953 * maps directly to the MSI-X table in that index 0 in the array 1954 * specifies the vector for the first message in the MSI-X table, etc. 1955 * The vector value in each array index can either be 0 to indicate 1956 * that no vector should be assigned to a message slot, or it can be a 1957 * number from 1 to N (where N is the count returned from a 1958 * succcessful call to pci_alloc_msix()) to indicate which message 1959 * vector (IRQ) to be used for the corresponding message. 1960 * 1961 * On successful return, each message with a non-zero vector will have 1962 * an associated SYS_RES_IRQ whose rid is equal to the array index + 1963 * 1. Additionally, if any of the IRQs allocated via the previous 1964 * call to pci_alloc_msix() are not used in the mapping, those IRQs 1965 * will be freed back to the system automatically. 1966 * 1967 * For example, suppose a driver has a MSI-X table with 6 messages and 1968 * asks for 6 messages, but pci_alloc_msix() only returns a count of 1969 * 3. Call the three vectors allocated by pci_alloc_msix() A, B, and 1970 * C. After the call to pci_alloc_msix(), the device will be setup to 1971 * have an MSI-X table of ABC--- (where - means no vector assigned). 1972 * If the driver then passes a vector array of { 1, 0, 1, 2, 0, 2 }, 1973 * then the MSI-X table will look like A-AB-B, and the 'C' vector will 1974 * be freed back to the system. This device will also have valid 1975 * SYS_RES_IRQ rids of 1, 3, 4, and 6. 1976 * 1977 * In any case, the SYS_RES_IRQ rid X will always map to the message 1978 * at MSI-X table index X - 1 and will only be valid if a vector is 1979 * assigned to that table entry. 1980 */ 1981 int 1982 pci_remap_msix_method(device_t dev, device_t child, int count, 1983 const u_int *vectors) 1984 { 1985 struct pci_devinfo *dinfo = device_get_ivars(child); 1986 struct pcicfg_msix *msix = &dinfo->cfg.msix; 1987 struct resource_list_entry *rle; 1988 int i, irq, j, *used; 1989 1990 /* 1991 * Have to have at least one message in the table but the 1992 * table can't be bigger than the actual MSI-X table in the 1993 * device. 1994 */ 1995 if (count == 0 || count > msix->msix_msgnum) 1996 return (EINVAL); 1997 1998 /* Sanity check the vectors. */ 1999 for (i = 0; i < count; i++) 2000 if (vectors[i] > msix->msix_alloc) 2001 return (EINVAL); 2002 2003 /* 2004 * Make sure there aren't any holes in the vectors to be used. 2005 * It's a big pain to support it, and it doesn't really make 2006 * sense anyway. Also, at least one vector must be used. 2007 */ 2008 used = malloc(sizeof(int) * msix->msix_alloc, M_DEVBUF, M_WAITOK | 2009 M_ZERO); 2010 for (i = 0; i < count; i++) 2011 if (vectors[i] != 0) 2012 used[vectors[i] - 1] = 1; 2013 for (i = 0; i < msix->msix_alloc - 1; i++) 2014 if (used[i] == 0 && used[i + 1] == 1) { 2015 free(used, M_DEVBUF); 2016 return (EINVAL); 2017 } 2018 if (used[0] != 1) { 2019 free(used, M_DEVBUF); 2020 return (EINVAL); 2021 } 2022 2023 /* Make sure none of the resources are allocated. */ 2024 for (i = 0; i < msix->msix_table_len; i++) { 2025 if (msix->msix_table[i].mte_vector == 0) 2026 continue; 2027 if (msix->msix_table[i].mte_handlers > 0) { 2028 free(used, M_DEVBUF); 2029 return (EBUSY); 2030 } 2031 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, i + 1); 2032 KASSERT(rle != NULL, ("missing resource")); 2033 if (rle->res != NULL) { 2034 free(used, M_DEVBUF); 2035 return (EBUSY); 2036 } 2037 } 2038 2039 /* Free the existing resource list entries. */ 2040 for (i = 0; i < msix->msix_table_len; i++) { 2041 if (msix->msix_table[i].mte_vector == 0) 2042 continue; 2043 resource_list_delete(&dinfo->resources, SYS_RES_IRQ, i + 1); 2044 } 2045 2046 /* 2047 * Build the new virtual table keeping track of which vectors are 2048 * used. 2049 */ 2050 free(msix->msix_table, M_DEVBUF); 2051 msix->msix_table = malloc(sizeof(struct msix_table_entry) * count, 2052 M_DEVBUF, M_WAITOK | M_ZERO); 2053 for (i = 0; i < count; i++) 2054 msix->msix_table[i].mte_vector = vectors[i]; 2055 msix->msix_table_len = count; 2056 2057 /* Free any unused IRQs and resize the vectors array if necessary. */ 2058 j = msix->msix_alloc - 1; 2059 if (used[j] == 0) { 2060 struct msix_vector *vec; 2061 2062 while (used[j] == 0) { 2063 PCIB_RELEASE_MSIX(device_get_parent(dev), child, 2064 msix->msix_vectors[j].mv_irq); 2065 j--; 2066 } 2067 vec = malloc(sizeof(struct msix_vector) * (j + 1), M_DEVBUF, 2068 M_WAITOK); 2069 bcopy(msix->msix_vectors, vec, sizeof(struct msix_vector) * 2070 (j + 1)); 2071 free(msix->msix_vectors, M_DEVBUF); 2072 msix->msix_vectors = vec; 2073 msix->msix_alloc = j + 1; 2074 } 2075 free(used, M_DEVBUF); 2076 2077 /* Map the IRQs onto the rids. */ 2078 for (i = 0; i < count; i++) { 2079 if (vectors[i] == 0) 2080 continue; 2081 irq = msix->msix_vectors[vectors[i] - 1].mv_irq; 2082 resource_list_add(&dinfo->resources, SYS_RES_IRQ, i + 1, irq, 2083 irq, 1); 2084 } 2085 2086 if (bootverbose) { 2087 device_printf(child, "Remapped MSI-X IRQs as: "); 2088 for (i = 0; i < count; i++) { 2089 if (i != 0) 2090 printf(", "); 2091 if (vectors[i] == 0) 2092 printf("---"); 2093 else 2094 printf("%d", 2095 msix->msix_vectors[vectors[i] - 1].mv_irq); 2096 } 2097 printf("\n"); 2098 } 2099 2100 return (0); 2101 } 2102 2103 static int 2104 pci_release_msix(device_t dev, device_t child) 2105 { 2106 struct pci_devinfo *dinfo = device_get_ivars(child); 2107 struct pcicfg_msix *msix = &dinfo->cfg.msix; 2108 struct resource_list_entry *rle; 2109 int i; 2110 2111 /* Do we have any messages to release? */ 2112 if (msix->msix_alloc == 0) 2113 return (ENODEV); 2114 2115 /* Make sure none of the resources are allocated. */ 2116 for (i = 0; i < msix->msix_table_len; i++) { 2117 if (msix->msix_table[i].mte_vector == 0) 2118 continue; 2119 if (msix->msix_table[i].mte_handlers > 0) 2120 return (EBUSY); 2121 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, i + 1); 2122 KASSERT(rle != NULL, ("missing resource")); 2123 if (rle->res != NULL) 2124 return (EBUSY); 2125 } 2126 2127 /* Update control register to disable MSI-X. */ 2128 msix->msix_ctrl &= ~PCIM_MSIXCTRL_MSIX_ENABLE; 2129 pci_write_config(child, msix->msix_location + PCIR_MSIX_CTRL, 2130 msix->msix_ctrl, 2); 2131 2132 /* Free the resource list entries. */ 2133 for (i = 0; i < msix->msix_table_len; i++) { 2134 if (msix->msix_table[i].mte_vector == 0) 2135 continue; 2136 resource_list_delete(&dinfo->resources, SYS_RES_IRQ, i + 1); 2137 } 2138 free(msix->msix_table, M_DEVBUF); 2139 msix->msix_table_len = 0; 2140 2141 /* Release the IRQs. */ 2142 for (i = 0; i < msix->msix_alloc; i++) 2143 PCIB_RELEASE_MSIX(device_get_parent(dev), child, 2144 msix->msix_vectors[i].mv_irq); 2145 free(msix->msix_vectors, M_DEVBUF); 2146 msix->msix_alloc = 0; 2147 return (0); 2148 } 2149 2150 /* 2151 * Return the max supported MSI-X messages this device supports. 2152 * Basically, assuming the MD code can alloc messages, this function 2153 * should return the maximum value that pci_alloc_msix() can return. 2154 * Thus, it is subject to the tunables, etc. 2155 */ 2156 int 2157 pci_msix_count_method(device_t dev, device_t child) 2158 { 2159 struct pci_devinfo *dinfo = device_get_ivars(child); 2160 struct pcicfg_msix *msix = &dinfo->cfg.msix; 2161 2162 if (pci_do_msix && msix->msix_location != 0) 2163 return (msix->msix_msgnum); 2164 return (0); 2165 } 2166 2167 int 2168 pci_msix_pba_bar_method(device_t dev, device_t child) 2169 { 2170 struct pci_devinfo *dinfo = device_get_ivars(child); 2171 struct pcicfg_msix *msix = &dinfo->cfg.msix; 2172 2173 if (pci_do_msix && msix->msix_location != 0) 2174 return (msix->msix_pba_bar); 2175 return (-1); 2176 } 2177 2178 int 2179 pci_msix_table_bar_method(device_t dev, device_t child) 2180 { 2181 struct pci_devinfo *dinfo = device_get_ivars(child); 2182 struct pcicfg_msix *msix = &dinfo->cfg.msix; 2183 2184 if (pci_do_msix && msix->msix_location != 0) 2185 return (msix->msix_table_bar); 2186 return (-1); 2187 } 2188 2189 /* 2190 * HyperTransport MSI mapping control 2191 */ 2192 void 2193 pci_ht_map_msi(device_t dev, uint64_t addr) 2194 { 2195 struct pci_devinfo *dinfo = device_get_ivars(dev); 2196 struct pcicfg_ht *ht = &dinfo->cfg.ht; 2197 2198 if (!ht->ht_msimap) 2199 return; 2200 2201 if (addr && !(ht->ht_msictrl & PCIM_HTCMD_MSI_ENABLE) && 2202 ht->ht_msiaddr >> 20 == addr >> 20) { 2203 /* Enable MSI -> HT mapping. */ 2204 ht->ht_msictrl |= PCIM_HTCMD_MSI_ENABLE; 2205 pci_write_config(dev, ht->ht_msimap + PCIR_HT_COMMAND, 2206 ht->ht_msictrl, 2); 2207 } 2208 2209 if (!addr && ht->ht_msictrl & PCIM_HTCMD_MSI_ENABLE) { 2210 /* Disable MSI -> HT mapping. */ 2211 ht->ht_msictrl &= ~PCIM_HTCMD_MSI_ENABLE; 2212 pci_write_config(dev, ht->ht_msimap + PCIR_HT_COMMAND, 2213 ht->ht_msictrl, 2); 2214 } 2215 } 2216 2217 int 2218 pci_get_relaxed_ordering_enabled(device_t dev) 2219 { 2220 struct pci_devinfo *dinfo = device_get_ivars(dev); 2221 int cap; 2222 uint16_t val; 2223 2224 cap = dinfo->cfg.pcie.pcie_location; 2225 if (cap == 0) 2226 return (0); 2227 val = pci_read_config(dev, cap + PCIER_DEVICE_CTL, 2); 2228 val &= PCIEM_CTL_RELAXED_ORD_ENABLE; 2229 return (val != 0); 2230 } 2231 2232 int 2233 pci_get_max_payload(device_t dev) 2234 { 2235 struct pci_devinfo *dinfo = device_get_ivars(dev); 2236 int cap; 2237 uint16_t val; 2238 2239 cap = dinfo->cfg.pcie.pcie_location; 2240 if (cap == 0) 2241 return (0); 2242 val = pci_read_config(dev, cap + PCIER_DEVICE_CTL, 2); 2243 val &= PCIEM_CTL_MAX_PAYLOAD; 2244 val >>= 5; 2245 return (1 << (val + 7)); 2246 } 2247 2248 int 2249 pci_get_max_read_req(device_t dev) 2250 { 2251 struct pci_devinfo *dinfo = device_get_ivars(dev); 2252 int cap; 2253 uint16_t val; 2254 2255 cap = dinfo->cfg.pcie.pcie_location; 2256 if (cap == 0) 2257 return (0); 2258 val = pci_read_config(dev, cap + PCIER_DEVICE_CTL, 2); 2259 val &= PCIEM_CTL_MAX_READ_REQUEST; 2260 val >>= 12; 2261 return (1 << (val + 7)); 2262 } 2263 2264 int 2265 pci_set_max_read_req(device_t dev, int size) 2266 { 2267 struct pci_devinfo *dinfo = device_get_ivars(dev); 2268 int cap; 2269 uint16_t val; 2270 2271 cap = dinfo->cfg.pcie.pcie_location; 2272 if (cap == 0) 2273 return (0); 2274 if (size < 128) 2275 size = 128; 2276 if (size > 4096) 2277 size = 4096; 2278 size = (1 << (fls(size) - 1)); 2279 val = pci_read_config(dev, cap + PCIER_DEVICE_CTL, 2); 2280 val &= ~PCIEM_CTL_MAX_READ_REQUEST; 2281 val |= (fls(size) - 8) << 12; 2282 pci_write_config(dev, cap + PCIER_DEVICE_CTL, val, 2); 2283 return (size); 2284 } 2285 2286 uint32_t 2287 pcie_read_config(device_t dev, int reg, int width) 2288 { 2289 struct pci_devinfo *dinfo = device_get_ivars(dev); 2290 int cap; 2291 2292 cap = dinfo->cfg.pcie.pcie_location; 2293 if (cap == 0) { 2294 if (width == 2) 2295 return (0xffff); 2296 return (0xffffffff); 2297 } 2298 2299 return (pci_read_config(dev, cap + reg, width)); 2300 } 2301 2302 void 2303 pcie_write_config(device_t dev, int reg, uint32_t value, int width) 2304 { 2305 struct pci_devinfo *dinfo = device_get_ivars(dev); 2306 int cap; 2307 2308 cap = dinfo->cfg.pcie.pcie_location; 2309 if (cap == 0) 2310 return; 2311 pci_write_config(dev, cap + reg, value, width); 2312 } 2313 2314 /* 2315 * Adjusts a PCI-e capability register by clearing the bits in mask 2316 * and setting the bits in (value & mask). Bits not set in mask are 2317 * not adjusted. 2318 * 2319 * Returns the old value on success or all ones on failure. 2320 */ 2321 uint32_t 2322 pcie_adjust_config(device_t dev, int reg, uint32_t mask, uint32_t value, 2323 int width) 2324 { 2325 struct pci_devinfo *dinfo = device_get_ivars(dev); 2326 uint32_t old, new; 2327 int cap; 2328 2329 cap = dinfo->cfg.pcie.pcie_location; 2330 if (cap == 0) { 2331 if (width == 2) 2332 return (0xffff); 2333 return (0xffffffff); 2334 } 2335 2336 old = pci_read_config(dev, cap + reg, width); 2337 new = old & ~mask; 2338 new |= (value & mask); 2339 pci_write_config(dev, cap + reg, new, width); 2340 return (old); 2341 } 2342 2343 /* 2344 * Support for MSI message signalled interrupts. 2345 */ 2346 void 2347 pci_enable_msi_method(device_t dev, device_t child, uint64_t address, 2348 uint16_t data) 2349 { 2350 struct pci_devinfo *dinfo = device_get_ivars(child); 2351 struct pcicfg_msi *msi = &dinfo->cfg.msi; 2352 2353 /* Write data and address values. */ 2354 pci_write_config(child, msi->msi_location + PCIR_MSI_ADDR, 2355 address & 0xffffffff, 4); 2356 if (msi->msi_ctrl & PCIM_MSICTRL_64BIT) { 2357 pci_write_config(child, msi->msi_location + PCIR_MSI_ADDR_HIGH, 2358 address >> 32, 4); 2359 pci_write_config(child, msi->msi_location + PCIR_MSI_DATA_64BIT, 2360 data, 2); 2361 } else 2362 pci_write_config(child, msi->msi_location + PCIR_MSI_DATA, data, 2363 2); 2364 2365 /* Enable MSI in the control register. */ 2366 msi->msi_ctrl |= PCIM_MSICTRL_MSI_ENABLE; 2367 pci_write_config(child, msi->msi_location + PCIR_MSI_CTRL, 2368 msi->msi_ctrl, 2); 2369 2370 /* Enable MSI -> HT mapping. */ 2371 pci_ht_map_msi(child, address); 2372 } 2373 2374 void 2375 pci_disable_msi_method(device_t dev, device_t child) 2376 { 2377 struct pci_devinfo *dinfo = device_get_ivars(child); 2378 struct pcicfg_msi *msi = &dinfo->cfg.msi; 2379 2380 /* Disable MSI -> HT mapping. */ 2381 pci_ht_map_msi(child, 0); 2382 2383 /* Disable MSI in the control register. */ 2384 msi->msi_ctrl &= ~PCIM_MSICTRL_MSI_ENABLE; 2385 pci_write_config(child, msi->msi_location + PCIR_MSI_CTRL, 2386 msi->msi_ctrl, 2); 2387 } 2388 2389 /* 2390 * Restore MSI registers during resume. If MSI is enabled then 2391 * restore the data and address registers in addition to the control 2392 * register. 2393 */ 2394 static void 2395 pci_resume_msi(device_t dev) 2396 { 2397 struct pci_devinfo *dinfo = device_get_ivars(dev); 2398 struct pcicfg_msi *msi = &dinfo->cfg.msi; 2399 uint64_t address; 2400 uint16_t data; 2401 2402 if (msi->msi_ctrl & PCIM_MSICTRL_MSI_ENABLE) { 2403 address = msi->msi_addr; 2404 data = msi->msi_data; 2405 pci_write_config(dev, msi->msi_location + PCIR_MSI_ADDR, 2406 address & 0xffffffff, 4); 2407 if (msi->msi_ctrl & PCIM_MSICTRL_64BIT) { 2408 pci_write_config(dev, msi->msi_location + 2409 PCIR_MSI_ADDR_HIGH, address >> 32, 4); 2410 pci_write_config(dev, msi->msi_location + 2411 PCIR_MSI_DATA_64BIT, data, 2); 2412 } else 2413 pci_write_config(dev, msi->msi_location + PCIR_MSI_DATA, 2414 data, 2); 2415 } 2416 pci_write_config(dev, msi->msi_location + PCIR_MSI_CTRL, msi->msi_ctrl, 2417 2); 2418 } 2419 2420 static int 2421 pci_remap_intr_method(device_t bus, device_t dev, u_int irq) 2422 { 2423 struct pci_devinfo *dinfo = device_get_ivars(dev); 2424 pcicfgregs *cfg = &dinfo->cfg; 2425 struct resource_list_entry *rle; 2426 struct msix_table_entry *mte; 2427 struct msix_vector *mv; 2428 uint64_t addr; 2429 uint32_t data; 2430 int error, i, j; 2431 2432 /* 2433 * Handle MSI first. We try to find this IRQ among our list 2434 * of MSI IRQs. If we find it, we request updated address and 2435 * data registers and apply the results. 2436 */ 2437 if (cfg->msi.msi_alloc > 0) { 2438 /* If we don't have any active handlers, nothing to do. */ 2439 if (cfg->msi.msi_handlers == 0) 2440 return (0); 2441 for (i = 0; i < cfg->msi.msi_alloc; i++) { 2442 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, 2443 i + 1); 2444 if (rle->start == irq) { 2445 error = PCIB_MAP_MSI(device_get_parent(bus), 2446 dev, irq, &addr, &data); 2447 if (error) 2448 return (error); 2449 pci_disable_msi(dev); 2450 dinfo->cfg.msi.msi_addr = addr; 2451 dinfo->cfg.msi.msi_data = data; 2452 pci_enable_msi(dev, addr, data); 2453 return (0); 2454 } 2455 } 2456 return (ENOENT); 2457 } 2458 2459 /* 2460 * For MSI-X, we check to see if we have this IRQ. If we do, 2461 * we request the updated mapping info. If that works, we go 2462 * through all the slots that use this IRQ and update them. 2463 */ 2464 if (cfg->msix.msix_alloc > 0) { 2465 for (i = 0; i < cfg->msix.msix_alloc; i++) { 2466 mv = &cfg->msix.msix_vectors[i]; 2467 if (mv->mv_irq == irq) { 2468 error = PCIB_MAP_MSI(device_get_parent(bus), 2469 dev, irq, &addr, &data); 2470 if (error) 2471 return (error); 2472 mv->mv_address = addr; 2473 mv->mv_data = data; 2474 for (j = 0; j < cfg->msix.msix_table_len; j++) { 2475 mte = &cfg->msix.msix_table[j]; 2476 if (mte->mte_vector != i + 1) 2477 continue; 2478 if (mte->mte_handlers == 0) 2479 continue; 2480 pci_mask_msix(dev, j); 2481 pci_enable_msix(dev, j, addr, data); 2482 pci_unmask_msix(dev, j); 2483 } 2484 } 2485 } 2486 return (ENOENT); 2487 } 2488 2489 return (ENOENT); 2490 } 2491 2492 /* 2493 * Returns true if the specified device is blacklisted because MSI 2494 * doesn't work. 2495 */ 2496 int 2497 pci_msi_device_blacklisted(device_t dev) 2498 { 2499 2500 if (!pci_honor_msi_blacklist) 2501 return (0); 2502 2503 return (pci_has_quirk(pci_get_devid(dev), PCI_QUIRK_DISABLE_MSI)); 2504 } 2505 2506 /* 2507 * Determine if MSI is blacklisted globally on this system. Currently, 2508 * we just check for blacklisted chipsets as represented by the 2509 * host-PCI bridge at device 0:0:0. In the future, it may become 2510 * necessary to check other system attributes, such as the kenv values 2511 * that give the motherboard manufacturer and model number. 2512 */ 2513 static int 2514 pci_msi_blacklisted(void) 2515 { 2516 device_t dev; 2517 2518 if (!pci_honor_msi_blacklist) 2519 return (0); 2520 2521 /* Blacklist all non-PCI-express and non-PCI-X chipsets. */ 2522 if (!(pcie_chipset || pcix_chipset)) { 2523 if (vm_guest != VM_GUEST_NO) { 2524 /* 2525 * Whitelist older chipsets in virtual 2526 * machines known to support MSI. 2527 */ 2528 dev = pci_find_bsf(0, 0, 0); 2529 if (dev != NULL) 2530 return (!pci_has_quirk(pci_get_devid(dev), 2531 PCI_QUIRK_ENABLE_MSI_VM)); 2532 } 2533 return (1); 2534 } 2535 2536 dev = pci_find_bsf(0, 0, 0); 2537 if (dev != NULL) 2538 return (pci_msi_device_blacklisted(dev)); 2539 return (0); 2540 } 2541 2542 /* 2543 * Returns true if the specified device is blacklisted because MSI-X 2544 * doesn't work. Note that this assumes that if MSI doesn't work, 2545 * MSI-X doesn't either. 2546 */ 2547 int 2548 pci_msix_device_blacklisted(device_t dev) 2549 { 2550 2551 if (!pci_honor_msi_blacklist) 2552 return (0); 2553 2554 if (pci_has_quirk(pci_get_devid(dev), PCI_QUIRK_DISABLE_MSIX)) 2555 return (1); 2556 2557 return (pci_msi_device_blacklisted(dev)); 2558 } 2559 2560 /* 2561 * Determine if MSI-X is blacklisted globally on this system. If MSI 2562 * is blacklisted, assume that MSI-X is as well. Check for additional 2563 * chipsets where MSI works but MSI-X does not. 2564 */ 2565 static int 2566 pci_msix_blacklisted(void) 2567 { 2568 device_t dev; 2569 2570 if (!pci_honor_msi_blacklist) 2571 return (0); 2572 2573 dev = pci_find_bsf(0, 0, 0); 2574 if (dev != NULL && pci_has_quirk(pci_get_devid(dev), 2575 PCI_QUIRK_DISABLE_MSIX)) 2576 return (1); 2577 2578 return (pci_msi_blacklisted()); 2579 } 2580 2581 /* 2582 * Attempt to allocate *count MSI messages. The actual number allocated is 2583 * returned in *count. After this function returns, each message will be 2584 * available to the driver as SYS_RES_IRQ resources starting at a rid 1. 2585 */ 2586 int 2587 pci_alloc_msi_method(device_t dev, device_t child, int *count) 2588 { 2589 struct pci_devinfo *dinfo = device_get_ivars(child); 2590 pcicfgregs *cfg = &dinfo->cfg; 2591 struct resource_list_entry *rle; 2592 int actual, error, i, irqs[32]; 2593 uint16_t ctrl; 2594 2595 /* Don't let count == 0 get us into trouble. */ 2596 if (*count == 0) 2597 return (EINVAL); 2598 2599 /* If rid 0 is allocated, then fail. */ 2600 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, 0); 2601 if (rle != NULL && rle->res != NULL) 2602 return (ENXIO); 2603 2604 /* Already have allocated messages? */ 2605 if (cfg->msi.msi_alloc != 0 || cfg->msix.msix_alloc != 0) 2606 return (ENXIO); 2607 2608 /* If MSI is blacklisted for this system, fail. */ 2609 if (pci_msi_blacklisted()) 2610 return (ENXIO); 2611 2612 /* MSI capability present? */ 2613 if (cfg->msi.msi_location == 0 || !pci_do_msi) 2614 return (ENODEV); 2615 2616 if (bootverbose) 2617 device_printf(child, 2618 "attempting to allocate %d MSI vectors (%d supported)\n", 2619 *count, cfg->msi.msi_msgnum); 2620 2621 /* Don't ask for more than the device supports. */ 2622 actual = min(*count, cfg->msi.msi_msgnum); 2623 2624 /* Don't ask for more than 32 messages. */ 2625 actual = min(actual, 32); 2626 2627 /* MSI requires power of 2 number of messages. */ 2628 if (!powerof2(actual)) 2629 return (EINVAL); 2630 2631 for (;;) { 2632 /* Try to allocate N messages. */ 2633 error = PCIB_ALLOC_MSI(device_get_parent(dev), child, actual, 2634 actual, irqs); 2635 if (error == 0) 2636 break; 2637 if (actual == 1) 2638 return (error); 2639 2640 /* Try N / 2. */ 2641 actual >>= 1; 2642 } 2643 2644 /* 2645 * We now have N actual messages mapped onto SYS_RES_IRQ 2646 * resources in the irqs[] array, so add new resources 2647 * starting at rid 1. 2648 */ 2649 for (i = 0; i < actual; i++) 2650 resource_list_add(&dinfo->resources, SYS_RES_IRQ, i + 1, 2651 irqs[i], irqs[i], 1); 2652 2653 if (bootverbose) { 2654 if (actual == 1) 2655 device_printf(child, "using IRQ %d for MSI\n", irqs[0]); 2656 else { 2657 int run; 2658 2659 /* 2660 * Be fancy and try to print contiguous runs 2661 * of IRQ values as ranges. 'run' is true if 2662 * we are in a range. 2663 */ 2664 device_printf(child, "using IRQs %d", irqs[0]); 2665 run = 0; 2666 for (i = 1; i < actual; i++) { 2667 /* Still in a run? */ 2668 if (irqs[i] == irqs[i - 1] + 1) { 2669 run = 1; 2670 continue; 2671 } 2672 2673 /* Finish previous range. */ 2674 if (run) { 2675 printf("-%d", irqs[i - 1]); 2676 run = 0; 2677 } 2678 2679 /* Start new range. */ 2680 printf(",%d", irqs[i]); 2681 } 2682 2683 /* Unfinished range? */ 2684 if (run) 2685 printf("-%d", irqs[actual - 1]); 2686 printf(" for MSI\n"); 2687 } 2688 } 2689 2690 /* Update control register with actual count. */ 2691 ctrl = cfg->msi.msi_ctrl; 2692 ctrl &= ~PCIM_MSICTRL_MME_MASK; 2693 ctrl |= (ffs(actual) - 1) << 4; 2694 cfg->msi.msi_ctrl = ctrl; 2695 pci_write_config(child, cfg->msi.msi_location + PCIR_MSI_CTRL, ctrl, 2); 2696 2697 /* Update counts of alloc'd messages. */ 2698 cfg->msi.msi_alloc = actual; 2699 cfg->msi.msi_handlers = 0; 2700 *count = actual; 2701 return (0); 2702 } 2703 2704 /* Release the MSI messages associated with this device. */ 2705 int 2706 pci_release_msi_method(device_t dev, device_t child) 2707 { 2708 struct pci_devinfo *dinfo = device_get_ivars(child); 2709 struct pcicfg_msi *msi = &dinfo->cfg.msi; 2710 struct resource_list_entry *rle; 2711 int error, i, irqs[32]; 2712 2713 /* Try MSI-X first. */ 2714 error = pci_release_msix(dev, child); 2715 if (error != ENODEV) 2716 return (error); 2717 2718 /* Do we have any messages to release? */ 2719 if (msi->msi_alloc == 0) 2720 return (ENODEV); 2721 KASSERT(msi->msi_alloc <= 32, ("more than 32 alloc'd messages")); 2722 2723 /* Make sure none of the resources are allocated. */ 2724 if (msi->msi_handlers > 0) 2725 return (EBUSY); 2726 for (i = 0; i < msi->msi_alloc; i++) { 2727 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, i + 1); 2728 KASSERT(rle != NULL, ("missing MSI resource")); 2729 if (rle->res != NULL) 2730 return (EBUSY); 2731 irqs[i] = rle->start; 2732 } 2733 2734 /* Update control register with 0 count. */ 2735 KASSERT(!(msi->msi_ctrl & PCIM_MSICTRL_MSI_ENABLE), 2736 ("%s: MSI still enabled", __func__)); 2737 msi->msi_ctrl &= ~PCIM_MSICTRL_MME_MASK; 2738 pci_write_config(child, msi->msi_location + PCIR_MSI_CTRL, 2739 msi->msi_ctrl, 2); 2740 2741 /* Release the messages. */ 2742 PCIB_RELEASE_MSI(device_get_parent(dev), child, msi->msi_alloc, irqs); 2743 for (i = 0; i < msi->msi_alloc; i++) 2744 resource_list_delete(&dinfo->resources, SYS_RES_IRQ, i + 1); 2745 2746 /* Update alloc count. */ 2747 msi->msi_alloc = 0; 2748 msi->msi_addr = 0; 2749 msi->msi_data = 0; 2750 return (0); 2751 } 2752 2753 /* 2754 * Return the max supported MSI messages this device supports. 2755 * Basically, assuming the MD code can alloc messages, this function 2756 * should return the maximum value that pci_alloc_msi() can return. 2757 * Thus, it is subject to the tunables, etc. 2758 */ 2759 int 2760 pci_msi_count_method(device_t dev, device_t child) 2761 { 2762 struct pci_devinfo *dinfo = device_get_ivars(child); 2763 struct pcicfg_msi *msi = &dinfo->cfg.msi; 2764 2765 if (pci_do_msi && msi->msi_location != 0) 2766 return (msi->msi_msgnum); 2767 return (0); 2768 } 2769 2770 /* free pcicfgregs structure and all depending data structures */ 2771 2772 int 2773 pci_freecfg(struct pci_devinfo *dinfo) 2774 { 2775 struct devlist *devlist_head; 2776 struct pci_map *pm, *next; 2777 int i; 2778 2779 devlist_head = &pci_devq; 2780 2781 if (dinfo->cfg.vpd.vpd_reg) { 2782 free(dinfo->cfg.vpd.vpd_ident, M_DEVBUF); 2783 for (i = 0; i < dinfo->cfg.vpd.vpd_rocnt; i++) 2784 free(dinfo->cfg.vpd.vpd_ros[i].value, M_DEVBUF); 2785 free(dinfo->cfg.vpd.vpd_ros, M_DEVBUF); 2786 for (i = 0; i < dinfo->cfg.vpd.vpd_wcnt; i++) 2787 free(dinfo->cfg.vpd.vpd_w[i].value, M_DEVBUF); 2788 free(dinfo->cfg.vpd.vpd_w, M_DEVBUF); 2789 } 2790 STAILQ_FOREACH_SAFE(pm, &dinfo->cfg.maps, pm_link, next) { 2791 free(pm, M_DEVBUF); 2792 } 2793 STAILQ_REMOVE(devlist_head, dinfo, pci_devinfo, pci_links); 2794 free(dinfo, M_DEVBUF); 2795 2796 /* increment the generation count */ 2797 pci_generation++; 2798 2799 /* we're losing one device */ 2800 pci_numdevs--; 2801 return (0); 2802 } 2803 2804 /* 2805 * PCI power manangement 2806 */ 2807 int 2808 pci_set_powerstate_method(device_t dev, device_t child, int state) 2809 { 2810 struct pci_devinfo *dinfo = device_get_ivars(child); 2811 pcicfgregs *cfg = &dinfo->cfg; 2812 uint16_t status; 2813 int oldstate, highest, delay; 2814 2815 if (cfg->pp.pp_cap == 0) 2816 return (EOPNOTSUPP); 2817 2818 /* 2819 * Optimize a no state change request away. While it would be OK to 2820 * write to the hardware in theory, some devices have shown odd 2821 * behavior when going from D3 -> D3. 2822 */ 2823 oldstate = pci_get_powerstate(child); 2824 if (oldstate == state) 2825 return (0); 2826 2827 /* 2828 * The PCI power management specification states that after a state 2829 * transition between PCI power states, system software must 2830 * guarantee a minimal delay before the function accesses the device. 2831 * Compute the worst case delay that we need to guarantee before we 2832 * access the device. Many devices will be responsive much more 2833 * quickly than this delay, but there are some that don't respond 2834 * instantly to state changes. Transitions to/from D3 state require 2835 * 10ms, while D2 requires 200us, and D0/1 require none. The delay 2836 * is done below with DELAY rather than a sleeper function because 2837 * this function can be called from contexts where we cannot sleep. 2838 */ 2839 highest = (oldstate > state) ? oldstate : state; 2840 if (highest == PCI_POWERSTATE_D3) 2841 delay = 10000; 2842 else if (highest == PCI_POWERSTATE_D2) 2843 delay = 200; 2844 else 2845 delay = 0; 2846 status = PCI_READ_CONFIG(dev, child, cfg->pp.pp_status, 2) 2847 & ~PCIM_PSTAT_DMASK; 2848 switch (state) { 2849 case PCI_POWERSTATE_D0: 2850 status |= PCIM_PSTAT_D0; 2851 break; 2852 case PCI_POWERSTATE_D1: 2853 if ((cfg->pp.pp_cap & PCIM_PCAP_D1SUPP) == 0) 2854 return (EOPNOTSUPP); 2855 status |= PCIM_PSTAT_D1; 2856 break; 2857 case PCI_POWERSTATE_D2: 2858 if ((cfg->pp.pp_cap & PCIM_PCAP_D2SUPP) == 0) 2859 return (EOPNOTSUPP); 2860 status |= PCIM_PSTAT_D2; 2861 break; 2862 case PCI_POWERSTATE_D3: 2863 status |= PCIM_PSTAT_D3; 2864 break; 2865 default: 2866 return (EINVAL); 2867 } 2868 2869 if (bootverbose) 2870 pci_printf(cfg, "Transition from D%d to D%d\n", oldstate, 2871 state); 2872 2873 PCI_WRITE_CONFIG(dev, child, cfg->pp.pp_status, status, 2); 2874 if (delay) 2875 DELAY(delay); 2876 return (0); 2877 } 2878 2879 int 2880 pci_get_powerstate_method(device_t dev, device_t child) 2881 { 2882 struct pci_devinfo *dinfo = device_get_ivars(child); 2883 pcicfgregs *cfg = &dinfo->cfg; 2884 uint16_t status; 2885 int result; 2886 2887 if (cfg->pp.pp_cap != 0) { 2888 status = PCI_READ_CONFIG(dev, child, cfg->pp.pp_status, 2); 2889 switch (status & PCIM_PSTAT_DMASK) { 2890 case PCIM_PSTAT_D0: 2891 result = PCI_POWERSTATE_D0; 2892 break; 2893 case PCIM_PSTAT_D1: 2894 result = PCI_POWERSTATE_D1; 2895 break; 2896 case PCIM_PSTAT_D2: 2897 result = PCI_POWERSTATE_D2; 2898 break; 2899 case PCIM_PSTAT_D3: 2900 result = PCI_POWERSTATE_D3; 2901 break; 2902 default: 2903 result = PCI_POWERSTATE_UNKNOWN; 2904 break; 2905 } 2906 } else { 2907 /* No support, device is always at D0 */ 2908 result = PCI_POWERSTATE_D0; 2909 } 2910 return (result); 2911 } 2912 2913 /* 2914 * Some convenience functions for PCI device drivers. 2915 */ 2916 2917 static __inline void 2918 pci_set_command_bit(device_t dev, device_t child, uint16_t bit) 2919 { 2920 uint16_t command; 2921 2922 command = PCI_READ_CONFIG(dev, child, PCIR_COMMAND, 2); 2923 command |= bit; 2924 PCI_WRITE_CONFIG(dev, child, PCIR_COMMAND, command, 2); 2925 } 2926 2927 static __inline void 2928 pci_clear_command_bit(device_t dev, device_t child, uint16_t bit) 2929 { 2930 uint16_t command; 2931 2932 command = PCI_READ_CONFIG(dev, child, PCIR_COMMAND, 2); 2933 command &= ~bit; 2934 PCI_WRITE_CONFIG(dev, child, PCIR_COMMAND, command, 2); 2935 } 2936 2937 int 2938 pci_enable_busmaster_method(device_t dev, device_t child) 2939 { 2940 pci_set_command_bit(dev, child, PCIM_CMD_BUSMASTEREN); 2941 return (0); 2942 } 2943 2944 int 2945 pci_disable_busmaster_method(device_t dev, device_t child) 2946 { 2947 pci_clear_command_bit(dev, child, PCIM_CMD_BUSMASTEREN); 2948 return (0); 2949 } 2950 2951 int 2952 pci_enable_io_method(device_t dev, device_t child, int space) 2953 { 2954 uint16_t bit; 2955 2956 switch(space) { 2957 case SYS_RES_IOPORT: 2958 bit = PCIM_CMD_PORTEN; 2959 break; 2960 case SYS_RES_MEMORY: 2961 bit = PCIM_CMD_MEMEN; 2962 break; 2963 default: 2964 return (EINVAL); 2965 } 2966 pci_set_command_bit(dev, child, bit); 2967 return (0); 2968 } 2969 2970 int 2971 pci_disable_io_method(device_t dev, device_t child, int space) 2972 { 2973 uint16_t bit; 2974 2975 switch(space) { 2976 case SYS_RES_IOPORT: 2977 bit = PCIM_CMD_PORTEN; 2978 break; 2979 case SYS_RES_MEMORY: 2980 bit = PCIM_CMD_MEMEN; 2981 break; 2982 default: 2983 return (EINVAL); 2984 } 2985 pci_clear_command_bit(dev, child, bit); 2986 return (0); 2987 } 2988 2989 /* 2990 * New style pci driver. Parent device is either a pci-host-bridge or a 2991 * pci-pci-bridge. Both kinds are represented by instances of pcib. 2992 */ 2993 2994 void 2995 pci_print_verbose(struct pci_devinfo *dinfo) 2996 { 2997 2998 if (bootverbose) { 2999 pcicfgregs *cfg = &dinfo->cfg; 3000 3001 printf("found->\tvendor=0x%04x, dev=0x%04x, revid=0x%02x\n", 3002 cfg->vendor, cfg->device, cfg->revid); 3003 printf("\tdomain=%d, bus=%d, slot=%d, func=%d\n", 3004 cfg->domain, cfg->bus, cfg->slot, cfg->func); 3005 printf("\tclass=%02x-%02x-%02x, hdrtype=0x%02x, mfdev=%d\n", 3006 cfg->baseclass, cfg->subclass, cfg->progif, cfg->hdrtype, 3007 cfg->mfdev); 3008 printf("\tcmdreg=0x%04x, statreg=0x%04x, cachelnsz=%d (dwords)\n", 3009 cfg->cmdreg, cfg->statreg, cfg->cachelnsz); 3010 printf("\tlattimer=0x%02x (%d ns), mingnt=0x%02x (%d ns), maxlat=0x%02x (%d ns)\n", 3011 cfg->lattimer, cfg->lattimer * 30, cfg->mingnt, 3012 cfg->mingnt * 250, cfg->maxlat, cfg->maxlat * 250); 3013 if (cfg->intpin > 0) 3014 printf("\tintpin=%c, irq=%d\n", 3015 cfg->intpin +'a' -1, cfg->intline); 3016 if (cfg->pp.pp_cap) { 3017 uint16_t status; 3018 3019 status = pci_read_config(cfg->dev, cfg->pp.pp_status, 2); 3020 printf("\tpowerspec %d supports D0%s%s D3 current D%d\n", 3021 cfg->pp.pp_cap & PCIM_PCAP_SPEC, 3022 cfg->pp.pp_cap & PCIM_PCAP_D1SUPP ? " D1" : "", 3023 cfg->pp.pp_cap & PCIM_PCAP_D2SUPP ? " D2" : "", 3024 status & PCIM_PSTAT_DMASK); 3025 } 3026 if (cfg->msi.msi_location) { 3027 int ctrl; 3028 3029 ctrl = cfg->msi.msi_ctrl; 3030 printf("\tMSI supports %d message%s%s%s\n", 3031 cfg->msi.msi_msgnum, 3032 (cfg->msi.msi_msgnum == 1) ? "" : "s", 3033 (ctrl & PCIM_MSICTRL_64BIT) ? ", 64 bit" : "", 3034 (ctrl & PCIM_MSICTRL_VECTOR) ? ", vector masks":""); 3035 } 3036 if (cfg->msix.msix_location) { 3037 printf("\tMSI-X supports %d message%s ", 3038 cfg->msix.msix_msgnum, 3039 (cfg->msix.msix_msgnum == 1) ? "" : "s"); 3040 if (cfg->msix.msix_table_bar == cfg->msix.msix_pba_bar) 3041 printf("in map 0x%x\n", 3042 cfg->msix.msix_table_bar); 3043 else 3044 printf("in maps 0x%x and 0x%x\n", 3045 cfg->msix.msix_table_bar, 3046 cfg->msix.msix_pba_bar); 3047 } 3048 } 3049 } 3050 3051 static int 3052 pci_porten(device_t dev) 3053 { 3054 return (pci_read_config(dev, PCIR_COMMAND, 2) & PCIM_CMD_PORTEN) != 0; 3055 } 3056 3057 static int 3058 pci_memen(device_t dev) 3059 { 3060 return (pci_read_config(dev, PCIR_COMMAND, 2) & PCIM_CMD_MEMEN) != 0; 3061 } 3062 3063 void 3064 pci_read_bar(device_t dev, int reg, pci_addr_t *mapp, pci_addr_t *testvalp, 3065 int *bar64) 3066 { 3067 struct pci_devinfo *dinfo; 3068 pci_addr_t map, testval; 3069 int ln2range; 3070 uint16_t cmd; 3071 3072 /* 3073 * The device ROM BAR is special. It is always a 32-bit 3074 * memory BAR. Bit 0 is special and should not be set when 3075 * sizing the BAR. 3076 */ 3077 dinfo = device_get_ivars(dev); 3078 if (PCIR_IS_BIOS(&dinfo->cfg, reg)) { 3079 map = pci_read_config(dev, reg, 4); 3080 pci_write_config(dev, reg, 0xfffffffe, 4); 3081 testval = pci_read_config(dev, reg, 4); 3082 pci_write_config(dev, reg, map, 4); 3083 *mapp = map; 3084 *testvalp = testval; 3085 if (bar64 != NULL) 3086 *bar64 = 0; 3087 return; 3088 } 3089 3090 map = pci_read_config(dev, reg, 4); 3091 ln2range = pci_maprange(map); 3092 if (ln2range == 64) 3093 map |= (pci_addr_t)pci_read_config(dev, reg + 4, 4) << 32; 3094 3095 /* 3096 * Disable decoding via the command register before 3097 * determining the BAR's length since we will be placing it in 3098 * a weird state. 3099 */ 3100 cmd = pci_read_config(dev, PCIR_COMMAND, 2); 3101 pci_write_config(dev, PCIR_COMMAND, 3102 cmd & ~(PCI_BAR_MEM(map) ? PCIM_CMD_MEMEN : PCIM_CMD_PORTEN), 2); 3103 3104 /* 3105 * Determine the BAR's length by writing all 1's. The bottom 3106 * log_2(size) bits of the BAR will stick as 0 when we read 3107 * the value back. 3108 * 3109 * NB: according to the PCI Local Bus Specification, rev. 3.0: 3110 * "Software writes 0FFFFFFFFh to both registers, reads them back, 3111 * and combines the result into a 64-bit value." (section 6.2.5.1) 3112 * 3113 * Writes to both registers must be performed before attempting to 3114 * read back the size value. 3115 */ 3116 testval = 0; 3117 pci_write_config(dev, reg, 0xffffffff, 4); 3118 if (ln2range == 64) { 3119 pci_write_config(dev, reg + 4, 0xffffffff, 4); 3120 testval |= (pci_addr_t)pci_read_config(dev, reg + 4, 4) << 32; 3121 } 3122 testval |= pci_read_config(dev, reg, 4); 3123 3124 /* 3125 * Restore the original value of the BAR. We may have reprogrammed 3126 * the BAR of the low-level console device and when booting verbose, 3127 * we need the console device addressable. 3128 */ 3129 pci_write_config(dev, reg, map, 4); 3130 if (ln2range == 64) 3131 pci_write_config(dev, reg + 4, map >> 32, 4); 3132 pci_write_config(dev, PCIR_COMMAND, cmd, 2); 3133 3134 *mapp = map; 3135 *testvalp = testval; 3136 if (bar64 != NULL) 3137 *bar64 = (ln2range == 64); 3138 } 3139 3140 static void 3141 pci_write_bar(device_t dev, struct pci_map *pm, pci_addr_t base) 3142 { 3143 struct pci_devinfo *dinfo; 3144 int ln2range; 3145 3146 /* The device ROM BAR is always a 32-bit memory BAR. */ 3147 dinfo = device_get_ivars(dev); 3148 if (PCIR_IS_BIOS(&dinfo->cfg, pm->pm_reg)) 3149 ln2range = 32; 3150 else 3151 ln2range = pci_maprange(pm->pm_value); 3152 pci_write_config(dev, pm->pm_reg, base, 4); 3153 if (ln2range == 64) 3154 pci_write_config(dev, pm->pm_reg + 4, base >> 32, 4); 3155 pm->pm_value = pci_read_config(dev, pm->pm_reg, 4); 3156 if (ln2range == 64) 3157 pm->pm_value |= (pci_addr_t)pci_read_config(dev, 3158 pm->pm_reg + 4, 4) << 32; 3159 } 3160 3161 struct pci_map * 3162 pci_find_bar(device_t dev, int reg) 3163 { 3164 struct pci_devinfo *dinfo; 3165 struct pci_map *pm; 3166 3167 dinfo = device_get_ivars(dev); 3168 STAILQ_FOREACH(pm, &dinfo->cfg.maps, pm_link) { 3169 if (pm->pm_reg == reg) 3170 return (pm); 3171 } 3172 return (NULL); 3173 } 3174 3175 int 3176 pci_bar_enabled(device_t dev, struct pci_map *pm) 3177 { 3178 struct pci_devinfo *dinfo; 3179 uint16_t cmd; 3180 3181 dinfo = device_get_ivars(dev); 3182 if (PCIR_IS_BIOS(&dinfo->cfg, pm->pm_reg) && 3183 !(pm->pm_value & PCIM_BIOS_ENABLE)) 3184 return (0); 3185 #ifdef PCI_IOV 3186 if ((dinfo->cfg.flags & PCICFG_VF) != 0) { 3187 struct pcicfg_iov *iov; 3188 3189 iov = dinfo->cfg.iov; 3190 cmd = pci_read_config(iov->iov_pf, 3191 iov->iov_pos + PCIR_SRIOV_CTL, 2); 3192 return ((cmd & PCIM_SRIOV_VF_MSE) != 0); 3193 } 3194 #endif 3195 cmd = pci_read_config(dev, PCIR_COMMAND, 2); 3196 if (PCIR_IS_BIOS(&dinfo->cfg, pm->pm_reg) || PCI_BAR_MEM(pm->pm_value)) 3197 return ((cmd & PCIM_CMD_MEMEN) != 0); 3198 else 3199 return ((cmd & PCIM_CMD_PORTEN) != 0); 3200 } 3201 3202 struct pci_map * 3203 pci_add_bar(device_t dev, int reg, pci_addr_t value, pci_addr_t size) 3204 { 3205 struct pci_devinfo *dinfo; 3206 struct pci_map *pm, *prev; 3207 3208 dinfo = device_get_ivars(dev); 3209 pm = malloc(sizeof(*pm), M_DEVBUF, M_WAITOK | M_ZERO); 3210 pm->pm_reg = reg; 3211 pm->pm_value = value; 3212 pm->pm_size = size; 3213 STAILQ_FOREACH(prev, &dinfo->cfg.maps, pm_link) { 3214 KASSERT(prev->pm_reg != pm->pm_reg, ("duplicate map %02x", 3215 reg)); 3216 if (STAILQ_NEXT(prev, pm_link) == NULL || 3217 STAILQ_NEXT(prev, pm_link)->pm_reg > pm->pm_reg) 3218 break; 3219 } 3220 if (prev != NULL) 3221 STAILQ_INSERT_AFTER(&dinfo->cfg.maps, prev, pm, pm_link); 3222 else 3223 STAILQ_INSERT_TAIL(&dinfo->cfg.maps, pm, pm_link); 3224 return (pm); 3225 } 3226 3227 static void 3228 pci_restore_bars(device_t dev) 3229 { 3230 struct pci_devinfo *dinfo; 3231 struct pci_map *pm; 3232 int ln2range; 3233 3234 dinfo = device_get_ivars(dev); 3235 STAILQ_FOREACH(pm, &dinfo->cfg.maps, pm_link) { 3236 if (PCIR_IS_BIOS(&dinfo->cfg, pm->pm_reg)) 3237 ln2range = 32; 3238 else 3239 ln2range = pci_maprange(pm->pm_value); 3240 pci_write_config(dev, pm->pm_reg, pm->pm_value, 4); 3241 if (ln2range == 64) 3242 pci_write_config(dev, pm->pm_reg + 4, 3243 pm->pm_value >> 32, 4); 3244 } 3245 } 3246 3247 /* 3248 * Add a resource based on a pci map register. Return 1 if the map 3249 * register is a 32bit map register or 2 if it is a 64bit register. 3250 */ 3251 static int 3252 pci_add_map(device_t bus, device_t dev, int reg, struct resource_list *rl, 3253 int force, int prefetch) 3254 { 3255 struct pci_map *pm; 3256 pci_addr_t base, map, testval; 3257 pci_addr_t start, end, count; 3258 int barlen, basezero, flags, maprange, mapsize, type; 3259 uint16_t cmd; 3260 struct resource *res; 3261 3262 /* 3263 * The BAR may already exist if the device is a CardBus card 3264 * whose CIS is stored in this BAR. 3265 */ 3266 pm = pci_find_bar(dev, reg); 3267 if (pm != NULL) { 3268 maprange = pci_maprange(pm->pm_value); 3269 barlen = maprange == 64 ? 2 : 1; 3270 return (barlen); 3271 } 3272 3273 pci_read_bar(dev, reg, &map, &testval, NULL); 3274 if (PCI_BAR_MEM(map)) { 3275 type = SYS_RES_MEMORY; 3276 if (map & PCIM_BAR_MEM_PREFETCH) 3277 prefetch = 1; 3278 } else 3279 type = SYS_RES_IOPORT; 3280 mapsize = pci_mapsize(testval); 3281 base = pci_mapbase(map); 3282 #ifdef __PCI_BAR_ZERO_VALID 3283 basezero = 0; 3284 #else 3285 basezero = base == 0; 3286 #endif 3287 maprange = pci_maprange(map); 3288 barlen = maprange == 64 ? 2 : 1; 3289 3290 /* 3291 * For I/O registers, if bottom bit is set, and the next bit up 3292 * isn't clear, we know we have a BAR that doesn't conform to the 3293 * spec, so ignore it. Also, sanity check the size of the data 3294 * areas to the type of memory involved. Memory must be at least 3295 * 16 bytes in size, while I/O ranges must be at least 4. 3296 */ 3297 if (PCI_BAR_IO(testval) && (testval & PCIM_BAR_IO_RESERVED) != 0) 3298 return (barlen); 3299 if ((type == SYS_RES_MEMORY && mapsize < 4) || 3300 (type == SYS_RES_IOPORT && mapsize < 2)) 3301 return (barlen); 3302 3303 /* Save a record of this BAR. */ 3304 pm = pci_add_bar(dev, reg, map, mapsize); 3305 if (bootverbose) { 3306 printf("\tmap[%02x]: type %s, range %2d, base %#jx, size %2d", 3307 reg, pci_maptype(map), maprange, (uintmax_t)base, mapsize); 3308 if (type == SYS_RES_IOPORT && !pci_porten(dev)) 3309 printf(", port disabled\n"); 3310 else if (type == SYS_RES_MEMORY && !pci_memen(dev)) 3311 printf(", memory disabled\n"); 3312 else 3313 printf(", enabled\n"); 3314 } 3315 3316 /* 3317 * If base is 0, then we have problems if this architecture does 3318 * not allow that. It is best to ignore such entries for the 3319 * moment. These will be allocated later if the driver specifically 3320 * requests them. However, some removable buses look better when 3321 * all resources are allocated, so allow '0' to be overriden. 3322 * 3323 * Similarly treat maps whose values is the same as the test value 3324 * read back. These maps have had all f's written to them by the 3325 * BIOS in an attempt to disable the resources. 3326 */ 3327 if (!force && (basezero || map == testval)) 3328 return (barlen); 3329 if ((u_long)base != base) { 3330 device_printf(bus, 3331 "pci%d:%d:%d:%d bar %#x too many address bits", 3332 pci_get_domain(dev), pci_get_bus(dev), pci_get_slot(dev), 3333 pci_get_function(dev), reg); 3334 return (barlen); 3335 } 3336 3337 /* 3338 * This code theoretically does the right thing, but has 3339 * undesirable side effects in some cases where peripherals 3340 * respond oddly to having these bits enabled. Let the user 3341 * be able to turn them off (since pci_enable_io_modes is 1 by 3342 * default). 3343 */ 3344 if (pci_enable_io_modes) { 3345 /* Turn on resources that have been left off by a lazy BIOS */ 3346 if (type == SYS_RES_IOPORT && !pci_porten(dev)) { 3347 cmd = pci_read_config(dev, PCIR_COMMAND, 2); 3348 cmd |= PCIM_CMD_PORTEN; 3349 pci_write_config(dev, PCIR_COMMAND, cmd, 2); 3350 } 3351 if (type == SYS_RES_MEMORY && !pci_memen(dev)) { 3352 cmd = pci_read_config(dev, PCIR_COMMAND, 2); 3353 cmd |= PCIM_CMD_MEMEN; 3354 pci_write_config(dev, PCIR_COMMAND, cmd, 2); 3355 } 3356 } else { 3357 if (type == SYS_RES_IOPORT && !pci_porten(dev)) 3358 return (barlen); 3359 if (type == SYS_RES_MEMORY && !pci_memen(dev)) 3360 return (barlen); 3361 } 3362 3363 count = (pci_addr_t)1 << mapsize; 3364 flags = RF_ALIGNMENT_LOG2(mapsize); 3365 if (prefetch) 3366 flags |= RF_PREFETCHABLE; 3367 if (basezero || base == pci_mapbase(testval) || pci_clear_bars) { 3368 start = 0; /* Let the parent decide. */ 3369 end = ~0; 3370 } else { 3371 start = base; 3372 end = base + count - 1; 3373 } 3374 resource_list_add(rl, type, reg, start, end, count); 3375 3376 /* 3377 * Try to allocate the resource for this BAR from our parent 3378 * so that this resource range is already reserved. The 3379 * driver for this device will later inherit this resource in 3380 * pci_alloc_resource(). 3381 */ 3382 res = resource_list_reserve(rl, bus, dev, type, ®, start, end, count, 3383 flags); 3384 if ((pci_do_realloc_bars 3385 || pci_has_quirk(pci_get_devid(dev), PCI_QUIRK_REALLOC_BAR)) 3386 && res == NULL && (start != 0 || end != ~0)) { 3387 /* 3388 * If the allocation fails, try to allocate a resource for 3389 * this BAR using any available range. The firmware felt 3390 * it was important enough to assign a resource, so don't 3391 * disable decoding if we can help it. 3392 */ 3393 resource_list_delete(rl, type, reg); 3394 resource_list_add(rl, type, reg, 0, ~0, count); 3395 res = resource_list_reserve(rl, bus, dev, type, ®, 0, ~0, 3396 count, flags); 3397 } 3398 if (res == NULL) { 3399 /* 3400 * If the allocation fails, delete the resource list entry 3401 * and disable decoding for this device. 3402 * 3403 * If the driver requests this resource in the future, 3404 * pci_reserve_map() will try to allocate a fresh 3405 * resource range. 3406 */ 3407 resource_list_delete(rl, type, reg); 3408 pci_disable_io(dev, type); 3409 if (bootverbose) 3410 device_printf(bus, 3411 "pci%d:%d:%d:%d bar %#x failed to allocate\n", 3412 pci_get_domain(dev), pci_get_bus(dev), 3413 pci_get_slot(dev), pci_get_function(dev), reg); 3414 } else { 3415 start = rman_get_start(res); 3416 pci_write_bar(dev, pm, start); 3417 } 3418 return (barlen); 3419 } 3420 3421 /* 3422 * For ATA devices we need to decide early what addressing mode to use. 3423 * Legacy demands that the primary and secondary ATA ports sits on the 3424 * same addresses that old ISA hardware did. This dictates that we use 3425 * those addresses and ignore the BAR's if we cannot set PCI native 3426 * addressing mode. 3427 */ 3428 static void 3429 pci_ata_maps(device_t bus, device_t dev, struct resource_list *rl, int force, 3430 uint32_t prefetchmask) 3431 { 3432 int rid, type, progif; 3433 #if 0 3434 /* if this device supports PCI native addressing use it */ 3435 progif = pci_read_config(dev, PCIR_PROGIF, 1); 3436 if ((progif & 0x8a) == 0x8a) { 3437 if (pci_mapbase(pci_read_config(dev, PCIR_BAR(0), 4)) && 3438 pci_mapbase(pci_read_config(dev, PCIR_BAR(2), 4))) { 3439 printf("Trying ATA native PCI addressing mode\n"); 3440 pci_write_config(dev, PCIR_PROGIF, progif | 0x05, 1); 3441 } 3442 } 3443 #endif 3444 progif = pci_read_config(dev, PCIR_PROGIF, 1); 3445 type = SYS_RES_IOPORT; 3446 if (progif & PCIP_STORAGE_IDE_MODEPRIM) { 3447 pci_add_map(bus, dev, PCIR_BAR(0), rl, force, 3448 prefetchmask & (1 << 0)); 3449 pci_add_map(bus, dev, PCIR_BAR(1), rl, force, 3450 prefetchmask & (1 << 1)); 3451 } else { 3452 rid = PCIR_BAR(0); 3453 resource_list_add(rl, type, rid, 0x1f0, 0x1f7, 8); 3454 (void)resource_list_reserve(rl, bus, dev, type, &rid, 0x1f0, 3455 0x1f7, 8, 0); 3456 rid = PCIR_BAR(1); 3457 resource_list_add(rl, type, rid, 0x3f6, 0x3f6, 1); 3458 (void)resource_list_reserve(rl, bus, dev, type, &rid, 0x3f6, 3459 0x3f6, 1, 0); 3460 } 3461 if (progif & PCIP_STORAGE_IDE_MODESEC) { 3462 pci_add_map(bus, dev, PCIR_BAR(2), rl, force, 3463 prefetchmask & (1 << 2)); 3464 pci_add_map(bus, dev, PCIR_BAR(3), rl, force, 3465 prefetchmask & (1 << 3)); 3466 } else { 3467 rid = PCIR_BAR(2); 3468 resource_list_add(rl, type, rid, 0x170, 0x177, 8); 3469 (void)resource_list_reserve(rl, bus, dev, type, &rid, 0x170, 3470 0x177, 8, 0); 3471 rid = PCIR_BAR(3); 3472 resource_list_add(rl, type, rid, 0x376, 0x376, 1); 3473 (void)resource_list_reserve(rl, bus, dev, type, &rid, 0x376, 3474 0x376, 1, 0); 3475 } 3476 pci_add_map(bus, dev, PCIR_BAR(4), rl, force, 3477 prefetchmask & (1 << 4)); 3478 pci_add_map(bus, dev, PCIR_BAR(5), rl, force, 3479 prefetchmask & (1 << 5)); 3480 } 3481 3482 static void 3483 pci_assign_interrupt(device_t bus, device_t dev, int force_route) 3484 { 3485 struct pci_devinfo *dinfo = device_get_ivars(dev); 3486 pcicfgregs *cfg = &dinfo->cfg; 3487 char tunable_name[64]; 3488 int irq; 3489 3490 /* Has to have an intpin to have an interrupt. */ 3491 if (cfg->intpin == 0) 3492 return; 3493 3494 /* Let the user override the IRQ with a tunable. */ 3495 irq = PCI_INVALID_IRQ; 3496 snprintf(tunable_name, sizeof(tunable_name), 3497 "hw.pci%d.%d.%d.INT%c.irq", 3498 cfg->domain, cfg->bus, cfg->slot, cfg->intpin + 'A' - 1); 3499 if (TUNABLE_INT_FETCH(tunable_name, &irq) && (irq >= 255 || irq <= 0)) 3500 irq = PCI_INVALID_IRQ; 3501 3502 /* 3503 * If we didn't get an IRQ via the tunable, then we either use the 3504 * IRQ value in the intline register or we ask the bus to route an 3505 * interrupt for us. If force_route is true, then we only use the 3506 * value in the intline register if the bus was unable to assign an 3507 * IRQ. 3508 */ 3509 if (!PCI_INTERRUPT_VALID(irq)) { 3510 if (!PCI_INTERRUPT_VALID(cfg->intline) || force_route) 3511 irq = PCI_ASSIGN_INTERRUPT(bus, dev); 3512 if (!PCI_INTERRUPT_VALID(irq)) 3513 irq = cfg->intline; 3514 } 3515 3516 /* If after all that we don't have an IRQ, just bail. */ 3517 if (!PCI_INTERRUPT_VALID(irq)) 3518 return; 3519 3520 /* Update the config register if it changed. */ 3521 if (irq != cfg->intline) { 3522 cfg->intline = irq; 3523 pci_write_config(dev, PCIR_INTLINE, irq, 1); 3524 } 3525 3526 /* Add this IRQ as rid 0 interrupt resource. */ 3527 resource_list_add(&dinfo->resources, SYS_RES_IRQ, 0, irq, irq, 1); 3528 } 3529 3530 /* Perform early OHCI takeover from SMM. */ 3531 static void 3532 ohci_early_takeover(device_t self) 3533 { 3534 struct resource *res; 3535 uint32_t ctl; 3536 int rid; 3537 int i; 3538 3539 rid = PCIR_BAR(0); 3540 res = bus_alloc_resource_any(self, SYS_RES_MEMORY, &rid, RF_ACTIVE); 3541 if (res == NULL) 3542 return; 3543 3544 ctl = bus_read_4(res, OHCI_CONTROL); 3545 if (ctl & OHCI_IR) { 3546 if (bootverbose) 3547 printf("ohci early: " 3548 "SMM active, request owner change\n"); 3549 bus_write_4(res, OHCI_COMMAND_STATUS, OHCI_OCR); 3550 for (i = 0; (i < 100) && (ctl & OHCI_IR); i++) { 3551 DELAY(1000); 3552 ctl = bus_read_4(res, OHCI_CONTROL); 3553 } 3554 if (ctl & OHCI_IR) { 3555 if (bootverbose) 3556 printf("ohci early: " 3557 "SMM does not respond, resetting\n"); 3558 bus_write_4(res, OHCI_CONTROL, OHCI_HCFS_RESET); 3559 } 3560 /* Disable interrupts */ 3561 bus_write_4(res, OHCI_INTERRUPT_DISABLE, OHCI_ALL_INTRS); 3562 } 3563 3564 bus_release_resource(self, SYS_RES_MEMORY, rid, res); 3565 } 3566 3567 /* Perform early UHCI takeover from SMM. */ 3568 static void 3569 uhci_early_takeover(device_t self) 3570 { 3571 struct resource *res; 3572 int rid; 3573 3574 /* 3575 * Set the PIRQD enable bit and switch off all the others. We don't 3576 * want legacy support to interfere with us XXX Does this also mean 3577 * that the BIOS won't touch the keyboard anymore if it is connected 3578 * to the ports of the root hub? 3579 */ 3580 pci_write_config(self, PCI_LEGSUP, PCI_LEGSUP_USBPIRQDEN, 2); 3581 3582 /* Disable interrupts */ 3583 rid = PCI_UHCI_BASE_REG; 3584 res = bus_alloc_resource_any(self, SYS_RES_IOPORT, &rid, RF_ACTIVE); 3585 if (res != NULL) { 3586 bus_write_2(res, UHCI_INTR, 0); 3587 bus_release_resource(self, SYS_RES_IOPORT, rid, res); 3588 } 3589 } 3590 3591 /* Perform early EHCI takeover from SMM. */ 3592 static void 3593 ehci_early_takeover(device_t self) 3594 { 3595 struct resource *res; 3596 uint32_t cparams; 3597 uint32_t eec; 3598 uint8_t eecp; 3599 uint8_t bios_sem; 3600 uint8_t offs; 3601 int rid; 3602 int i; 3603 3604 rid = PCIR_BAR(0); 3605 res = bus_alloc_resource_any(self, SYS_RES_MEMORY, &rid, RF_ACTIVE); 3606 if (res == NULL) 3607 return; 3608 3609 cparams = bus_read_4(res, EHCI_HCCPARAMS); 3610 3611 /* Synchronise with the BIOS if it owns the controller. */ 3612 for (eecp = EHCI_HCC_EECP(cparams); eecp != 0; 3613 eecp = EHCI_EECP_NEXT(eec)) { 3614 eec = pci_read_config(self, eecp, 4); 3615 if (EHCI_EECP_ID(eec) != EHCI_EC_LEGSUP) { 3616 continue; 3617 } 3618 bios_sem = pci_read_config(self, eecp + 3619 EHCI_LEGSUP_BIOS_SEM, 1); 3620 if (bios_sem == 0) { 3621 continue; 3622 } 3623 if (bootverbose) 3624 printf("ehci early: " 3625 "SMM active, request owner change\n"); 3626 3627 pci_write_config(self, eecp + EHCI_LEGSUP_OS_SEM, 1, 1); 3628 3629 for (i = 0; (i < 100) && (bios_sem != 0); i++) { 3630 DELAY(1000); 3631 bios_sem = pci_read_config(self, eecp + 3632 EHCI_LEGSUP_BIOS_SEM, 1); 3633 } 3634 3635 if (bios_sem != 0) { 3636 if (bootverbose) 3637 printf("ehci early: " 3638 "SMM does not respond\n"); 3639 } 3640 /* Disable interrupts */ 3641 offs = EHCI_CAPLENGTH(bus_read_4(res, EHCI_CAPLEN_HCIVERSION)); 3642 bus_write_4(res, offs + EHCI_USBINTR, 0); 3643 } 3644 bus_release_resource(self, SYS_RES_MEMORY, rid, res); 3645 } 3646 3647 /* Perform early XHCI takeover from SMM. */ 3648 static void 3649 xhci_early_takeover(device_t self) 3650 { 3651 struct resource *res; 3652 uint32_t cparams; 3653 uint32_t eec; 3654 uint8_t eecp; 3655 uint8_t bios_sem; 3656 uint8_t offs; 3657 int rid; 3658 int i; 3659 3660 rid = PCIR_BAR(0); 3661 res = bus_alloc_resource_any(self, SYS_RES_MEMORY, &rid, RF_ACTIVE); 3662 if (res == NULL) 3663 return; 3664 3665 cparams = bus_read_4(res, XHCI_HCSPARAMS0); 3666 3667 eec = -1; 3668 3669 /* Synchronise with the BIOS if it owns the controller. */ 3670 for (eecp = XHCI_HCS0_XECP(cparams) << 2; eecp != 0 && XHCI_XECP_NEXT(eec); 3671 eecp += XHCI_XECP_NEXT(eec) << 2) { 3672 eec = bus_read_4(res, eecp); 3673 3674 if (XHCI_XECP_ID(eec) != XHCI_ID_USB_LEGACY) 3675 continue; 3676 3677 bios_sem = bus_read_1(res, eecp + XHCI_XECP_BIOS_SEM); 3678 if (bios_sem == 0) 3679 continue; 3680 3681 if (bootverbose) 3682 printf("xhci early: " 3683 "SMM active, request owner change\n"); 3684 3685 bus_write_1(res, eecp + XHCI_XECP_OS_SEM, 1); 3686 3687 /* wait a maximum of 5 second */ 3688 3689 for (i = 0; (i < 5000) && (bios_sem != 0); i++) { 3690 DELAY(1000); 3691 bios_sem = bus_read_1(res, eecp + 3692 XHCI_XECP_BIOS_SEM); 3693 } 3694 3695 if (bios_sem != 0) { 3696 if (bootverbose) 3697 printf("xhci early: " 3698 "SMM does not respond\n"); 3699 } 3700 3701 /* Disable interrupts */ 3702 offs = bus_read_1(res, XHCI_CAPLENGTH); 3703 bus_write_4(res, offs + XHCI_USBCMD, 0); 3704 bus_read_4(res, offs + XHCI_USBSTS); 3705 } 3706 bus_release_resource(self, SYS_RES_MEMORY, rid, res); 3707 } 3708 3709 #if defined(NEW_PCIB) && defined(PCI_RES_BUS) 3710 static void 3711 pci_reserve_secbus(device_t bus, device_t dev, pcicfgregs *cfg, 3712 struct resource_list *rl) 3713 { 3714 struct resource *res; 3715 char *cp; 3716 rman_res_t start, end, count; 3717 int rid, sec_bus, sec_reg, sub_bus, sub_reg, sup_bus; 3718 3719 switch (cfg->hdrtype & PCIM_HDRTYPE) { 3720 case PCIM_HDRTYPE_BRIDGE: 3721 sec_reg = PCIR_SECBUS_1; 3722 sub_reg = PCIR_SUBBUS_1; 3723 break; 3724 case PCIM_HDRTYPE_CARDBUS: 3725 sec_reg = PCIR_SECBUS_2; 3726 sub_reg = PCIR_SUBBUS_2; 3727 break; 3728 default: 3729 return; 3730 } 3731 3732 /* 3733 * If the existing bus range is valid, attempt to reserve it 3734 * from our parent. If this fails for any reason, clear the 3735 * secbus and subbus registers. 3736 * 3737 * XXX: Should we reset sub_bus to sec_bus if it is < sec_bus? 3738 * This would at least preserve the existing sec_bus if it is 3739 * valid. 3740 */ 3741 sec_bus = PCI_READ_CONFIG(bus, dev, sec_reg, 1); 3742 sub_bus = PCI_READ_CONFIG(bus, dev, sub_reg, 1); 3743 3744 /* Quirk handling. */ 3745 switch (pci_get_devid(dev)) { 3746 case 0x12258086: /* Intel 82454KX/GX (Orion) */ 3747 sup_bus = pci_read_config(dev, 0x41, 1); 3748 if (sup_bus != 0xff) { 3749 sec_bus = sup_bus + 1; 3750 sub_bus = sup_bus + 1; 3751 PCI_WRITE_CONFIG(bus, dev, sec_reg, sec_bus, 1); 3752 PCI_WRITE_CONFIG(bus, dev, sub_reg, sub_bus, 1); 3753 } 3754 break; 3755 3756 case 0x00dd10de: 3757 /* Compaq R3000 BIOS sets wrong subordinate bus number. */ 3758 if ((cp = kern_getenv("smbios.planar.maker")) == NULL) 3759 break; 3760 if (strncmp(cp, "Compal", 6) != 0) { 3761 freeenv(cp); 3762 break; 3763 } 3764 freeenv(cp); 3765 if ((cp = kern_getenv("smbios.planar.product")) == NULL) 3766 break; 3767 if (strncmp(cp, "08A0", 4) != 0) { 3768 freeenv(cp); 3769 break; 3770 } 3771 freeenv(cp); 3772 if (sub_bus < 0xa) { 3773 sub_bus = 0xa; 3774 PCI_WRITE_CONFIG(bus, dev, sub_reg, sub_bus, 1); 3775 } 3776 break; 3777 } 3778 3779 if (bootverbose) 3780 printf("\tsecbus=%d, subbus=%d\n", sec_bus, sub_bus); 3781 if (sec_bus > 0 && sub_bus >= sec_bus) { 3782 start = sec_bus; 3783 end = sub_bus; 3784 count = end - start + 1; 3785 3786 resource_list_add(rl, PCI_RES_BUS, 0, 0, ~0, count); 3787 3788 /* 3789 * If requested, clear secondary bus registers in 3790 * bridge devices to force a complete renumbering 3791 * rather than reserving the existing range. However, 3792 * preserve the existing size. 3793 */ 3794 if (pci_clear_buses) 3795 goto clear; 3796 3797 rid = 0; 3798 res = resource_list_reserve(rl, bus, dev, PCI_RES_BUS, &rid, 3799 start, end, count, 0); 3800 if (res != NULL) 3801 return; 3802 3803 if (bootverbose) 3804 device_printf(bus, 3805 "pci%d:%d:%d:%d secbus failed to allocate\n", 3806 pci_get_domain(dev), pci_get_bus(dev), 3807 pci_get_slot(dev), pci_get_function(dev)); 3808 } 3809 3810 clear: 3811 PCI_WRITE_CONFIG(bus, dev, sec_reg, 0, 1); 3812 PCI_WRITE_CONFIG(bus, dev, sub_reg, 0, 1); 3813 } 3814 3815 static struct resource * 3816 pci_alloc_secbus(device_t dev, device_t child, int *rid, rman_res_t start, 3817 rman_res_t end, rman_res_t count, u_int flags) 3818 { 3819 struct pci_devinfo *dinfo; 3820 pcicfgregs *cfg; 3821 struct resource_list *rl; 3822 struct resource *res; 3823 int sec_reg, sub_reg; 3824 3825 dinfo = device_get_ivars(child); 3826 cfg = &dinfo->cfg; 3827 rl = &dinfo->resources; 3828 switch (cfg->hdrtype & PCIM_HDRTYPE) { 3829 case PCIM_HDRTYPE_BRIDGE: 3830 sec_reg = PCIR_SECBUS_1; 3831 sub_reg = PCIR_SUBBUS_1; 3832 break; 3833 case PCIM_HDRTYPE_CARDBUS: 3834 sec_reg = PCIR_SECBUS_2; 3835 sub_reg = PCIR_SUBBUS_2; 3836 break; 3837 default: 3838 return (NULL); 3839 } 3840 3841 if (*rid != 0) 3842 return (NULL); 3843 3844 if (resource_list_find(rl, PCI_RES_BUS, *rid) == NULL) 3845 resource_list_add(rl, PCI_RES_BUS, *rid, start, end, count); 3846 if (!resource_list_reserved(rl, PCI_RES_BUS, *rid)) { 3847 res = resource_list_reserve(rl, dev, child, PCI_RES_BUS, rid, 3848 start, end, count, flags & ~RF_ACTIVE); 3849 if (res == NULL) { 3850 resource_list_delete(rl, PCI_RES_BUS, *rid); 3851 device_printf(child, "allocating %ju bus%s failed\n", 3852 count, count == 1 ? "" : "es"); 3853 return (NULL); 3854 } 3855 if (bootverbose) 3856 device_printf(child, 3857 "Lazy allocation of %ju bus%s at %ju\n", count, 3858 count == 1 ? "" : "es", rman_get_start(res)); 3859 PCI_WRITE_CONFIG(dev, child, sec_reg, rman_get_start(res), 1); 3860 PCI_WRITE_CONFIG(dev, child, sub_reg, rman_get_end(res), 1); 3861 } 3862 return (resource_list_alloc(rl, dev, child, PCI_RES_BUS, rid, start, 3863 end, count, flags)); 3864 } 3865 #endif 3866 3867 static int 3868 pci_ea_bei_to_rid(device_t dev, int bei) 3869 { 3870 #ifdef PCI_IOV 3871 struct pci_devinfo *dinfo; 3872 int iov_pos; 3873 struct pcicfg_iov *iov; 3874 3875 dinfo = device_get_ivars(dev); 3876 iov = dinfo->cfg.iov; 3877 if (iov != NULL) 3878 iov_pos = iov->iov_pos; 3879 else 3880 iov_pos = 0; 3881 #endif 3882 3883 /* Check if matches BAR */ 3884 if ((bei >= PCIM_EA_BEI_BAR_0) && 3885 (bei <= PCIM_EA_BEI_BAR_5)) 3886 return (PCIR_BAR(bei)); 3887 3888 /* Check ROM */ 3889 if (bei == PCIM_EA_BEI_ROM) 3890 return (PCIR_BIOS); 3891 3892 #ifdef PCI_IOV 3893 /* Check if matches VF_BAR */ 3894 if ((iov != NULL) && (bei >= PCIM_EA_BEI_VF_BAR_0) && 3895 (bei <= PCIM_EA_BEI_VF_BAR_5)) 3896 return (PCIR_SRIOV_BAR(bei - PCIM_EA_BEI_VF_BAR_0) + 3897 iov_pos); 3898 #endif 3899 3900 return (-1); 3901 } 3902 3903 int 3904 pci_ea_is_enabled(device_t dev, int rid) 3905 { 3906 struct pci_ea_entry *ea; 3907 struct pci_devinfo *dinfo; 3908 3909 dinfo = device_get_ivars(dev); 3910 3911 STAILQ_FOREACH(ea, &dinfo->cfg.ea.ea_entries, eae_link) { 3912 if (pci_ea_bei_to_rid(dev, ea->eae_bei) == rid) 3913 return ((ea->eae_flags & PCIM_EA_ENABLE) > 0); 3914 } 3915 3916 return (0); 3917 } 3918 3919 void 3920 pci_add_resources_ea(device_t bus, device_t dev, int alloc_iov) 3921 { 3922 struct pci_ea_entry *ea; 3923 struct pci_devinfo *dinfo; 3924 pci_addr_t start, end, count; 3925 struct resource_list *rl; 3926 int type, flags, rid; 3927 struct resource *res; 3928 uint32_t tmp; 3929 #ifdef PCI_IOV 3930 struct pcicfg_iov *iov; 3931 #endif 3932 3933 dinfo = device_get_ivars(dev); 3934 rl = &dinfo->resources; 3935 flags = 0; 3936 3937 #ifdef PCI_IOV 3938 iov = dinfo->cfg.iov; 3939 #endif 3940 3941 if (dinfo->cfg.ea.ea_location == 0) 3942 return; 3943 3944 STAILQ_FOREACH(ea, &dinfo->cfg.ea.ea_entries, eae_link) { 3945 /* 3946 * TODO: Ignore EA-BAR if is not enabled. 3947 * Currently the EA implementation supports 3948 * only situation, where EA structure contains 3949 * predefined entries. In case they are not enabled 3950 * leave them unallocated and proceed with 3951 * a legacy-BAR mechanism. 3952 */ 3953 if ((ea->eae_flags & PCIM_EA_ENABLE) == 0) 3954 continue; 3955 3956 switch ((ea->eae_flags & PCIM_EA_PP) >> PCIM_EA_PP_OFFSET) { 3957 case PCIM_EA_P_MEM_PREFETCH: 3958 case PCIM_EA_P_VF_MEM_PREFETCH: 3959 flags = RF_PREFETCHABLE; 3960 /* FALLTHROUGH */ 3961 case PCIM_EA_P_VF_MEM: 3962 case PCIM_EA_P_MEM: 3963 type = SYS_RES_MEMORY; 3964 break; 3965 case PCIM_EA_P_IO: 3966 type = SYS_RES_IOPORT; 3967 break; 3968 default: 3969 continue; 3970 } 3971 3972 if (alloc_iov != 0) { 3973 #ifdef PCI_IOV 3974 /* Allocating IOV, confirm BEI matches */ 3975 if ((ea->eae_bei < PCIM_EA_BEI_VF_BAR_0) || 3976 (ea->eae_bei > PCIM_EA_BEI_VF_BAR_5)) 3977 continue; 3978 #else 3979 continue; 3980 #endif 3981 } else { 3982 /* Allocating BAR, confirm BEI matches */ 3983 if (((ea->eae_bei < PCIM_EA_BEI_BAR_0) || 3984 (ea->eae_bei > PCIM_EA_BEI_BAR_5)) && 3985 (ea->eae_bei != PCIM_EA_BEI_ROM)) 3986 continue; 3987 } 3988 3989 rid = pci_ea_bei_to_rid(dev, ea->eae_bei); 3990 if (rid < 0) 3991 continue; 3992 3993 /* Skip resources already allocated by EA */ 3994 if ((resource_list_find(rl, SYS_RES_MEMORY, rid) != NULL) || 3995 (resource_list_find(rl, SYS_RES_IOPORT, rid) != NULL)) 3996 continue; 3997 3998 start = ea->eae_base; 3999 count = ea->eae_max_offset + 1; 4000 #ifdef PCI_IOV 4001 if (iov != NULL) 4002 count = count * iov->iov_num_vfs; 4003 #endif 4004 end = start + count - 1; 4005 if (count == 0) 4006 continue; 4007 4008 resource_list_add(rl, type, rid, start, end, count); 4009 res = resource_list_reserve(rl, bus, dev, type, &rid, start, end, count, 4010 flags); 4011 if (res == NULL) { 4012 resource_list_delete(rl, type, rid); 4013 4014 /* 4015 * Failed to allocate using EA, disable entry. 4016 * Another attempt to allocation will be performed 4017 * further, but this time using legacy BAR registers 4018 */ 4019 tmp = pci_read_config(dev, ea->eae_cfg_offset, 4); 4020 tmp &= ~PCIM_EA_ENABLE; 4021 pci_write_config(dev, ea->eae_cfg_offset, tmp, 4); 4022 4023 /* 4024 * Disabling entry might fail in case it is hardwired. 4025 * Read flags again to match current status. 4026 */ 4027 ea->eae_flags = pci_read_config(dev, ea->eae_cfg_offset, 4); 4028 4029 continue; 4030 } 4031 4032 /* As per specification, fill BAR with zeros */ 4033 pci_write_config(dev, rid, 0, 4); 4034 } 4035 } 4036 4037 void 4038 pci_add_resources(device_t bus, device_t dev, int force, uint32_t prefetchmask) 4039 { 4040 struct pci_devinfo *dinfo; 4041 pcicfgregs *cfg; 4042 struct resource_list *rl; 4043 const struct pci_quirk *q; 4044 uint32_t devid; 4045 int i; 4046 4047 dinfo = device_get_ivars(dev); 4048 cfg = &dinfo->cfg; 4049 rl = &dinfo->resources; 4050 devid = (cfg->device << 16) | cfg->vendor; 4051 4052 /* Allocate resources using Enhanced Allocation */ 4053 pci_add_resources_ea(bus, dev, 0); 4054 4055 /* ATA devices needs special map treatment */ 4056 if ((pci_get_class(dev) == PCIC_STORAGE) && 4057 (pci_get_subclass(dev) == PCIS_STORAGE_IDE) && 4058 ((pci_get_progif(dev) & PCIP_STORAGE_IDE_MASTERDEV) || 4059 (!pci_read_config(dev, PCIR_BAR(0), 4) && 4060 !pci_read_config(dev, PCIR_BAR(2), 4))) ) 4061 pci_ata_maps(bus, dev, rl, force, prefetchmask); 4062 else 4063 for (i = 0; i < cfg->nummaps;) { 4064 /* Skip resources already managed by EA */ 4065 if ((resource_list_find(rl, SYS_RES_MEMORY, PCIR_BAR(i)) != NULL) || 4066 (resource_list_find(rl, SYS_RES_IOPORT, PCIR_BAR(i)) != NULL) || 4067 pci_ea_is_enabled(dev, PCIR_BAR(i))) { 4068 i++; 4069 continue; 4070 } 4071 4072 /* 4073 * Skip quirked resources. 4074 */ 4075 for (q = &pci_quirks[0]; q->devid != 0; q++) 4076 if (q->devid == devid && 4077 q->type == PCI_QUIRK_UNMAP_REG && 4078 q->arg1 == PCIR_BAR(i)) 4079 break; 4080 if (q->devid != 0) { 4081 i++; 4082 continue; 4083 } 4084 i += pci_add_map(bus, dev, PCIR_BAR(i), rl, force, 4085 prefetchmask & (1 << i)); 4086 } 4087 4088 /* 4089 * Add additional, quirked resources. 4090 */ 4091 for (q = &pci_quirks[0]; q->devid != 0; q++) 4092 if (q->devid == devid && q->type == PCI_QUIRK_MAP_REG) 4093 pci_add_map(bus, dev, q->arg1, rl, force, 0); 4094 4095 if (cfg->intpin > 0 && PCI_INTERRUPT_VALID(cfg->intline)) { 4096 #ifdef __PCI_REROUTE_INTERRUPT 4097 /* 4098 * Try to re-route interrupts. Sometimes the BIOS or 4099 * firmware may leave bogus values in these registers. 4100 * If the re-route fails, then just stick with what we 4101 * have. 4102 */ 4103 pci_assign_interrupt(bus, dev, 1); 4104 #else 4105 pci_assign_interrupt(bus, dev, 0); 4106 #endif 4107 } 4108 4109 if (pci_usb_takeover && pci_get_class(dev) == PCIC_SERIALBUS && 4110 pci_get_subclass(dev) == PCIS_SERIALBUS_USB) { 4111 if (pci_get_progif(dev) == PCIP_SERIALBUS_USB_XHCI) 4112 xhci_early_takeover(dev); 4113 else if (pci_get_progif(dev) == PCIP_SERIALBUS_USB_EHCI) 4114 ehci_early_takeover(dev); 4115 else if (pci_get_progif(dev) == PCIP_SERIALBUS_USB_OHCI) 4116 ohci_early_takeover(dev); 4117 else if (pci_get_progif(dev) == PCIP_SERIALBUS_USB_UHCI) 4118 uhci_early_takeover(dev); 4119 } 4120 4121 #if defined(NEW_PCIB) && defined(PCI_RES_BUS) 4122 /* 4123 * Reserve resources for secondary bus ranges behind bridge 4124 * devices. 4125 */ 4126 pci_reserve_secbus(bus, dev, cfg, rl); 4127 #endif 4128 } 4129 4130 static struct pci_devinfo * 4131 pci_identify_function(device_t pcib, device_t dev, int domain, int busno, 4132 int slot, int func) 4133 { 4134 struct pci_devinfo *dinfo; 4135 4136 dinfo = pci_read_device(pcib, dev, domain, busno, slot, func); 4137 if (dinfo != NULL) 4138 pci_add_child(dev, dinfo); 4139 4140 return (dinfo); 4141 } 4142 4143 void 4144 pci_add_children(device_t dev, int domain, int busno) 4145 { 4146 #define REG(n, w) PCIB_READ_CONFIG(pcib, busno, s, f, n, w) 4147 device_t pcib = device_get_parent(dev); 4148 struct pci_devinfo *dinfo; 4149 int maxslots; 4150 int s, f, pcifunchigh; 4151 uint8_t hdrtype; 4152 int first_func; 4153 4154 /* 4155 * Try to detect a device at slot 0, function 0. If it exists, try to 4156 * enable ARI. We must enable ARI before detecting the rest of the 4157 * functions on this bus as ARI changes the set of slots and functions 4158 * that are legal on this bus. 4159 */ 4160 dinfo = pci_identify_function(pcib, dev, domain, busno, 0, 0); 4161 if (dinfo != NULL && pci_enable_ari) 4162 PCIB_TRY_ENABLE_ARI(pcib, dinfo->cfg.dev); 4163 4164 /* 4165 * Start looking for new devices on slot 0 at function 1 because we 4166 * just identified the device at slot 0, function 0. 4167 */ 4168 first_func = 1; 4169 4170 maxslots = PCIB_MAXSLOTS(pcib); 4171 for (s = 0; s <= maxslots; s++, first_func = 0) { 4172 pcifunchigh = 0; 4173 f = 0; 4174 DELAY(1); 4175 4176 /* If function 0 is not present, skip to the next slot. */ 4177 if (REG(PCIR_VENDOR, 2) == PCIV_INVALID) 4178 continue; 4179 hdrtype = REG(PCIR_HDRTYPE, 1); 4180 if ((hdrtype & PCIM_HDRTYPE) > PCI_MAXHDRTYPE) 4181 continue; 4182 if (hdrtype & PCIM_MFDEV) 4183 pcifunchigh = PCIB_MAXFUNCS(pcib); 4184 for (f = first_func; f <= pcifunchigh; f++) 4185 pci_identify_function(pcib, dev, domain, busno, s, f); 4186 } 4187 #undef REG 4188 } 4189 4190 int 4191 pci_rescan_method(device_t dev) 4192 { 4193 #define REG(n, w) PCIB_READ_CONFIG(pcib, busno, s, f, n, w) 4194 device_t pcib = device_get_parent(dev); 4195 device_t child, *devlist, *unchanged; 4196 int devcount, error, i, j, maxslots, oldcount; 4197 int busno, domain, s, f, pcifunchigh; 4198 uint8_t hdrtype; 4199 4200 /* No need to check for ARI on a rescan. */ 4201 error = device_get_children(dev, &devlist, &devcount); 4202 if (error) 4203 return (error); 4204 if (devcount != 0) { 4205 unchanged = malloc(devcount * sizeof(device_t), M_TEMP, 4206 M_NOWAIT | M_ZERO); 4207 if (unchanged == NULL) { 4208 free(devlist, M_TEMP); 4209 return (ENOMEM); 4210 } 4211 } else 4212 unchanged = NULL; 4213 4214 domain = pcib_get_domain(dev); 4215 busno = pcib_get_bus(dev); 4216 maxslots = PCIB_MAXSLOTS(pcib); 4217 for (s = 0; s <= maxslots; s++) { 4218 /* If function 0 is not present, skip to the next slot. */ 4219 f = 0; 4220 if (REG(PCIR_VENDOR, 2) == PCIV_INVALID) 4221 continue; 4222 pcifunchigh = 0; 4223 hdrtype = REG(PCIR_HDRTYPE, 1); 4224 if ((hdrtype & PCIM_HDRTYPE) > PCI_MAXHDRTYPE) 4225 continue; 4226 if (hdrtype & PCIM_MFDEV) 4227 pcifunchigh = PCIB_MAXFUNCS(pcib); 4228 for (f = 0; f <= pcifunchigh; f++) { 4229 if (REG(PCIR_VENDOR, 2) == PCIV_INVALID) 4230 continue; 4231 4232 /* 4233 * Found a valid function. Check if a 4234 * device_t for this device already exists. 4235 */ 4236 for (i = 0; i < devcount; i++) { 4237 child = devlist[i]; 4238 if (child == NULL) 4239 continue; 4240 if (pci_get_slot(child) == s && 4241 pci_get_function(child) == f) { 4242 unchanged[i] = child; 4243 goto next_func; 4244 } 4245 } 4246 4247 pci_identify_function(pcib, dev, domain, busno, s, f); 4248 next_func:; 4249 } 4250 } 4251 4252 /* Remove devices that are no longer present. */ 4253 for (i = 0; i < devcount; i++) { 4254 if (unchanged[i] != NULL) 4255 continue; 4256 device_delete_child(dev, devlist[i]); 4257 } 4258 4259 free(devlist, M_TEMP); 4260 oldcount = devcount; 4261 4262 /* Try to attach the devices just added. */ 4263 error = device_get_children(dev, &devlist, &devcount); 4264 if (error) { 4265 free(unchanged, M_TEMP); 4266 return (error); 4267 } 4268 4269 for (i = 0; i < devcount; i++) { 4270 for (j = 0; j < oldcount; j++) { 4271 if (devlist[i] == unchanged[j]) 4272 goto next_device; 4273 } 4274 4275 device_probe_and_attach(devlist[i]); 4276 next_device:; 4277 } 4278 4279 free(unchanged, M_TEMP); 4280 free(devlist, M_TEMP); 4281 return (0); 4282 #undef REG 4283 } 4284 4285 #ifdef PCI_IOV 4286 device_t 4287 pci_add_iov_child(device_t bus, device_t pf, uint16_t rid, uint16_t vid, 4288 uint16_t did) 4289 { 4290 struct pci_devinfo *vf_dinfo; 4291 device_t pcib; 4292 int busno, slot, func; 4293 4294 pcib = device_get_parent(bus); 4295 4296 PCIB_DECODE_RID(pcib, rid, &busno, &slot, &func); 4297 4298 vf_dinfo = pci_fill_devinfo(pcib, bus, pci_get_domain(pcib), busno, 4299 slot, func, vid, did); 4300 4301 vf_dinfo->cfg.flags |= PCICFG_VF; 4302 pci_add_child(bus, vf_dinfo); 4303 4304 return (vf_dinfo->cfg.dev); 4305 } 4306 4307 device_t 4308 pci_create_iov_child_method(device_t bus, device_t pf, uint16_t rid, 4309 uint16_t vid, uint16_t did) 4310 { 4311 4312 return (pci_add_iov_child(bus, pf, rid, vid, did)); 4313 } 4314 #endif 4315 4316 /* 4317 * For PCIe device set Max_Payload_Size to match PCIe root's. 4318 */ 4319 static void 4320 pcie_setup_mps(device_t dev) 4321 { 4322 struct pci_devinfo *dinfo = device_get_ivars(dev); 4323 device_t root; 4324 uint16_t rmps, mmps, mps; 4325 4326 if (dinfo->cfg.pcie.pcie_location == 0) 4327 return; 4328 root = pci_find_pcie_root_port(dev); 4329 if (root == NULL) 4330 return; 4331 /* Check whether the MPS is already configured. */ 4332 rmps = pcie_read_config(root, PCIER_DEVICE_CTL, 2) & 4333 PCIEM_CTL_MAX_PAYLOAD; 4334 mps = pcie_read_config(dev, PCIER_DEVICE_CTL, 2) & 4335 PCIEM_CTL_MAX_PAYLOAD; 4336 if (mps == rmps) 4337 return; 4338 /* Check whether the device is capable of the root's MPS. */ 4339 mmps = (pcie_read_config(dev, PCIER_DEVICE_CAP, 2) & 4340 PCIEM_CAP_MAX_PAYLOAD) << 5; 4341 if (rmps > mmps) { 4342 /* 4343 * The device is unable to handle root's MPS. Limit root. 4344 * XXX: We should traverse through all the tree, applying 4345 * it to all the devices. 4346 */ 4347 pcie_adjust_config(root, PCIER_DEVICE_CTL, 4348 PCIEM_CTL_MAX_PAYLOAD, mmps, 2); 4349 } else { 4350 pcie_adjust_config(dev, PCIER_DEVICE_CTL, 4351 PCIEM_CTL_MAX_PAYLOAD, rmps, 2); 4352 } 4353 } 4354 4355 static void 4356 pci_add_child_clear_aer(device_t dev, struct pci_devinfo *dinfo) 4357 { 4358 int aer; 4359 uint32_t r; 4360 uint16_t r2; 4361 4362 if (dinfo->cfg.pcie.pcie_location != 0 && 4363 dinfo->cfg.pcie.pcie_type == PCIEM_TYPE_ROOT_PORT) { 4364 r2 = pci_read_config(dev, dinfo->cfg.pcie.pcie_location + 4365 PCIER_ROOT_CTL, 2); 4366 r2 &= ~(PCIEM_ROOT_CTL_SERR_CORR | 4367 PCIEM_ROOT_CTL_SERR_NONFATAL | PCIEM_ROOT_CTL_SERR_FATAL); 4368 pci_write_config(dev, dinfo->cfg.pcie.pcie_location + 4369 PCIER_ROOT_CTL, r2, 2); 4370 } 4371 if (pci_find_extcap(dev, PCIZ_AER, &aer) == 0) { 4372 r = pci_read_config(dev, aer + PCIR_AER_UC_STATUS, 4); 4373 pci_write_config(dev, aer + PCIR_AER_UC_STATUS, r, 4); 4374 if (r != 0 && bootverbose) { 4375 pci_printf(&dinfo->cfg, 4376 "clearing AER UC 0x%08x -> 0x%08x\n", 4377 r, pci_read_config(dev, aer + PCIR_AER_UC_STATUS, 4378 4)); 4379 } 4380 4381 r = pci_read_config(dev, aer + PCIR_AER_UC_MASK, 4); 4382 r &= ~(PCIM_AER_UC_TRAINING_ERROR | 4383 PCIM_AER_UC_DL_PROTOCOL_ERROR | 4384 PCIM_AER_UC_SURPRISE_LINK_DOWN | 4385 PCIM_AER_UC_POISONED_TLP | 4386 PCIM_AER_UC_FC_PROTOCOL_ERROR | 4387 PCIM_AER_UC_COMPLETION_TIMEOUT | 4388 PCIM_AER_UC_COMPLETER_ABORT | 4389 PCIM_AER_UC_UNEXPECTED_COMPLETION | 4390 PCIM_AER_UC_RECEIVER_OVERFLOW | 4391 PCIM_AER_UC_MALFORMED_TLP | 4392 PCIM_AER_UC_ECRC_ERROR | 4393 PCIM_AER_UC_UNSUPPORTED_REQUEST | 4394 PCIM_AER_UC_ACS_VIOLATION | 4395 PCIM_AER_UC_INTERNAL_ERROR | 4396 PCIM_AER_UC_MC_BLOCKED_TLP | 4397 PCIM_AER_UC_ATOMIC_EGRESS_BLK | 4398 PCIM_AER_UC_TLP_PREFIX_BLOCKED); 4399 pci_write_config(dev, aer + PCIR_AER_UC_MASK, r, 4); 4400 4401 r = pci_read_config(dev, aer + PCIR_AER_COR_STATUS, 4); 4402 pci_write_config(dev, aer + PCIR_AER_COR_STATUS, r, 4); 4403 if (r != 0 && bootverbose) { 4404 pci_printf(&dinfo->cfg, 4405 "clearing AER COR 0x%08x -> 0x%08x\n", 4406 r, pci_read_config(dev, aer + PCIR_AER_COR_STATUS, 4407 4)); 4408 } 4409 4410 r = pci_read_config(dev, aer + PCIR_AER_COR_MASK, 4); 4411 r &= ~(PCIM_AER_COR_RECEIVER_ERROR | 4412 PCIM_AER_COR_BAD_TLP | 4413 PCIM_AER_COR_BAD_DLLP | 4414 PCIM_AER_COR_REPLAY_ROLLOVER | 4415 PCIM_AER_COR_REPLAY_TIMEOUT | 4416 PCIM_AER_COR_ADVISORY_NF_ERROR | 4417 PCIM_AER_COR_INTERNAL_ERROR | 4418 PCIM_AER_COR_HEADER_LOG_OVFLOW); 4419 pci_write_config(dev, aer + PCIR_AER_COR_MASK, r, 4); 4420 4421 r = pci_read_config(dev, dinfo->cfg.pcie.pcie_location + 4422 PCIER_DEVICE_CTL, 2); 4423 r |= PCIEM_CTL_COR_ENABLE | PCIEM_CTL_NFER_ENABLE | 4424 PCIEM_CTL_FER_ENABLE | PCIEM_CTL_URR_ENABLE; 4425 pci_write_config(dev, dinfo->cfg.pcie.pcie_location + 4426 PCIER_DEVICE_CTL, r, 2); 4427 } 4428 } 4429 4430 void 4431 pci_add_child(device_t bus, struct pci_devinfo *dinfo) 4432 { 4433 device_t dev; 4434 4435 dinfo->cfg.dev = dev = device_add_child(bus, NULL, -1); 4436 device_set_ivars(dev, dinfo); 4437 resource_list_init(&dinfo->resources); 4438 pci_cfg_save(dev, dinfo, 0); 4439 pci_cfg_restore(dev, dinfo); 4440 pci_print_verbose(dinfo); 4441 pci_add_resources(bus, dev, 0, 0); 4442 pcie_setup_mps(dev); 4443 pci_child_added(dinfo->cfg.dev); 4444 4445 if (pci_clear_aer_on_attach) 4446 pci_add_child_clear_aer(dev, dinfo); 4447 4448 EVENTHANDLER_INVOKE(pci_add_device, dinfo->cfg.dev); 4449 } 4450 4451 void 4452 pci_child_added_method(device_t dev, device_t child) 4453 { 4454 4455 } 4456 4457 static int 4458 pci_probe(device_t dev) 4459 { 4460 4461 device_set_desc(dev, "PCI bus"); 4462 4463 /* Allow other subclasses to override this driver. */ 4464 return (BUS_PROBE_GENERIC); 4465 } 4466 4467 int 4468 pci_attach_common(device_t dev) 4469 { 4470 struct pci_softc *sc; 4471 int busno, domain; 4472 #ifdef PCI_RES_BUS 4473 int rid; 4474 #endif 4475 4476 sc = device_get_softc(dev); 4477 domain = pcib_get_domain(dev); 4478 busno = pcib_get_bus(dev); 4479 #ifdef PCI_RES_BUS 4480 rid = 0; 4481 sc->sc_bus = bus_alloc_resource(dev, PCI_RES_BUS, &rid, busno, busno, 4482 1, 0); 4483 if (sc->sc_bus == NULL) { 4484 device_printf(dev, "failed to allocate bus number\n"); 4485 return (ENXIO); 4486 } 4487 #endif 4488 if (bootverbose) 4489 device_printf(dev, "domain=%d, physical bus=%d\n", 4490 domain, busno); 4491 sc->sc_dma_tag = bus_get_dma_tag(dev); 4492 return (0); 4493 } 4494 4495 int 4496 pci_attach(device_t dev) 4497 { 4498 int busno, domain, error; 4499 4500 error = pci_attach_common(dev); 4501 if (error) 4502 return (error); 4503 4504 /* 4505 * Since there can be multiple independently numbered PCI 4506 * buses on systems with multiple PCI domains, we can't use 4507 * the unit number to decide which bus we are probing. We ask 4508 * the parent pcib what our domain and bus numbers are. 4509 */ 4510 domain = pcib_get_domain(dev); 4511 busno = pcib_get_bus(dev); 4512 pci_add_children(dev, domain, busno); 4513 return (bus_generic_attach(dev)); 4514 } 4515 4516 int 4517 pci_detach(device_t dev) 4518 { 4519 #ifdef PCI_RES_BUS 4520 struct pci_softc *sc; 4521 #endif 4522 int error; 4523 4524 error = bus_generic_detach(dev); 4525 if (error) 4526 return (error); 4527 #ifdef PCI_RES_BUS 4528 sc = device_get_softc(dev); 4529 error = bus_release_resource(dev, PCI_RES_BUS, 0, sc->sc_bus); 4530 if (error) 4531 return (error); 4532 #endif 4533 return (device_delete_children(dev)); 4534 } 4535 4536 static void 4537 pci_hint_device_unit(device_t dev, device_t child, const char *name, int *unitp) 4538 { 4539 int line, unit; 4540 const char *at; 4541 char me1[24], me2[32]; 4542 uint8_t b, s, f; 4543 uint32_t d; 4544 device_location_cache_t *cache; 4545 4546 d = pci_get_domain(child); 4547 b = pci_get_bus(child); 4548 s = pci_get_slot(child); 4549 f = pci_get_function(child); 4550 snprintf(me1, sizeof(me1), "pci%u:%u:%u", b, s, f); 4551 snprintf(me2, sizeof(me2), "pci%u:%u:%u:%u", d, b, s, f); 4552 line = 0; 4553 cache = dev_wired_cache_init(); 4554 while (resource_find_dev(&line, name, &unit, "at", NULL) == 0) { 4555 resource_string_value(name, unit, "at", &at); 4556 if (strcmp(at, me1) == 0 || strcmp(at, me2) == 0) { 4557 *unitp = unit; 4558 break; 4559 } 4560 if (dev_wired_cache_match(cache, child, at)) { 4561 *unitp = unit; 4562 break; 4563 } 4564 } 4565 dev_wired_cache_fini(cache); 4566 } 4567 4568 static void 4569 pci_set_power_child(device_t dev, device_t child, int state) 4570 { 4571 device_t pcib; 4572 int dstate; 4573 4574 /* 4575 * Set the device to the given state. If the firmware suggests 4576 * a different power state, use it instead. If power management 4577 * is not present, the firmware is responsible for managing 4578 * device power. Skip children who aren't attached since they 4579 * are handled separately. 4580 */ 4581 pcib = device_get_parent(dev); 4582 dstate = state; 4583 if (device_is_attached(child) && 4584 PCIB_POWER_FOR_SLEEP(pcib, child, &dstate) == 0) 4585 pci_set_powerstate(child, dstate); 4586 } 4587 4588 int 4589 pci_suspend_child(device_t dev, device_t child) 4590 { 4591 struct pci_devinfo *dinfo; 4592 struct resource_list_entry *rle; 4593 int error; 4594 4595 dinfo = device_get_ivars(child); 4596 4597 /* 4598 * Save the PCI configuration space for the child and set the 4599 * device in the appropriate power state for this sleep state. 4600 */ 4601 pci_cfg_save(child, dinfo, 0); 4602 4603 /* Suspend devices before potentially powering them down. */ 4604 error = bus_generic_suspend_child(dev, child); 4605 4606 if (error) 4607 return (error); 4608 4609 if (pci_do_power_suspend) { 4610 /* 4611 * Make sure this device's interrupt handler is not invoked 4612 * in the case the device uses a shared interrupt that can 4613 * be raised by some other device. 4614 * This is applicable only to regular (legacy) PCI interrupts 4615 * as MSI/MSI-X interrupts are never shared. 4616 */ 4617 rle = resource_list_find(&dinfo->resources, 4618 SYS_RES_IRQ, 0); 4619 if (rle != NULL && rle->res != NULL) 4620 (void)bus_suspend_intr(child, rle->res); 4621 pci_set_power_child(dev, child, PCI_POWERSTATE_D3); 4622 } 4623 4624 return (0); 4625 } 4626 4627 int 4628 pci_resume_child(device_t dev, device_t child) 4629 { 4630 struct pci_devinfo *dinfo; 4631 struct resource_list_entry *rle; 4632 4633 if (pci_do_power_resume) 4634 pci_set_power_child(dev, child, PCI_POWERSTATE_D0); 4635 4636 dinfo = device_get_ivars(child); 4637 pci_cfg_restore(child, dinfo); 4638 if (!device_is_attached(child)) 4639 pci_cfg_save(child, dinfo, 1); 4640 4641 bus_generic_resume_child(dev, child); 4642 4643 /* 4644 * Allow interrupts only after fully resuming the driver and hardware. 4645 */ 4646 if (pci_do_power_suspend) { 4647 /* See pci_suspend_child for details. */ 4648 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, 0); 4649 if (rle != NULL && rle->res != NULL) 4650 (void)bus_resume_intr(child, rle->res); 4651 } 4652 4653 return (0); 4654 } 4655 4656 int 4657 pci_resume(device_t dev) 4658 { 4659 device_t child, *devlist; 4660 int error, i, numdevs; 4661 4662 if ((error = device_get_children(dev, &devlist, &numdevs)) != 0) 4663 return (error); 4664 4665 /* 4666 * Resume critical devices first, then everything else later. 4667 */ 4668 for (i = 0; i < numdevs; i++) { 4669 child = devlist[i]; 4670 switch (pci_get_class(child)) { 4671 case PCIC_DISPLAY: 4672 case PCIC_MEMORY: 4673 case PCIC_BRIDGE: 4674 case PCIC_BASEPERIPH: 4675 BUS_RESUME_CHILD(dev, child); 4676 break; 4677 } 4678 } 4679 for (i = 0; i < numdevs; i++) { 4680 child = devlist[i]; 4681 switch (pci_get_class(child)) { 4682 case PCIC_DISPLAY: 4683 case PCIC_MEMORY: 4684 case PCIC_BRIDGE: 4685 case PCIC_BASEPERIPH: 4686 break; 4687 default: 4688 BUS_RESUME_CHILD(dev, child); 4689 } 4690 } 4691 free(devlist, M_TEMP); 4692 return (0); 4693 } 4694 4695 static void 4696 pci_load_vendor_data(void) 4697 { 4698 caddr_t data; 4699 void *ptr; 4700 size_t sz; 4701 4702 data = preload_search_by_type("pci_vendor_data"); 4703 if (data != NULL) { 4704 ptr = preload_fetch_addr(data); 4705 sz = preload_fetch_size(data); 4706 if (ptr != NULL && sz != 0) { 4707 pci_vendordata = ptr; 4708 pci_vendordata_size = sz; 4709 /* terminate the database */ 4710 pci_vendordata[pci_vendordata_size] = '\n'; 4711 } 4712 } 4713 } 4714 4715 void 4716 pci_driver_added(device_t dev, driver_t *driver) 4717 { 4718 int numdevs; 4719 device_t *devlist; 4720 device_t child; 4721 struct pci_devinfo *dinfo; 4722 int i; 4723 4724 if (bootverbose) 4725 device_printf(dev, "driver added\n"); 4726 DEVICE_IDENTIFY(driver, dev); 4727 if (device_get_children(dev, &devlist, &numdevs) != 0) 4728 return; 4729 for (i = 0; i < numdevs; i++) { 4730 child = devlist[i]; 4731 if (device_get_state(child) != DS_NOTPRESENT) 4732 continue; 4733 dinfo = device_get_ivars(child); 4734 pci_print_verbose(dinfo); 4735 if (bootverbose) 4736 pci_printf(&dinfo->cfg, "reprobing on driver added\n"); 4737 pci_cfg_restore(child, dinfo); 4738 if (device_probe_and_attach(child) != 0) 4739 pci_child_detached(dev, child); 4740 } 4741 free(devlist, M_TEMP); 4742 } 4743 4744 int 4745 pci_setup_intr(device_t dev, device_t child, struct resource *irq, int flags, 4746 driver_filter_t *filter, driver_intr_t *intr, void *arg, void **cookiep) 4747 { 4748 struct pci_devinfo *dinfo; 4749 struct msix_table_entry *mte; 4750 struct msix_vector *mv; 4751 uint64_t addr; 4752 uint32_t data; 4753 void *cookie; 4754 int error, rid; 4755 4756 error = bus_generic_setup_intr(dev, child, irq, flags, filter, intr, 4757 arg, &cookie); 4758 if (error) 4759 return (error); 4760 4761 /* If this is not a direct child, just bail out. */ 4762 if (device_get_parent(child) != dev) { 4763 *cookiep = cookie; 4764 return(0); 4765 } 4766 4767 rid = rman_get_rid(irq); 4768 if (rid == 0) { 4769 /* Make sure that INTx is enabled */ 4770 pci_clear_command_bit(dev, child, PCIM_CMD_INTxDIS); 4771 } else { 4772 /* 4773 * Check to see if the interrupt is MSI or MSI-X. 4774 * Ask our parent to map the MSI and give 4775 * us the address and data register values. 4776 * If we fail for some reason, teardown the 4777 * interrupt handler. 4778 */ 4779 dinfo = device_get_ivars(child); 4780 if (dinfo->cfg.msi.msi_alloc > 0) { 4781 if (dinfo->cfg.msi.msi_addr == 0) { 4782 KASSERT(dinfo->cfg.msi.msi_handlers == 0, 4783 ("MSI has handlers, but vectors not mapped")); 4784 error = PCIB_MAP_MSI(device_get_parent(dev), 4785 child, rman_get_start(irq), &addr, &data); 4786 if (error) 4787 goto bad; 4788 dinfo->cfg.msi.msi_addr = addr; 4789 dinfo->cfg.msi.msi_data = data; 4790 } 4791 if (dinfo->cfg.msi.msi_handlers == 0) 4792 pci_enable_msi(child, dinfo->cfg.msi.msi_addr, 4793 dinfo->cfg.msi.msi_data); 4794 dinfo->cfg.msi.msi_handlers++; 4795 } else { 4796 KASSERT(dinfo->cfg.msix.msix_alloc > 0, 4797 ("No MSI or MSI-X interrupts allocated")); 4798 KASSERT(rid <= dinfo->cfg.msix.msix_table_len, 4799 ("MSI-X index too high")); 4800 mte = &dinfo->cfg.msix.msix_table[rid - 1]; 4801 KASSERT(mte->mte_vector != 0, ("no message vector")); 4802 mv = &dinfo->cfg.msix.msix_vectors[mte->mte_vector - 1]; 4803 KASSERT(mv->mv_irq == rman_get_start(irq), 4804 ("IRQ mismatch")); 4805 if (mv->mv_address == 0) { 4806 KASSERT(mte->mte_handlers == 0, 4807 ("MSI-X table entry has handlers, but vector not mapped")); 4808 error = PCIB_MAP_MSI(device_get_parent(dev), 4809 child, rman_get_start(irq), &addr, &data); 4810 if (error) 4811 goto bad; 4812 mv->mv_address = addr; 4813 mv->mv_data = data; 4814 } 4815 4816 /* 4817 * The MSIX table entry must be made valid by 4818 * incrementing the mte_handlers before 4819 * calling pci_enable_msix() and 4820 * pci_resume_msix(). Else the MSIX rewrite 4821 * table quirk will not work as expected. 4822 */ 4823 mte->mte_handlers++; 4824 if (mte->mte_handlers == 1) { 4825 pci_enable_msix(child, rid - 1, mv->mv_address, 4826 mv->mv_data); 4827 pci_unmask_msix(child, rid - 1); 4828 } 4829 } 4830 4831 /* 4832 * Make sure that INTx is disabled if we are using MSI/MSI-X, 4833 * unless the device is affected by PCI_QUIRK_MSI_INTX_BUG, 4834 * in which case we "enable" INTx so MSI/MSI-X actually works. 4835 */ 4836 if (!pci_has_quirk(pci_get_devid(child), 4837 PCI_QUIRK_MSI_INTX_BUG)) 4838 pci_set_command_bit(dev, child, PCIM_CMD_INTxDIS); 4839 else 4840 pci_clear_command_bit(dev, child, PCIM_CMD_INTxDIS); 4841 bad: 4842 if (error) { 4843 (void)bus_generic_teardown_intr(dev, child, irq, 4844 cookie); 4845 return (error); 4846 } 4847 } 4848 *cookiep = cookie; 4849 return (0); 4850 } 4851 4852 int 4853 pci_teardown_intr(device_t dev, device_t child, struct resource *irq, 4854 void *cookie) 4855 { 4856 struct msix_table_entry *mte; 4857 struct resource_list_entry *rle; 4858 struct pci_devinfo *dinfo; 4859 int error, rid; 4860 4861 if (irq == NULL || !(rman_get_flags(irq) & RF_ACTIVE)) 4862 return (EINVAL); 4863 4864 /* If this isn't a direct child, just bail out */ 4865 if (device_get_parent(child) != dev) 4866 return(bus_generic_teardown_intr(dev, child, irq, cookie)); 4867 4868 rid = rman_get_rid(irq); 4869 if (rid == 0) { 4870 /* Mask INTx */ 4871 pci_set_command_bit(dev, child, PCIM_CMD_INTxDIS); 4872 } else { 4873 /* 4874 * Check to see if the interrupt is MSI or MSI-X. If so, 4875 * decrement the appropriate handlers count and mask the 4876 * MSI-X message, or disable MSI messages if the count 4877 * drops to 0. 4878 */ 4879 dinfo = device_get_ivars(child); 4880 rle = resource_list_find(&dinfo->resources, SYS_RES_IRQ, rid); 4881 if (rle->res != irq) 4882 return (EINVAL); 4883 if (dinfo->cfg.msi.msi_alloc > 0) { 4884 KASSERT(rid <= dinfo->cfg.msi.msi_alloc, 4885 ("MSI-X index too high")); 4886 if (dinfo->cfg.msi.msi_handlers == 0) 4887 return (EINVAL); 4888 dinfo->cfg.msi.msi_handlers--; 4889 if (dinfo->cfg.msi.msi_handlers == 0) 4890 pci_disable_msi(child); 4891 } else { 4892 KASSERT(dinfo->cfg.msix.msix_alloc > 0, 4893 ("No MSI or MSI-X interrupts allocated")); 4894 KASSERT(rid <= dinfo->cfg.msix.msix_table_len, 4895 ("MSI-X index too high")); 4896 mte = &dinfo->cfg.msix.msix_table[rid - 1]; 4897 if (mte->mte_handlers == 0) 4898 return (EINVAL); 4899 mte->mte_handlers--; 4900 if (mte->mte_handlers == 0) 4901 pci_mask_msix(child, rid - 1); 4902 } 4903 } 4904 error = bus_generic_teardown_intr(dev, child, irq, cookie); 4905 if (rid > 0) 4906 KASSERT(error == 0, 4907 ("%s: generic teardown failed for MSI/MSI-X", __func__)); 4908 return (error); 4909 } 4910 4911 int 4912 pci_print_child(device_t dev, device_t child) 4913 { 4914 struct pci_devinfo *dinfo; 4915 struct resource_list *rl; 4916 int retval = 0; 4917 4918 dinfo = device_get_ivars(child); 4919 rl = &dinfo->resources; 4920 4921 retval += bus_print_child_header(dev, child); 4922 4923 retval += resource_list_print_type(rl, "port", SYS_RES_IOPORT, "%#jx"); 4924 retval += resource_list_print_type(rl, "mem", SYS_RES_MEMORY, "%#jx"); 4925 retval += resource_list_print_type(rl, "irq", SYS_RES_IRQ, "%jd"); 4926 if (device_get_flags(dev)) 4927 retval += printf(" flags %#x", device_get_flags(dev)); 4928 4929 retval += printf(" at device %d.%d", pci_get_slot(child), 4930 pci_get_function(child)); 4931 4932 retval += bus_print_child_domain(dev, child); 4933 retval += bus_print_child_footer(dev, child); 4934 4935 return (retval); 4936 } 4937 4938 static const struct 4939 { 4940 int class; 4941 int subclass; 4942 int report; /* 0 = bootverbose, 1 = always */ 4943 const char *desc; 4944 } pci_nomatch_tab[] = { 4945 {PCIC_OLD, -1, 1, "old"}, 4946 {PCIC_OLD, PCIS_OLD_NONVGA, 1, "non-VGA display device"}, 4947 {PCIC_OLD, PCIS_OLD_VGA, 1, "VGA-compatible display device"}, 4948 {PCIC_STORAGE, -1, 1, "mass storage"}, 4949 {PCIC_STORAGE, PCIS_STORAGE_SCSI, 1, "SCSI"}, 4950 {PCIC_STORAGE, PCIS_STORAGE_IDE, 1, "ATA"}, 4951 {PCIC_STORAGE, PCIS_STORAGE_FLOPPY, 1, "floppy disk"}, 4952 {PCIC_STORAGE, PCIS_STORAGE_IPI, 1, "IPI"}, 4953 {PCIC_STORAGE, PCIS_STORAGE_RAID, 1, "RAID"}, 4954 {PCIC_STORAGE, PCIS_STORAGE_ATA_ADMA, 1, "ATA (ADMA)"}, 4955 {PCIC_STORAGE, PCIS_STORAGE_SATA, 1, "SATA"}, 4956 {PCIC_STORAGE, PCIS_STORAGE_SAS, 1, "SAS"}, 4957 {PCIC_STORAGE, PCIS_STORAGE_NVM, 1, "NVM"}, 4958 {PCIC_NETWORK, -1, 1, "network"}, 4959 {PCIC_NETWORK, PCIS_NETWORK_ETHERNET, 1, "ethernet"}, 4960 {PCIC_NETWORK, PCIS_NETWORK_TOKENRING, 1, "token ring"}, 4961 {PCIC_NETWORK, PCIS_NETWORK_FDDI, 1, "fddi"}, 4962 {PCIC_NETWORK, PCIS_NETWORK_ATM, 1, "ATM"}, 4963 {PCIC_NETWORK, PCIS_NETWORK_ISDN, 1, "ISDN"}, 4964 {PCIC_DISPLAY, -1, 1, "display"}, 4965 {PCIC_DISPLAY, PCIS_DISPLAY_VGA, 1, "VGA"}, 4966 {PCIC_DISPLAY, PCIS_DISPLAY_XGA, 1, "XGA"}, 4967 {PCIC_DISPLAY, PCIS_DISPLAY_3D, 1, "3D"}, 4968 {PCIC_MULTIMEDIA, -1, 1, "multimedia"}, 4969 {PCIC_MULTIMEDIA, PCIS_MULTIMEDIA_VIDEO, 1, "video"}, 4970 {PCIC_MULTIMEDIA, PCIS_MULTIMEDIA_AUDIO, 1, "audio"}, 4971 {PCIC_MULTIMEDIA, PCIS_MULTIMEDIA_TELE, 1, "telephony"}, 4972 {PCIC_MULTIMEDIA, PCIS_MULTIMEDIA_HDA, 1, "HDA"}, 4973 {PCIC_MEMORY, -1, 1, "memory"}, 4974 {PCIC_MEMORY, PCIS_MEMORY_RAM, 1, "RAM"}, 4975 {PCIC_MEMORY, PCIS_MEMORY_FLASH, 1, "flash"}, 4976 {PCIC_BRIDGE, -1, 1, "bridge"}, 4977 {PCIC_BRIDGE, PCIS_BRIDGE_HOST, 1, "HOST-PCI"}, 4978 {PCIC_BRIDGE, PCIS_BRIDGE_ISA, 1, "PCI-ISA"}, 4979 {PCIC_BRIDGE, PCIS_BRIDGE_EISA, 1, "PCI-EISA"}, 4980 {PCIC_BRIDGE, PCIS_BRIDGE_MCA, 1, "PCI-MCA"}, 4981 {PCIC_BRIDGE, PCIS_BRIDGE_PCI, 1, "PCI-PCI"}, 4982 {PCIC_BRIDGE, PCIS_BRIDGE_PCMCIA, 1, "PCI-PCMCIA"}, 4983 {PCIC_BRIDGE, PCIS_BRIDGE_NUBUS, 1, "PCI-NuBus"}, 4984 {PCIC_BRIDGE, PCIS_BRIDGE_CARDBUS, 1, "PCI-CardBus"}, 4985 {PCIC_BRIDGE, PCIS_BRIDGE_RACEWAY, 1, "PCI-RACEway"}, 4986 {PCIC_SIMPLECOMM, -1, 1, "simple comms"}, 4987 {PCIC_SIMPLECOMM, PCIS_SIMPLECOMM_UART, 1, "UART"}, /* could detect 16550 */ 4988 {PCIC_SIMPLECOMM, PCIS_SIMPLECOMM_PAR, 1, "parallel port"}, 4989 {PCIC_SIMPLECOMM, PCIS_SIMPLECOMM_MULSER, 1, "multiport serial"}, 4990 {PCIC_SIMPLECOMM, PCIS_SIMPLECOMM_MODEM, 1, "generic modem"}, 4991 {PCIC_BASEPERIPH, -1, 0, "base peripheral"}, 4992 {PCIC_BASEPERIPH, PCIS_BASEPERIPH_PIC, 1, "interrupt controller"}, 4993 {PCIC_BASEPERIPH, PCIS_BASEPERIPH_DMA, 1, "DMA controller"}, 4994 {PCIC_BASEPERIPH, PCIS_BASEPERIPH_TIMER, 1, "timer"}, 4995 {PCIC_BASEPERIPH, PCIS_BASEPERIPH_RTC, 1, "realtime clock"}, 4996 {PCIC_BASEPERIPH, PCIS_BASEPERIPH_PCIHOT, 1, "PCI hot-plug controller"}, 4997 {PCIC_BASEPERIPH, PCIS_BASEPERIPH_SDHC, 1, "SD host controller"}, 4998 {PCIC_BASEPERIPH, PCIS_BASEPERIPH_IOMMU, 1, "IOMMU"}, 4999 {PCIC_INPUTDEV, -1, 1, "input device"}, 5000 {PCIC_INPUTDEV, PCIS_INPUTDEV_KEYBOARD, 1, "keyboard"}, 5001 {PCIC_INPUTDEV, PCIS_INPUTDEV_DIGITIZER,1, "digitizer"}, 5002 {PCIC_INPUTDEV, PCIS_INPUTDEV_MOUSE, 1, "mouse"}, 5003 {PCIC_INPUTDEV, PCIS_INPUTDEV_SCANNER, 1, "scanner"}, 5004 {PCIC_INPUTDEV, PCIS_INPUTDEV_GAMEPORT, 1, "gameport"}, 5005 {PCIC_DOCKING, -1, 1, "docking station"}, 5006 {PCIC_PROCESSOR, -1, 1, "processor"}, 5007 {PCIC_SERIALBUS, -1, 1, "serial bus"}, 5008 {PCIC_SERIALBUS, PCIS_SERIALBUS_FW, 1, "FireWire"}, 5009 {PCIC_SERIALBUS, PCIS_SERIALBUS_ACCESS, 1, "AccessBus"}, 5010 {PCIC_SERIALBUS, PCIS_SERIALBUS_SSA, 1, "SSA"}, 5011 {PCIC_SERIALBUS, PCIS_SERIALBUS_USB, 1, "USB"}, 5012 {PCIC_SERIALBUS, PCIS_SERIALBUS_FC, 1, "Fibre Channel"}, 5013 {PCIC_SERIALBUS, PCIS_SERIALBUS_SMBUS, 0, "SMBus"}, 5014 {PCIC_WIRELESS, -1, 1, "wireless controller"}, 5015 {PCIC_WIRELESS, PCIS_WIRELESS_IRDA, 1, "iRDA"}, 5016 {PCIC_WIRELESS, PCIS_WIRELESS_IR, 1, "IR"}, 5017 {PCIC_WIRELESS, PCIS_WIRELESS_RF, 1, "RF"}, 5018 {PCIC_INTELLIIO, -1, 1, "intelligent I/O controller"}, 5019 {PCIC_INTELLIIO, PCIS_INTELLIIO_I2O, 1, "I2O"}, 5020 {PCIC_SATCOM, -1, 1, "satellite communication"}, 5021 {PCIC_SATCOM, PCIS_SATCOM_TV, 1, "sat TV"}, 5022 {PCIC_SATCOM, PCIS_SATCOM_AUDIO, 1, "sat audio"}, 5023 {PCIC_SATCOM, PCIS_SATCOM_VOICE, 1, "sat voice"}, 5024 {PCIC_SATCOM, PCIS_SATCOM_DATA, 1, "sat data"}, 5025 {PCIC_CRYPTO, -1, 1, "encrypt/decrypt"}, 5026 {PCIC_CRYPTO, PCIS_CRYPTO_NETCOMP, 1, "network/computer crypto"}, 5027 {PCIC_CRYPTO, PCIS_CRYPTO_ENTERTAIN, 1, "entertainment crypto"}, 5028 {PCIC_DASP, -1, 0, "dasp"}, 5029 {PCIC_DASP, PCIS_DASP_DPIO, 1, "DPIO module"}, 5030 {PCIC_DASP, PCIS_DASP_PERFCNTRS, 1, "performance counters"}, 5031 {PCIC_DASP, PCIS_DASP_COMM_SYNC, 1, "communication synchronizer"}, 5032 {PCIC_DASP, PCIS_DASP_MGMT_CARD, 1, "signal processing management"}, 5033 {0, 0, 0, NULL} 5034 }; 5035 5036 void 5037 pci_probe_nomatch(device_t dev, device_t child) 5038 { 5039 int i, report; 5040 const char *cp, *scp; 5041 char *device; 5042 5043 /* 5044 * Look for a listing for this device in a loaded device database. 5045 */ 5046 report = 1; 5047 if ((device = pci_describe_device(child)) != NULL) { 5048 device_printf(dev, "<%s>", device); 5049 free(device, M_DEVBUF); 5050 } else { 5051 /* 5052 * Scan the class/subclass descriptions for a general 5053 * description. 5054 */ 5055 cp = "unknown"; 5056 scp = NULL; 5057 for (i = 0; pci_nomatch_tab[i].desc != NULL; i++) { 5058 if (pci_nomatch_tab[i].class == pci_get_class(child)) { 5059 if (pci_nomatch_tab[i].subclass == -1) { 5060 cp = pci_nomatch_tab[i].desc; 5061 report = pci_nomatch_tab[i].report; 5062 } else if (pci_nomatch_tab[i].subclass == 5063 pci_get_subclass(child)) { 5064 scp = pci_nomatch_tab[i].desc; 5065 report = pci_nomatch_tab[i].report; 5066 } 5067 } 5068 } 5069 if (report || bootverbose) { 5070 device_printf(dev, "<%s%s%s>", 5071 cp ? cp : "", 5072 ((cp != NULL) && (scp != NULL)) ? ", " : "", 5073 scp ? scp : ""); 5074 } 5075 } 5076 if (report || bootverbose) { 5077 printf(" at device %d.%d (no driver attached)\n", 5078 pci_get_slot(child), pci_get_function(child)); 5079 } 5080 pci_cfg_save(child, device_get_ivars(child), 1); 5081 } 5082 5083 void 5084 pci_child_detached(device_t dev, device_t child) 5085 { 5086 struct pci_devinfo *dinfo; 5087 struct resource_list *rl; 5088 5089 dinfo = device_get_ivars(child); 5090 rl = &dinfo->resources; 5091 5092 /* 5093 * Have to deallocate IRQs before releasing any MSI messages and 5094 * have to release MSI messages before deallocating any memory 5095 * BARs. 5096 */ 5097 if (resource_list_release_active(rl, dev, child, SYS_RES_IRQ) != 0) 5098 pci_printf(&dinfo->cfg, "Device leaked IRQ resources\n"); 5099 if (dinfo->cfg.msi.msi_alloc != 0 || dinfo->cfg.msix.msix_alloc != 0) { 5100 if (dinfo->cfg.msi.msi_alloc != 0) 5101 pci_printf(&dinfo->cfg, "Device leaked %d MSI " 5102 "vectors\n", dinfo->cfg.msi.msi_alloc); 5103 else 5104 pci_printf(&dinfo->cfg, "Device leaked %d MSI-X " 5105 "vectors\n", dinfo->cfg.msix.msix_alloc); 5106 (void)pci_release_msi(child); 5107 } 5108 if (resource_list_release_active(rl, dev, child, SYS_RES_MEMORY) != 0) 5109 pci_printf(&dinfo->cfg, "Device leaked memory resources\n"); 5110 if (resource_list_release_active(rl, dev, child, SYS_RES_IOPORT) != 0) 5111 pci_printf(&dinfo->cfg, "Device leaked I/O resources\n"); 5112 #ifdef PCI_RES_BUS 5113 if (resource_list_release_active(rl, dev, child, PCI_RES_BUS) != 0) 5114 pci_printf(&dinfo->cfg, "Device leaked PCI bus numbers\n"); 5115 #endif 5116 5117 pci_cfg_save(child, dinfo, 1); 5118 } 5119 5120 /* 5121 * Parse the PCI device database, if loaded, and return a pointer to a 5122 * description of the device. 5123 * 5124 * The database is flat text formatted as follows: 5125 * 5126 * Any line not in a valid format is ignored. 5127 * Lines are terminated with newline '\n' characters. 5128 * 5129 * A VENDOR line consists of the 4 digit (hex) vendor code, a TAB, then 5130 * the vendor name. 5131 * 5132 * A DEVICE line is entered immediately below the corresponding VENDOR ID. 5133 * - devices cannot be listed without a corresponding VENDOR line. 5134 * A DEVICE line consists of a TAB, the 4 digit (hex) device code, 5135 * another TAB, then the device name. 5136 */ 5137 5138 /* 5139 * Assuming (ptr) points to the beginning of a line in the database, 5140 * return the vendor or device and description of the next entry. 5141 * The value of (vendor) or (device) inappropriate for the entry type 5142 * is set to -1. Returns nonzero at the end of the database. 5143 * 5144 * Note that this is slightly unrobust in the face of corrupt data; 5145 * we attempt to safeguard against this by spamming the end of the 5146 * database with a newline when we initialise. 5147 */ 5148 static int 5149 pci_describe_parse_line(char **ptr, int *vendor, int *device, char **desc) 5150 { 5151 char *cp = *ptr; 5152 int left; 5153 5154 *device = -1; 5155 *vendor = -1; 5156 **desc = '\0'; 5157 for (;;) { 5158 left = pci_vendordata_size - (cp - pci_vendordata); 5159 if (left <= 0) { 5160 *ptr = cp; 5161 return(1); 5162 } 5163 5164 /* vendor entry? */ 5165 if (*cp != '\t' && 5166 sscanf(cp, "%x\t%80[^\n]", vendor, *desc) == 2) 5167 break; 5168 /* device entry? */ 5169 if (*cp == '\t' && 5170 sscanf(cp, "%x\t%80[^\n]", device, *desc) == 2) 5171 break; 5172 5173 /* skip to next line */ 5174 while (*cp != '\n' && left > 0) { 5175 cp++; 5176 left--; 5177 } 5178 if (*cp == '\n') { 5179 cp++; 5180 left--; 5181 } 5182 } 5183 /* skip to next line */ 5184 while (*cp != '\n' && left > 0) { 5185 cp++; 5186 left--; 5187 } 5188 if (*cp == '\n' && left > 0) 5189 cp++; 5190 *ptr = cp; 5191 return(0); 5192 } 5193 5194 static char * 5195 pci_describe_device(device_t dev) 5196 { 5197 int vendor, device; 5198 char *desc, *vp, *dp, *line; 5199 5200 desc = vp = dp = NULL; 5201 5202 /* 5203 * If we have no vendor data, we can't do anything. 5204 */ 5205 if (pci_vendordata == NULL) 5206 goto out; 5207 5208 /* 5209 * Scan the vendor data looking for this device 5210 */ 5211 line = pci_vendordata; 5212 if ((vp = malloc(80, M_DEVBUF, M_NOWAIT)) == NULL) 5213 goto out; 5214 for (;;) { 5215 if (pci_describe_parse_line(&line, &vendor, &device, &vp)) 5216 goto out; 5217 if (vendor == pci_get_vendor(dev)) 5218 break; 5219 } 5220 if ((dp = malloc(80, M_DEVBUF, M_NOWAIT)) == NULL) 5221 goto out; 5222 for (;;) { 5223 if (pci_describe_parse_line(&line, &vendor, &device, &dp)) { 5224 *dp = 0; 5225 break; 5226 } 5227 if (vendor != -1) { 5228 *dp = 0; 5229 break; 5230 } 5231 if (device == pci_get_device(dev)) 5232 break; 5233 } 5234 if (dp[0] == '\0') 5235 snprintf(dp, 80, "0x%x", pci_get_device(dev)); 5236 if ((desc = malloc(strlen(vp) + strlen(dp) + 3, M_DEVBUF, M_NOWAIT)) != 5237 NULL) 5238 sprintf(desc, "%s, %s", vp, dp); 5239 out: 5240 if (vp != NULL) 5241 free(vp, M_DEVBUF); 5242 if (dp != NULL) 5243 free(dp, M_DEVBUF); 5244 return(desc); 5245 } 5246 5247 int 5248 pci_read_ivar(device_t dev, device_t child, int which, uintptr_t *result) 5249 { 5250 struct pci_devinfo *dinfo; 5251 pcicfgregs *cfg; 5252 5253 dinfo = device_get_ivars(child); 5254 cfg = &dinfo->cfg; 5255 5256 switch (which) { 5257 case PCI_IVAR_ETHADDR: 5258 /* 5259 * The generic accessor doesn't deal with failure, so 5260 * we set the return value, then return an error. 5261 */ 5262 *((uint8_t **) result) = NULL; 5263 return (EINVAL); 5264 case PCI_IVAR_SUBVENDOR: 5265 *result = cfg->subvendor; 5266 break; 5267 case PCI_IVAR_SUBDEVICE: 5268 *result = cfg->subdevice; 5269 break; 5270 case PCI_IVAR_VENDOR: 5271 *result = cfg->vendor; 5272 break; 5273 case PCI_IVAR_DEVICE: 5274 *result = cfg->device; 5275 break; 5276 case PCI_IVAR_DEVID: 5277 *result = (cfg->device << 16) | cfg->vendor; 5278 break; 5279 case PCI_IVAR_CLASS: 5280 *result = cfg->baseclass; 5281 break; 5282 case PCI_IVAR_SUBCLASS: 5283 *result = cfg->subclass; 5284 break; 5285 case PCI_IVAR_PROGIF: 5286 *result = cfg->progif; 5287 break; 5288 case PCI_IVAR_REVID: 5289 *result = cfg->revid; 5290 break; 5291 case PCI_IVAR_INTPIN: 5292 *result = cfg->intpin; 5293 break; 5294 case PCI_IVAR_IRQ: 5295 *result = cfg->intline; 5296 break; 5297 case PCI_IVAR_DOMAIN: 5298 *result = cfg->domain; 5299 break; 5300 case PCI_IVAR_BUS: 5301 *result = cfg->bus; 5302 break; 5303 case PCI_IVAR_SLOT: 5304 *result = cfg->slot; 5305 break; 5306 case PCI_IVAR_FUNCTION: 5307 *result = cfg->func; 5308 break; 5309 case PCI_IVAR_CMDREG: 5310 *result = cfg->cmdreg; 5311 break; 5312 case PCI_IVAR_CACHELNSZ: 5313 *result = cfg->cachelnsz; 5314 break; 5315 case PCI_IVAR_MINGNT: 5316 if (cfg->hdrtype != PCIM_HDRTYPE_NORMAL) { 5317 *result = -1; 5318 return (EINVAL); 5319 } 5320 *result = cfg->mingnt; 5321 break; 5322 case PCI_IVAR_MAXLAT: 5323 if (cfg->hdrtype != PCIM_HDRTYPE_NORMAL) { 5324 *result = -1; 5325 return (EINVAL); 5326 } 5327 *result = cfg->maxlat; 5328 break; 5329 case PCI_IVAR_LATTIMER: 5330 *result = cfg->lattimer; 5331 break; 5332 default: 5333 return (ENOENT); 5334 } 5335 return (0); 5336 } 5337 5338 int 5339 pci_write_ivar(device_t dev, device_t child, int which, uintptr_t value) 5340 { 5341 struct pci_devinfo *dinfo; 5342 5343 dinfo = device_get_ivars(child); 5344 5345 switch (which) { 5346 case PCI_IVAR_INTPIN: 5347 dinfo->cfg.intpin = value; 5348 return (0); 5349 case PCI_IVAR_ETHADDR: 5350 case PCI_IVAR_SUBVENDOR: 5351 case PCI_IVAR_SUBDEVICE: 5352 case PCI_IVAR_VENDOR: 5353 case PCI_IVAR_DEVICE: 5354 case PCI_IVAR_DEVID: 5355 case PCI_IVAR_CLASS: 5356 case PCI_IVAR_SUBCLASS: 5357 case PCI_IVAR_PROGIF: 5358 case PCI_IVAR_REVID: 5359 case PCI_IVAR_IRQ: 5360 case PCI_IVAR_DOMAIN: 5361 case PCI_IVAR_BUS: 5362 case PCI_IVAR_SLOT: 5363 case PCI_IVAR_FUNCTION: 5364 return (EINVAL); /* disallow for now */ 5365 5366 default: 5367 return (ENOENT); 5368 } 5369 } 5370 5371 #include "opt_ddb.h" 5372 #ifdef DDB 5373 #include <ddb/ddb.h> 5374 #include <sys/cons.h> 5375 5376 /* 5377 * List resources based on pci map registers, used for within ddb 5378 */ 5379 5380 DB_SHOW_COMMAND(pciregs, db_pci_dump) 5381 { 5382 struct pci_devinfo *dinfo; 5383 struct devlist *devlist_head; 5384 struct pci_conf *p; 5385 const char *name; 5386 int i, error, none_count; 5387 5388 none_count = 0; 5389 /* get the head of the device queue */ 5390 devlist_head = &pci_devq; 5391 5392 /* 5393 * Go through the list of devices and print out devices 5394 */ 5395 for (error = 0, i = 0, 5396 dinfo = STAILQ_FIRST(devlist_head); 5397 (dinfo != NULL) && (error == 0) && (i < pci_numdevs) && !db_pager_quit; 5398 dinfo = STAILQ_NEXT(dinfo, pci_links), i++) { 5399 /* Populate pd_name and pd_unit */ 5400 name = NULL; 5401 if (dinfo->cfg.dev) 5402 name = device_get_name(dinfo->cfg.dev); 5403 5404 p = &dinfo->conf; 5405 db_printf("%s%d@pci%d:%d:%d:%d:\tclass=0x%06x card=0x%08x " 5406 "chip=0x%08x rev=0x%02x hdr=0x%02x\n", 5407 (name && *name) ? name : "none", 5408 (name && *name) ? (int)device_get_unit(dinfo->cfg.dev) : 5409 none_count++, 5410 p->pc_sel.pc_domain, p->pc_sel.pc_bus, p->pc_sel.pc_dev, 5411 p->pc_sel.pc_func, (p->pc_class << 16) | 5412 (p->pc_subclass << 8) | p->pc_progif, 5413 (p->pc_subdevice << 16) | p->pc_subvendor, 5414 (p->pc_device << 16) | p->pc_vendor, 5415 p->pc_revid, p->pc_hdr); 5416 } 5417 } 5418 #endif /* DDB */ 5419 5420 struct resource * 5421 pci_reserve_map(device_t dev, device_t child, int type, int *rid, 5422 rman_res_t start, rman_res_t end, rman_res_t count, u_int num, 5423 u_int flags) 5424 { 5425 struct pci_devinfo *dinfo = device_get_ivars(child); 5426 struct resource_list *rl = &dinfo->resources; 5427 struct resource *res; 5428 struct pci_map *pm; 5429 uint16_t cmd; 5430 pci_addr_t map, testval; 5431 int mapsize; 5432 5433 res = NULL; 5434 5435 /* If rid is managed by EA, ignore it */ 5436 if (pci_ea_is_enabled(child, *rid)) 5437 goto out; 5438 5439 pm = pci_find_bar(child, *rid); 5440 if (pm != NULL) { 5441 /* This is a BAR that we failed to allocate earlier. */ 5442 mapsize = pm->pm_size; 5443 map = pm->pm_value; 5444 } else { 5445 /* 5446 * Weed out the bogons, and figure out how large the 5447 * BAR/map is. BARs that read back 0 here are bogus 5448 * and unimplemented. Note: atapci in legacy mode are 5449 * special and handled elsewhere in the code. If you 5450 * have a atapci device in legacy mode and it fails 5451 * here, that other code is broken. 5452 */ 5453 pci_read_bar(child, *rid, &map, &testval, NULL); 5454 5455 /* 5456 * Determine the size of the BAR and ignore BARs with a size 5457 * of 0. Device ROM BARs use a different mask value. 5458 */ 5459 if (PCIR_IS_BIOS(&dinfo->cfg, *rid)) 5460 mapsize = pci_romsize(testval); 5461 else 5462 mapsize = pci_mapsize(testval); 5463 if (mapsize == 0) 5464 goto out; 5465 pm = pci_add_bar(child, *rid, map, mapsize); 5466 } 5467 5468 if (PCI_BAR_MEM(map) || PCIR_IS_BIOS(&dinfo->cfg, *rid)) { 5469 if (type != SYS_RES_MEMORY) { 5470 if (bootverbose) 5471 device_printf(dev, 5472 "child %s requested type %d for rid %#x," 5473 " but the BAR says it is an memio\n", 5474 device_get_nameunit(child), type, *rid); 5475 goto out; 5476 } 5477 } else { 5478 if (type != SYS_RES_IOPORT) { 5479 if (bootverbose) 5480 device_printf(dev, 5481 "child %s requested type %d for rid %#x," 5482 " but the BAR says it is an ioport\n", 5483 device_get_nameunit(child), type, *rid); 5484 goto out; 5485 } 5486 } 5487 5488 /* 5489 * For real BARs, we need to override the size that 5490 * the driver requests, because that's what the BAR 5491 * actually uses and we would otherwise have a 5492 * situation where we might allocate the excess to 5493 * another driver, which won't work. 5494 */ 5495 count = ((pci_addr_t)1 << mapsize) * num; 5496 if (RF_ALIGNMENT(flags) < mapsize) 5497 flags = (flags & ~RF_ALIGNMENT_MASK) | RF_ALIGNMENT_LOG2(mapsize); 5498 if (PCI_BAR_MEM(map) && (map & PCIM_BAR_MEM_PREFETCH)) 5499 flags |= RF_PREFETCHABLE; 5500 5501 /* 5502 * Allocate enough resource, and then write back the 5503 * appropriate BAR for that resource. 5504 */ 5505 resource_list_add(rl, type, *rid, start, end, count); 5506 res = resource_list_reserve(rl, dev, child, type, rid, start, end, 5507 count, flags & ~RF_ACTIVE); 5508 if (res == NULL) { 5509 resource_list_delete(rl, type, *rid); 5510 device_printf(child, 5511 "%#jx bytes of rid %#x res %d failed (%#jx, %#jx).\n", 5512 count, *rid, type, start, end); 5513 goto out; 5514 } 5515 if (bootverbose) 5516 device_printf(child, 5517 "Lazy allocation of %#jx bytes rid %#x type %d at %#jx\n", 5518 count, *rid, type, rman_get_start(res)); 5519 5520 /* Disable decoding via the CMD register before updating the BAR */ 5521 cmd = pci_read_config(child, PCIR_COMMAND, 2); 5522 pci_write_config(child, PCIR_COMMAND, 5523 cmd & ~(PCI_BAR_MEM(map) ? PCIM_CMD_MEMEN : PCIM_CMD_PORTEN), 2); 5524 5525 map = rman_get_start(res); 5526 pci_write_bar(child, pm, map); 5527 5528 /* Restore the original value of the CMD register */ 5529 pci_write_config(child, PCIR_COMMAND, cmd, 2); 5530 out: 5531 return (res); 5532 } 5533 5534 struct resource * 5535 pci_alloc_multi_resource(device_t dev, device_t child, int type, int *rid, 5536 rman_res_t start, rman_res_t end, rman_res_t count, u_long num, 5537 u_int flags) 5538 { 5539 struct pci_devinfo *dinfo; 5540 struct resource_list *rl; 5541 struct resource_list_entry *rle; 5542 struct resource *res; 5543 pcicfgregs *cfg; 5544 5545 /* 5546 * Perform lazy resource allocation 5547 */ 5548 dinfo = device_get_ivars(child); 5549 rl = &dinfo->resources; 5550 cfg = &dinfo->cfg; 5551 switch (type) { 5552 #if defined(NEW_PCIB) && defined(PCI_RES_BUS) 5553 case PCI_RES_BUS: 5554 return (pci_alloc_secbus(dev, child, rid, start, end, count, 5555 flags)); 5556 #endif 5557 case SYS_RES_IRQ: 5558 /* 5559 * Can't alloc legacy interrupt once MSI messages have 5560 * been allocated. 5561 */ 5562 if (*rid == 0 && (cfg->msi.msi_alloc > 0 || 5563 cfg->msix.msix_alloc > 0)) 5564 return (NULL); 5565 5566 /* 5567 * If the child device doesn't have an interrupt 5568 * routed and is deserving of an interrupt, try to 5569 * assign it one. 5570 */ 5571 if (*rid == 0 && !PCI_INTERRUPT_VALID(cfg->intline) && 5572 (cfg->intpin != 0)) 5573 pci_assign_interrupt(dev, child, 0); 5574 break; 5575 case SYS_RES_IOPORT: 5576 case SYS_RES_MEMORY: 5577 #ifdef NEW_PCIB 5578 /* 5579 * PCI-PCI bridge I/O window resources are not BARs. 5580 * For those allocations just pass the request up the 5581 * tree. 5582 */ 5583 if (cfg->hdrtype == PCIM_HDRTYPE_BRIDGE) { 5584 switch (*rid) { 5585 case PCIR_IOBASEL_1: 5586 case PCIR_MEMBASE_1: 5587 case PCIR_PMBASEL_1: 5588 /* 5589 * XXX: Should we bother creating a resource 5590 * list entry? 5591 */ 5592 return (bus_generic_alloc_resource(dev, child, 5593 type, rid, start, end, count, flags)); 5594 } 5595 } 5596 #endif 5597 /* Reserve resources for this BAR if needed. */ 5598 rle = resource_list_find(rl, type, *rid); 5599 if (rle == NULL) { 5600 res = pci_reserve_map(dev, child, type, rid, start, end, 5601 count, num, flags); 5602 if (res == NULL) 5603 return (NULL); 5604 } 5605 } 5606 return (resource_list_alloc(rl, dev, child, type, rid, 5607 start, end, count, flags)); 5608 } 5609 5610 struct resource * 5611 pci_alloc_resource(device_t dev, device_t child, int type, int *rid, 5612 rman_res_t start, rman_res_t end, rman_res_t count, u_int flags) 5613 { 5614 #ifdef PCI_IOV 5615 struct pci_devinfo *dinfo; 5616 #endif 5617 5618 if (device_get_parent(child) != dev) 5619 return (BUS_ALLOC_RESOURCE(device_get_parent(dev), child, 5620 type, rid, start, end, count, flags)); 5621 5622 #ifdef PCI_IOV 5623 dinfo = device_get_ivars(child); 5624 if (dinfo->cfg.flags & PCICFG_VF) { 5625 switch (type) { 5626 /* VFs can't have I/O BARs. */ 5627 case SYS_RES_IOPORT: 5628 return (NULL); 5629 case SYS_RES_MEMORY: 5630 return (pci_vf_alloc_mem_resource(dev, child, rid, 5631 start, end, count, flags)); 5632 } 5633 5634 /* Fall through for other types of resource allocations. */ 5635 } 5636 #endif 5637 5638 return (pci_alloc_multi_resource(dev, child, type, rid, start, end, 5639 count, 1, flags)); 5640 } 5641 5642 int 5643 pci_release_resource(device_t dev, device_t child, int type, int rid, 5644 struct resource *r) 5645 { 5646 struct pci_devinfo *dinfo; 5647 struct resource_list *rl; 5648 pcicfgregs *cfg; 5649 5650 if (device_get_parent(child) != dev) 5651 return (BUS_RELEASE_RESOURCE(device_get_parent(dev), child, 5652 type, rid, r)); 5653 5654 dinfo = device_get_ivars(child); 5655 cfg = &dinfo->cfg; 5656 5657 #ifdef PCI_IOV 5658 if (dinfo->cfg.flags & PCICFG_VF) { 5659 switch (type) { 5660 /* VFs can't have I/O BARs. */ 5661 case SYS_RES_IOPORT: 5662 return (EDOOFUS); 5663 case SYS_RES_MEMORY: 5664 return (pci_vf_release_mem_resource(dev, child, rid, 5665 r)); 5666 } 5667 5668 /* Fall through for other types of resource allocations. */ 5669 } 5670 #endif 5671 5672 #ifdef NEW_PCIB 5673 /* 5674 * PCI-PCI bridge I/O window resources are not BARs. For 5675 * those allocations just pass the request up the tree. 5676 */ 5677 if (cfg->hdrtype == PCIM_HDRTYPE_BRIDGE && 5678 (type == SYS_RES_IOPORT || type == SYS_RES_MEMORY)) { 5679 switch (rid) { 5680 case PCIR_IOBASEL_1: 5681 case PCIR_MEMBASE_1: 5682 case PCIR_PMBASEL_1: 5683 return (bus_generic_release_resource(dev, child, type, 5684 rid, r)); 5685 } 5686 } 5687 #endif 5688 5689 rl = &dinfo->resources; 5690 return (resource_list_release(rl, dev, child, type, rid, r)); 5691 } 5692 5693 int 5694 pci_activate_resource(device_t dev, device_t child, int type, int rid, 5695 struct resource *r) 5696 { 5697 struct pci_devinfo *dinfo; 5698 int error; 5699 5700 error = bus_generic_activate_resource(dev, child, type, rid, r); 5701 if (error) 5702 return (error); 5703 5704 /* Enable decoding in the command register when activating BARs. */ 5705 if (device_get_parent(child) == dev) { 5706 /* Device ROMs need their decoding explicitly enabled. */ 5707 dinfo = device_get_ivars(child); 5708 if (type == SYS_RES_MEMORY && PCIR_IS_BIOS(&dinfo->cfg, rid)) 5709 pci_write_bar(child, pci_find_bar(child, rid), 5710 rman_get_start(r) | PCIM_BIOS_ENABLE); 5711 switch (type) { 5712 case SYS_RES_IOPORT: 5713 case SYS_RES_MEMORY: 5714 error = PCI_ENABLE_IO(dev, child, type); 5715 break; 5716 } 5717 } 5718 return (error); 5719 } 5720 5721 int 5722 pci_deactivate_resource(device_t dev, device_t child, int type, 5723 int rid, struct resource *r) 5724 { 5725 struct pci_devinfo *dinfo; 5726 int error; 5727 5728 error = bus_generic_deactivate_resource(dev, child, type, rid, r); 5729 if (error) 5730 return (error); 5731 5732 /* Disable decoding for device ROMs. */ 5733 if (device_get_parent(child) == dev) { 5734 dinfo = device_get_ivars(child); 5735 if (type == SYS_RES_MEMORY && PCIR_IS_BIOS(&dinfo->cfg, rid)) 5736 pci_write_bar(child, pci_find_bar(child, rid), 5737 rman_get_start(r)); 5738 } 5739 return (0); 5740 } 5741 5742 void 5743 pci_child_deleted(device_t dev, device_t child) 5744 { 5745 struct resource_list_entry *rle; 5746 struct resource_list *rl; 5747 struct pci_devinfo *dinfo; 5748 5749 dinfo = device_get_ivars(child); 5750 rl = &dinfo->resources; 5751 5752 EVENTHANDLER_INVOKE(pci_delete_device, child); 5753 5754 /* Turn off access to resources we're about to free */ 5755 if (bus_child_present(child) != 0) { 5756 pci_write_config(child, PCIR_COMMAND, pci_read_config(child, 5757 PCIR_COMMAND, 2) & ~(PCIM_CMD_MEMEN | PCIM_CMD_PORTEN), 2); 5758 5759 pci_disable_busmaster(child); 5760 } 5761 5762 /* Free all allocated resources */ 5763 STAILQ_FOREACH(rle, rl, link) { 5764 if (rle->res) { 5765 if (rman_get_flags(rle->res) & RF_ACTIVE || 5766 resource_list_busy(rl, rle->type, rle->rid)) { 5767 pci_printf(&dinfo->cfg, 5768 "Resource still owned, oops. " 5769 "(type=%d, rid=%d, addr=%lx)\n", 5770 rle->type, rle->rid, 5771 rman_get_start(rle->res)); 5772 bus_release_resource(child, rle->type, rle->rid, 5773 rle->res); 5774 } 5775 resource_list_unreserve(rl, dev, child, rle->type, 5776 rle->rid); 5777 } 5778 } 5779 resource_list_free(rl); 5780 5781 pci_freecfg(dinfo); 5782 } 5783 5784 void 5785 pci_delete_resource(device_t dev, device_t child, int type, int rid) 5786 { 5787 struct pci_devinfo *dinfo; 5788 struct resource_list *rl; 5789 struct resource_list_entry *rle; 5790 5791 if (device_get_parent(child) != dev) 5792 return; 5793 5794 dinfo = device_get_ivars(child); 5795 rl = &dinfo->resources; 5796 rle = resource_list_find(rl, type, rid); 5797 if (rle == NULL) 5798 return; 5799 5800 if (rle->res) { 5801 if (rman_get_flags(rle->res) & RF_ACTIVE || 5802 resource_list_busy(rl, type, rid)) { 5803 device_printf(dev, "delete_resource: " 5804 "Resource still owned by child, oops. " 5805 "(type=%d, rid=%d, addr=%jx)\n", 5806 type, rid, rman_get_start(rle->res)); 5807 return; 5808 } 5809 resource_list_unreserve(rl, dev, child, type, rid); 5810 } 5811 resource_list_delete(rl, type, rid); 5812 } 5813 5814 struct resource_list * 5815 pci_get_resource_list (device_t dev, device_t child) 5816 { 5817 struct pci_devinfo *dinfo = device_get_ivars(child); 5818 5819 return (&dinfo->resources); 5820 } 5821 5822 #ifdef IOMMU 5823 bus_dma_tag_t 5824 pci_get_dma_tag(device_t bus, device_t dev) 5825 { 5826 bus_dma_tag_t tag; 5827 struct pci_softc *sc; 5828 5829 if (device_get_parent(dev) == bus) { 5830 /* try iommu and return if it works */ 5831 tag = iommu_get_dma_tag(bus, dev); 5832 } else 5833 tag = NULL; 5834 if (tag == NULL) { 5835 sc = device_get_softc(bus); 5836 tag = sc->sc_dma_tag; 5837 } 5838 return (tag); 5839 } 5840 #else 5841 bus_dma_tag_t 5842 pci_get_dma_tag(device_t bus, device_t dev) 5843 { 5844 struct pci_softc *sc = device_get_softc(bus); 5845 5846 return (sc->sc_dma_tag); 5847 } 5848 #endif 5849 5850 uint32_t 5851 pci_read_config_method(device_t dev, device_t child, int reg, int width) 5852 { 5853 struct pci_devinfo *dinfo = device_get_ivars(child); 5854 pcicfgregs *cfg = &dinfo->cfg; 5855 5856 #ifdef PCI_IOV 5857 /* 5858 * SR-IOV VFs don't implement the VID or DID registers, so we have to 5859 * emulate them here. 5860 */ 5861 if (cfg->flags & PCICFG_VF) { 5862 if (reg == PCIR_VENDOR) { 5863 switch (width) { 5864 case 4: 5865 return (cfg->device << 16 | cfg->vendor); 5866 case 2: 5867 return (cfg->vendor); 5868 case 1: 5869 return (cfg->vendor & 0xff); 5870 default: 5871 return (0xffffffff); 5872 } 5873 } else if (reg == PCIR_DEVICE) { 5874 switch (width) { 5875 /* Note that an unaligned 4-byte read is an error. */ 5876 case 2: 5877 return (cfg->device); 5878 case 1: 5879 return (cfg->device & 0xff); 5880 default: 5881 return (0xffffffff); 5882 } 5883 } 5884 } 5885 #endif 5886 5887 return (PCIB_READ_CONFIG(device_get_parent(dev), 5888 cfg->bus, cfg->slot, cfg->func, reg, width)); 5889 } 5890 5891 void 5892 pci_write_config_method(device_t dev, device_t child, int reg, 5893 uint32_t val, int width) 5894 { 5895 struct pci_devinfo *dinfo = device_get_ivars(child); 5896 pcicfgregs *cfg = &dinfo->cfg; 5897 5898 PCIB_WRITE_CONFIG(device_get_parent(dev), 5899 cfg->bus, cfg->slot, cfg->func, reg, val, width); 5900 } 5901 5902 int 5903 pci_child_location_method(device_t dev, device_t child, struct sbuf *sb) 5904 { 5905 5906 sbuf_printf(sb, "slot=%d function=%d dbsf=pci%d:%d:%d:%d", 5907 pci_get_slot(child), pci_get_function(child), pci_get_domain(child), 5908 pci_get_bus(child), pci_get_slot(child), pci_get_function(child)); 5909 return (0); 5910 } 5911 5912 int 5913 pci_child_pnpinfo_method(device_t dev, device_t child, struct sbuf *sb) 5914 { 5915 struct pci_devinfo *dinfo; 5916 pcicfgregs *cfg; 5917 5918 dinfo = device_get_ivars(child); 5919 cfg = &dinfo->cfg; 5920 sbuf_printf(sb, "vendor=0x%04x device=0x%04x subvendor=0x%04x " 5921 "subdevice=0x%04x class=0x%02x%02x%02x", cfg->vendor, cfg->device, 5922 cfg->subvendor, cfg->subdevice, cfg->baseclass, cfg->subclass, 5923 cfg->progif); 5924 return (0); 5925 } 5926 5927 int 5928 pci_get_device_path_method(device_t bus, device_t child, const char *locator, 5929 struct sbuf *sb) 5930 { 5931 device_t parent = device_get_parent(bus); 5932 int rv; 5933 5934 if (strcmp(locator, BUS_LOCATOR_UEFI) == 0) { 5935 rv = bus_generic_get_device_path(parent, bus, locator, sb); 5936 if (rv == 0) { 5937 sbuf_printf(sb, "/Pci(0x%x,0x%x)", pci_get_slot(child), 5938 pci_get_function(child)); 5939 } 5940 return (0); 5941 } 5942 return (bus_generic_get_device_path(bus, child, locator, sb)); 5943 } 5944 5945 int 5946 pci_assign_interrupt_method(device_t dev, device_t child) 5947 { 5948 struct pci_devinfo *dinfo = device_get_ivars(child); 5949 pcicfgregs *cfg = &dinfo->cfg; 5950 5951 return (PCIB_ROUTE_INTERRUPT(device_get_parent(dev), child, 5952 cfg->intpin)); 5953 } 5954 5955 static void 5956 pci_lookup(void *arg, const char *name, device_t *dev) 5957 { 5958 long val; 5959 char *end; 5960 int domain, bus, slot, func; 5961 5962 if (*dev != NULL) 5963 return; 5964 5965 /* 5966 * Accept pciconf-style selectors of either pciD:B:S:F or 5967 * pciB:S:F. In the latter case, the domain is assumed to 5968 * be zero. 5969 */ 5970 if (strncmp(name, "pci", 3) != 0) 5971 return; 5972 val = strtol(name + 3, &end, 10); 5973 if (val < 0 || val > INT_MAX || *end != ':') 5974 return; 5975 domain = val; 5976 val = strtol(end + 1, &end, 10); 5977 if (val < 0 || val > INT_MAX || *end != ':') 5978 return; 5979 bus = val; 5980 val = strtol(end + 1, &end, 10); 5981 if (val < 0 || val > INT_MAX) 5982 return; 5983 slot = val; 5984 if (*end == ':') { 5985 val = strtol(end + 1, &end, 10); 5986 if (val < 0 || val > INT_MAX || *end != '\0') 5987 return; 5988 func = val; 5989 } else if (*end == '\0') { 5990 func = slot; 5991 slot = bus; 5992 bus = domain; 5993 domain = 0; 5994 } else 5995 return; 5996 5997 if (domain > PCI_DOMAINMAX || bus > PCI_BUSMAX || slot > PCI_SLOTMAX || 5998 func > PCIE_ARI_FUNCMAX || (slot != 0 && func > PCI_FUNCMAX)) 5999 return; 6000 6001 *dev = pci_find_dbsf(domain, bus, slot, func); 6002 } 6003 6004 static int 6005 pci_modevent(module_t mod, int what, void *arg) 6006 { 6007 static struct cdev *pci_cdev; 6008 static eventhandler_tag tag; 6009 6010 switch (what) { 6011 case MOD_LOAD: 6012 STAILQ_INIT(&pci_devq); 6013 pci_generation = 0; 6014 pci_cdev = make_dev(&pcicdev, 0, UID_ROOT, GID_WHEEL, 0644, 6015 "pci"); 6016 pci_load_vendor_data(); 6017 tag = EVENTHANDLER_REGISTER(dev_lookup, pci_lookup, NULL, 6018 1000); 6019 break; 6020 6021 case MOD_UNLOAD: 6022 if (tag != NULL) 6023 EVENTHANDLER_DEREGISTER(dev_lookup, tag); 6024 destroy_dev(pci_cdev); 6025 break; 6026 } 6027 6028 return (0); 6029 } 6030 6031 static void 6032 pci_cfg_restore_pcie(device_t dev, struct pci_devinfo *dinfo) 6033 { 6034 #define WREG(n, v) pci_write_config(dev, pos + (n), (v), 2) 6035 struct pcicfg_pcie *cfg; 6036 int version, pos; 6037 6038 cfg = &dinfo->cfg.pcie; 6039 pos = cfg->pcie_location; 6040 6041 version = cfg->pcie_flags & PCIEM_FLAGS_VERSION; 6042 6043 WREG(PCIER_DEVICE_CTL, cfg->pcie_device_ctl); 6044 6045 if (version > 1 || cfg->pcie_type == PCIEM_TYPE_ROOT_PORT || 6046 cfg->pcie_type == PCIEM_TYPE_ENDPOINT || 6047 cfg->pcie_type == PCIEM_TYPE_LEGACY_ENDPOINT) 6048 WREG(PCIER_LINK_CTL, cfg->pcie_link_ctl); 6049 6050 if (version > 1 || (cfg->pcie_type == PCIEM_TYPE_ROOT_PORT || 6051 (cfg->pcie_type == PCIEM_TYPE_DOWNSTREAM_PORT && 6052 (cfg->pcie_flags & PCIEM_FLAGS_SLOT)))) 6053 WREG(PCIER_SLOT_CTL, cfg->pcie_slot_ctl); 6054 6055 if (version > 1 || cfg->pcie_type == PCIEM_TYPE_ROOT_PORT || 6056 cfg->pcie_type == PCIEM_TYPE_ROOT_EC) 6057 WREG(PCIER_ROOT_CTL, cfg->pcie_root_ctl); 6058 6059 if (version > 1) { 6060 WREG(PCIER_DEVICE_CTL2, cfg->pcie_device_ctl2); 6061 WREG(PCIER_LINK_CTL2, cfg->pcie_link_ctl2); 6062 WREG(PCIER_SLOT_CTL2, cfg->pcie_slot_ctl2); 6063 } 6064 #undef WREG 6065 } 6066 6067 static void 6068 pci_cfg_restore_pcix(device_t dev, struct pci_devinfo *dinfo) 6069 { 6070 pci_write_config(dev, dinfo->cfg.pcix.pcix_location + PCIXR_COMMAND, 6071 dinfo->cfg.pcix.pcix_command, 2); 6072 } 6073 6074 void 6075 pci_cfg_restore(device_t dev, struct pci_devinfo *dinfo) 6076 { 6077 6078 /* 6079 * Restore the device to full power mode. We must do this 6080 * before we restore the registers because moving from D3 to 6081 * D0 will cause the chip's BARs and some other registers to 6082 * be reset to some unknown power on reset values. Cut down 6083 * the noise on boot by doing nothing if we are already in 6084 * state D0. 6085 */ 6086 if (pci_get_powerstate(dev) != PCI_POWERSTATE_D0) 6087 pci_set_powerstate(dev, PCI_POWERSTATE_D0); 6088 pci_write_config(dev, PCIR_INTLINE, dinfo->cfg.intline, 1); 6089 pci_write_config(dev, PCIR_INTPIN, dinfo->cfg.intpin, 1); 6090 pci_write_config(dev, PCIR_CACHELNSZ, dinfo->cfg.cachelnsz, 1); 6091 pci_write_config(dev, PCIR_LATTIMER, dinfo->cfg.lattimer, 1); 6092 pci_write_config(dev, PCIR_PROGIF, dinfo->cfg.progif, 1); 6093 pci_write_config(dev, PCIR_REVID, dinfo->cfg.revid, 1); 6094 switch (dinfo->cfg.hdrtype & PCIM_HDRTYPE) { 6095 case PCIM_HDRTYPE_NORMAL: 6096 pci_write_config(dev, PCIR_MINGNT, dinfo->cfg.mingnt, 1); 6097 pci_write_config(dev, PCIR_MAXLAT, dinfo->cfg.maxlat, 1); 6098 break; 6099 case PCIM_HDRTYPE_BRIDGE: 6100 pci_write_config(dev, PCIR_SECLAT_1, 6101 dinfo->cfg.bridge.br_seclat, 1); 6102 pci_write_config(dev, PCIR_SUBBUS_1, 6103 dinfo->cfg.bridge.br_subbus, 1); 6104 pci_write_config(dev, PCIR_SECBUS_1, 6105 dinfo->cfg.bridge.br_secbus, 1); 6106 pci_write_config(dev, PCIR_PRIBUS_1, 6107 dinfo->cfg.bridge.br_pribus, 1); 6108 pci_write_config(dev, PCIR_BRIDGECTL_1, 6109 dinfo->cfg.bridge.br_control, 2); 6110 break; 6111 case PCIM_HDRTYPE_CARDBUS: 6112 pci_write_config(dev, PCIR_SECLAT_2, 6113 dinfo->cfg.bridge.br_seclat, 1); 6114 pci_write_config(dev, PCIR_SUBBUS_2, 6115 dinfo->cfg.bridge.br_subbus, 1); 6116 pci_write_config(dev, PCIR_SECBUS_2, 6117 dinfo->cfg.bridge.br_secbus, 1); 6118 pci_write_config(dev, PCIR_PRIBUS_2, 6119 dinfo->cfg.bridge.br_pribus, 1); 6120 pci_write_config(dev, PCIR_BRIDGECTL_2, 6121 dinfo->cfg.bridge.br_control, 2); 6122 break; 6123 } 6124 pci_restore_bars(dev); 6125 6126 if ((dinfo->cfg.hdrtype & PCIM_HDRTYPE) != PCIM_HDRTYPE_BRIDGE) 6127 pci_write_config(dev, PCIR_COMMAND, dinfo->cfg.cmdreg, 2); 6128 6129 /* 6130 * Restore extended capabilities for PCI-Express and PCI-X 6131 */ 6132 if (dinfo->cfg.pcie.pcie_location != 0) 6133 pci_cfg_restore_pcie(dev, dinfo); 6134 if (dinfo->cfg.pcix.pcix_location != 0) 6135 pci_cfg_restore_pcix(dev, dinfo); 6136 6137 /* Restore MSI and MSI-X configurations if they are present. */ 6138 if (dinfo->cfg.msi.msi_location != 0) 6139 pci_resume_msi(dev); 6140 if (dinfo->cfg.msix.msix_location != 0) 6141 pci_resume_msix(dev); 6142 6143 #ifdef PCI_IOV 6144 if (dinfo->cfg.iov != NULL) 6145 pci_iov_cfg_restore(dev, dinfo); 6146 #endif 6147 } 6148 6149 static void 6150 pci_cfg_save_pcie(device_t dev, struct pci_devinfo *dinfo) 6151 { 6152 #define RREG(n) pci_read_config(dev, pos + (n), 2) 6153 struct pcicfg_pcie *cfg; 6154 int version, pos; 6155 6156 cfg = &dinfo->cfg.pcie; 6157 pos = cfg->pcie_location; 6158 6159 cfg->pcie_flags = RREG(PCIER_FLAGS); 6160 6161 version = cfg->pcie_flags & PCIEM_FLAGS_VERSION; 6162 6163 cfg->pcie_device_ctl = RREG(PCIER_DEVICE_CTL); 6164 6165 if (version > 1 || cfg->pcie_type == PCIEM_TYPE_ROOT_PORT || 6166 cfg->pcie_type == PCIEM_TYPE_ENDPOINT || 6167 cfg->pcie_type == PCIEM_TYPE_LEGACY_ENDPOINT) 6168 cfg->pcie_link_ctl = RREG(PCIER_LINK_CTL); 6169 6170 if (version > 1 || (cfg->pcie_type == PCIEM_TYPE_ROOT_PORT || 6171 (cfg->pcie_type == PCIEM_TYPE_DOWNSTREAM_PORT && 6172 (cfg->pcie_flags & PCIEM_FLAGS_SLOT)))) 6173 cfg->pcie_slot_ctl = RREG(PCIER_SLOT_CTL); 6174 6175 if (version > 1 || cfg->pcie_type == PCIEM_TYPE_ROOT_PORT || 6176 cfg->pcie_type == PCIEM_TYPE_ROOT_EC) 6177 cfg->pcie_root_ctl = RREG(PCIER_ROOT_CTL); 6178 6179 if (version > 1) { 6180 cfg->pcie_device_ctl2 = RREG(PCIER_DEVICE_CTL2); 6181 cfg->pcie_link_ctl2 = RREG(PCIER_LINK_CTL2); 6182 cfg->pcie_slot_ctl2 = RREG(PCIER_SLOT_CTL2); 6183 } 6184 #undef RREG 6185 } 6186 6187 static void 6188 pci_cfg_save_pcix(device_t dev, struct pci_devinfo *dinfo) 6189 { 6190 dinfo->cfg.pcix.pcix_command = pci_read_config(dev, 6191 dinfo->cfg.pcix.pcix_location + PCIXR_COMMAND, 2); 6192 } 6193 6194 void 6195 pci_cfg_save(device_t dev, struct pci_devinfo *dinfo, int setstate) 6196 { 6197 uint32_t cls; 6198 int ps; 6199 6200 /* 6201 * Some drivers apparently write to these registers w/o updating our 6202 * cached copy. No harm happens if we update the copy, so do so here 6203 * so we can restore them. The COMMAND register is modified by the 6204 * bus w/o updating the cache. This should represent the normally 6205 * writable portion of the 'defined' part of type 0/1/2 headers. 6206 */ 6207 dinfo->cfg.vendor = pci_read_config(dev, PCIR_VENDOR, 2); 6208 dinfo->cfg.device = pci_read_config(dev, PCIR_DEVICE, 2); 6209 dinfo->cfg.cmdreg = pci_read_config(dev, PCIR_COMMAND, 2); 6210 dinfo->cfg.intline = pci_read_config(dev, PCIR_INTLINE, 1); 6211 dinfo->cfg.intpin = pci_read_config(dev, PCIR_INTPIN, 1); 6212 dinfo->cfg.cachelnsz = pci_read_config(dev, PCIR_CACHELNSZ, 1); 6213 dinfo->cfg.lattimer = pci_read_config(dev, PCIR_LATTIMER, 1); 6214 dinfo->cfg.baseclass = pci_read_config(dev, PCIR_CLASS, 1); 6215 dinfo->cfg.subclass = pci_read_config(dev, PCIR_SUBCLASS, 1); 6216 dinfo->cfg.progif = pci_read_config(dev, PCIR_PROGIF, 1); 6217 dinfo->cfg.revid = pci_read_config(dev, PCIR_REVID, 1); 6218 switch (dinfo->cfg.hdrtype & PCIM_HDRTYPE) { 6219 case PCIM_HDRTYPE_NORMAL: 6220 dinfo->cfg.subvendor = pci_read_config(dev, PCIR_SUBVEND_0, 2); 6221 dinfo->cfg.subdevice = pci_read_config(dev, PCIR_SUBDEV_0, 2); 6222 dinfo->cfg.mingnt = pci_read_config(dev, PCIR_MINGNT, 1); 6223 dinfo->cfg.maxlat = pci_read_config(dev, PCIR_MAXLAT, 1); 6224 break; 6225 case PCIM_HDRTYPE_BRIDGE: 6226 dinfo->cfg.bridge.br_seclat = pci_read_config(dev, 6227 PCIR_SECLAT_1, 1); 6228 dinfo->cfg.bridge.br_subbus = pci_read_config(dev, 6229 PCIR_SUBBUS_1, 1); 6230 dinfo->cfg.bridge.br_secbus = pci_read_config(dev, 6231 PCIR_SECBUS_1, 1); 6232 dinfo->cfg.bridge.br_pribus = pci_read_config(dev, 6233 PCIR_PRIBUS_1, 1); 6234 dinfo->cfg.bridge.br_control = pci_read_config(dev, 6235 PCIR_BRIDGECTL_1, 2); 6236 break; 6237 case PCIM_HDRTYPE_CARDBUS: 6238 dinfo->cfg.bridge.br_seclat = pci_read_config(dev, 6239 PCIR_SECLAT_2, 1); 6240 dinfo->cfg.bridge.br_subbus = pci_read_config(dev, 6241 PCIR_SUBBUS_2, 1); 6242 dinfo->cfg.bridge.br_secbus = pci_read_config(dev, 6243 PCIR_SECBUS_2, 1); 6244 dinfo->cfg.bridge.br_pribus = pci_read_config(dev, 6245 PCIR_PRIBUS_2, 1); 6246 dinfo->cfg.bridge.br_control = pci_read_config(dev, 6247 PCIR_BRIDGECTL_2, 2); 6248 dinfo->cfg.subvendor = pci_read_config(dev, PCIR_SUBVEND_2, 2); 6249 dinfo->cfg.subdevice = pci_read_config(dev, PCIR_SUBDEV_2, 2); 6250 break; 6251 } 6252 6253 if (dinfo->cfg.pcie.pcie_location != 0) 6254 pci_cfg_save_pcie(dev, dinfo); 6255 6256 if (dinfo->cfg.pcix.pcix_location != 0) 6257 pci_cfg_save_pcix(dev, dinfo); 6258 6259 #ifdef PCI_IOV 6260 if (dinfo->cfg.iov != NULL) 6261 pci_iov_cfg_save(dev, dinfo); 6262 #endif 6263 6264 /* 6265 * don't set the state for display devices, base peripherals and 6266 * memory devices since bad things happen when they are powered down. 6267 * We should (a) have drivers that can easily detach and (b) use 6268 * generic drivers for these devices so that some device actually 6269 * attaches. We need to make sure that when we implement (a) we don't 6270 * power the device down on a reattach. 6271 */ 6272 cls = pci_get_class(dev); 6273 if (!setstate) 6274 return; 6275 switch (pci_do_power_nodriver) 6276 { 6277 case 0: /* NO powerdown at all */ 6278 return; 6279 case 1: /* Conservative about what to power down */ 6280 if (cls == PCIC_STORAGE) 6281 return; 6282 /*FALLTHROUGH*/ 6283 case 2: /* Aggressive about what to power down */ 6284 if (cls == PCIC_DISPLAY || cls == PCIC_MEMORY || 6285 cls == PCIC_BASEPERIPH) 6286 return; 6287 /*FALLTHROUGH*/ 6288 case 3: /* Power down everything */ 6289 break; 6290 } 6291 /* 6292 * PCI spec says we can only go into D3 state from D0 state. 6293 * Transition from D[12] into D0 before going to D3 state. 6294 */ 6295 ps = pci_get_powerstate(dev); 6296 if (ps != PCI_POWERSTATE_D0 && ps != PCI_POWERSTATE_D3) 6297 pci_set_powerstate(dev, PCI_POWERSTATE_D0); 6298 if (pci_get_powerstate(dev) != PCI_POWERSTATE_D3) 6299 pci_set_powerstate(dev, PCI_POWERSTATE_D3); 6300 } 6301 6302 /* Wrapper APIs suitable for device driver use. */ 6303 void 6304 pci_save_state(device_t dev) 6305 { 6306 struct pci_devinfo *dinfo; 6307 6308 dinfo = device_get_ivars(dev); 6309 pci_cfg_save(dev, dinfo, 0); 6310 } 6311 6312 void 6313 pci_restore_state(device_t dev) 6314 { 6315 struct pci_devinfo *dinfo; 6316 6317 dinfo = device_get_ivars(dev); 6318 pci_cfg_restore(dev, dinfo); 6319 } 6320 6321 static int 6322 pci_get_id_method(device_t dev, device_t child, enum pci_id_type type, 6323 uintptr_t *id) 6324 { 6325 6326 return (PCIB_GET_ID(device_get_parent(dev), child, type, id)); 6327 } 6328 6329 /* Find the upstream port of a given PCI device in a root complex. */ 6330 device_t 6331 pci_find_pcie_root_port(device_t dev) 6332 { 6333 struct pci_devinfo *dinfo; 6334 devclass_t pci_class; 6335 device_t pcib, bus; 6336 6337 pci_class = devclass_find("pci"); 6338 KASSERT(device_get_devclass(device_get_parent(dev)) == pci_class, 6339 ("%s: non-pci device %s", __func__, device_get_nameunit(dev))); 6340 6341 /* 6342 * Walk the bridge hierarchy until we find a PCI-e root 6343 * port or a non-PCI device. 6344 */ 6345 for (;;) { 6346 bus = device_get_parent(dev); 6347 KASSERT(bus != NULL, ("%s: null parent of %s", __func__, 6348 device_get_nameunit(dev))); 6349 6350 pcib = device_get_parent(bus); 6351 KASSERT(pcib != NULL, ("%s: null bridge of %s", __func__, 6352 device_get_nameunit(bus))); 6353 6354 /* 6355 * pcib's parent must be a PCI bus for this to be a 6356 * PCI-PCI bridge. 6357 */ 6358 if (device_get_devclass(device_get_parent(pcib)) != pci_class) 6359 return (NULL); 6360 6361 dinfo = device_get_ivars(pcib); 6362 if (dinfo->cfg.pcie.pcie_location != 0 && 6363 dinfo->cfg.pcie.pcie_type == PCIEM_TYPE_ROOT_PORT) 6364 return (pcib); 6365 6366 dev = pcib; 6367 } 6368 } 6369 6370 /* 6371 * Wait for pending transactions to complete on a PCI-express function. 6372 * 6373 * The maximum delay is specified in milliseconds in max_delay. Note 6374 * that this function may sleep. 6375 * 6376 * Returns true if the function is idle and false if the timeout is 6377 * exceeded. If dev is not a PCI-express function, this returns true. 6378 */ 6379 bool 6380 pcie_wait_for_pending_transactions(device_t dev, u_int max_delay) 6381 { 6382 struct pci_devinfo *dinfo = device_get_ivars(dev); 6383 uint16_t sta; 6384 int cap; 6385 6386 cap = dinfo->cfg.pcie.pcie_location; 6387 if (cap == 0) 6388 return (true); 6389 6390 sta = pci_read_config(dev, cap + PCIER_DEVICE_STA, 2); 6391 while (sta & PCIEM_STA_TRANSACTION_PND) { 6392 if (max_delay == 0) 6393 return (false); 6394 6395 /* Poll once every 100 milliseconds up to the timeout. */ 6396 if (max_delay > 100) { 6397 pause_sbt("pcietp", 100 * SBT_1MS, 0, C_HARDCLOCK); 6398 max_delay -= 100; 6399 } else { 6400 pause_sbt("pcietp", max_delay * SBT_1MS, 0, 6401 C_HARDCLOCK); 6402 max_delay = 0; 6403 } 6404 sta = pci_read_config(dev, cap + PCIER_DEVICE_STA, 2); 6405 } 6406 6407 return (true); 6408 } 6409 6410 /* 6411 * Determine the maximum Completion Timeout in microseconds. 6412 * 6413 * For non-PCI-express functions this returns 0. 6414 */ 6415 int 6416 pcie_get_max_completion_timeout(device_t dev) 6417 { 6418 struct pci_devinfo *dinfo = device_get_ivars(dev); 6419 int cap; 6420 6421 cap = dinfo->cfg.pcie.pcie_location; 6422 if (cap == 0) 6423 return (0); 6424 6425 /* 6426 * Functions using the 1.x spec use the default timeout range of 6427 * 50 microseconds to 50 milliseconds. Functions that do not 6428 * support programmable timeouts also use this range. 6429 */ 6430 if ((dinfo->cfg.pcie.pcie_flags & PCIEM_FLAGS_VERSION) < 2 || 6431 (pci_read_config(dev, cap + PCIER_DEVICE_CAP2, 4) & 6432 PCIEM_CAP2_COMP_TIMO_RANGES) == 0) 6433 return (50 * 1000); 6434 6435 switch (pci_read_config(dev, cap + PCIER_DEVICE_CTL2, 2) & 6436 PCIEM_CTL2_COMP_TIMO_VAL) { 6437 case PCIEM_CTL2_COMP_TIMO_100US: 6438 return (100); 6439 case PCIEM_CTL2_COMP_TIMO_10MS: 6440 return (10 * 1000); 6441 case PCIEM_CTL2_COMP_TIMO_55MS: 6442 return (55 * 1000); 6443 case PCIEM_CTL2_COMP_TIMO_210MS: 6444 return (210 * 1000); 6445 case PCIEM_CTL2_COMP_TIMO_900MS: 6446 return (900 * 1000); 6447 case PCIEM_CTL2_COMP_TIMO_3500MS: 6448 return (3500 * 1000); 6449 case PCIEM_CTL2_COMP_TIMO_13S: 6450 return (13 * 1000 * 1000); 6451 case PCIEM_CTL2_COMP_TIMO_64S: 6452 return (64 * 1000 * 1000); 6453 default: 6454 return (50 * 1000); 6455 } 6456 } 6457 6458 void 6459 pcie_apei_error(device_t dev, int sev, uint8_t *aerp) 6460 { 6461 struct pci_devinfo *dinfo = device_get_ivars(dev); 6462 const char *s; 6463 int aer; 6464 uint32_t r, r1; 6465 uint16_t rs; 6466 6467 if (sev == PCIEM_STA_CORRECTABLE_ERROR) 6468 s = "Correctable"; 6469 else if (sev == PCIEM_STA_NON_FATAL_ERROR) 6470 s = "Uncorrectable (Non-Fatal)"; 6471 else 6472 s = "Uncorrectable (Fatal)"; 6473 device_printf(dev, "%s PCIe error reported by APEI\n", s); 6474 if (aerp) { 6475 if (sev == PCIEM_STA_CORRECTABLE_ERROR) { 6476 r = le32dec(aerp + PCIR_AER_COR_STATUS); 6477 r1 = le32dec(aerp + PCIR_AER_COR_MASK); 6478 } else { 6479 r = le32dec(aerp + PCIR_AER_UC_STATUS); 6480 r1 = le32dec(aerp + PCIR_AER_UC_MASK); 6481 } 6482 device_printf(dev, "status 0x%08x mask 0x%08x", r, r1); 6483 if (sev != PCIEM_STA_CORRECTABLE_ERROR) { 6484 r = le32dec(aerp + PCIR_AER_UC_SEVERITY); 6485 rs = le16dec(aerp + PCIR_AER_CAP_CONTROL); 6486 printf(" severity 0x%08x first %d\n", 6487 r, rs & 0x1f); 6488 } else 6489 printf("\n"); 6490 } 6491 6492 /* As kind of recovery just report and clear the error statuses. */ 6493 if (pci_find_extcap(dev, PCIZ_AER, &aer) == 0) { 6494 r = pci_read_config(dev, aer + PCIR_AER_UC_STATUS, 4); 6495 if (r != 0) { 6496 pci_write_config(dev, aer + PCIR_AER_UC_STATUS, r, 4); 6497 device_printf(dev, "Clearing UC AER errors 0x%08x\n", r); 6498 } 6499 6500 r = pci_read_config(dev, aer + PCIR_AER_COR_STATUS, 4); 6501 if (r != 0) { 6502 pci_write_config(dev, aer + PCIR_AER_COR_STATUS, r, 4); 6503 device_printf(dev, "Clearing COR AER errors 0x%08x\n", r); 6504 } 6505 } 6506 if (dinfo->cfg.pcie.pcie_location != 0) { 6507 rs = pci_read_config(dev, dinfo->cfg.pcie.pcie_location + 6508 PCIER_DEVICE_STA, 2); 6509 if ((rs & (PCIEM_STA_CORRECTABLE_ERROR | 6510 PCIEM_STA_NON_FATAL_ERROR | PCIEM_STA_FATAL_ERROR | 6511 PCIEM_STA_UNSUPPORTED_REQ)) != 0) { 6512 pci_write_config(dev, dinfo->cfg.pcie.pcie_location + 6513 PCIER_DEVICE_STA, rs, 2); 6514 device_printf(dev, "Clearing PCIe errors 0x%04x\n", rs); 6515 } 6516 } 6517 } 6518 6519 /* 6520 * Perform a Function Level Reset (FLR) on a device. 6521 * 6522 * This function first waits for any pending transactions to complete 6523 * within the timeout specified by max_delay. If transactions are 6524 * still pending, the function will return false without attempting a 6525 * reset. 6526 * 6527 * If dev is not a PCI-express function or does not support FLR, this 6528 * function returns false. 6529 * 6530 * Note that no registers are saved or restored. The caller is 6531 * responsible for saving and restoring any registers including 6532 * PCI-standard registers via pci_save_state() and 6533 * pci_restore_state(). 6534 */ 6535 bool 6536 pcie_flr(device_t dev, u_int max_delay, bool force) 6537 { 6538 struct pci_devinfo *dinfo = device_get_ivars(dev); 6539 uint16_t cmd, ctl; 6540 int compl_delay; 6541 int cap; 6542 6543 cap = dinfo->cfg.pcie.pcie_location; 6544 if (cap == 0) 6545 return (false); 6546 6547 if (!(pci_read_config(dev, cap + PCIER_DEVICE_CAP, 4) & PCIEM_CAP_FLR)) 6548 return (false); 6549 6550 /* 6551 * Disable busmastering to prevent generation of new 6552 * transactions while waiting for the device to go idle. If 6553 * the idle timeout fails, the command register is restored 6554 * which will re-enable busmastering. 6555 */ 6556 cmd = pci_read_config(dev, PCIR_COMMAND, 2); 6557 pci_write_config(dev, PCIR_COMMAND, cmd & ~(PCIM_CMD_BUSMASTEREN), 2); 6558 if (!pcie_wait_for_pending_transactions(dev, max_delay)) { 6559 if (!force) { 6560 pci_write_config(dev, PCIR_COMMAND, cmd, 2); 6561 return (false); 6562 } 6563 pci_printf(&dinfo->cfg, 6564 "Resetting with transactions pending after %d ms\n", 6565 max_delay); 6566 6567 /* 6568 * Extend the post-FLR delay to cover the maximum 6569 * Completion Timeout delay of anything in flight 6570 * during the FLR delay. Enforce a minimum delay of 6571 * at least 10ms. 6572 */ 6573 compl_delay = pcie_get_max_completion_timeout(dev) / 1000; 6574 if (compl_delay < 10) 6575 compl_delay = 10; 6576 } else 6577 compl_delay = 0; 6578 6579 /* Initiate the reset. */ 6580 ctl = pci_read_config(dev, cap + PCIER_DEVICE_CTL, 2); 6581 pci_write_config(dev, cap + PCIER_DEVICE_CTL, ctl | 6582 PCIEM_CTL_INITIATE_FLR, 2); 6583 6584 /* Wait for 100ms. */ 6585 pause_sbt("pcieflr", (100 + compl_delay) * SBT_1MS, 0, C_HARDCLOCK); 6586 6587 if (pci_read_config(dev, cap + PCIER_DEVICE_STA, 2) & 6588 PCIEM_STA_TRANSACTION_PND) 6589 pci_printf(&dinfo->cfg, "Transactions pending after FLR!\n"); 6590 return (true); 6591 } 6592 6593 /* 6594 * Attempt a power-management reset by cycling the device in/out of D3 6595 * state. PCI spec says we can only go into D3 state from D0 state. 6596 * Transition from D[12] into D0 before going to D3 state. 6597 */ 6598 int 6599 pci_power_reset(device_t dev) 6600 { 6601 int ps; 6602 6603 ps = pci_get_powerstate(dev); 6604 if (ps != PCI_POWERSTATE_D0 && ps != PCI_POWERSTATE_D3) 6605 pci_set_powerstate(dev, PCI_POWERSTATE_D0); 6606 pci_set_powerstate(dev, PCI_POWERSTATE_D3); 6607 pci_set_powerstate(dev, ps); 6608 return (0); 6609 } 6610 6611 /* 6612 * Try link drop and retrain of the downstream port of upstream 6613 * switch, for PCIe. According to the PCIe 3.0 spec 6.6.1, this must 6614 * cause Conventional Hot reset of the device in the slot. 6615 * Alternative, for PCIe, could be the secondary bus reset initiatied 6616 * on the upstream switch PCIR_BRIDGECTL_1, bit 6. 6617 */ 6618 int 6619 pcie_link_reset(device_t port, int pcie_location) 6620 { 6621 uint16_t v; 6622 6623 v = pci_read_config(port, pcie_location + PCIER_LINK_CTL, 2); 6624 v |= PCIEM_LINK_CTL_LINK_DIS; 6625 pci_write_config(port, pcie_location + PCIER_LINK_CTL, v, 2); 6626 pause_sbt("pcier1", mstosbt(20), 0, 0); 6627 v &= ~PCIEM_LINK_CTL_LINK_DIS; 6628 v |= PCIEM_LINK_CTL_RETRAIN_LINK; 6629 pci_write_config(port, pcie_location + PCIER_LINK_CTL, v, 2); 6630 pause_sbt("pcier2", mstosbt(100), 0, 0); /* 100 ms */ 6631 v = pci_read_config(port, pcie_location + PCIER_LINK_STA, 2); 6632 return ((v & PCIEM_LINK_STA_TRAINING) != 0 ? ETIMEDOUT : 0); 6633 } 6634 6635 static int 6636 pci_reset_post(device_t dev, device_t child) 6637 { 6638 6639 if (dev == device_get_parent(child)) 6640 pci_restore_state(child); 6641 return (0); 6642 } 6643 6644 static int 6645 pci_reset_prepare(device_t dev, device_t child) 6646 { 6647 6648 if (dev == device_get_parent(child)) 6649 pci_save_state(child); 6650 return (0); 6651 } 6652 6653 static int 6654 pci_reset_child(device_t dev, device_t child, int flags) 6655 { 6656 int error; 6657 6658 if (dev == NULL || device_get_parent(child) != dev) 6659 return (0); 6660 if ((flags & DEVF_RESET_DETACH) != 0) { 6661 error = device_get_state(child) == DS_ATTACHED ? 6662 device_detach(child) : 0; 6663 } else { 6664 error = BUS_SUSPEND_CHILD(dev, child); 6665 } 6666 if (error == 0) { 6667 if (!pcie_flr(child, 1000, false)) { 6668 error = BUS_RESET_PREPARE(dev, child); 6669 if (error == 0) 6670 pci_power_reset(child); 6671 BUS_RESET_POST(dev, child); 6672 } 6673 if ((flags & DEVF_RESET_DETACH) != 0) 6674 device_probe_and_attach(child); 6675 else 6676 BUS_RESUME_CHILD(dev, child); 6677 } 6678 return (error); 6679 } 6680 6681 const struct pci_device_table * 6682 pci_match_device(device_t child, const struct pci_device_table *id, size_t nelt) 6683 { 6684 bool match; 6685 uint16_t vendor, device, subvendor, subdevice, class, subclass, revid; 6686 6687 vendor = pci_get_vendor(child); 6688 device = pci_get_device(child); 6689 subvendor = pci_get_subvendor(child); 6690 subdevice = pci_get_subdevice(child); 6691 class = pci_get_class(child); 6692 subclass = pci_get_subclass(child); 6693 revid = pci_get_revid(child); 6694 while (nelt-- > 0) { 6695 match = true; 6696 if (id->match_flag_vendor) 6697 match &= vendor == id->vendor; 6698 if (id->match_flag_device) 6699 match &= device == id->device; 6700 if (id->match_flag_subvendor) 6701 match &= subvendor == id->subvendor; 6702 if (id->match_flag_subdevice) 6703 match &= subdevice == id->subdevice; 6704 if (id->match_flag_class) 6705 match &= class == id->class_id; 6706 if (id->match_flag_subclass) 6707 match &= subclass == id->subclass; 6708 if (id->match_flag_revid) 6709 match &= revid == id->revid; 6710 if (match) 6711 return (id); 6712 id++; 6713 } 6714 return (NULL); 6715 } 6716 6717 static void 6718 pci_print_faulted_dev_name(const struct pci_devinfo *dinfo) 6719 { 6720 const char *dev_name; 6721 device_t dev; 6722 6723 dev = dinfo->cfg.dev; 6724 printf("pci%d:%d:%d:%d", dinfo->cfg.domain, dinfo->cfg.bus, 6725 dinfo->cfg.slot, dinfo->cfg.func); 6726 dev_name = device_get_name(dev); 6727 if (dev_name != NULL) 6728 printf(" (%s%d)", dev_name, device_get_unit(dev)); 6729 } 6730 6731 void 6732 pci_print_faulted_dev(void) 6733 { 6734 struct pci_devinfo *dinfo; 6735 device_t dev; 6736 int aer, i; 6737 uint32_t r1, r2; 6738 uint16_t status; 6739 6740 STAILQ_FOREACH(dinfo, &pci_devq, pci_links) { 6741 dev = dinfo->cfg.dev; 6742 status = pci_read_config(dev, PCIR_STATUS, 2); 6743 status &= PCIM_STATUS_MDPERR | PCIM_STATUS_STABORT | 6744 PCIM_STATUS_RTABORT | PCIM_STATUS_RMABORT | 6745 PCIM_STATUS_SERR | PCIM_STATUS_PERR; 6746 if (status != 0) { 6747 pci_print_faulted_dev_name(dinfo); 6748 printf(" error 0x%04x\n", status); 6749 } 6750 if (dinfo->cfg.pcie.pcie_location != 0) { 6751 status = pci_read_config(dev, 6752 dinfo->cfg.pcie.pcie_location + 6753 PCIER_DEVICE_STA, 2); 6754 if ((status & (PCIEM_STA_CORRECTABLE_ERROR | 6755 PCIEM_STA_NON_FATAL_ERROR | PCIEM_STA_FATAL_ERROR | 6756 PCIEM_STA_UNSUPPORTED_REQ)) != 0) { 6757 pci_print_faulted_dev_name(dinfo); 6758 printf(" PCIe DEVCTL 0x%04x DEVSTA 0x%04x\n", 6759 pci_read_config(dev, 6760 dinfo->cfg.pcie.pcie_location + 6761 PCIER_DEVICE_CTL, 2), 6762 status); 6763 } 6764 } 6765 if (pci_find_extcap(dev, PCIZ_AER, &aer) == 0) { 6766 r1 = pci_read_config(dev, aer + PCIR_AER_UC_STATUS, 4); 6767 r2 = pci_read_config(dev, aer + PCIR_AER_COR_STATUS, 4); 6768 if (r1 != 0 || r2 != 0) { 6769 pci_print_faulted_dev_name(dinfo); 6770 printf(" AER UC 0x%08x Mask 0x%08x Svr 0x%08x\n" 6771 " COR 0x%08x Mask 0x%08x Ctl 0x%08x\n", 6772 r1, pci_read_config(dev, aer + 6773 PCIR_AER_UC_MASK, 4), 6774 pci_read_config(dev, aer + 6775 PCIR_AER_UC_SEVERITY, 4), 6776 r2, pci_read_config(dev, aer + 6777 PCIR_AER_COR_MASK, 4), 6778 pci_read_config(dev, aer + 6779 PCIR_AER_CAP_CONTROL, 4)); 6780 for (i = 0; i < 4; i++) { 6781 r1 = pci_read_config(dev, aer + 6782 PCIR_AER_HEADER_LOG + i * 4, 4); 6783 printf(" HL%d: 0x%08x\n", i, r1); 6784 } 6785 } 6786 } 6787 } 6788 } 6789 6790 #ifdef DDB 6791 DB_SHOW_COMMAND(pcierr, pci_print_faulted_dev_db) 6792 { 6793 6794 pci_print_faulted_dev(); 6795 } 6796 6797 static void 6798 db_clear_pcie_errors(const struct pci_devinfo *dinfo) 6799 { 6800 device_t dev; 6801 int aer; 6802 uint32_t r; 6803 6804 dev = dinfo->cfg.dev; 6805 r = pci_read_config(dev, dinfo->cfg.pcie.pcie_location + 6806 PCIER_DEVICE_STA, 2); 6807 pci_write_config(dev, dinfo->cfg.pcie.pcie_location + 6808 PCIER_DEVICE_STA, r, 2); 6809 6810 if (pci_find_extcap(dev, PCIZ_AER, &aer) != 0) 6811 return; 6812 r = pci_read_config(dev, aer + PCIR_AER_UC_STATUS, 4); 6813 if (r != 0) 6814 pci_write_config(dev, aer + PCIR_AER_UC_STATUS, r, 4); 6815 r = pci_read_config(dev, aer + PCIR_AER_COR_STATUS, 4); 6816 if (r != 0) 6817 pci_write_config(dev, aer + PCIR_AER_COR_STATUS, r, 4); 6818 } 6819 6820 DB_COMMAND(pci_clearerr, db_pci_clearerr) 6821 { 6822 struct pci_devinfo *dinfo; 6823 device_t dev; 6824 uint16_t status, status1; 6825 6826 STAILQ_FOREACH(dinfo, &pci_devq, pci_links) { 6827 dev = dinfo->cfg.dev; 6828 status1 = status = pci_read_config(dev, PCIR_STATUS, 2); 6829 status1 &= PCIM_STATUS_MDPERR | PCIM_STATUS_STABORT | 6830 PCIM_STATUS_RTABORT | PCIM_STATUS_RMABORT | 6831 PCIM_STATUS_SERR | PCIM_STATUS_PERR; 6832 if (status1 != 0) { 6833 status &= ~status1; 6834 pci_write_config(dev, PCIR_STATUS, status, 2); 6835 } 6836 if (dinfo->cfg.pcie.pcie_location != 0) 6837 db_clear_pcie_errors(dinfo); 6838 } 6839 } 6840 #endif 6841